.u-overflowHidden {
  overflow: hidden !important; }

.u-listInline li {
  display: inline; }

.u-textTruncate {
  text-overflow: ellipsis;
  overflow: hidden;
  white-space: nowrap; }

.u-textCenter {
  text-align: center; }

.u-verticalCenter {
  display: table;
  height: 100%;
  width: 100%; }

.u-vcCell {
  display: table-cell;
  vertical-align: middle; }

.u-prepend-1 {
  margin-top: 10px; }

.u-prepend-2 {
  margin-top: 20px; }

.u-prepend-3 {
  margin-top: 30px; }

.u-prepend-4 {
  margin-top: 40px; }

.u-prepend-5 {
  margin-top: 50px; }

.u-prepend-6 {
  margin-top: 60px; }

.u-prepend-7 {
  margin-top: 70px; }

.u-prepend-8 {
  margin-top: 80px; }

.u-prepend-9 {
  margin-top: 90px; }

.u-prepend-10 {
  margin-top: 100px; }

.u-append-1 {
  margin-bottom: 10px; }

.u-append-2 {
  margin-bottom: 20px; }

.u-append-3 {
  margin-bottom: 30px; }

.u-append-4 {
  margin-bottom: 40px; }

.u-append-5 {
  margin-bottom: 50px; }

.u-append-6 {
  margin-bottom: 60px; }

.u-append-7 {
  margin-bottom: 70px; }

.u-append-8 {
  margin-bottom: 80px; }

.u-append-9 {
  margin-bottom: 90px; }

.u-append-10 {
  margin-bottom: 100px; }

.u-cursorPointer, .cursor-pointer {
  cursor: pointer; }

.centered {
  text-align: center; }

.absolute-center {
  position: absolute;
  top: 0;
  bottom: 0;
  left: 0;
  right: 0;
  margin: auto;
  display: block; }

.table-no-border {
  border: 0; }

.table-no-border td,
.table-no-border th {
  border: 0; }

.ic-text-truncate {
  text-overflow: ellipsis;
  white-space: nowrap;
  overflow: hidden;
  max-width: 100%; }

.ic-horizontal-rule-text,
p.ic-horizontal-rule-text,
.ic-fresh p.ic-horizontal-rule-text {
  color: #43B02A;
  overflow: hidden;
  text-align: center;
  padding: 0 0px;
  margin: 20px 0;
  font-size: 20px;
  font-weight: 300; }
  .ic-horizontal-rule-text:before, .ic-horizontal-rule-text:after,
  p.ic-horizontal-rule-text:before,
  p.ic-horizontal-rule-text:after,
  .ic-fresh p.ic-horizontal-rule-text:before,
  .ic-fresh p.ic-horizontal-rule-text:after {
    background-color: #43B02A;
    content: "";
    display: inline-block;
    height: 1px;
    position: relative;
    vertical-align: middle;
    width: 50%; }
  .ic-horizontal-rule-text:before,
  p.ic-horizontal-rule-text:before,
  .ic-fresh p.ic-horizontal-rule-text:before {
    right: 1.2em;
    margin-left: -50%; }
  .ic-horizontal-rule-text:after,
  p.ic-horizontal-rule-text:after,
  .ic-fresh p.ic-horizontal-rule-text:after {
    left: 1.2em;
    margin-right: -50%; }

.background-white {
  background-color: #ffffff; }

.color-white {
  color: #ffffff; }

.background-black {
  background-color: #393939; }

.color-black {
  color: #393939; }

.background-black-lighter {
  background-color: #5f5f5f; }

.color-black-lighter {
  color: #5f5f5f; }

.background-gray-dark {
  background-color: #6c6c6c; }

.color-gray-dark {
  color: #6c6c6c; }

.background-gray {
  background-color: #8e8e8e; }

.color-gray {
  color: #8e8e8e; }

.background-gray-light {
  background-color: #b0b0b0; }

.color-gray-light {
  color: #b0b0b0; }

.background-gray-lighter {
  background-color: white; }

.color-gray-lighter {
  color: white; }

.background-max-light-gray {
  background-color: #e6e6e6; }

.color-max-light-gray {
  color: #e6e6e6; }

.background-green-light {
  background-color: #CBF1C4; }

.color-green-light {
  color: #CBF1C4; }

.background-green {
  background-color: #43B02A; }

.color-green {
  color: #43B02A; }

.background-green-dark {
  background-color: #487943; }

.color-green-dark {
  color: #487943; }

.background-pink {
  background-color: #E8104A; }

.color-pink {
  color: #E8104A; }

.background-grey-border {
  background-color: #F0EFEC; }

.color-grey-border {
  color: #F0EFEC; }

.ic-weight-100 {
  font-weight: 100; }

.ic-weight-500 {
  font-weight: 500; }

.ic-weight-600 {
  font-weight: 600; }

.ic-weight-700 {
  font-weight: 700; }

.address-form input,
.address-form input[type=text],
.address-form textarea {
  width: 100%;
  max-width: 100%;
  box-sizing: border-box;
  margin: 0;
  transition: color .2s; }

.address-form input[type=text],
.address-form input[type=search] {
  padding: 0;
  height: 36px; }

.address-form.form-horizontal .controls {
  margin-left: 0; }

.address-form .address-form-type-controls input,
.address-form .address-form-type-controls input[type=radio],
.address-form .address-form-type-controls input[type=radio]:checked {
  background-image: none;
  visibility: hidden; }

.address-form .address-form-type-controls input[type=radio] {
  display: none; }

.address-form .address-form-type-controls input[type="radio"]:focus + .ic-icon {
  color: #01939A; }

.address-form .address-form-type-controls label:hover {
  cursor: pointer; }

.address-form .address-form-type-controls label.radio,
.address-form .address-form-type-controls label.radio.inline + label.radio.inline {
  width: 50%;
  box-sizing: border-box;
  float: left;
  margin: 0;
  padding: 7px 15px;
  text-align: center;
  font-size: 14px;
  font-weight: 600;
  color: #999;
  line-height: 20px;
  border: 1px solid #dadada;
  border-radius: 4px;
  transition: background .2s; }
  .address-form .address-form-type-controls label.radio.active,
  .address-form .address-form-type-controls label.radio.inline + label.radio.inline.active {
    color: #01939A;
    background: #f1f8f8; }
    .address-form .address-form-type-controls label.radio.active input,
    .address-form .address-form-type-controls label.radio.inline + label.radio.inline.active input {
      color: #01939A; }

.address-form .address-form-type-controls label.radio.inline:first-child {
  border-top-right-radius: 0;
  border-bottom-right-radius: 0;
  border-right-width: 0; }
  .address-form .address-form-type-controls label.radio.inline:first-child.active {
    border-right-width: 1px; }

.address-form .address-form-type-controls label.radio.inline + label.radio.inline {
  border-left-width: 0;
  border-radius: 0;
  border-top-right-radius: 4px;
  border-bottom-right-radius: 4px; }
  .address-form .address-form-type-controls label.radio.inline + label.radio.inline.active {
    border-left-width: 1px; }

.address-form .address-form-type-controls .ic-icon:before {
  font-size: 16px;
  left: -5px; }

.address-form .street-input {
  position: relative;
  z-index: 2; }

.address-form .zip-input-wrapper input[type=text],
.address-form .city-wrapper {
  box-sizing: border-box;
  display: inline-block;
  float: left; }

.address-form .zip-input-wrapper {
  margin-bottom: 20px; }
  .address-form .zip-input-wrapper input[type=text] {
    width: 22%; }

.address-form .zip-input {
  margin: 0; }

.address-form .city-wrapper {
  width: 78%;
  padding-left: 15px;
  height: 56px; }
  .address-form .city-wrapper p {
    line-height: 56px; }
  .address-form .city-wrapper .ic-loading {
    margin-top: 5px; }
    .address-form .city-wrapper .ic-loading .ic-spinner {
      margin: 0; }

.address-form .ic-btn {
  font-weight: 700; }

.address-form .delete-btn-wrapper {
  box-sizing: border-box;
  float: right; }
  .address-form .delete-btn-wrapper .ic-btn.ic-btn-ng {
    color: #E8104A;
    border-color: #E8104A; }

.address-form .buttons-wrapper {
  margin-top: 10px; }

.address-form .inner-button-wrapper {
  box-sizing: border-box;
  width: auto;
  float: left; }
  .address-form .inner-button-wrapper .ic-btn {
    width: 150px;
    padding: 6px 14px; }
  .address-form .inner-button-wrapper .ic-btn-secondary {
    width: 80px;
    margin-left: 15px; }

.address-form .phone-input-wrapper {
  padding-top: 20px;
  border-top: 1px solid #eee; }
  .address-form .phone-input-wrapper p {
    line-height: 36px;
    margin-bottom: 0; }

@media (max-width: 544px) {
  .address-form .address-form-label {
    display: none; } }

.address-dropdown-wrapper .icDropdownItem {
  padding: 8px 40px; }
  .address-dropdown-wrapper .icDropdownItem.divider {
    padding: 0; }
  .address-dropdown-wrapper .icDropdownItem.is-selected:before {
    content: "\E020";
    font-family: 'ic-icons' !important;
    font-style: normal !important;
    font-weight: normal !important;
    font-variant: normal !important;
    text-transform: none !important;
    speak: none;
    line-height: 1;
    -webkit-font-smoothing: antialiased;
    -moz-osx-font-smoothing: grayscale;
    box-sizing: border-box;
    position: absolute;
    left: 10px;
    top: 0;
    padding: 9px 0;
    font-size: 18px; }

.card-chooser-modal h2 {
  text-align: center; }

.cart-quantity {
  width: 125px;
  height: 30px;
  margin: auto;
  background-color: #fff;
  border: 1px solid #e5edec;
  border-radius: 3px;
  text-align: center; }
  .cart-quantity a.add, .cart-quantity a.remove {
    float: left;
    width: 40px;
    padding: 0;
    margin-top: 5px;
    font-size: 12px;
    color: #43b02a; }
    .cart-quantity a.add:hover, .cart-quantity a.remove:hover {
      cursor: pointer;
      text-decoration: none; }
  .cart-quantity p {
    float: left;
    width: 40px;
    border-left: 1px solid #e5edec;
    border-right: 1px solid #e5edec;
    margin-top: 5px;
    font-size: 12px;
    color: #6c6c6c; }
  .cart-quantity.large {
    display: inline-block;
    width: auto;
    height: 36px; }
    .cart-quantity.large a.add,
    .cart-quantity.large a.remove {
      width: 55px;
      font-size: 14px;
      font-weight: 600; }
    .cart-quantity.large p {
      width: 98px;
      font-size: 14px;
      font-weight: 600; }

.category-menu {
  background-color: #f7f7f7; }
  .category-menu > h1 {
    margin: 32px 0;
    font-size: 28px;
    font-weight: bold;
    text-align: center;
    line-height: 1; }
  .category-menu .categories-wrapper {
    margin: 0 auto 32px; }

.category-menu-category {
  width: 256px;
  height: 256px;
  position: relative;
  display: inline-block;
  float: left;
  margin: 4px;
  padding: 32px;
  overflow: hidden;
  background-color: #fff;
  border-radius: 4px; }
  @media (max-width: 767px) {
    .category-menu-category {
      width: 158px;
      height: 158px;
      padding: 16px; } }
  .category-menu-category > h2 {
    position: relative;
    margin: 0;
    font-size: 18px;
    font-weight: bold;
    color: #373a3c; }
    .category-menu-category > h2.category-loading {
      margin-bottom: 27px;
      width: 80%; }
    .category-menu-category > h2 a {
      display: block;
      padding-bottom: 13px; }
    .category-menu-category > h2 a,
    .category-menu-category > h2 a:hover {
      color: #373a3c; }
    @media (max-width: 767px) {
      .category-menu-category > h2 {
        position: absolute;
        bottom: 0;
        white-space: normal;
        width: calc(100% - 32px); }
        .category-menu-category > h2 a.ic-truncate {
          white-space: normal; } }

.category-menu-category-list-image {
  width: 64px;
  display: inline-block;
  float: left; }
  .category-menu-category-list-image a {
    display: block;
    padding: 2px 0; }
  .category-menu-category-list-image:nth-child(even) a {
    padding: 2px 4px; }
  @media (max-width: 767px) {
    .category-menu-category-list-image {
      width: 42px; } }

.category-menu-category-small-link {
  position: absolute;
  top: 0;
  left: 0;
  width: 100%;
  height: 100%;
  display: none; }
  @media (max-width: 767px) {
    .category-menu-category-small-link {
      display: inline-block; } }

.category-menu-sub-categories-wrapper {
  position: relative; }

.category-menu-view-more {
  position: absolute;
  bottom: 32px;
  width: calc(100% - 32px * 2); }
  @media (max-width: 767px) {
    .category-menu-view-more {
      display: none; } }
  .category-menu-view-more a {
    display: block;
    color: #43B02A;
    font-weight: 600;
    line-height: 14px; }
    .category-menu-view-more a:hover {
      color: #43B02A;
      text-decoration: underline;
      cursor: pointer; }
  .category-menu-view-more .ic-icon {
    top: 4px;
    color: #43B02A;
    display: inline-block; }

.category-menu-category-image {
  width: 120px;
  position: absolute;
  top: -30px;
  right: -10px; }
  @media (max-width: 767px) {
    .category-menu-category-image {
      top: 0;
      right: 0; } }

.category-menu-sub-category {
  list-style-type: none; }
  .category-menu-sub-category.category-loading {
    margin: 16px 0; }
    .category-menu-sub-category.category-loading:nth-child(1) {
      width: 60%; }
    .category-menu-sub-category.category-loading:nth-child(2) {
      width: 75%; }
    .category-menu-sub-category.category-loading:nth-child(3) {
      width: 70%; }
    .category-menu-sub-category.category-loading:nth-child(4) {
      width: 60%; }
  @media (max-width: 767px) {
    .category-menu-sub-category {
      display: none; } }
  .category-menu-sub-category a {
    display: inline-block;
    padding: 7px 7px 7px 0;
    font-size: 16px;
    font-weight: 500;
    color: #757575;
    vertical-align: top; }

.category-loading {
  animation-name: category-loading;
  animation-duration: 2s;
  animation-direction: alternate;
  animation-timing-function: ease-in-out;
  animation-iteration-count: 100; }

@-webkit-keyframes category-loading {
  0% {
    background-color: #efefef; }
  100% {
    background-color: #ddd; } }

@-moz-keyframes category-loading {
  0% {
    background-color: #efefef; }
  100% {
    background-color: #ddd; } }

@keyframes category-loading {
  0% {
    background-color: #efefef; }
  100% {
    background-color: #ddd; } }

.shopper-chat {
  /***************************************
***** Order status specific styles *****
***************************************/
  /***************************************
***** Order changes specific styles *****
***************************************/
  /************************
  ***** Media queries *****
  ************************/ }
  .shopper-chat .chat-shopper-badges-wrapper {
    margin-bottom: 25px; }
    .shopper-chat .chat-shopper-badges-wrapper p {
      margin-bottom: 2px;
      font-size: 16px; }
  .shopper-chat .chat-badge-wrapper.docked {
    margin-top: -15px;
    margin-left: -15px; }
    .shopper-chat .chat-badge-wrapper.docked .avatar-outter-wrapper {
      float: left;
      width: 20%; }
      .shopper-chat .chat-badge-wrapper.docked .avatar-outter-wrapper:before {
        font-size: 10px;
        bottom: 25%; }
    .shopper-chat .chat-badge-wrapper.docked p {
      display: none; }
  .shopper-chat .chat-badge-wrapper.split {
    width: 50%;
    display: inline-block; }
    .shopper-chat .chat-badge-wrapper.split p {
      display: none; }
    .shopper-chat .chat-badge-wrapper.split .avatar-outter-wrapper:before {
      font-size: 16px; }
  .shopper-chat .avatar-outter-wrapper {
    position: relative; }
  .shopper-chat .avatar-outter-wrapper:before {
    font-size: 34px;
    position: absolute;
    bottom: 5%;
    right: 15%;
    text-shadow: 1px 1px 0 #fff, -1px -1px 0 #fff, 1px -1px 0 #fff, -1px 1px 0 #fff, 1px 1px 0 #fff; }
  .shopper-chat .shopper .avatar-outter-wrapper:before {
    color: #43B02A; }
  .shopper-chat .driver .avatar-outter-wrapper:before {
    color: #FF5600; }
  .shopper-chat .avatar-wrapper {
    border-radius: 50%;
    overflow: hidden;
    width: 75%;
    margin: 0 auto;
    margin-bottom: 15px; }
    .shopper-chat .avatar-wrapper img {
      margin: 0 auto;
      max-width: 100%;
      max-height: 100%;
      width: 100%; }
  .shopper-chat .chat-log-wrapper {
    padding: 0;
    background-color: #F7F7F7;
    border-radius: 4px;
    overflow: hidden;
    -webkit-box-shadow: inset 0 20px 20px -20px #ddd;
    -moz-box-shadow: inset 0 20px 20px -20px #ddd;
    box-shadow: inset 0 20px 20px -20px #ddd; }
    .shopper-chat .chat-log-wrapper.no-chat .chat-log-inner-wrapper {
      overflow: hidden; }
  .shopper-chat.no-shadow .chat-log-wrapper,
  .shopper-chat.no-shadow .chat-message-submit-area-wrapper {
    -webkit-box-shadow: none;
    -moz-box-shadow: none;
    box-shadow: none; }
  .shopper-chat .chat-log-inner-wrapper {
    -webkit-transform: translate3d(0, 0, 0);
    overflow: scroll;
    max-height: 450px;
    overflow-x: hidden;
    padding: 15px 15px 0 15px; }
  .shopper-chat .message-avatar-wrapper {
    overflow: hidden;
    min-height: 1px;
    position: absolute;
    left: 0;
    bottom: 2px;
    z-index: 10;
    height: 35px;
    padding: 0; }
    .shopper-chat .message-avatar-wrapper .img {
      height: 35px;
      width: 35px;
      background-size: contain;
      background-repeat: no-repeat;
      background-position: bottom;
      border-radius: 50%;
      overflow: hidden;
      margin: 0 auto; }
  .shopper-chat .chat-message-wrapper {
    margin-bottom: 15px;
    position: relative; }
    .shopper-chat .chat-message-wrapper .message-body-wrapper {
      background-color: #eaeaea;
      padding: 8px 12px;
      border-radius: 15px;
      color: inherit;
      float: right;
      position: relative; }
      .shopper-chat .chat-message-wrapper .message-body-wrapper p {
        margin-bottom: 0;
        white-space: pre-wrap;
        overflow-wrap: break-word; }
      .shopper-chat .chat-message-wrapper .message-body-wrapper:before {
        content: "";
        position: absolute;
        z-index: 0;
        bottom: -2px;
        left: -55px;
        height: 16px;
        border-right: 60px solid #eaeaea;
        background: #eaeaea;
        -webkit-border-bottom-right-radius: 80px 50px;
        -moz-border-radius-bottomright: 80px 50px;
        border-bottom-right-radius: 80px 50px;
        -webkit-transform: translate(3px, -2px);
        -moz-transform: translate(3px, -2px);
        -ms-transform: translate(3px, -2px);
        -o-transform: translate(3px, -2px);
        transform: translate(3px, -2px); }
      .shopper-chat .chat-message-wrapper .message-body-wrapper:after {
        content: "";
        position: absolute;
        z-index: 0;
        bottom: -2px;
        left: -25px;
        width: 55px;
        height: 17px;
        background: #F7F7F7;
        -webkit-border-bottom-right-radius: 10px 50px;
        -moz-border-radius-bottomright: 10px 50px;
        border-bottom-right-radius: 10px 50px;
        -webkit-transform: translate(-30px, -2px);
        -moz-transform: translate(-30px, -2px);
        -ms-transform: translate(-30px, -2px);
        -o-transform: translate(-30px, -2px);
        transform: translate(-30px, -2px); }
    .shopper-chat .chat-message-wrapper.user-message .message-body-wrapper {
      background-color: #87c46f;
      color: #fff;
      margin-left: 0;
      float: left;
      z-index: 1; }
      .shopper-chat .chat-message-wrapper.user-message .message-body-wrapper:before {
        left: inherit;
        right: -45px;
        border-right: 60px solid #87c46f;
        background: #87c46f;
        -webkit-border-bottom-left-radius: 80px 50px;
        -moz-border-bottom-left-radius: 80px 50px;
        border-bottom-left-radius: 80px 50px; }
      .shopper-chat .chat-message-wrapper.user-message .message-body-wrapper:after {
        left: inherit;
        right: -85px;
        -webkit-border-bottom-left-radius: 10px 50px;
        -moz-border-bottom-left-radius: 10px 50px;
        border-bottom-left-radius: 10px 50px; }
    .shopper-chat .chat-message-wrapper.item-change-alert {
      margin-bottom: 0; }
      .shopper-chat .chat-message-wrapper.item-change-alert .message-body-wrapper {
        background-color: #F7F7F7;
        color: inherit;
        width: 100%;
        padding-left: 30px; }
        .shopper-chat .chat-message-wrapper.item-change-alert .message-body-wrapper:before {
          border: 0;
          font-family: 'ic-icons' !important;
          font-style: normal !important;
          font-weight: normal !important;
          font-variant: normal !important;
          text-transform: none !important;
          speak: none;
          line-height: 1;
          -webkit-font-smoothing: antialiased;
          -moz-osx-font-smoothing: grayscale;
          content: "\E01A";
          position: relative;
          background: inherit;
          top: 20px;
          left: -20px; }
        .shopper-chat .chat-message-wrapper.item-change-alert .message-body-wrapper:after {
          display: none; }
  .shopper-chat .user-message .message-avatar-wrapper {
    left: inherit;
    right: 0; }
  .shopper-chat .no-chats-wrapper .chat-smile {
    background-image: url(chat_smiley_face-70599defcef9e427976e50f6750401e0.png);
    background-repeat: no-repeat;
    background-size: contain;
    height: 50px;
    transition: all .2s ease-in-out; }
  .shopper-chat .no-chats-wrapper:hover {
    cursor: pointer; }
    .shopper-chat .no-chats-wrapper:hover .chat-smile {
      transform: scale(1.1); }
  .shopper-chat .chat-message-submit-area-wrapper {
    padding: 15px;
    z-index: 1;
    position: relative;
    -webkit-box-shadow: inset 0px 0px 20px 0px #ddd;
    -moz-box-shadow: inset 0px 0px 20px 0px #ddd;
    box-shadow: 0px 0px 20px 0px #ddd; }
  .shopper-chat .chat-message-submit-area {
    margin-bottom: 0;
    padding: 10px;
    width: 100%;
    max-width: 100%; }
  .shopper-chat .chat-shopper-badges-wrapper.received .driver {
    display: none; }
  .shopper-chat .chat-shopper-badges-wrapper.inProgress .driver {
    display: none; }
  .shopper-chat .chat-shopper-badges-wrapper.staged .driver {
    display: none; }
  .shopper-chat .chat-shopper-badges-wrapper.canceled .driver {
    display: none; }
  .shopper-chat .chat-errors {
    margin-top: 20px; }
    .shopper-chat .chat-errors p {
      margin: 0; }
  .shopper-chat.order-changes {
    overflow-x: hidden; }
    .shopper-chat.order-changes .no-chats-wrapper {
      background: #fff;
      padding: 15px;
      text-align: center;
      border: 1px solid #e5e5e5; }
      .shopper-chat.order-changes .no-chats-wrapper .chat-smile {
        margin: 0 auto;
        width: 50px; }
    .shopper-chat.order-changes .message-avatar-wrapper {
      bottom: -5px; }
      .shopper-chat.order-changes .message-avatar-wrapper img {
        max-width: 75%;
        margin: 0 auto;
        display: block; }
    .shopper-chat.order-changes .chat-message-wrapper {
      margin-bottom: 20px; }
      .shopper-chat.order-changes .chat-message-wrapper.item-change-alert {
        margin-bottom: 0; }
    .shopper-chat.order-changes .chat-message-submit-area-wrapper {
      position: fixed;
      bottom: 0;
      width: 100%;
      margin: 0;
      background: #F7F7F7; }
    .shopper-chat.order-changes .send-chat-btn {
      width: 100%; }
    .shopper-chat.order-changes .chat-log-wrapper {
      min-height: 100vh; }
    .shopper-chat.order-changes .chat-log-inner-wrapper {
      max-height: inherit;
      margin-bottom: 140px;
      overflow: hidden; }
  @media (max-width: 980px) {
    .shopper-chat .avatar-outter-wrapper:before {
      font-size: 18px; } }

.checkout-container {
  padding-top: 20px; }
  .checkout-container *,
  .checkout-container *:before,
  .checkout-container *:after {
    -webkit-box-sizing: border-box;
    -moz-box-sizing: border-box;
    box-sizing: border-box; }
  .checkout-container .disabled {
    cursor: default !important;
    pointer-events: none !important; }
  .checkout-container .text-muted {
    color: #8e8e8e !important; }
  .checkout-container .text-green {
    color: #43B02A; }
  .checkout-container .alert {
    -moz-border-radius-topleft: 4px !important;
    -moz-border-radius-topright: 4px !important;
    -moz-border-radius-bottomright: 4px !important;
    -moz-border-radius-bottomleft: 4px !important;
    -webkit-border-top-left-radius: 4px !important;
    -webkit-border-top-right-radius: 4px !important;
    -webkit-border-bottom-right-radius: 4px !important;
    -webkit-border-bottom-left-radius: 4px !important;
    border-top-left-radius: 4px !important;
    border-top-right-radius: 4px !important;
    border-bottom-right-radius: 4px !important;
    border-bottom-left-radius: 4px !important;
    margin-bottom: 0px; }
  .checkout-container .form-control {
    height: 46px;
    width: 100%; }
  .checkout-container textarea.form-control {
    height: auto; }
  .checkout-container .tooltip {
    width: 200px; }
  .checkout-container .service-fee-notice, .checkout-container .service-amount-notice {
    margin-bottom: 20px;
    text-align: center;
    color: inherit;
    background-color: #c9f4c9; }
  .checkout-container .service-amount-notice {
    text-align: left;
    margin-top: 10px;
    margin-bottom: 0px;
    color: #616161; }

.checkout-card.active {
  background-color: white;
  margin-top: 20px;
  margin-bottom: 20px;
  border-radius: 4px; }

.checkout-card.active.highlight {
  box-shadow: inset 0px 0px 0px 1px #43B02A;
  -webkit-animation: shakeHorizontal 0.5s 1;
  -moz-animation: shakeHorizontal 0.5s 1;
  animation: shakeHorizontal 0.5s 1; }

.checkout-card:first-of-type {
  margin-top: 0px; }

.checkout-card.summary:first-of-type {
  border-top-left-radius: 4px;
  border-top-right-radius: 4px; }

.checkout-card.summary:last-of-type {
  border-bottom-left-radius: 4px;
  border-bottom-right-radius: 4px; }

.checkout-card:not(.active) + .checkout-card:not(.active) {
  border-top-color: transparent; }

.checkout-actions-container {
  position: relative;
  overflow: visible; }

.checkout-card-actions {
  padding: 0px 30px 20px; }

.checkout-card-title {
  font-size: 20px;
  font-weight: 800;
  padding: 20px 30px; }

.checkout-card-warehouse-title {
  margin: 30px 30px 15px;
  font-size: 18px;
  font-weight: 600; }

.checkout-step-summary.cursor-pointer:hover {
  background-color: #fafafa; }
  .checkout-step-summary.cursor-pointer:hover .action {
    text-decoration: underline; }

.checkout-step-summary.cursor-pointer .action .cursor-pointer {
  padding: 5px 10px;
  font-size: 12px;
  line-height: 1.5;
  font-weight: normal; }
  .checkout-step-summary.cursor-pointer .action .cursor-pointer.ic-btn {
    margin-right: -2px; }

.checkout-step-summary {
  display: table;
  width: 100%; }
  .checkout-step-summary > div {
    display: table-cell;
    vertical-align: middle; }
  .checkout-step-summary .icon {
    width: 5%; }
  .checkout-step-summary .title {
    width: 25%; }
  .checkout-step-summary .detail {
    width: 60%; }
  .checkout-step-summary .title-detail {
    width: 85%; }
  .checkout-step-summary .action {
    width: 10%;
    text-align: right; }

.checkout-card.invalid .checkout-step-summary .icon {
  color: #b0b0b0; }

.checkout-card.valid .checkout-step-summary .icon {
  color: #43B02A; }

.checkout-credit-card-submit-btn-wrapper {
  width: auto;
  float: right;
  box-sizing: border-box; }
  .checkout-credit-card-submit-btn-wrapper .ic-btn {
    width: auto; }

.express-trial-buttons-wrapper {
  display: flex;
  justify-content: flex-end; }

.checkout-card-actions ul {
  margin: 0; }

.CheckoutReplacementOption + .CheckoutReplacementOption {
  border-top: 1px solid #e5edec; }

.CheckoutReplacementOption {
  margin: 0 30px; }
  .CheckoutReplacementOption .item-image, .CheckoutReplacementOption .replacement-item-detail, .CheckoutReplacementOption .item-pricing {
    float: left;
    position: relative;
    min-height: 1px; }
  .CheckoutReplacementOption .item-image {
    padding: 14px 14px 14px 0;
    width: 64px; }
  .CheckoutReplacementOption .item-pricing {
    width: 170px;
    padding: 14px 0px;
    line-height: 28px; }
    .CheckoutReplacementOption .item-pricing .qty-dropdown-wrapper {
      display: inline-block; }
    .CheckoutReplacementOption .item-pricing .checkout-item-price {
      min-width: 70px;
      display: inline-block;
      float: right; }
    .CheckoutReplacementOption .item-pricing .ic-btn {
      width: 65px;
      padding: 3px 10px; }
    .CheckoutReplacementOption .item-pricing .ic-input-lg {
      font-size: 14px; }
    .CheckoutReplacementOption .item-pricing .ic-input-append {
      right: 12px;
      top: 15px;
      font-size: 14px; }
    .CheckoutReplacementOption .item-pricing .icDropdownItems {
      text-align: center;
      left: -53px; }
    .CheckoutReplacementOption .item-pricing .ic-loading {
      right: -15px;
      position: relative; }
    .CheckoutReplacementOption .item-pricing .loose-weight .ic-input-lg {
      text-align: left; }

.replacement-item-detail {
  padding: 14px 5px; }
  .replacement-item-detail.has-children-props {
    width: -webkit-calc(100% - 258px);
    width: calc(100% - 258px); }
  .replacement-item-detail.no-children-props {
    width: -webkit-calc(100% - 88px);
    width: calc(100% - 88px); }
  .replacement-item-detail .title {
    font-weight: 600;
    width: 100%; }
  .replacement-item-detail > div + div {
    margin-top: 10px; }

.replacement-item-detail a {
  cursor: pointer; }

.replacement-item-detail .selected-replacement-choice .ic-icon {
  vertical-align: sub;
  margin-right: 5px; }

.checkout-container .affix {
  top: 75px; }

.price-free {
  color: #43B02A !important;
  font-weight: bold;
  margin-right: 5px;
  margin-left: 5px; }

.PickReplacementModal {
  width: 550px; }
  .PickReplacementModal .icModalRow {
    padding: 20px; }
  .PickReplacementModal ul.replacement-option-thumbnails {
    margin: 0;
    padding: 0; }
  .PickReplacementModal li.replacement-item-container {
    cursor: pointer;
    width: 20%;
    height: 250px;
    float: left;
    margin: 2.5%; }
  .PickReplacementModal .replacement-item {
    width: 100%;
    display: block;
    -moz-border-radius-topleft: 4px !important;
    -moz-border-radius-topright: 4px !important;
    -moz-border-radius-bottomright: 4px !important;
    -moz-border-radius-bottomleft: 4px !important;
    -webkit-border-top-left-radius: 4px !important;
    -webkit-border-top-right-radius: 4px !important;
    -webkit-border-bottom-right-radius: 4px !important;
    -webkit-border-bottom-left-radius: 4px !important;
    border-top-left-radius: 4px !important;
    border-top-right-radius: 4px !important;
    border-bottom-right-radius: 4px !important;
    border-bottom-left-radius: 4px !important; }
    .PickReplacementModal .replacement-item:hover {
      border-color: #DADAD9; }
    .PickReplacementModal .replacement-item .display-name {
      height: 80px;
      overflow: hidden; }
  .PickReplacementModal .replacement-item img {
    width: 100%;
    max-height: 100%;
    margin: 0 auto;
    display: block; }
  @media (max-width: 767px) {
    .PickReplacementModal .pick-replacement-modal-header {
      font-size: 22px; } }

.CustomTipModal {
  max-width: 380px; }
  .CustomTipModal .tip-steps.ic-btn-group {
    margin-bottom: 20px; }
    .CustomTipModal .tip-steps.ic-btn-group .ic-btn.checkout-tip-btn {
      height: 60px; }
    .CustomTipModal .tip-steps.ic-btn-group .tip-amount-text {
      font-size: 12px; }

.CustomTipModal-prefix {
  position: absolute;
  left: 5px;
  padding-top: 12px;
  color: #43B02A;
  font-weight: 100;
  font-size: 18px; }

@media (max-width: 992px) {
  .checkout-container .checkout-card-actions .delivery-option-panel .price {
    line-height: 48px; }
  .checkout-container .checkout-card-actions .delivery-option-panel .ic-btn {
    margin-top: 9px; }
  .checkout-container .ic-btn {
    padding: 5px 14px; } }

@media (max-width: 544px) {
  .container-fluid {
    padding: 0; }
  .CheckoutReplacementOption .item-pricing .ic-btn {
    padding: 10px; }
  .checkout-card .icon {
    width: 8%; }
  .checkout-card .checkout-step-summary .title {
    display: none; }
  .checkout-card .p-x-xlg {
    padding-left: 12px !important;
    padding-right: 12px !important; }
  .checkout-card .checkout-card-title {
    font-size: 16px;
    padding: 10px 10px 12px; }
  .checkout-card .checkout-card-actions {
    padding: 0 10px 20px; }
    .checkout-card .checkout-card-actions form.address-form fieldset div {
      margin-bottom: 12px; }
    .checkout-card .checkout-card-actions form.address-form fieldset input[type=text],
    .checkout-card .checkout-card-actions form.address-form fieldset input[type=search] {
      text-indent: 8px; }
    .checkout-card .checkout-card-actions .phone-input-wrapper .control-label {
      display: none; }
    .checkout-card .checkout-card-actions .phone-input-wrapper .controls {
      margin-left: 0;
      padding-left: 0 !important; }
    .checkout-card .checkout-card-actions .phone-input-wrapper p.phone-number-help-text {
      display: none; }
    .checkout-card .checkout-card-actions .credit-card-billing-form label.control-label {
      float: none;
      font-size: 13px;
      font-weight: 600;
      text-align: left; }
    .checkout-card .checkout-card-actions .credit-card-billing-form .controls {
      margin: 0; }
      .checkout-card .checkout-card-actions .credit-card-billing-form .controls form.credit-card-input-wrapper {
        overflow: hidden;
        white-space: nowrap; }
  .icModalContent.CustomTipModal {
    width: auto;
    max-width: none; } }

.checkout-container .payment_method_icon {
  width: 27px;
  margin-right: 33px; }
  .checkout-container .payment_method_icon.apple-pay-mark {
    margin: 0 32px 0 -1px; }

.checkout-container .apple-pay-mark {
  width: 29px;
  height: 20px;
  vertical-align: middle;
  display: inline-block;
  background-size: 100% 60%;
  background-repeat: no-repeat;
  background-position: 50% 50%;
  border-radius: 5px;
  padding: 0px;
  box-sizing: border-box;
  background-image: -webkit-named-image(apple-pay-logo-black);
  background-color: white;
  border: .5px solid black; }

.debit-card-prompt-modal-banner {
  width: 100%; }

.coupon-clipping-apply-btn, .coupon-clipping-apply-btn-mini,
.ic-btn.coupon-clipping-apply-btn-mini,
.ic-btn.coupon-clipping-apply-btn,
.ic-btn.coupon-clipping-apply-btn-mini {
  padding-top: 5px;
  background-color: #FFF6F2;
  border: 1px dashed #E8104A;
  color: #E8104A; }

.coupon-clipping-apply-btn:hover, .coupon-clipping-apply-btn-mini:hover, .coupon-clipping-apply-btn:active, .coupon-clipping-apply-btn-mini:active, .coupon-clipping-apply-btn:focus, .coupon-clipping-apply-btn-mini:focus {
  color: #E8104A;
  background-color: #FFEAE1; }

.coupon-clipping-mini {
  margin-top: 30px;
  bottom: 20px;
  font-size: 13px;
  position: absolute;
  right: 10%; }

.coupon-clipping-mini.color-pink,
.ic-btn.coupon-clipping-mini.color-pink {
  border-color: #E8104A; }

.coupon-clipping-apply-btn-mini,
.ic-btn.coupon-clipping-apply-btn-mini {
  font-size: 13px;
  width: 80%;
  display: none; }
  @media (max-width: 991px) {
    .coupon-clipping-apply-btn-mini,
    .ic-btn.coupon-clipping-apply-btn-mini {
      bottom: -5px !important; } }
  @media (min-width: 768px) and (max-width: 991px) {
    .coupon-clipping-apply-btn-mini,
    .ic-btn.coupon-clipping-apply-btn-mini {
      bottom: 20px !important; } }

.coupon-clipping-apply-primary-text {
  font-size: 14px;
  line-height: 18px; }

.coupon-clipping-applied-btn, .coupon-clipping-applied-btn-mini {
  background-color: #FFF;
  border-color: #E0E0E0; }

.coupon-clipping-applied-btn-mini {
  display: none;
  background: transparent;
  left: 16px;
  margin-right: 20px;
  bottom: 10px; }

.coupon-clipping-unclipped {
  text-align: center;
  margin-top: 1em; }

.coupon-clipping-unclipped-btn-mini,
.ic-btn.coupon-clipping-unclipped-btn-mini {
  padding-top: 5px;
  background-color: #FFF;
  border: 1px dashed #CCC;
  color: #E8104A;
  width: 80%;
  margin-top: 20px;
  font-size: 13px;
  text-align: center; }
  .coupon-clipping-unclipped-btn-mini.color-pink,
  .ic-btn.coupon-clipping-unclipped-btn-mini.color-pink {
    border-color: #E8104A; }
  @media (max-width: 991px) {
    .coupon-clipping-unclipped-btn-mini,
    .ic-btn.coupon-clipping-unclipped-btn-mini {
      bottom: -5px !important; } }
  @media (min-width: 768px) and (max-width: 991px) {
    .coupon-clipping-unclipped-btn-mini,
    .ic-btn.coupon-clipping-unclipped-btn-mini {
      bottom: 20px !important; } }

.coupon-clipping-unclipped-btn-mini:hover {
  color: #E8104A;
  background-color: #FFF; }

/* Show and hide logic for Item Card (V2 and V3) */
.item:hover .item-aisle-link, .item:hover .item-es-score, .item-card:hover .item-aisle-link, .item-card:hover .item-es-score {
  visibility: visible; }

.item:hover .coupon-clipping-apply-btn, .item:hover .coupon-clipping-apply-btn-mini, .item-card:hover .coupon-clipping-apply-btn, .item-card:hover .coupon-clipping-apply-btn-mini {
  display: block; }

.item:hover .coupon-clipping-unclipped-btn-mini, .item-card:hover .coupon-clipping-unclipped-btn-mini {
  display: none; }

.item:hover .coupon-clipping-applied-btn-mini, .item-card:hover .coupon-clipping-applied-btn-mini {
  display: block; }
  @media (max-width: 767px) {
    .item:hover .coupon-clipping-applied-btn-mini, .item-card:hover .coupon-clipping-applied-btn-mini {
      display: none; } }

/* End of Show and hide logic for Item Card (V2 and V3) */
.coupon-offer {
  position: absolute;
  bottom: 12px;
  padding: 0 15px 0;
  font-weight: 600;
  font-size: 12px;
  display: none; }
  @media (max-width: 576px) {
    .coupon-offer {
      bottom: 5px;
      font-size: 11px; } }

.coupons {
  width: 700px;
  padding-left: 135px;
  position: relative; }
  .coupons .icon {
    width: 100px;
    height: 100px;
    position: absolute;
    top: 0;
    left: 10px; }
  .coupons .coupons-list {
    width: 400px;
    margin-top: 30px; }

.account-coupons .coupon-icon {
  background: url(icon-coupon-88379d1c080758a38ddb96fd1b878ed3.png) no-repeat center;
  height: 100%;
  width: 100%; }

.coupon-message-modal {
  text-align: center; }
  .coupon-message-modal .coupon-image {
    height: 128px;
    width: 128px;
    background-size: 128px 128px !important;
    margin: 0 auto; }
  .coupon-message-modal .success-image {
    background: url(promo-success-1c69b76955d831e5b6e44059c6ec4e12.png) no-repeat center; }
  .coupon-message-modal .error-image {
    background: url(promo-error-75388ee9297e17e2a0cd6d68b59df2d0.png) no-repeat center; }
  .coupon-message-modal p {
    color: #757575;
    font-size: 16px; }

.coupon-modal .promo-input {
  margin-bottom: 5px; }

.coupon-modal .error-message {
  text-align: left;
  font-size: 13px; }

.coupon-modal .has-error {
  color: #E8104A; }
  .coupon-modal .has-error .promo-input {
    border: 1px solid #E8104A;
    background: #fef2f5; }

.credit-card-dropdown .card-error {
  margin-top: 5px; }
  .credit-card-dropdown .card-error .error {
    color: #E8104A; }
  .credit-card-dropdown .card-error a {
    cursor: pointer; }

.StripeElement {
  background-color: white;
  padding: 8px 12px;
  border-radius: 4px;
  border: 1px solid #E7E6E5;
  border: 1px solid transparent;
  box-shadow: 0 1px 3px 0 #e6ebf1;
  -webkit-transition: box-shadow 150ms ease;
  transition: box-shadow 150ms ease; }

.StripeElement--focus {
  box-shadow: 0 0 0 1px #fff, 0 0 0 3px #36DAE3; }

.StripeElement--invalid {
  box-shadow: 0 0 0 1px #fff, 0 0 0 3px #E8104A; }

.credit-card-input-wrapper {
  background-color: #fff;
  border: 1px solid #E7E6E5;
  border-radius: 4px; }
  .credit-card-input-wrapper .credit-card-form-input-wrapper {
    display: inline-block; }
    .credit-card-input-wrapper .credit-card-form-input-wrapper input {
      width: 70px;
      margin-bottom: 0;
      padding: 8px 5px;
      border: 0;
      box-shadow: none;
      border-radius: 0 !important;
      opacity: 0;
      transition: opacity .3s; }
    .credit-card-input-wrapper .credit-card-form-input-wrapper .credit-card-input {
      width: 150px;
      text-indent: 0;
      transition: width .3s;
      opacity: 1; }
      .credit-card-input-wrapper .credit-card-form-input-wrapper .credit-card-input.has-card-number {
        text-indent: -105px;
        width: 60px; }
        .credit-card-input-wrapper .credit-card-form-input-wrapper .credit-card-input.has-card-number.amex {
          text-indent: -88px; }
      .credit-card-input-wrapper .credit-card-form-input-wrapper .credit-card-input.has-card-number:focus, .credit-card-input-wrapper .credit-card-form-input-wrapper .credit-card-input:focus {
        width: 150px;
        text-indent: 0; }
  @media (max-width: 767px) {
    .credit-card-input-wrapper .card-image {
      display: none; }
    .credit-card-input-wrapper .expiration-input {
      max-width: 58px; }
    .credit-card-input-wrapper .cvv-input {
      max-width: 43px; } }

.credit-card-form-modal {
  width: 550px; }
  .credit-card-form-modal .icModalRow {
    border-top: 0; }
  .credit-card-form-modal .icModalRow .ic-btn + .ic-btn {
    margin-left: 10px; }
  .credit-card-form-modal .icModalHeader {
    border-top: none;
    padding-bottom: 0; }
    .credit-card-form-modal .icModalHeader h1 {
      text-align: center;
      margin: 0; }
    .credit-card-form-modal .icModalHeader h5 {
      text-align: center;
      margin: 0; }
  .credit-card-form-modal .icModalBody {
    padding: 30px; }
  .credit-card-form-modal .icDropdown > .ic-btn {
    width: 100%;
    text-align: left; }
  .credit-card-form-modal .icDropdownItems {
    width: 100%; }
  .credit-card-form-modal .form-horizontal .controls {
    margin-left: 132px; }
  .credit-card-form-modal .form-horizontal .control-label {
    width: 118px; }
  .credit-card-form-modal .form-horizontal.address-form .controls {
    margin-left: 0; }
    .credit-card-form-modal .form-horizontal.address-form .controls .zip-input {
      width: 25%; }
    .credit-card-form-modal .form-horizontal.address-form .controls .city-wrapper {
      width: 74%; }
    .credit-card-form-modal .form-horizontal.address-form .controls .alert-info {
      margin-bottom: 0; }
  @media (max-width: 767px) {
    .credit-card-form-modal .icModalBody {
      padding: 15px !important; }
    .credit-card-form-modal label.control-label {
      text-align: left;
      float: none; }
    .credit-card-form-modal .form-horizontal .controls {
      margin-left: 0; } }

.express-terms-modal {
  width: 550px; }
  .express-terms-modal .icModalRow {
    border-top: 0; }
  .express-terms-modal .icModalRow .ic-btn + .ic-btn {
    margin-left: 10px; }
  .express-terms-modal .icModalHeader {
    border-top: none;
    padding-bottom: 0; }
    .express-terms-modal .icModalHeader h1 {
      text-align: center;
      margin: 0;
      font-weight: 700;
      font-size: 30px; }
    .express-terms-modal .icModalHeader h5 {
      text-align: center;
      margin: 0; }
  .express-terms-modal .accept-text {
    cursor: default;
    position: relative;
    top: -4px; }
  .express-terms-modal .icModalBody {
    padding: 30px; }
  .express-terms-modal .acceptTerms {
    padding-bottom: 20px;
    text-align: center; }
  .express-terms-modal .inner-button-wrapper {
    text-align: right; }
  .express-terms-modal #terms {
    max-height: 250px;
    overflow-y: scroll;
    border: 1px solid #e6e6e6; }

.credit-card-page-container .ic-btn {
  margin-left: 10px; }

.credit-card-page-container h2 {
  text-align: center;
  margin: 0;
  font-weight: 700;
  font-size: 30px; }

.credit-card-page-container h5 {
  text-align: center;
  margin: 0; }

.icModalContent.errorModal {
  width: 700px;
  text-align: center; }
  @media (max-width: 767px) {
    .icModalContent.errorModal {
      width: 100vw; } }
  .icModalContent.errorModal > div {
    padding: 30px 0px; }

.express {
  margin-bottom: 50px; }
  .express a:hover {
    cursor: pointer; }
  .express .checkout-card.active {
    border-bottom-right-radius: 4px;
    border-bottom-left-radius: 4px;
    margin-top: 0;
    border-top: none; }
  .express .express-error {
    padding: 10px;
    color: #E8104A; }

.express-badge-white {
  background-repeat: no-repeat;
  background-position: center;
  background-image: url(badge-white-481e8a4f3d02f15b153a17b5d45aa137.png);
  min-width: 41px;
  min-height: 41px; }

.ExpressRewardsModal .module-renderer {
  padding: 0; }

.express-gifting-panel {
  max-width: 800px;
  padding-bottom: 50px;
  margin-bottom: 50px; }

.express-gifting-banner {
  display: flex;
  display: -webkit-flex;
  display: -ms-flex;
  justify-content: space-between;
  align-items: center;
  height: 192px;
  margin: 0 -15px 40px -15px;
  background-color: #364c64;
  color: #fff; }
  .express-gifting-banner img {
    max-height: 100%;
    max-width: 100%; }
  .express-gifting-banner .banner-text {
    display: flex;
    display: -webkit-flex;
    display: -ms-flex;
    align-items: center; }
    .express-gifting-banner .banner-text h3 {
      font-size: 1.2vw;
      font-weight: 600;
      margin-right: 1em;
      text-align: center; }

.express-gifting-banner--top {
  height: inherit; }
  .express-gifting-banner--top a {
    width: auto !important;
    height: auto !important; }

.express-gifting-header {
  text-align: center;
  padding-left: 40px;
  padding-right: 40px;
  background: #F6FBFF; }
  @media (max-width: 767px) {
    .express-gifting-header {
      padding: 15px; } }

.express-gifting-body {
  max-width: 800px;
  margin-top: 14px; }

.express-gifting-other-cards {
  text-align: right;
  padding: 4%; }
  .express-gifting-other-cards a {
    cursor: pointer; }

.express-gifting-description {
  padding-bottom: 20px;
  padding-left: 60px;
  padding-right: 60px; }
  .express-gifting-description img {
    width: 100px; }

.express-gift-card {
  position: relative;
  max-width: 385px;
  margin: 0 auto 2em auto; }
  @media (max-width: 767px) {
    .express-gift-card {
      margin: 0 auto 1em auto; } }
  .express-gift-card .term-text {
    position: absolute;
    right: 26px;
    bottom: 24px;
    font-weight: bolder;
    font-size: 20px;
    color: #43B02A; }
    @media (max-width: 991px) {
      .express-gift-card .term-text {
        right: 16px;
        bottom: 16px;
        font-weight: normal; } }

.express-gifting form input {
  width: 50%; }

.express-gifting form textarea {
  width: 60%; }

.express-gifting form .control-label {
  width: 210px; }

.express-gifting form .controls {
  margin-left: 230px; }

.express-gifting form legend {
  font-size: 14px;
  font-weight: normal;
  line-height: 20px; }

.express-gifting form .credit-card-dropdown {
  width: 100%; }
  .express-gifting form .credit-card-dropdown button,
  .express-gifting form .credit-card-dropdown .icDropdownItems {
    width: 50%;
    text-align: left; }

.express-gifting form .send-to-me-checkbox {
  display: flex;
  display: -webkit-flex;
  display: -ms-flex;
  align-items: center; }
  .express-gifting form .send-to-me-checkbox input[type="checkbox"] {
    margin: 0 5px 0 0; }
  .express-gifting form .send-to-me-checkbox label {
    margin-bottom: 0; }

.gift-plans {
  display: flex;
  display: -webkit-flex;
  display: -ms-flex; }

.gift-plan {
  display: flex;
  display: -webkit-flex;
  display: -ms-flex;
  align-items: center;
  justify-content: center;
  padding: 13px;
  position: relative;
  text-align: center;
  border: 2px solid #e5edec;
  cursor: pointer;
  border-right: none; }
  .gift-plan:last-child {
    border-right: 2px solid #e5edec; }
  .gift-plan.active {
    background-color: #f1f8f8;
    border: 2px solid #57b7bc; }
    .gift-plan.active + .gift-plan {
      border-left: none; }
  .gift-plan .gift-term-text {
    color: #57b7bc;
    font-weight: bolder; }
  .gift-plan input[type="radio"] {
    display: none; }

.check-box {
  background: url(unchecked-plain@2x-537243a0b0ffc2a82f8ea2720cf62cb9.png) no-repeat !important;
  background-size: 24px 24px !important;
  width: 24px !important;
  height: 24px !important; }
  .check-box.active {
    background: url(check-mark@2x-bb982be301ef8a04f7ae8cbda057b05c.png) no-repeat !important;
    background-size: 24px 24px !important;
    width: 24px !important;
    height: 24px !important; }

.redeem-express-gift-modal {
  padding-top: 2em;
  padding-bottom: 2em; }
  .redeem-express-gift-modal input[type="text"] {
    width: 100%; }
  .redeem-express-gift-modal h2 {
    font-size: 20px;
    margin-bottom: 1em;
    margin-top: 0; }
  .redeem-express-gift-modal button {
    width: 100%; }
  .redeem-express-gift-modal .redeem-modal-success button {
    width: 35%; }

.color-red {
  color: red !important; }

.express-gifting-over-header .close-ad {
  padding: 5px 5px 4px;
  border-radius: 4px;
  background-color: rgba(0, 0, 0, 0.5); }
  .express-gifting-over-header .close-ad .ic-icon {
    margin-right: 0;
    color: #FFFFFF; }

.subscription-terms-modal {
  text-align: center;
  padding: 10px; }
  .subscription-terms-modal .terms-text {
    text-align: left;
    height: 250px;
    font-size: 13px;
    overflow: scroll;
    border: 1px solid #F0EFEC;
    padding: 5px; }
    .subscription-terms-modal .terms-text b {
      text-align: center; }
  .subscription-terms-modal .terms-controls input {
    display: inline-block;
    vertical-align: middle; }
  .subscription-terms-modal .terms-controls .accept-label {
    font-weight: 600;
    margin-left: 10px;
    display: inline-block; }
  .subscription-terms-modal .terms-controls .payment-label, .subscription-terms-modal .terms-controls .credit-card-dropdown {
    display: inline-block;
    margin: 10px; }
  .subscription-terms-modal .terms-controls .terms-buttons .ic-btn {
    margin: 10px; }
  .subscription-terms-modal .terms-controls .terms-buttons .ic-btn-secondary {
    color: #43B02A; }

.SubscriptionThanksModal {
  position: absolute;
  top: 0;
  left: 0;
  width: 100%;
  height: 100%;
  background: transparent;
  background-color: transparent !important;
  -webkit-box-shadow: none !important;
  box-shadow: none !important;
  border: none !important;
  text-align: center;
  vertical-align: middle; }

.subscription-thanks-modal {
  background: transparent; }
  .subscription-thanks-modal .thanks-content {
    color: white; }
    @media (max-width: 576px) {
      .subscription-thanks-modal .thanks-content {
        margin-top: 0; } }
    .subscription-thanks-modal .thanks-content h1 {
      color: white;
      font-weight: 600; }
    .subscription-thanks-modal .thanks-content div {
      font-size: 18px;
      margin-bottom: 16px; }
  .subscription-thanks-modal .falling-money {
    z-index: -200;
    width: 100%;
    height: 100%;
    padding: 0; }
    .subscription-thanks-modal .falling-money span.coin, .subscription-thanks-modal .falling-money span.bill {
      width: 55px;
      height: 55px;
      display: inline-block;
      padding: 0;
      background-size: contain !important;
      opacity: 0;
      margin-top: -200px; }
    .subscription-thanks-modal .falling-money span.coin {
      background: url(coin-dd13c079218d37b745e02f7d790a972f.png) no-repeat center;
      -webkit-animation: falling-coins 3s infinite linear;
      -moz-animation: falling-coins 3s infinite linear; }
    .subscription-thanks-modal .falling-money span.bill {
      background: url(dollar-bill-d7cb98068fd012ebe35499eac54c3132.png) no-repeat center;
      -webkit-animation: falling-bills 5s infinite linear;
      -moz-animation: falling-bills 5s infinite linear; }
    .subscription-thanks-modal .falling-money span.coin:nth-child(5n+7) {
      -webkit-animation-delay: 2.3s;
      -moz-animation-delay: 2.3s; }
    .subscription-thanks-modal .falling-money span.bill:nth-child(2n+4) {
      -webkit-animation-delay: 1.9s;
      -moz-animation-delay: 1.9s; }
    .subscription-thanks-modal .falling-money span.coin:nth-child(3n+9) {
      -webkit-animation-delay: 0.6s;
      -moz-animation-delay: 0.6s; }
    .subscription-thanks-modal .falling-money span.bill:nth-child(2n+9) {
      -webkit-animation-delay: 3.5s;
      -moz-animation-delay: 3.5s; }
    .subscription-thanks-modal .falling-money span.coin:nth-child(2n+3) {
      -webkit-animation-delay: 1.9s;
      -moz-animation-delay: 1.9s; }
    .subscription-thanks-modal .falling-money span.bill:nth-child(5n+3) {
      -webkit-animation-delay: 0.1s;
      -moz-animation-delay: 0.1s; }
    .subscription-thanks-modal .falling-money span.coin:nth-child(3n+7) {
      -webkit-animation-delay: 2.7s;
      -moz-animation-delay: 2.7s; }
    .subscription-thanks-modal .falling-money span.bill:nth-child(7n+4) {
      -webkit-animation-delay: 2.1s;
      -moz-animation-delay: 2.1s; }
    .subscription-thanks-modal .falling-money span.coin:nth-child(7n+5) {
      -webkit-animation-delay: 0.2s;
      -moz-animation-delay: 0.2s; }
    .subscription-thanks-modal .falling-money span.bill:nth-child(6n+5) {
      -webkit-animation-delay: 1.1s;
      -moz-animation-delay: 1.1s; }
    .subscription-thanks-modal .falling-money span.coin:nth-child(4n+6) {
      -webkit-animation-delay: 2.5s;
      -moz-animation-delay: 2.5s; }
    .subscription-thanks-modal .falling-money span.bill:nth-child(5n+6) {
      -webkit-animation-delay: 4.5s;
      -moz-animation-delay: 4.5s; }
    .subscription-thanks-modal .falling-money span.coin:nth-child(4n+3) {
      -webkit-animation-delay: 1.8s;
      -moz-animation-delay: 1.8s; }
    .subscription-thanks-modal .falling-money span.bill:nth-child(7n+7) {
      -webkit-animation-delay: 2s;
      -moz-animation-delay: 2s; }

@-webkit-keyframes falling-coins {
  0% {
    opacity: 1;
    -webkit-transform: translate(0, 0px) rotateZ(0deg); }
  75% {
    opacity: 1;
    -webkit-transform: translate(50px, 600px) rotateZ(270deg); }
  100% {
    opacity: 0;
    -webkit-transform: translate(100px, 800px) rotateZ(360deg); } }

@-moz-keyframes falling-coins {
  0% {
    opacity: 1;
    -webkit-transform: translate(0, 0px) rotateZ(0deg); }
  75% {
    opacity: 1;
    -webkit-transform: translate(100px, 600px) rotateZ(270deg); }
  100% {
    opacity: 0;
    -webkit-transform: translate(150px, 800px) rotateZ(360deg); } }

@-webkit-keyframes falling-bills {
  0% {
    opacity: 1;
    -webkit-transform: translate(0, 0px) rotateZ(0deg); }
  25% {
    opacity: 1;
    -webkit-transform: translate(100px, 200px) rotateZ(45deg); }
  50% {
    opacity: 1;
    -webkit-transform: translate(0px, 400px) rotateZ(0deg); }
  75% {
    opacity: 1;
    -webkit-transform: translate(-100px, 600px) rotateZ(-45deg); }
  100% {
    opacity: 0;
    -webkit-transform: translate(0px, 800px) rotateZ(0deg); } }

@-moz-keyframes falling-bills {
  0% {
    opacity: 1;
    -webkit-transform: translate(0, 0px) rotateZ(0deg); }
  25% {
    opacity: 1;
    -webkit-transform: translate(100px, 200px) rotateZ(45deg); }
  50% {
    opacity: 1;
    -webkit-transform: translate(0px, 400px) rotateZ(0deg); }
  75% {
    opacity: 1;
    -webkit-transform: translate(-100px, 600px) rotateZ(-45deg); }
  100% {
    opacity: 0;
    -webkit-transform: translate(0px, 800px) rotateZ(0deg); } }

.express-placement.over-header, .express-placement.cart {
  background: url(general-pattern-dark@2x-39b2afa0a9682625b1d83d19b63a2906.png) repeat;
  background-size: 208px 208px;
  background-color: #43B02A;
  font-size: 14px;
  padding: 10px;
  color: white;
  vertical-align: middle;
  cursor: pointer; }
  .express-placement.over-header .cart-text, .express-placement.cart .cart-text {
    display: inline-block;
    font-size: 15px; }
    .express-placement.over-header .cart-text p, .express-placement.cart .cart-text p {
      margin: 0; }
  .express-placement.over-header .action, .express-placement.cart .action {
    display: inline-block; }

.express-placement.over-header {
  text-align: center;
  height: 70px;
  position: fixed;
  top: 0;
  left: 0;
  z-index: 1020;
  width: 100%;
  box-shadow: 0 1px 5px 0 rgba(0, 0, 0, 0.16), 0 1px 2px 0 rgba(0, 0, 0, 0.26);
  padding-top: 12px; }
  .express-placement.over-header .express-badge-white {
    vertical-align: middle;
    margin-right: 16px;
    margin-top: -10px; }
    @media (max-width: 767px) {
      .express-placement.over-header .express-badge-white {
        display: none; } }
  .express-placement.over-header .banner-text {
    display: inline-block;
    margin-right: 24px;
    font-size: 20px; }
    @media (max-width: 576px) {
      .express-placement.over-header .banner-text {
        margin-right: 0;
        font-size: 16px;
        width: 50vw;
        float: left;
        margin-top: 5px; } }
  .express-placement.over-header i.ic-icon {
    padding: 5px 5px 4px;
    border-radius: 4px;
    background-color: rgba(0, 0, 0, 0.16);
    font-size: 10px;
    line-height: 10px;
    color: #FFFFFF;
    float: right; }
  .express-placement.over-header .ic-btn-default {
    font-size: 18px;
    color: #43B02A;
    margin-top: -6px; }
  .express-placement.over-header p {
    line-height: 45px;
    margin: 0; }
    @media (max-width: 576px) {
      .express-placement.over-header p {
        line-height: 22px; } }
  @media (max-width: 576px) {
    .express-placement.over-header .action {
      margin-top: 15px; }
      .express-placement.over-header .action a {
        font-size: 14px; } }
  @media (max-width: 767px) {
    .express-placement.over-header .action {
      display: inline-block;
      margin-top: 15px;
      margin-right: 40px; } }
  @media (max-width: 767px) {
    .express-placement.over-header {
      padding: 5px 10px; } }

.express-placement .express-badge-white {
  background: url(badge-white@2x-8b66ef36decc6c204ae74f4d1d54c1e1.png) no-repeat left;
  background-size: 41px 40px;
  width: 41px;
  height: 40px;
  display: inline-block;
  margin-right: 10px; }

.express-placement .express-badge {
  background: url(badge@2x-eea28e5fe7c4cb08fb1dc3a829b189bf.png) no-repeat left;
  background-size: 41px 40px;
  width: 41px;
  height: 40px;
  display: inline-block;
  margin-right: 10px; }

.express-placement.order-status {
  border-radius: 4px;
  background-color: #CAF2C2;
  padding: 16px 24px;
  position: relative; }
  .express-placement.order-status h4 {
    width: 85%;
    color: #487943; }
  .express-placement.order-status .express-badge {
    position: absolute;
    top: 16px;
    right: 6px; }

.express-placement.fly-out {
  position: absolute;
  bottom: 2px;
  right: 6px;
  font-size: 11px;
  font-weight: 700;
  cursor: pointer; }

.express-placement.checkout-delivery {
  padding: 16px;
  margin: 16px 0; }
  .express-placement.checkout-delivery .express-badge {
    top: 10px;
    right: 12px; }
  .express-placement.checkout-delivery .check-box {
    margin-right: 8px; }

.express-placement.checkout-total {
  padding: 16px;
  margin: 8px 0;
  font-size: 12px; }
  .express-placement.checkout-total h4 {
    font-size: 13px; }
  .express-placement.checkout-total .express-badge {
    top: 8px;
    right: 8px; }
  .express-placement.checkout-total .check-box {
    margin-right: 8px; }
  .express-placement.checkout-total.opted-in {
    font-size: 13px;
    background: #CAF2C2; }

.express-placement.checkout-delivery, .express-placement.checkout-total {
  position: relative;
  background: #CAF2C2;
  border-radius: 4px; }
  .express-placement.checkout-delivery .check-box, .express-placement.checkout-total .check-box {
    background: url(check-mark-off@2x-32520ae2bd7916627b76be4bd69cff8e.png) no-repeat;
    background-size: 24px 24px;
    width: 24px;
    height: 24px; }
    .express-placement.checkout-delivery .check-box.active, .express-placement.checkout-total .check-box.active {
      background: url(check-mark@2x-bb982be301ef8a04f7ae8cbda057b05c.png) no-repeat;
      background-size: 24px 24px; }
  .express-placement.checkout-delivery .new-check-box, .express-placement.checkout-total .new-check-box {
    margin-right: 8px;
    background: #fff;
    background-size: 24px 24px;
    border: 1px solid #3CB046;
    width: 24px;
    height: 24px;
    -moz-border-radius-topleft: 4px !important;
    -moz-border-radius-topright: 4px !important;
    -moz-border-radius-bottomright: 4px !important;
    -moz-border-radius-bottomleft: 4px !important;
    -webkit-border-top-left-radius: 4px !important;
    -webkit-border-top-right-radius: 4px !important;
    -webkit-border-bottom-right-radius: 4px !important;
    -webkit-border-bottom-left-radius: 4px !important;
    border-top-left-radius: 4px !important;
    border-top-right-radius: 4px !important;
    border-bottom-right-radius: 4px !important;
    border-bottom-left-radius: 4px !important; }
    .express-placement.checkout-delivery .new-check-box.active, .express-placement.checkout-total .new-check-box.active {
      background: url(check-mark@2x-bb982be301ef8a04f7ae8cbda057b05c.png) no-repeat;
      background-size: 24px 24px;
      border: none; }
  .express-placement.checkout-delivery .express-badge, .express-placement.checkout-total .express-badge {
    background-size: 31px 30px;
    width: 31px;
    height: 30px;
    margin-right: 0;
    position: absolute; }
  .express-placement.checkout-delivery h4, .express-placement.checkout-total h4 {
    font-weight: 600;
    margin: 4px 0 10px;
    color: #487943; }
  .express-placement.checkout-delivery .disclaimer, .express-placement.checkout-total .disclaimer {
    font-size: 10px;
    line-height: 1.4em;
    margin: 8px 0 0;
    display: block; }
  .express-placement.checkout-delivery.opted-in, .express-placement.checkout-total.opted-in {
    background: #fafafa;
    border: 1px solid #e5edec; }
    .express-placement.checkout-delivery.opted-in strong, .express-placement.checkout-total.opted-in strong {
      color: #43B02A; }
    .express-placement.checkout-delivery.opted-in .express-badge, .express-placement.checkout-total.opted-in .express-badge {
      background-size: 31px 30px;
      width: 31px;
      height: 30px;
      position: absolute;
      top: 11px;
      right: 16px; }

.express-placement.checkout-delivery.placement-variant-checkbox .opt-in-text {
  margin-left: 32px; }

.express-placement.placement-variant-checkbox, .express-placement.placement-variant-button {
  background: #C9F2C7; }
  .express-placement.placement-variant-checkbox h4, .express-placement.placement-variant-button h4 {
    color: #3CB046;
    font-weight: 800; }

.express-placement.entry-modal h2, .express-placement.entry-modal h3, .express-placement.entry-modal h4 {
  color: white; }

.express-placement.entry-modal h2 {
  font-size: 28px;
  font-weight: 600;
  margin-bottom: 0;
  text-shadow: 2px 4px 3px rgba(0, 0, 0, 0.3); }
  @media (max-width: 767px) {
    .express-placement.entry-modal h2 {
      font-size: 24px; } }

.express-pill .carrot-white {
  background: url(carrot-logo-white-83d99ed7cce8f58dde2f62a73fc53a99.png) no-repeat;
  background-size: 14px 15px;
  width: 14px;
  height: 15px;
  display: inline-block;
  margin-right: 4px;
  vertical-align: middle;
  margin-top: -2px; }

.express-pill .label {
  font-weight: 700;
  font-size: 12px; }

.label-pill.is-hoverable:hover {
  background: #3b9b25; }

.EntryModal {
  max-width: 800px !important; }
  @media (min-width: 768px) {
    .EntryModal {
      width: 90%; } }
  .EntryModal .icModalClose {
    color: #fff; }

.entry-modal-bg-img {
  border-radius: 5px 5px 0 0;
  color: #fff;
  background-color: #2b3c4e; }
  @media (min-width: 768px) {
    .entry-modal-bg-img {
      background: url(trial-modal-background-22bdd7aeb200344c2f4fce4858f9b393.jpg) no-repeat;
      background-size: cover;
      background-position: top center;
      background-color: white;
      height: 540px; } }
  @media (max-width: 767px) {
    .entry-modal-bg-img {
      min-height: 80vh;
      display: flex;
      flex-direction: column;
      justify-content: center; } }

.upgrade-check-box {
  background: #fff;
  background-image: none !important;
  border-radius: 4px;
  border: 1px solid #8c8c8c;
  width: 24px !important;
  height: 24px !important; }
  .upgrade-check-box.active {
    background: url(check-mark@2x-bb982be301ef8a04f7ae8cbda057b05c.png) no-repeat !important;
    background-size: 24px 24px !important;
    width: 24px !important;
    height: 24px !important; }

.icModalContentContainer > .EntryModal {
  position: relative; }

.nux-trial-offer-background {
  background: url(trial-offer-background-9610f79426c8cfa56010918050bf8f25.jpg) center no-repeat;
  background-size: cover;
  position: relative; }

.express-subscription-chooser {
  position: relative; }
  .express-subscription-chooser .discount-banner {
    background: url(express-ribbon-green-c43e43f78c381e0bfc91d3629a17acc4.png) no-repeat center;
    background-size: cover;
    width: 84px;
    height: 30px;
    background-size: cover;
    position: absolute;
    top: 10px;
    text-align: center;
    padding-top: 3px;
    color: #fff;
    font-weight: 800; }
  .express-subscription-chooser .original-price-container {
    line-height: 0.5em;
    text-align: right; }
  .express-subscription-chooser .original-strikethrough {
    position: relative;
    display: inline-block;
    margin-bottom: 0;
    font-size: 18px;
    font-weight: 300; }
  .express-subscription-chooser .original-strikethrough:before {
    position: absolute;
    content: "";
    left: 0;
    top: 50%;
    right: 0;
    border-top: 1px solid #62c94b;
    -webkit-transform: rotate(-15deg);
    -moz-transform: rotate(-15deg);
    -ms-transform: rotate(-15deg);
    -o-transform: rotate(-15deg);
    transform: rotate(-15deg); }
  .express-subscription-chooser .express-option-container {
    float: left;
    padding: 10px 0;
    transition: all 0.2s ease; }
    @media (max-width: 991px) {
      .express-subscription-chooser .express-option-container {
        padding: 0; } }
    .express-subscription-chooser .express-option-container.selected {
      padding: 0; }
      .express-subscription-chooser .express-option-container.selected .ic-btn {
        display: none; }
      .express-subscription-chooser .express-option-container.selected .discount-banner {
        background: url(express-ribbon-0f70903eddd3fea40fa26daa8eb24a2f.png) no-repeat center;
        background-size: cover;
        color: #43b029; }
      .express-subscription-chooser .express-option-container.selected .express-check {
        background: url(express-check-green-f8acc25f3f162f772cd984fa9f2b1ed0.png) no-repeat center;
        background-size: cover; }
      .express-subscription-chooser .express-option-container.selected .express-option {
        background-color: #62c94b;
        color: #fff;
        height: 190px; }
        .express-subscription-chooser .express-option-container.selected .express-option .option-title {
          color: #fff; }
        .express-subscription-chooser .express-option-container.selected .express-option .original-strikethrough:before {
          border-top: 1px solid #FFF; }
  .express-subscription-chooser .express-option {
    width: 240px;
    height: 170px;
    max-width: 240px;
    display: inline-block;
    background-color: #fbfaf9;
    position: relative;
    border-radius: 4px;
    overflow: hidden;
    color: #62c94b;
    transition: all 0.2s ease;
    background: url(express-term-stars-gray-26e8b5a23b821c83b69dd7d009724206.png) no-repeat center;
    background-size: cover; }
    .express-subscription-chooser .express-option .express-check {
      background: url(express-check-gray-ff7eb97d049017608cee3affc31fcb00.png) no-repeat center;
      background-size: cover;
      width: 26px;
      height: 26px;
      position: absolute;
      top: 10px;
      right: 10px; }
    .express-subscription-chooser .express-option:not(.selected) {
      border-top: 1px solid #E5EDEC;
      border-bottom: 1px solid #E5EDEC;
      border-left: 1px solid #E5EDEC; }
      .express-subscription-chooser .express-option:not(.selected):last-child {
        border-right: 1px solid #E5EDEC; }
    .express-subscription-chooser .express-option:hover {
      cursor: pointer; }
    .express-subscription-chooser .express-option .option-title {
      text-align: center;
      color: #62c94b;
      font-size: 16px;
      margin-top: 50px; }
    .express-subscription-chooser .express-option .option-subtitle {
      margin-left: 5px; }
    .express-subscription-chooser .express-option .option-body-container {
      display: table;
      margin: 0 auto; }
      .express-subscription-chooser .express-option .option-body-container .option-price-container {
        display: table-cell;
        padding-right: 5px; }
        .express-subscription-chooser .express-option .option-body-container .option-price-container .option-price {
          font-size: 40px;
          font-weight: 900; }
  @media (max-width: 700px) {
    .express-subscription-chooser {
      margin: 0 auto;
      width: 260px; }
      .express-subscription-chooser .express-option-container {
        float: none;
        padding: 0 10px; }
        .express-subscription-chooser .express-option-container .express-option {
          width: 240px; }
        .express-subscription-chooser .express-option-container.selected .express-option {
          width: 260px;
          max-width: 260px; }
      .express-subscription-chooser .express-monthly-option {
        margin-top: -5px; } }

.rcp-gift-cards .disclaimer {
  margin-top: 10px; }

@media (min-width: 768px) and (max-width: 991px) {
  .rcp-gift-cards .card-column {
    padding: 0; } }

.rcp-gift-cards-form input, .rcp-gift-cards-form textarea {
  width: 100%;
  margin-bottom: 0; }

.rcp-gift-cards-form label {
  line-height: 3em; }

.rcp-gift-cards-form .field {
  padding-bottom: 15px; }

.rcp-gift-cards-form .submit-wrap {
  text-align: right;
  line-height: 2em; }
  .rcp-gift-cards-form .submit-wrap button {
    margin-left: 10px; }

.rcp-gift-cards-form .amount-select {
  width: 100%; }
  .rcp-gift-cards-form .amount-select a {
    display: block;
    line-height: 52px;
    width: 20%;
    padding: 0;
    text-align: center; }
    .rcp-gift-cards-form .amount-select a.custom-choice {
      width: 40%; }
    @media (max-width: 767px) {
      .rcp-gift-cards-form .amount-select a {
        font-size: 14px; } }

.rcp-gift-cards-form .error input {
  border: 1px solid #E8104A; }

.rcp-gift-cards-form .error .error-message {
  margin-top: 5px;
  color: #E8104A; }

.rcp-gift-cards-card-graphic {
  box-shadow: 2px 2px 10px #E1E1E1;
  border-radius: 5px;
  max-width: 300px;
  margin: auto; }
  .rcp-gift-cards-card-graphic .card-graphic .face {
    border-radius: 5px 5px 0 0;
    height: 140px;
    background: #aaea6e url(artwork-gift-card@3x-09f70f160a8e368aeb54237ca05a6a18.png) no-repeat center center;
    background-size: cover; }
  .rcp-gift-cards-card-graphic .card-graphic .baseline {
    position: relative;
    background-color: #FFF;
    border-radius: 0 0 5px 5px;
    line-height: 50px;
    height: 50px;
    font-size: 16px; }
    .rcp-gift-cards-card-graphic .card-graphic .baseline .logo {
      background-image: url(instacart-logo-color-ec528759d281bfc17858b166ae8e88e1.png);
      background-repeat: no-repeat;
      height: 20px;
      width: 100px;
      position: absolute;
      left: 15px;
      top: 15px;
      background-size: 100px 20px; }
      @media only screen and (-webkit-min-device-pixel-ratio: 1.3), only screen and (min--moz-device-pixel-ratio: 1.3), only screen and (-o-min-device-pixel-ratio: 1.3 / 1), only screen and (min-resolution: 125dpi), only screen and (min-resolution: 1.3dppx) {
        .rcp-gift-cards-card-graphic .card-graphic .baseline .logo {
          background-image: url(instacart-logo-color@2x-bc8a513eedacc7362ed66cedbff7c890.png);
          background-size: 100px 20px; } }
    .rcp-gift-cards-card-graphic .card-graphic .baseline .text {
      position: absolute;
      top: 0;
      left: 125px; }
    .rcp-gift-cards-card-graphic .card-graphic .baseline .amount {
      color: #43B02A;
      font-size: 16px;
      font-weight: bold;
      position: absolute;
      right: 15px;
      top: 0; }

.rcp-gift-cards-message-sample {
  margin-top: 20px; }
  .rcp-gift-cards-message-sample .gift-cards-message-sample {
    color: #939291;
    padding: 30px 20px;
    background-color: #FFF;
    border-radius: 5px;
    box-shadow: 2px 2px 10px #E1E1E1;
    max-width: 300px;
    margin: 0 auto; }
  .rcp-gift-cards-message-sample .message {
    text-align: center;
    word-break: break-all; }
  .rcp-gift-cards-message-sample .from {
    text-align: right;
    margin-top: 20px;
    font-style: italic; }

.rcp-gift-cards-success-modal {
  max-width: 600px;
  padding: 40px;
  margin: auto;
  text-align: center; }
  .rcp-gift-cards-success-modal h2 {
    margin-top: 40px; }
  .rcp-gift-cards-success-modal .cta-wrap {
    margin-top: 40px; }
    .rcp-gift-cards-success-modal .cta-wrap button {
      margin: 0 10px; }

.rcp-gift-cards-redemption-container {
  padding-top: 20px; }
  .rcp-gift-cards-redemption-container .rcp-gift-cards-redemption {
    margin: 0 auto;
    max-width: 700px;
    border-radius: 5px;
    background-color: #FFFFFF;
    border: 1px solid #e5edec;
    padding: 20px 30px; }
    .rcp-gift-cards-redemption-container .rcp-gift-cards-redemption p,
    .rcp-gift-cards-redemption-container .rcp-gift-cards-redemption h2,
    .rcp-gift-cards-redemption-container .rcp-gift-cards-redemption h3 {
      text-align: center; }
    .rcp-gift-cards-redemption-container .rcp-gift-cards-redemption h2 {
      font-weight: 700;
      margin-top: 30px; }
    .rcp-gift-cards-redemption-container .rcp-gift-cards-redemption .rcp-gift-card-redemption-error br {
      display: none; }
    .rcp-gift-cards-redemption-container .rcp-gift-cards-redemption p, .rcp-gift-cards-redemption-container .rcp-gift-cards-redemption .rcp-gift-card-redemption-error .muted {
      font-size: 16px;
      color: #939291; }
    .rcp-gift-cards-redemption-container .rcp-gift-cards-redemption .rcp-gift-cards-redemption-loading p {
      margin-top: 10px;
      margin-bottom: 0; }
    .rcp-gift-cards-redemption-container .rcp-gift-cards-redemption .error-message {
      color: #E8104A; }
    .rcp-gift-cards-redemption-container .rcp-gift-cards-redemption .spinner {
      background-color: #43B02A; }
    .rcp-gift-cards-redemption-container .rcp-gift-cards-redemption .rcp-gift-cards-redemption-shopping-button-container {
      text-align: center;
      padding-top: 20px; }
      .rcp-gift-cards-redemption-container .rcp-gift-cards-redemption .rcp-gift-cards-redemption-shopping-button-container a {
        width: 200px;
        height: 35px; }

.rcp-converted-users .progress-wrap {
  margin-bottom: 30px;
  margin-top: 10px; }

.rcp-converted-users .avatar-wrap {
  float: left;
  width: 20%;
  position: relative;
  color: #FFF; }
  .rcp-converted-users .avatar-wrap .avatar {
    height: 110px;
    width: 110px;
    margin: auto;
    border-radius: 110px;
    background-color: #E0E0E0;
    font-size: 38px;
    line-height: 110px;
    text-align: center;
    background-repeat: no-repeat;
    background-position: center center;
    background-size: cover; }
  .rcp-converted-users .avatar-wrap.converted .avatar {
    background-color: #43B02A; }
  @media (max-width: 768px) {
    .rcp-converted-users .avatar-wrap {
      float: none;
      width: auto; }
      .rcp-converted-users .avatar-wrap .avatar {
        margin-bottom: 15px; } }

.rcp-converted-users .avatar-wrap-v1 {
  margin: 10px 0px;
  float: left;
  width: 15%;
  position: relative;
  color: #FFF; }
  .rcp-converted-users .avatar-wrap-v1 .avatar {
    height: 60px;
    width: 60px;
    margin: auto;
    border-radius: 60px;
    background-color: #E0E0E0;
    font-size: 25px;
    line-height: 60px;
    text-align: center;
    background-repeat: no-repeat;
    background-position: center center;
    background-size: cover; }
  .rcp-converted-users .avatar-wrap-v1.converted .avatar {
    background-color: #43B02A; }
  @media (max-width: 768px) {
    .rcp-converted-users .avatar-wrap-v1 {
      float: none;
      width: auto; }
      .rcp-converted-users .avatar-wrap-v1 .avatar {
        margin-bottom: 15px; } }

.rcp-converted-users .email {
  margin-top: 15px;
  font-size: 14px; }

.rcp-converted-users .name {
  text-align: left;
  margin-top: 15px;
  font-size: 16px;
  font-weight: 600; }

.rcp-converted-users .resend {
  color: #43B02A;
  font-size: 14px;
  font-weight: 600;
  margin-top: 5px; }

.rcp-converted-users .message {
  color: #757575;
  width: 400px;
  text-align: left; }

.rcp-converted-users .status {
  color: #757575;
  font-style: italic;
  margin-top: 5px;
  padding-right: 16px; }

.rcp-converted-users .amount {
  margin-top: 20px;
  margin-right: 10px; }

.btn-load-more {
  width: 100% !important; }

#header {
  position: relative;
  /* ======= mobile header styles START ======= */
  /* ======= mobile header styles END ======= */ }
  #header ul.small-list {
    margin-left: 0px;
    font-size: 12px;
    text-align: center;
    padding: 0px !important; }
    #header ul.small-list.zone-info {
      color: #CFE5CD;
      text-align: left; }
    #header ul.small-list li {
      display: inline; }
      #header ul.small-list li:first-child:before {
        content: ' ';
        margin: 0px; }
      #header ul.small-list li:before {
        content: '\B7';
        margin: 0px 5px; }
      #header ul.small-list li:last-child {
        border: none; }
      #header ul.small-list li a {
        display: inline-block;
        padding: 0px;
        height: 12px;
        line-height: 12px;
        font-size: 12px;
        color: #6c6c6c; }
        #header ul.small-list li a:hover {
          color: #43B02A;
          background-color: #fff;
          text-decoration: underline; }
  #header .header-inner-wrapper.disable-hero-and-secondary-nav {
    margin-bottom: 0px !important; }
    #header .header-inner-wrapper.disable-hero-and-secondary-nav .header-primary-nav {
      box-shadow: 0px 1px 5px rgba(0, 0, 0, 0.16); }
    #header .header-inner-wrapper.disable-hero-and-secondary-nav .header-secondary-nav, #header .header-inner-wrapper.disable-hero-and-secondary-nav .header-secondary-nav-mobile {
      display: none; }
  #header .header-inner-wrapper.fixed .primary-nav-link:hover,
  #header .header-inner-wrapper.fixed .header-logo-color:hover {
    background-color: #f2f2f2; }
  #header .header-inner-wrapper.fixed .ic-btn--viewCart {
    box-shadow: none; }
  #header .header-inner-wrapper.fixed .header-secondary-nav-store-name {
    opacity: 1;
    pointer-events: auto; }
  #header .over-header {
    height: 70px;
    position: fixed;
    top: 0;
    left: 0;
    z-index: 1020;
    width: 100%; }
    #header .over-header a {
      width: 100%;
      height: 100%;
      display: block;
      cursor: pointer; }
    #header .over-header .close-ad {
      position: fixed;
      top: 16px;
      right: 10px; }
  #header .header-primary-nav {
    position: fixed;
    left: 0;
    top: 0;
    z-index: 1020;
    width: 100%;
    will-change: background-color; }
    #header .header-primary-nav .header-logo-inner-wrapper {
      height: 56px;
      width: 189px;
      position: relative; }
    #header .header-primary-nav .header-logo-white,
    #header .header-primary-nav .header-logo-color {
      width: 100%;
      height: 100%;
      display: inline-block;
      padding: 0 16px 0 24px;
      position: absolute;
      top: 0;
      left: 0;
      background-size: 149px 30px;
      background-repeat: no-repeat;
      background-position: 24px 12px;
      text-indent: 110%;
      opacity: 1;
      will-change: opacity; }
    #header .header-primary-nav .header-logo-white {
      background-image: url(instacart-logo-white-a053f69c06b841e7ab19ca43c84bf130.png); }
      @media only screen and (-webkit-min-device-pixel-ratio: 1.3), only screen and (min--moz-device-pixel-ratio: 1.3), only screen and (-o-min-device-pixel-ratio: 1.3 / 1), only screen and (min-resolution: 125dpi), only screen and (min-resolution: 1.3dppx) {
        #header .header-primary-nav .header-logo-white {
          background-image: url(instacart-logo-white@2x-1dc66270725da4dfd25a8ac34507c454.png);
          background-size: 149px 30px; } }
    #header .header-primary-nav .header-logo-color {
      background-image: url(instacart-logo-color-ec528759d281bfc17858b166ae8e88e1.png); }
      @media only screen and (-webkit-min-device-pixel-ratio: 1.3), only screen and (min--moz-device-pixel-ratio: 1.3), only screen and (-o-min-device-pixel-ratio: 1.3 / 1), only screen and (min-resolution: 125dpi), only screen and (min-resolution: 1.3dppx) {
        #header .header-primary-nav .header-logo-color {
          background-image: url(instacart-logo-color@2x-bc8a513eedacc7362ed66cedbff7c890.png);
          background-size: 149px 30px; } }
    #header .header-primary-nav .primary-nav-link-wrapper {
      display: inline-block; }
    #header .header-primary-nav .primary-nav-link {
      display: inline-block;
      font-size: 16px;
      font-weight: 600;
      will-change: color; }
      #header .header-primary-nav .primary-nav-link:hover, #header .header-primary-nav .primary-nav-link:focus {
        text-decoration: none; }
    #header .header-primary-nav .nav-dropdown .dropdown-menu {
      animation: fadeIn;
      animation-duration: .5s; }
    #header .header-primary-nav .nav-dropdown .dropdown-menu a:hover,
    #header .header-primary-nav .nav-dropdown .dropdown-menu a:focus {
      background-color: #f2f2f2; }
    #header .header-primary-nav .nav-dropdown .dropdown-menu .small-list a:hover,
    #header .header-primary-nav .nav-dropdown .dropdown-menu .small-list a:focus {
      background-color: #fff; }
    #header .header-primary-nav .nav-dropdown.account-dropdown .dropdown-menu li > a {
      color: #757575; }
    #header .header-primary-nav .ic-btn--viewCart {
      background-color: #43B02A;
      color: white;
      font-size: 16px;
      font-weight: 600;
      line-height: 22px;
      margin: 0 24px 0 16px;
      position: relative;
      width: 95px;
      height: 36px;
      vertical-align: inherit;
      box-shadow: 0px 0px 0px 1px rgba(0, 0, 0, 0.16); }
      #header .header-primary-nav .ic-btn--viewCart .ic-icon {
        font-weight: bold;
        vertical-align: middle;
        display: inline-block;
        width: 22px; }
      #header .header-primary-nav .ic-btn--viewCart .ic-icon-cart {
        font-size: 22px;
        line-height: 22px;
        margin: -3px 7px auto -3px; }
      #header .header-primary-nav .ic-btn--viewCart .ic-icon-x {
        font-size: 16px;
        line-height: 22px;
        margin: -2px 5px auto -2px; }
      #header .header-primary-nav .ic-btn--viewCart .cart-qty-badge {
        background-color: #E8104A;
        color: #fff;
        line-height: 26px;
        position: absolute;
        right: -10px;
        top: -8px;
        width: 26px;
        height: 26px;
        border-radius: 50%; }
        #header .header-primary-nav .ic-btn--viewCart .cart-qty-badge.plus-100 {
          font-size: 12px; }
  #header .primary-nav-search-bar {
    position: relative;
    border-radius: 4px;
    border: 1px solid #e0e0e0; }
    #header .primary-nav-search-bar.hide-input {
      pointer-events: none; }
    #header .primary-nav-search-bar input[type="search"] {
      -webkit-box-sizing: border-box;
      -moz-box-sizing: border-box;
      box-sizing: border-box;
      box-shadow: none;
      width: 100%;
      height: 36px;
      padding: 0 10px;
      margin-bottom: 0px;
      background-position: left 14px center;
      background-color: #f7f7f7;
      font-size: 16px;
      font-weight: normal;
      line-height: 22px;
      color: #393939;
      border: none; }
    #header .primary-nav-search-bar .search-btn {
      position: absolute;
      right: 0px;
      top: 0;
      height: 100%;
      width: 50px;
      border-top-right-radius: 5px;
      border-bottom-right-radius: 5px;
      border: 0;
      border-left: 1px solid #e0e0e0;
      -webkit-appearance: none;
      background-color: white;
      background-repeat: no-repeat;
      color: #43B02A;
      padding: 0;
      margin: 0; }
      #header .primary-nav-search-bar .search-btn:hover {
        background-color: #f2f2f2; }
      #header .primary-nav-search-bar .search-btn:before {
        top: 2px;
        position: relative; }
  #header .header-hero {
    height: 325px;
    position: relative;
    z-index: 1010;
    will-change: height;
    -webkit-backface-visibility: hidden;
    backface-visibility: hidden;
    -webkit-transform: translateZ(0);
    -moz-transform: translateZ(0);
    -ms-transform: translateZ(0);
    -o-transform: translateZ(0);
    transform: translateZ(0); }
    #header .header-hero.closing {
      overflow: hidden; }
    #header .header-hero.closed {
      display: none; }
    #header .header-hero.retailer-loading h1,
    #header .header-hero.retailer-loading .header-hero-price-transparency,
    #header .header-hero.retailer-loading .primary-nav-search-bar input {
      animation-duration: 6s;
      animation-fill-mode: forwards;
      animation-iteration-count: infinite;
      animation-name: skeleton-item-loading;
      animation-timing-function: linear;
      background: #f6f7f8;
      background: linear-gradient(to right, #eeeeee 8%, #dddddd 18%, #eeeeee 33%);
      position: relative; }
    #header .header-hero.retailer-loading h1 {
      height: 20px;
      width: 300px;
      margin: 32px auto 12px;
      background-color: #DFDFDF;
      color: transparent; }
    #header .header-hero.retailer-loading .header-hero-logo img {
      background-color: #DFDFDF; }
    #header .header-hero .header-hero-image-wrapper {
      width: 100%;
      height: 100%;
      position: absolute;
      left: 0;
      top: 0;
      z-index: 1; }
    #header .header-hero .header-hero-image-overlay {
      position: absolute;
      left: 0;
      top: 0;
      width: 100%;
      height: 100%;
      background-color: rgba(0, 0, 0, 0.2);
      z-index: 100; }
      #header .header-hero .header-hero-image-overlay.no-hero-image {
        background-color: rgba(0, 0, 0, 0); }
      #header .header-hero .header-hero-image-overlay.active {
        -webkit-transition: background-color 0.5s;
        -moz-transition: background-color 0.5s;
        transition: background-color 0.5s;
        background-color: rgba(0, 0, 0, 0.6); }
    #header .header-hero .header-hero-image {
      position: absolute;
      left: 0;
      top: 0;
      background-size: cover;
      background-repeat: no-repeat;
      background-position-x: center;
      width: 100%;
      height: 100%;
      will-change: background-position-y;
      -webkit-backface-visibility: hidden;
      backface-visibility: hidden;
      -webkit-transform: translateZ(0);
      -moz-transform: translateZ(0);
      -ms-transform: translateZ(0);
      -o-transform: translateZ(0);
      transform: translateZ(0); }
      @media (max-width: 991px) {
        #header .header-hero .header-hero-image {
          background-size: 120%; } }
    #header .header-hero .header-hero-inner-wrapper {
      padding-top: 24px;
      position: relative;
      z-index: 10;
      will-change: opacity;
      -webkit-transform: translateZ(0);
      -moz-transform: translateZ(0);
      -ms-transform: translateZ(0);
      -o-transform: translateZ(0);
      transform: translateZ(0);
      -webkit-backface-visibility: hidden;
      backface-visibility: hidden; }
      #header .header-hero .header-hero-inner-wrapper .primary-nav-search-bar {
        border: 0; }
        #header .header-hero .header-hero-inner-wrapper .primary-nav-search-bar input[type="search"] {
          box-shadow: 0px 0px 0px 1px rgba(0, 0, 0, 0.16); }
      @media screen and (max-width: 1040px) {
        #header .header-hero .header-hero-inner-wrapper {
          padding-top: 68px; } }
    #header .header-hero .header-hero-logo {
      width: 156px;
      height: 156px;
      margin: 0 auto;
      position: relative; }
      #header .header-hero .header-hero-logo img {
        height: 100%;
        width: 100%;
        display: block;
        position: relative;
        z-index: 5;
        -webkit-background-clip: padding-box;
        -moz-background-clip: padding;
        background-clip: padding-box;
        border-radius: 50%;
        overflow: hidden;
        box-shadow: 0px 0px 0px 1px rgba(0, 0, 0, 0.16);
        text-align: center;
        line-height: 156px; }
      #header .header-hero .header-hero-logo .logo-background {
        height: 99%;
        width: 99%;
        border-radius: 50%;
        overflow: hidden;
        background-color: #fff;
        position: absolute;
        top: 1px;
        left: 1px;
        -webkit-background-clip: padding-box;
        -moz-background-clip: padding;
        background-clip: padding-box; }
    #header .header-hero h1 {
      margin: 16px 0 0;
      font-size: 28px;
      font-weight: bold;
      color: #fff;
      line-height: 38px;
      text-align: center; }
    #header .header-hero .header-hero-price-transparency {
      color: #fff;
      font-size: 14px;
      font-weight: 600;
      line-height: 20px; }
      #header .header-hero .header-hero-price-transparency a {
        color: #fff; }
        #header .header-hero .header-hero-price-transparency a.header-hero-price-transparency-pricing-link {
          text-decoration: none; }
          #header .header-hero .header-hero-price-transparency a.header-hero-price-transparency-pricing-link:hover {
            text-decoration: underline; }
      #header .header-hero .header-hero-price-transparency:before {
        display: inline-block;
        height: 16px;
        width: 16px;
        border-radius: 50%;
        line-height: 16px;
        margin-right: 6px;
        font-family: 'ic-icons';
        -webkit-font-smoothing: antialiased;
        -moz-osx-font-smoothing: grayscale;
        vertical-align: middle; }
    #header .header-hero .primary-nav-search-bar {
      max-width: 700px;
      margin: 0 auto;
      display: block; }
    @media screen and (max-width: 1040px) {
      #header .header-hero h1 {
        display: none; }
      #header .header-hero .header-hero-logo {
        width: 96px;
        height: 96px; }
      #header .header-hero .primary-nav-search-bar {
        max-width: calc(100% - 16px); } }
  #header .header-secondary-nav {
    height: 56px;
    background-color: #fff;
    width: 100%;
    z-index: 1000;
    border-bottom: 1px solid #e5edec;
    position: relative;
    will-change: position; }
    #header .header-secondary-nav .navigation-tabs-inner-wrapper {
      display: inline-block; }
    #header .header-secondary-nav.fixed {
      position: fixed;
      box-shadow: 0px 1px 5px rgba(0, 0, 0, 0.16);
      -webkit-transition: box-shadow 200ms linear;
      -moz-transition: box-shadow 200ms linear;
      transition: box-shadow 200ms linear; }
    @media (max-width: 991px) {
      #header .header-secondary-nav {
        display: none; } }
  #header .header-secondary-nav-inner-wrapper {
    height: 100%; }
  #header .header-secondary-nav-store-name {
    display: inline-block;
    position: absolute;
    top: 0;
    left: 0;
    padding: 8px 24px;
    opacity: 0;
    will-change: opacity;
    -webkit-transition: opacity 200ms linear;
    -moz-transition: opacity 200ms linear;
    transition: opacity 200ms linear;
    pointer-events: none; }
    #header .header-secondary-nav-store-name:hover {
      background-color: #f2f2f2; }
    #header .header-secondary-nav-store-name p {
      color: #747474;
      font-size: 16px;
      font-weight: 600;
      line-height: 40px;
      margin: 0; }
    #header .header-secondary-nav-store-name .header-secondary-nav-logo-wrapper {
      width: 40px;
      height: 40px;
      margin-right: 12px; }
      #header .header-secondary-nav-store-name .header-secondary-nav-logo-wrapper img {
        border-radius: 50%;
        display: block;
        overflow: hidden; }
  #header .availability-link {
    position: absolute;
    right: 24px;
    top: 15px;
    font-size: 16px;
    font-weight: 600;
    opacity: 0;
    -webkit-transition: opacity 200ms linear;
    -moz-transition: opacity 200ms linear;
    transition: opacity 200ms linear; }
    #header .availability-link.loading {
      opacity: 0;
      pointer-events: none; }
    #header .availability-link.loaded {
      opacity: 1; }
    #header .availability-link a {
      color: #747474; }
      #header .availability-link a:hover, #header .availability-link a:active, #header .availability-link a:focus {
        text-decoration: none; }
    #header .availability-link strong {
      color: #43B02A;
      font-weight: 600; }
    #header .availability-link .ic-icon {
      vertical-align: middle;
      font-size: 18px; }
    #header .availability-link .ic-icon-arrow-right-small {
      margin-right: 0; }
    @media (min-width: 768px) and (max-width: 991px) {
      #header .availability-link {
        display: none; } }
  #header .retailer-chooser {
    width: 70vw;
    max-width: 920px;
    position: fixed;
    left: 10px;
    z-index: 1020;
    border-radius: 4px;
    margin: 0; }
    #header .retailer-chooser:focus {
      outline: none; }
    #header .retailer-chooser .retailer-chooser-arrow {
      display: block; }
    #header .retailer-chooser .retailer-chooser-retailer-option-list-wrapper {
      overflow-y: auto;
      border-bottom-right-radius: 4px;
      border-bottom-left-radius: 4px; }
    @media (max-width: 991px) {
      #header .retailer-chooser {
        width: 100vw;
        left: 0; }
        #header .retailer-chooser .retailer-chooser-arrow {
          display: none; } }
  #header .retailer-chooser.old {
    width: 100%;
    max-width: none;
    max-height: 90vh;
    overflow-y: auto;
    position: fixed;
    top: 56px;
    left: 0;
    z-index: 1020;
    border-radius: 0px; }
  #header .header-departments-menu {
    position: fixed;
    height: 100%;
    background: #fff;
    top: 0;
    left: 0;
    z-index: 1020;
    width: 326px;
    padding: 0;
    color: #6c6c6c;
    -webkit-transform: translateZ(0) translateX(-100%);
    -moz-transform: translateZ(0) translateX(-100%);
    -ms-transform: translateZ(0) translateX(-100%);
    -o-transform: translateZ(0) translateX(-100%);
    transform: translateZ(0) translateX(-100%);
    -webkit-transition: -webkit-transform 200ms ease-in-out;
    -moz-transition: -moz-transform 200ms ease-in-out;
    transition: transform 200ms ease-in-out;
    will-change: translateX; }
    #header .header-departments-menu.open {
      -webkit-transform: translateZ(0) translateX(0);
      -moz-transform: translateZ(0) translateX(0);
      -ms-transform: translateZ(0) translateX(0);
      -o-transform: translateZ(0) translateX(0);
      transform: translateZ(0) translateX(0); }
    #header .header-departments-menu button.ic-icon-x {
      position: absolute;
      right: 10px;
      top: 15px;
      background: none;
      border: 0;
      color: #6c6c6c;
      margin-right: 0; }
      #header .header-departments-menu button.ic-icon-x:hover {
        cursor: pointer;
        color: #5f5f5f; }
    #header .header-departments-menu h2,
    #header .header-departments-menu h2 > a {
      height: 56px;
      padding: 0px 20px;
      margin: 0;
      font-size: 20px;
      font-weight: normal;
      color: #757575;
      line-height: 56px;
      overflow: hidden;
      text-overflow: ellipsis;
      white-space: nowrap;
      border-bottom: 1px solid #e3e2df; }
    #header .header-departments-menu h2 > a {
      color: #43B02A; }
  #header .departments-menu-lists-wrapper {
    overflow-y: auto; }
  #header .department-menu-list .ic-loading {
    margin-top: 100px; }
    #header .department-menu-list .ic-loading .ic-spinner {
      width: 50px;
      height: 50px; }
  #header .department-menu-featured-list {
    padding: 10px 0px;
    border-bottom: 1px solid #e3e2df; }
  #header .department-menu-list {
    padding-bottom: 30px; }
  #header .departments-menu-featured-item,
  #header .departments-menu-item {
    position: static;
    width: 100%; }
    #header .departments-menu-featured-item:hover,
    #header .departments-menu-featured-item a:hover,
    #header .departments-menu-item:hover,
    #header .departments-menu-item a:hover {
      color: #fff;
      background-color: #43B02A;
      text-decoration: none;
      cursor: pointer; }
    #header .departments-menu-featured-item:hover > a,
    #header .departments-menu-item:hover > a {
      color: #fff; }
    #header .departments-menu-featured-item a,
    #header .departments-menu-item a {
      width: 100%;
      height: 100%;
      display: block;
      padding: 10px 20px;
      text-decoration: none;
      font-size: 16px;
      font-weight: normal;
      line-height: 20px;
      white-space: nowrap; }
  #header .departments-menu-featured-item a {
    color: #43B02A; }
  #header .departments-menu-item a {
    color: #6c6c6c; }
  #header .departments-menu-item .ic-icon-arrow-right-small {
    float: right;
    right: -10px; }
  #header .departments-menu-aisle-flyout {
    position: absolute;
    left: 306px;
    z-index: 10;
    background: #fff;
    box-shadow: 0px 3px 10px 0px rgba(0, 0, 0, 0.23), 0px 3px 10px 0px rgba(0, 0, 0, 0.16); }
    #header .departments-menu-aisle-flyout > h2 {
      padding: 0; }
    #header .departments-menu-aisle-flyout ul.two-cols {
      -webkit-columns: 2;
      -moz-columns: 2;
      columns: 2; }
      #header .departments-menu-aisle-flyout ul.two-cols > li > a {
        -webkit-column-break-inside: avoid;
        -webkit-margin-bottom-collapse: collapse; }
  @media screen and (max-width: 992px) {
    #header .availability-link {
      right: 10px; }
      #header .availability-link a {
        font-size: 14px; }
    #header .header-secondary-nav-store-name {
      padding: 12px 24px; }
      #header .header-secondary-nav-store-name p {
        font-size: 14px;
        line-height: 30px; }
      #header .header-secondary-nav-store-name .header-secondary-nav-logo-wrapper {
        width: 30px;
        height: 30px; } }
  @media screen and (max-height: 768px) and (min-width: 991px) {
    #header .header-hero {
      height: 215px; }
      #header .header-hero h1 {
        margin: 0; }
      #header .header-hero.retailer-loading h1 {
        margin-top: 10px; }
      #header .header-hero .header-hero-inner-wrapper {
        padding-top: 8px; }
      #header .header-hero .header-hero-logo {
        width: 96px;
        height: 96px; }
        #header .header-hero .header-hero-logo .logo-background {
          width: 98%;
          height: 98%; }
      #header .header-hero .header-hero-price-transparency {
        margin-bottom: 8px; } }
  #header .header-inner-wrapper.over-header-showing .header-primary-nav-mobile {
    top: 70px; }
  #header .header-inner-wrapper.over-header-showing .header-secondary-nav-mobile.fixed {
    top: 126px; }
  #header .header-primary-nav-mobile {
    display: none;
    height: 56px;
    position: fixed;
    left: 0;
    top: 0;
    z-index: 1020;
    width: 100%; }
    #header .header-primary-nav-mobile .ic-icon {
      font-size: 26px;
      line-height: 56px; }
    #header .header-primary-nav-mobile .primary-nav-mobile-account-link,
    #header .header-primary-nav-mobile .primary-nav-mobile-store-chooser-wrapper,
    #header .header-primary-nav-mobile .primary-nav-mobile-cart-btn {
      display: table-cell;
      vertical-align: middle; }
      #header .header-primary-nav-mobile .primary-nav-mobile-account-link > a:hover, #header .header-primary-nav-mobile .primary-nav-mobile-account-link > a:active, #header .header-primary-nav-mobile .primary-nav-mobile-account-link > a:focus,
      #header .header-primary-nav-mobile .primary-nav-mobile-store-chooser-wrapper > a:hover,
      #header .header-primary-nav-mobile .primary-nav-mobile-store-chooser-wrapper > a:active,
      #header .header-primary-nav-mobile .primary-nav-mobile-store-chooser-wrapper > a:focus,
      #header .header-primary-nav-mobile .primary-nav-mobile-cart-btn > a:hover,
      #header .header-primary-nav-mobile .primary-nav-mobile-cart-btn > a:active,
      #header .header-primary-nav-mobile .primary-nav-mobile-cart-btn > a:focus {
        text-decoration: none; }
    #header .header-primary-nav-mobile .primary-nav-mobile-account-link {
      text-align: left; }
      #header .header-primary-nav-mobile .primary-nav-mobile-account-link a {
        display: inline-block;
        width: 100%;
        height: 100%;
        padding-left: 8px; }
    #header .header-primary-nav-mobile .primary-nav-mobile-cart-btn {
      text-align: right; }
      #header .header-primary-nav-mobile .primary-nav-mobile-cart-btn .cart-qty-badge {
        background-color: #E8104A;
        color: #fff;
        line-height: 18px;
        position: absolute;
        right: 5px;
        top: 4px;
        width: 20px;
        height: 20px;
        border-radius: 50%;
        text-align: center;
        font-weight: 700;
        font-size: 13px; }
      #header .header-primary-nav-mobile .primary-nav-mobile-cart-btn a {
        width: 100%;
        height: 100%;
        display: inline-block;
        padding-right: 8px; }
    #header .header-primary-nav-mobile .primary-nav-mobile-store-chooser-wrapper {
      text-align: center; }
      #header .header-primary-nav-mobile .primary-nav-mobile-store-chooser-wrapper .primary-nav-link p {
        margin: 0; }
      #header .header-primary-nav-mobile .primary-nav-mobile-store-chooser-wrapper .primary-nav-link .mobile-store-chooser-store-name {
        font-size: 16px;
        padding-left: 16px;
        font-weight: 600; }
        #header .header-primary-nav-mobile .primary-nav-mobile-store-chooser-wrapper .primary-nav-link .mobile-store-chooser-store-name .ic-icon {
          display: inline-block;
          font-size: 18px;
          top: 2px;
          margin-left: 4px;
          line-height: initial; }
      #header .header-primary-nav-mobile .primary-nav-mobile-store-chooser-wrapper .primary-nav-link .mobile-store-chooser-zip {
        font-size: 11px; }
      #header .header-primary-nav-mobile .primary-nav-mobile-store-chooser-wrapper .primary-nav-link .ic-icon-arrow-down-small-bold {
        -webkit-transition: -webkit-transform 0.5s;
        -moz-transition: -moz-transform 0.5s;
        transition: transform 0.5s; }
      #header .header-primary-nav-mobile .primary-nav-mobile-store-chooser-wrapper .primary-nav-link:focus, #header .header-primary-nav-mobile .primary-nav-mobile-store-chooser-wrapper .primary-nav-link:hover {
        text-decoration: none; }
      #header .header-primary-nav-mobile .primary-nav-mobile-store-chooser-wrapper .primary-nav-link.active .ic-icon-arrow-down-small-bold {
        -webkit-transform: translateY(-3px) rotate(180deg);
        -moz-transform: translateY(-3px) rotate(180deg);
        -ms-transform: translateY(-3px) rotate(180deg);
        -o-transform: translateY(-3px) rotate(180deg);
        transform: translateY(-3px) rotate(180deg); }
      #header .header-primary-nav-mobile .primary-nav-mobile-store-chooser-wrapper .primary-nav-link.disabled .ic-icon-arrow-down-small-bold {
        display: none; }
      #header .header-primary-nav-mobile .primary-nav-mobile-store-chooser-wrapper .primary-nav-link.disabled .mobile-store-chooser-store-name {
        padding-left: 0; }
    @media screen and (max-width: 1040px) {
      #header .header-primary-nav-mobile {
        display: table; } }
  #header .header-secondary-nav-mobile {
    display: none;
    height: 56px;
    width: 100%;
    background-color: #fff;
    border-bottom: 1px solid #e5edec;
    z-index: 1010;
    -webkit-transform: translate3d(0, 0, 0);
    -moz-transform: translate3d(0, 0, 0);
    -ms-transform: translate3d(0, 0, 0);
    -o-transform: translate3d(0, 0, 0);
    transform: translate3d(0, 0, 0); }
    #header .header-secondary-nav-mobile.fixed {
      position: fixed;
      top: 56px;
      box-shadow: 0px 1px 5px rgba(0, 0, 0, 0.16);
      -webkit-transition: box-shadow 200ms linear;
      -moz-transition: box-shadow 200ms linear;
      transition: box-shadow 200ms linear; }
    @media screen and (max-width: 1040px) {
      #header .header-secondary-nav-mobile {
        display: block; } }
  #header .mobile-nav-tabs {
    height: 100%;
    margin: 0; }
    #header .mobile-nav-tabs .mobile-nav-tab {
      display: inline-block;
      float: left;
      height: 100%;
      text-align: center;
      color: #757575;
      font-size: 11px; }
      #header .mobile-nav-tabs .mobile-nav-tab > a {
        display: block;
        width: 100%;
        height: 100%;
        padding-top: 5px;
        color: #757575;
        font-weight: bold;
        -webkit-transition: color 200ms linear;
        -moz-transition: color 200ms linear;
        transition: color 200ms linear; }
        #header .mobile-nav-tabs .mobile-nav-tab > a:hover, #header .mobile-nav-tabs .mobile-nav-tab > a:active {
          text-decoration: none; }
        #header .mobile-nav-tabs .mobile-nav-tab > a.action-active {
          color: #43B02A; }
          #header .mobile-nav-tabs .mobile-nav-tab > a.action-active .ic-icon.active {
            display: block; }
          #header .mobile-nav-tabs .mobile-nav-tab > a.action-active .ic-icon.inactive {
            display: none; }
      #header .mobile-nav-tabs .mobile-nav-tab .ic-icon {
        display: block;
        margin: 0 0 3px 0;
        font-size: 28px; }
        #header .mobile-nav-tabs .mobile-nav-tab .ic-icon.active {
          display: none; }

#quick-search {
  background-color: #fff;
  padding: 8px;
  border-bottom: 1px solid #e5edec;
  position: relative;
  z-index: 1010; }
  #quick-search .quicksearch-search-bar {
    position: relative;
    border-radius: 4px;
    border: 1px solid #e0e0e0; }
    #quick-search .quicksearch-search-bar.hide-input {
      pointer-events: none; }
    #quick-search .quicksearch-search-bar input[type="search"] {
      -webkit-box-sizing: border-box;
      -moz-box-sizing: border-box;
      box-sizing: border-box;
      box-shadow: none;
      width: 100%;
      height: 36px;
      padding: 0 10px;
      margin-bottom: 0px;
      background-position: left 14px center;
      background-color: #f7f7f7;
      font-size: 16px;
      font-weight: normal;
      line-height: 22px;
      border: none; }
    #quick-search .quicksearch-search-bar .search-btn {
      position: absolute;
      right: 0px;
      top: 0;
      height: 100%;
      width: 50px;
      border-top-right-radius: 5px;
      border-bottom-right-radius: 5px;
      border: 0;
      border-left: 1px solid #e0e0e0;
      -webkit-appearance: none;
      background-color: white;
      background-repeat: no-repeat;
      color: #43B02A;
      padding: 0;
      margin: 0; }
      #quick-search .quicksearch-search-bar .search-btn:hover {
        background-color: #f2f2f2; }
      #quick-search .quicksearch-search-bar .search-btn:before {
        top: 2px;
        position: relative;
        font-size: 20px; }

/* high-contrast-mode */
.high-contrast-mode #header .header-hero .header-hero-image-overlay {
  background-color: rgba(0, 0, 0, 0.85); }

.high-contrast-mode #header .header-primary-nav .ic-btn--viewCart {
  border: 1px solid #fff; }

.HowItWorksComponent .next-tab-btn-container {
  max-width: 960px;
  margin: 20px auto 50px;
  text-align: right; }
  .HowItWorksComponent .next-tab-btn-container a.next-tab-link {
    display: block;
    font-size: 18px;
    font-weight: 600; }
    .HowItWorksComponent .next-tab-btn-container a.next-tab-link:hover {
      text-decoration: none; }

.HowItWorksComponent .how-it-works-pricing .how-it-works-block .hero-image {
  max-width: 150px; }

.HowItWorksComponent .how-it-works-block {
  padding: 40px 70px;
  box-sizing: border-box;
  border: 1px solid #ddd;
  margin: 20px auto;
  background: white;
  border-radius: 5px;
  text-align: center;
  font-size: 14px;
  max-width: 960px; }
  .HowItWorksComponent .how-it-works-block h2 {
    font-weight: bold; }
  .HowItWorksComponent .how-it-works-block h3 {
    line-height: 1.35em;
    font-size: 20px;
    font-weight: 600; }
  .HowItWorksComponent .how-it-works-block h4 {
    font-weight: 500; }
  .HowItWorksComponent .how-it-works-block > p,
  .HowItWorksComponent .how-it-works-block .how-it-works-container p {
    font-size: 20px;
    margin: 20px 0;
    line-height: 1.6em;
    color: #8e8e8e; }
  .HowItWorksComponent .how-it-works-block .how-it-works-step p {
    font-size: 18px;
    line-height: 1.6em;
    color: #8e8e8e; }
  .HowItWorksComponent .how-it-works-block .greenPricing {
    color: #43B02A !important; }
    .HowItWorksComponent .how-it-works-block .greenPricing.bold {
      font-weight: bold; }
  .HowItWorksComponent .how-it-works-block hr {
    margin: 20px 0; }
  .HowItWorksComponent .how-it-works-block .busy {
    text-transform: uppercase;
    color: white;
    background-color: #F5A623;
    padding: 2px 7px;
    margin: 0 2px;
    border-radius: 20px;
    font-size: 10px; }
  .HowItWorksComponent .how-it-works-block.no-bg {
    border: none;
    background-color: transparent;
    padding: 20px 0;
    max-width: 960px; }
  .HowItWorksComponent .how-it-works-block.full-header {
    padding: 0;
    max-width: 960px; }
    .HowItWorksComponent .how-it-works-block.full-header .how-it-works-container {
      padding: 40px 100px; }
    .HowItWorksComponent .how-it-works-block.full-header .hero-image {
      max-width: 100%; }
  .HowItWorksComponent .how-it-works-block.green-bg {
    background-color: #43B02A;
    color: white; }
    .HowItWorksComponent .how-it-works-block.green-bg p {
      color: white; }
  .HowItWorksComponent .how-it-works-block .hero-image {
    display: block;
    margin: 0 auto 20px;
    max-width: 200px; }
  .HowItWorksComponent .how-it-works-block .pricing-structure {
    margin: 20px 0;
    width: 100%;
    border-collapse: collapse;
    border: 1px solid white; }
    .HowItWorksComponent .how-it-works-block .pricing-structure th, .HowItWorksComponent .how-it-works-block .pricing-structure td {
      border: 1px solid white;
      padding: 10px; }
    .HowItWorksComponent .how-it-works-block .pricing-structure th, .HowItWorksComponent .how-it-works-block .pricing-structure td:first-child {
      font-weight: normal;
      color: #6c6c6c;
      background-color: #fcfcfc;
      text-align: center; }

.HowItWorksComponent .how-it-works-steps {
  text-align: left; }
  .HowItWorksComponent .how-it-works-steps .how-it-works-step {
    margin-bottom: 20px; }
    .HowItWorksComponent .how-it-works-steps .how-it-works-step p {
      margin-top: 0; }
    .HowItWorksComponent .how-it-works-steps .how-it-works-step h4 {
      margin: 20px 0 5px;
      color: #222; }
    .HowItWorksComponent .how-it-works-steps .how-it-works-step img {
      float: left;
      width: 250px;
      min-height: 172px;
      margin: 10px 70px 15px 0; }

@media (max-width: 998px) {
  ul.store-prices.retailer-cards-list {
    width: 658px;
    margin: 20px auto; } }

@media (max-width: 770px) {
  .HowItWorksComponent h1 {
    font-size: 36px; }
  .HowItWorksComponent .how-it-works-details .how-it-works-block {
    padding: 20px 30px; }
    .HowItWorksComponent .how-it-works-details .how-it-works-block .hero-image {
      height: 150px; }
    .HowItWorksComponent .how-it-works-details .how-it-works-block h2 {
      font-size: 24px;
      line-height: 1.35em; }
    .HowItWorksComponent .how-it-works-details .how-it-works-block h3 {
      font-size: 18px; }
    .HowItWorksComponent .how-it-works-details .how-it-works-block h4 {
      font-size: 12px; }
    .HowItWorksComponent .how-it-works-details .how-it-works-block > p, .HowItWorksComponent .how-it-works-details .how-it-works-block .how-it-works-container p {
      font-size: 16px; }
    .HowItWorksComponent .how-it-works-details .how-it-works-block .how-it-works-step p {
      font-size: 16px; }
    .HowItWorksComponent .how-it-works-details .how-it-works-block.full-header {
      padding: 0; }
      .HowItWorksComponent .how-it-works-details .how-it-works-block.full-header .hero-image {
        max-width: 100%;
        height: auto; }
      .HowItWorksComponent .how-it-works-details .how-it-works-block.full-header .how-it-works-container {
        padding: 0 20px; }
  .HowItWorksComponent .how-it-works-details .how-it-works-steps .how-it-works-step img {
    margin: 10px 30px 10px 0; }
  .HowItWorksComponent .next-tab-btn-container a.next-tab-link {
    font-size: 15px; } }

@media (max-width: 640px) {
  .HowItWorksComponent .how-it-works-details .how-it-works-steps .how-it-works-step {
    margin-bottom: 10px; }
    .HowItWorksComponent .how-it-works-details .how-it-works-steps .how-it-works-step img {
      float: none;
      display: block;
      margin: 20px auto 10px;
      min-height: 90px; }
  ul.store-prices.retailer-cards-list {
    width: 100%; }
    ul.store-prices.retailer-cards-list li.retailer-card {
      display: block;
      float: none;
      width: 100%;
      margin: 15px 0;
      line-height: 0; }
      ul.store-prices.retailer-cards-list li.retailer-card .card-header {
        display: inline-block;
        width: 50%;
        height: 95px;
        -moz-border-radius-topleft: 4px !important;
        -moz-border-radius-topright: 0 !important;
        -moz-border-radius-bottomright: 0 !important;
        -moz-border-radius-bottomleft: 4px !important;
        -webkit-border-top-left-radius: 4px !important;
        -webkit-border-top-right-radius: 0 !important;
        -webkit-border-bottom-right-radius: 0 !important;
        -webkit-border-bottom-left-radius: 4px !important;
        border-top-left-radius: 4px !important;
        border-top-right-radius: 0 !important;
        border-bottom-right-radius: 0 !important;
        border-bottom-left-radius: 4px !important; }
        ul.store-prices.retailer-cards-list li.retailer-card .card-header .logo {
          width: 70%;
          max-height: 70px;
          margin: 5px auto; }
      ul.store-prices.retailer-cards-list li.retailer-card .card-body {
        float: right;
        width: 50%;
        padding-top: 20px;
        box-sizing: border-box; } }

@media (max-width: 480px) {
  .HowItWorksComponent .navigation-pills a {
    font-size: 12px; }
  .HowItWorksComponent .how-it-works-details {
    margin-right: 10px; }
    .HowItWorksComponent .how-it-works-details .how-it-works-block {
      padding: 20px 30px; }
      .HowItWorksComponent .how-it-works-details .how-it-works-block .hero-image {
        height: 125px; }
      .HowItWorksComponent .how-it-works-details .how-it-works-block h2 {
        font-size: 18px; }
      .HowItWorksComponent .how-it-works-details .how-it-works-block h3 {
        font-size: 15px; }
      .HowItWorksComponent .how-it-works-details .how-it-works-block h4 {
        font-size: 12px; }
      .HowItWorksComponent .how-it-works-details .how-it-works-block > p, .HowItWorksComponent .how-it-works-details .how-it-works-block .how-it-works-container p {
        font-size: 16px; }
      .HowItWorksComponent .how-it-works-details .how-it-works-block .how-it-works-step p {
        font-size: 16px; }
      .HowItWorksComponent .how-it-works-details .how-it-works-block.full-header {
        padding: 0; }
        .HowItWorksComponent .how-it-works-details .how-it-works-block.full-header .hero-image {
          max-width: 100%;
          height: auto; }
        .HowItWorksComponent .how-it-works-details .how-it-works-block.full-header .how-it-works-container {
          padding: 0 20px; }
  .HowItWorksComponent .next-tab-btn-container a.next-tab-link {
    font-size: 13px; }
  ul.store-prices.retailer-cards-list li.retailer-card .card-body {
    padding-top: 0; }
    ul.store-prices.retailer-cards-list li.retailer-card .card-body .prices {
      font-size: 15px; }
    ul.store-prices.retailer-cards-list li.retailer-card .card-body p {
      font-size: 13px;
      line-height: 1.2em; } }

@media (max-width: 375px) {
  .HowItWorksComponent h1 {
    font-size: 24px; }
  .HowItWorksComponent .how-it-works-details {
    margin-right: 10px; }
    .HowItWorksComponent .how-it-works-details .how-it-works-block {
      padding: 20px; }
      .HowItWorksComponent .how-it-works-details .how-it-works-block .hero-image {
        height: 100px; }
      .HowItWorksComponent .how-it-works-details .how-it-works-block > p, .HowItWorksComponent .how-it-works-details .how-it-works-block .how-it-works-container p {
        font-size: 14px; }
      .HowItWorksComponent .how-it-works-details .how-it-works-block .how-it-works-step p {
        font-size: 13px; } }

.ic-image-zoomer {
  position: relative;
  overflow: hidden; }

.item-card {
  display: inline-block;
  width: 208px;
  vertical-align: top;
  background: #fff;
  text-align: left;
  color: #5a5a5a;
  font-weight: 400;
  cursor: pointer;
  white-space: initial;
  opacity: 1;
  -webkit-transition: opacity 400ms ease-in-out;
  -moz-transition: opacity 400ms ease-in-out;
  transition: opacity 400ms ease-in-out; }
  .item-card.loading {
    pointer-events: none; }
    .item-card.loading .item-info {
      padding: 5px 20px 0 20px; }
    .item-card.loading .item-name .full-item-name {
      width: 90%;
      margin-bottom: 5px; }
    .item-card.loading .item-size {
      display: block;
      width: 25%; }
    .item-card.loading .item-price {
      display: block;
      width: 35%; }
    .item-card.loading .item-name .full-item-name,
    .item-card.loading .item-size,
    .item-card.loading .item-price {
      height: 15px; }
    .item-card.loading .media .image-loading-placeholder {
      background-color: #f7f7f7; }
  .item-card.unavailable .item-image {
    opacity: 0.4; }
  .item-card.unavailable .out-of-stock-text {
    color: #757575; }
  .item-card .choice {
    text-align: center;
    border-bottom: 1px solid #eee;
    margin-bottom: 4px;
    color: #999; }
  .item-card:hover, .item-card:focus {
    outline: none; }
    .item-card:hover.test-with-link-styles .full-item-name, .item-card:focus.test-with-link-styles .full-item-name {
      color: #01939A; }
      .item-card:hover.test-with-link-styles .full-item-name:hover, .item-card:focus.test-with-link-styles .full-item-name:hover {
        text-decoration: underline; }
    .item-card:hover .item-quantity-small, .item-card:focus .item-quantity-small {
      display: none; }
    .item-card:hover .media, .item-card:focus .media {
      -webkit-user-select: none;
      -moz-user-select: none;
      -ms-user-select: none;
      user-select: none; }
      .item-card:hover .media .btn-group, .item-card:focus .media .btn-group {
        display: block; }
  .item-card .quick-add-badge .item-quantity-small {
    -moz-border-radius-topleft: 20px !important;
    -moz-border-radius-topright: 20px !important;
    -moz-border-radius-bottomright: 20px !important;
    -moz-border-radius-bottomleft: 20px !important;
    -webkit-border-top-left-radius: 20px !important;
    -webkit-border-top-right-radius: 20px !important;
    -webkit-border-bottom-right-radius: 20px !important;
    -webkit-border-bottom-left-radius: 20px !important;
    border-top-left-radius: 20px !important;
    border-top-right-radius: 20px !important;
    border-bottom-right-radius: 20px !important;
    border-bottom-left-radius: 20px !important;
    padding: 2px 8px;
    min-width: 10px;
    position: absolute;
    display: block;
    right: 7px;
    top: 10px;
    height: 24px;
    background-color: #43B02A;
    color: #fff;
    font-size: 16px;
    text-align: center;
    font-weight: normal;
    text-rendering: optimizeLegibility; }
  .item-card .media {
    margin-top: 0;
    position: relative;
    overflow: visible; }
    .item-card .media .item-image {
      display: block;
      width: 155px;
      height: 155px;
      margin: 10px auto; }
    .item-card .media .btn-group {
      display: none;
      position: absolute; }
    .item-card .media .item-quantity {
      display: none;
      position: absolute;
      left: 0;
      top: -10px;
      width: 100%;
      height: 112px;
      color: #fff;
      font-weight: 300;
      background-color: rgba(0, 0, 0, 0.5); }
      .item-card .media .item-quantity .item-quantity-amount {
        margin-top: 30px;
        font-size: 40px;
        display: block;
        text-align: center;
        line-height: 38px; }
      .item-card .media .item-quantity .item-quantity-label {
        text-align: center;
        display: block;
        font-size: 16px; }
      @media (max-width: 767px) {
        .item-card .media .item-quantity {
          height: 88px; } }
    .item-card .media .item-quantity-small {
      -moz-border-radius-topleft: 20px !important;
      -moz-border-radius-topright: 20px !important;
      -moz-border-radius-bottomright: 20px !important;
      -moz-border-radius-bottomleft: 20px !important;
      -webkit-border-top-left-radius: 20px !important;
      -webkit-border-top-right-radius: 20px !important;
      -webkit-border-bottom-right-radius: 20px !important;
      -webkit-border-bottom-left-radius: 20px !important;
      border-top-left-radius: 20px !important;
      border-top-right-radius: 20px !important;
      border-bottom-right-radius: 20px !important;
      border-bottom-left-radius: 20px !important;
      padding: 4px 9px;
      min-width: 10px;
      position: absolute;
      display: none;
      right: 7px;
      top: 40px;
      background-color: #43B02A;
      color: #fff;
      font-size: 16px;
      text-align: center;
      font-weight: normal;
      text-rendering: optimizeLegibility; }
      @media (min-width: 1200px) {
        .item-card .media .item-quantity-small {
          top: 7px;
          right: 25px; } }
    .item-card .media .info-group {
      position: absolute;
      bottom: 0;
      width: 100%;
      height: 53px;
      padding: 10px;
      padding-bottom: 0;
      background-image: -webkit-linear-gradient( bottom , white 33%, rgba(255, 255, 255, 0) 100%);
      background-image: linear-gradient(to top, white 33%, rgba(255, 255, 255, 0) 100%);
      filter: progid:DXImageTransform.Microsoft.gradient( startColorstr='#d9ffffff', endColorstr='#ffffff',GradientType=0 ); }
      .item-card .media .info-group .info-price {
        background-color: #929292;
        background-color: rgba(146, 146, 146, 0.75);
        padding: 8px;
        font-size: 14px;
        text-align: center;
        color: #fff;
        display: inline-block;
        font-weight: 300;
        letter-spacing: 1px;
        -moz-border-radius-topleft: 4px !important;
        -moz-border-radius-topright: 4px !important;
        -moz-border-radius-bottomright: 4px !important;
        -moz-border-radius-bottomleft: 4px !important;
        -webkit-border-top-left-radius: 4px !important;
        -webkit-border-top-right-radius: 4px !important;
        -webkit-border-bottom-right-radius: 4px !important;
        -webkit-border-bottom-left-radius: 4px !important;
        border-top-left-radius: 4px !important;
        border-top-right-radius: 4px !important;
        border-bottom-right-radius: 4px !important;
        border-bottom-left-radius: 4px !important;
        max-width: 64px;
        line-height: 15px; }
      .item-card .media .info-group .item-full-price {
        display: inline-block;
        padding-left: 5px; }
      .item-card .media .info-group .qty-buttons {
        margin-right: 4px;
        margin-left: 0; }
        .item-card .media .info-group .qty-buttons .dec {
          display: none;
          margin-right: 5px; }
        .item-card .media .info-group .qty-buttons button {
          text-decoration: none;
          font-weight: 700;
          letter-spacing: 0.1em;
          line-height: 20px;
          padding: 6px 10px;
          -moz-border-radius-topleft: 4px !important;
          -moz-border-radius-topright: 4px !important;
          -moz-border-radius-bottomright: 4px !important;
          -moz-border-radius-bottomleft: 4px !important;
          -webkit-border-top-left-radius: 4px !important;
          -webkit-border-top-right-radius: 4px !important;
          -webkit-border-bottom-right-radius: 4px !important;
          -webkit-border-bottom-left-radius: 4px !important;
          border-top-left-radius: 4px !important;
          border-top-right-radius: 4px !important;
          border-bottom-right-radius: 4px !important;
          border-bottom-left-radius: 4px !important; }
          .item-card .media .info-group .qty-buttons button.favorite-btn {
            font-size: 20px; }
    .item-card .media .on-sale-banner {
      width: 36px;
      height: 18px;
      position: absolute;
      top: 46px;
      right: 5px;
      padding: 0; }
  .item-card .item-row {
    margin-bottom: 4px; }
  .item-card .item-name {
    line-height: 1.5em; }
    .item-card .item-name .full-item-name {
      max-height: 55px;
      overflow: hidden;
      display: block;
      text-overflow: ellipsis;
      line-height: 1.4em; }
  .item-card .item-aisle-link,
  .item-card .item-es-score {
    position: absolute;
    visibility: hidden;
    left: 0;
    right: 0;
    bottom: 0;
    margin-bottom: 10px;
    text-align: center;
    padding: 0 20px 0 20px;
    color: #43B02A; }
    @media (max-width: 767px) {
      .item-card .item-aisle-link,
      .item-card .item-es-score {
        display: none; } }
  .item-card .item-es-score {
    bottom: 22px; }
  .item-card .item-coupon {
    position: absolute;
    z-index: 100;
    width: 100%;
    text-align: center;
    background: #8AAFB0;
    margin-bottom: 0;
    color: #fff;
    font-size: 11px;
    line-height: 11px;
    letter-spacing: 1px;
    padding: 2px 0; }
    .item-card .item-coupon .expires {
      color: #eee;
      font-weight: 300;
      font-size: 12px; }
  .item-card .item-info {
    padding: 10px;
    min-height: 61px;
    font-size: 13px;
    padding: 5px 25px 0; }
    .item-card .item-info .muted {
      color: #999; }
  .item-card .input-qty {
    width: 25px;
    text-align: center;
    padding-top: 2px;
    padding-bottom: 2px; }
  .item-card .detail-progress-indicator {
    display: none; }
  .item-card .badge--coupon-clipping,
  .item-card .badge--coupon-clipping-applied {
    display: none; }
  @media (max-width: 767px) {
    .item-card {
      width: 40vw; }
      .item-card:hover .media .info-group, .item-card:focus .media .info-group {
        display: none; }
      .item-card .media .item-image {
        width: 20vw;
        height: 20vw; }
      .item-card .item-info {
        padding: 5px 15px 0; } }

.item-card-contents {
  min-height: 338px;
  position: relative; }
  .item-card-contents.in-cart .media:not(.quick-add-view-allowed) .item-quantity-small {
    display: block; }
  .item-card-contents.in-cart .media.quick-add-view-allowed .item-quantity-small {
    display: none; }
  .item-card-contents.in-cart .media .info-group .qty-buttons .dec {
    display: inline-block; }
  .item-card-contents.in-cart:hover,
  .item-card-contents.in-cart:focus .media {
    outline: none; }
    .item-card-contents.in-cart:hover .item-quantity-small,
    .item-card-contents.in-cart:hover .btn-group,
    .item-card-contents.in-cart:focus .media .item-quantity-small,
    .item-card-contents.in-cart:focus .media .btn-group {
      display: none; }
    .item-card-contents.in-cart:hover .info-group,
    .item-card-contents.in-cart:focus .media .info-group {
      display: block; }
    .item-card-contents.in-cart:hover:not(.quick-add-view-allowed) .item-quantity,
    .item-card-contents.in-cart:focus .media:not(.quick-add-view-allowed) .item-quantity {
      display: block; }
    .item-card-contents.in-cart:hover.quick-add-view-allowed .item-quantity,
    .item-card-contents.in-cart:focus .media.quick-add-view-allowed .item-quantity {
      display: none; }
  .item-card-contents:hover .on-sale-banner,
  .item-card-contents:hover .item-coupon, .item-card-contents:focus .on-sale-banner,
  .item-card-contents:focus .item-coupon {
    display: none; }
  @media (max-width: 767px) {
    .item-card-contents {
      height: 50vw;
      min-height: 220px; } }

.items-grid .item-card {
  max-width: 33%; }
  @media (max-width: 767px) {
    .items-grid .item-card {
      width: 50%;
      max-width: none;
      border-right: 0;
      border-left: 0;
      margin-right: 0;
      margin-top: -1px; }
      .items-grid .item-card .media .item-image {
        width: 25vw;
        height: 25vw; } }

.item-loading {
  animation-name: item-loading;
  animation-duration: 2s;
  animation-direction: alternate;
  animation-timing-function: ease-in-out;
  animation-iteration-count: 100; }

@-webkit-keyframes item-loading {
  0% {
    background-color: #efefef; }
  100% {
    background-color: #ddd; } }

@-moz-keyframes item-loading {
  0% {
    background-color: #efefef; }
  100% {
    background-color: #ddd; } }

@keyframes item-loading {
  0% {
    background-color: #efefef; }
  100% {
    background-color: #ddd; } }

@-webkit-keyframes close-quick-add {
  0% {
    opacity: 1;
    z-index: 21;
    visibility: visible; }
  100% {
    opacity: 0;
    z-index: -1;
    visibility: hidden; } }

@-moz-keyframes close-quick-add {
  0% {
    opacity: 1;
    z-index: 21;
    visibility: visible; }
  100% {
    opacity: 0;
    z-index: -1;
    visibility: hidden; } }

@keyframes close-quick-add {
  0% {
    opacity: 1;
    z-index: 21;
    visibility: visible; }
  100% {
    opacity: 0;
    z-index: -1;
    visibility: hidden; } }

@-webkit-keyframes open-quick-add {
  0% {
    width: 0%;
    height: 0;
    visibility: hidden; }
  100% {
    width: 90%;
    height: 3em;
    visibility: visible; } }

@-moz-keyframes open-quick-add {
  0% {
    width: 0%;
    height: 0;
    visibility: hidden; }
  100% {
    width: 90%;
    height: 3em;
    visibility: visible; } }

@keyframes open-quick-add {
  0% {
    width: 0%;
    height: 0;
    visibility: hidden; }
  100% {
    width: 90%;
    height: 3em;
    visibility: visible; } }

@-webkit-keyframes fade-in-background-color-opacity {
  0% {
    background-color: 'none';
    opacity: 0; }
  100% {
    background-color: white;
    opacity: 0.6; } }

@-moz-keyframes fade-in-background-color-opacity {
  0% {
    background-color: 'none';
    opacity: 0; }
  100% {
    background-color: white;
    opacity: 0.6; } }

@keyframes fade-in-background-color-opacity {
  0% {
    background-color: 'none';
    opacity: 0; }
  100% {
    background-color: white;
    opacity: 0.6; } }

@-webkit-keyframes fade-out-background-color-opacity {
  0% {
    background-color: white;
    opacity: 0.6;
    z-index: 20; }
  100% {
    background-color: 'none';
    opacity: 0;
    z-index: -1; } }

@-moz-keyframes fade-out-background-color-opacity {
  0% {
    background-color: white;
    opacity: 0.6;
    z-index: 20; }
  100% {
    background-color: 'none';
    opacity: 0;
    z-index: -1; } }

@keyframes fade-out-background-color-opacity {
  0% {
    background-color: white;
    opacity: 0.6;
    z-index: 20; }
  100% {
    background-color: 'none';
    opacity: 0;
    z-index: -1; } }

@-webkit-keyframes fade-out-opacity {
  0% {
    opacity: 1; }
  100% {
    opacity: 0; } }

@-moz-keyframes fade-out-opacity {
  0% {
    opacity: 1; }
  100% {
    opacity: 0; } }

@keyframes fade-out-opacity {
  0% {
    opacity: 1; }
  100% {
    opacity: 0; } }

/* high contrast mode */
.high-contrast-mode .item-card .item-info .muted {
  color: #757575; }

.high-contrast-mode .item-card .media .item-quantity-small {
  background-color: #424242; }

neighbor-item .icModalContent.itemModal {
  width: 852px;
  max-height: 10000px;
  -webkit-transform: translate3d(0, 0, 0); }
  neighbor-item .icModalContent.itemModal p {
    color: #5f5f5f; }

.icModalContentContainer .neighbor-item {
  position: fixed;
  top: 48%;
  width: 40px;
  height: 40px;
  margin-top: -20px;
  background-color: white;
  text-align: center;
  border-radius: 25px;
  overflow: hidden;
  box-shadow: 0 3px 9px rgba(0, 0, 0, 0.5);
  opacity: 0.90; }
  .icModalContentContainer .neighbor-item .ic-icon {
    font-size: 30px;
    position: absolute;
    top: 1px; }
  .icModalContentContainer .neighbor-item.next-item {
    right: calc(28% - 300px); }
    .icModalContentContainer .neighbor-item.next-item .ic-icon {
      right: 3px; }
  .icModalContentContainer .neighbor-item.prev-item {
    left: calc(28% - 300px); }
    .icModalContentContainer .neighbor-item.prev-item .ic-icon {
      right: 7px; }

.itemModalHeader .leftCol {
  margin-right: 26px;
  text-align: center; }

.itemModal .imageWrapper {
  display: table-cell;
  height: 380px;
  vertical-align: middle;
  width: 380px; }
  @media (max-width: 767px) {
    .itemModal .imageWrapper {
      width: 100%; } }

.itemModal .imageWrapper.outOfStock {
  height: 304px;
  width: 304px; }

.itemModalUnavailableHeader {
  background-color: #b0b0b0;
  text-align: center;
  line-height: 50px;
  color: white;
  font-size: 15px;
  border-top-left-radius: 5px;
  border-top-right-radius: 5px; }

.itemModalHeader h2.item-title {
  font-weight: 400;
  margin-bottom: 5px;
  line-height: 36px; }
  .itemModalHeader h2.item-title:focus {
    outline-style: none; }

.itemModalHeader h2.item-title.item-title-smaller {
  font-size: 20px;
  line-height: 28px; }

.itemModalHeader h2.outOfStockHeader {
  width: 500px;
  text-align: center;
  margin: 30px auto; }

.itemModalHeader h4.item-size-info {
  font-weight: 400;
  margin-top: 5px;
  margin-bottom: 20px;
  color: #8e8e8e; }

.itemModalHeader img {
  max-width: 380px;
  margin: auto; }
  @media (max-width: 767px) {
    .itemModalHeader img {
      max-width: 100%; } }

.itemModalHeader .ic-btn {
  margin-bottom: 14px; }

.itemModalHeader .ic-btn-lg > .ic-icon {
  position: absolute;
  right: 15px;
  top: 15px; }

.itemModalHeader .ic-btn-link > .ic-icon,
.itemModalHeader a > .ic-icon {
  font-size: 16px;
  padding: 0px 4px; }

.itemModal .nutrition-facts {
  max-width: none;
  border: 1px solid #000;
  border-radius: 4px; }

.itemModal .secondaryActions {
  margin-top: 14px;
  margin-left: -11px; }

.itemModal .secondaryActions > div,
.itemModal .secondaryActions > button {
  display: block; }

.itemModal .secondaryActions > a,
.itemModal .secondaryActions > button {
  padding: 3px 6px; }

.itemModal .price--displayModifier {
  font-size: 16px;
  margin-left: 4px;
  line-height: 16px;
  font-weight: 500;
  color: #8e8e8e; }

.itemModal .price--displayModifier.price--displayModifierProminent {
  font-size: 18px;
  font-weight: bold;
  color: #393939; }

.itemModal .price.is-sale {
  display: table; }

.itemModal .saleBadge {
  font-size: 20px;
  background-color: #E8104A;
  color: #fff;
  font-weight: 600;
  border-radius: 18px;
  padding: 5px 10px;
  margin: 0px 10px; }
  .itemModal .saleBadge.deals-feature {
    display: inline-block;
    height: 24px;
    border-radius: 18px;
    vertical-align: middle;
    margin: 7px 10px 0 10px;
    padding: 3px 15px;
    line-height: 18px;
    font-weight: 600;
    font-size: 14px; }

.itemModal .productPromotionBadge {
  top: -5px;
  display: inline-block;
  height: 22px;
  background-color: #fff;
  border: 1px dashed #E8104A;
  border-radius: 16px;
  vertical-align: middle;
  margin-top: 10px;
  padding: 3px 15px;
  line-height: 16px;
  font-weight: 600;
  font-size: 14px;
  color: #E8104A; }
  .itemModal .productPromotionBadge.ic-icon-deals:before {
    padding-right: 5px;
    vertical-align: middle;
    display: inline-block;
    margin-top: -3px; }

.itemModal .productPromotionBadge.no-border {
  border: none;
  padding-left: 0;
  margin-left: 0; }

.itemModal .priceTransparencyBadge {
  float: right;
  font-size: 12px;
  margin-top: -3px;
  line-height: 28px;
  padding-left: 30px; }
  .itemModal .priceTransparencyBadge > .ic-icon {
    font-size: 26px;
    top: 1px;
    left: 1px; }

.icQtyDropdown .icDropdownItems {
  right: 0;
  text-align: center;
  top: 0; }

.ic-form-group {
  position: relative;
  color: #6c6c6c; }
  .ic-form-group.has-error {
    -webkit-animation: shakeHorizontal 0.5s 1;
    -moz-animation: shakeHorizontal 0.5s 1;
    animation: shakeHorizontal 0.5s 1; }
    .ic-form-group.has-error input[type="text"]:focus {
      border-color: #FF5600; }
  .ic-form-group input[type="text"] {
    -moz-border-radius-topleft: 4px !important;
    -moz-border-radius-topright: 4px !important;
    -moz-border-radius-bottomright: 4px !important;
    -moz-border-radius-bottomleft: 4px !important;
    -webkit-border-top-left-radius: 4px !important;
    -webkit-border-top-right-radius: 4px !important;
    -webkit-border-bottom-right-radius: 4px !important;
    -webkit-border-bottom-left-radius: 4px !important;
    border-top-left-radius: 4px !important;
    border-top-right-radius: 4px !important;
    border-bottom-right-radius: 4px !important;
    border-bottom-left-radius: 4px !important;
    box-sizing: border-box;
    color: #6c6c6c; }
    .ic-form-group input[type="text"]:focus {
      border-color: #01939A;
      box-shadow: none; }

.ic-input-group-lg .ic-input-append {
  position: absolute;
  right: 12px;
  top: 12px; }

.ic-form-group-lg {
  line-height: 1.33333;
  font-size: 18px; }
  .ic-form-group-lg input[type="text"] {
    font-size: 18px;
    height: 46px;
    line-height: 1.33333; }

form.itemCustomQuantity input {
  margin-bottom: 14px;
  text-align: center;
  width: 100%; }

button.favorite-btn,
button.is-favorite {
  color: #E8104A;
  padding: 2px 6px; }
  button.favorite-btn:hover, button.favorite-btn:focus,
  button.is-favorite:hover,
  button.is-favorite:focus {
    color: #a00b33; }

@media (min-width: 1012px) {
  .icModalContent.itemModal {
    width: 934px; }
    .icModalContent.itemModal .icModalRow .leftCol {
      width: 462px; }
    .icModalContent.itemModal .imageWrapper {
      width: 462px; }
      .icModalContent.itemModal .imageWrapper img {
        max-width: 100%; }
    .icModalContent.itemModal .imageWrapper.outOfStock {
      width: 346px;
      height: 346px;
      float: right; } }

@media (min-width: 1096px) {
  .icModalContent.itemModal {
    width: 1016px; }
    .icModalContent.itemModal .icModalRow .leftCol {
      width: 544px; }
    .icModalContent.itemModal .imageWrapper {
      width: 544px; }
      .icModalContent.itemModal .imageWrapper img {
        max-width: 100%; }
    .icModalContent.itemModal .imageWrapper.outOfStock {
      width: 304px;
      height: 304px;
      float: right; } }

.related_item_top_row_height {
  overflow: hidden;
  height: 340px; }

/* high-contrast-mode */
.high-contrast-mode .itemModalHeader h4.item-size-info {
  color: #757575; }

ul.relatedItemsList {
  margin: 0;
  position: relative; }
  ul.relatedItemsList .slick-prev, ul.relatedItemsList .slick-next {
    position: absolute;
    top: 42%;
    z-index: 900; }
  ul.relatedItemsList .slick-prev {
    left: -20px; }
  ul.relatedItemsList .slick-next {
    right: -20px; }

.relatedItemsList li {
  -moz-border-radius-topleft: 4px !important;
  -moz-border-radius-topright: 4px !important;
  -moz-border-radius-bottomright: 4px !important;
  -moz-border-radius-bottomleft: 4px !important;
  -webkit-border-top-left-radius: 4px !important;
  -webkit-border-top-right-radius: 4px !important;
  -webkit-border-bottom-right-radius: 4px !important;
  -webkit-border-bottom-left-radius: 4px !important;
  border-top-left-radius: 4px !important;
  border-top-right-radius: 4px !important;
  border-bottom-right-radius: 4px !important;
  border-bottom-left-radius: 4px !important;
  border: 1px solid #fff;
  display: inline-block;
  width: 156px;
  height: 100%;
  vertical-align: top; }
  .relatedItemsList li:hover {
    cursor: pointer;
    border-color: #F0EFEC; }

.relatedItem {
  padding: 10px; }

.relatedItem img {
  height: 138px;
  width: 138px; }

.relatedItem .name {
  max-height: 80px;
  overflow: hidden;
  display: inline-block; }

.relatedItem .size {
  color: #8e8e8e;
  display: block; }

.price--sale {
  color: #E8104A; }

.relatedItem .price--sale {
  font-weight: 600; }

.itemNoteWrapper {
  position: relative;
  overflow: hidden; }
  .itemNoteWrapper.read-only {
    pointer-events: none; }
    .itemNoteWrapper.read-only .note-cover {
      display: block; }
    .itemNoteWrapper.read-only p.editNoteLink,
    .itemNoteWrapper.read-only p.removeNoteLink {
      opacity: 0;
      display: none; }
    .itemNoteWrapper.read-only:hover p.editNoteLink,
    .itemNoteWrapper.read-only:hover p.removeNoteLink {
      opacity: 0;
      display: none; }
  .itemNoteWrapper .note-cover {
    display: none;
    width: 100%;
    height: 100%;
    margin: auto;
    position: absolute;
    top: 0;
    left: 0;
    bottom: 0;
    right: 0;
    pointer-events: none; }
  .itemNoteWrapper textarea {
    color: #999;
    width: 100%;
    max-width: 100%;
    min-width: 100%;
    min-height: 0px;
    margin-bottom: 1px;
    resize: none;
    padding: 10px 40px;
    overflow: hidden;
    box-sizing: border-box; }
    .itemNoteWrapper textarea:focus {
      border: 1px solid #aaa;
      color: #555; }
    .itemNoteWrapper textarea.active {
      resize: inherit; }
  .itemNoteWrapper .enterHelpText {
    position: absolute;
    bottom: 5px;
    right: 15px;
    text-transform: uppercase;
    font-size: 12px;
    color: #999999; }
    .itemNoteWrapper .enterHelpText .ic-icon-arrow-enter {
      margin-left: 5px;
      vertical-align: middle; }
  .itemNoteWrapper .ic-icon-note {
    -webkit-transition: left 0.1s linear;
    -moz-transition: left 0.1s linear;
    transition: left 0.1s linear;
    position: absolute;
    top: 14px;
    left: 15px;
    font-size: 16px; }
  .itemNoteWrapper p.editNoteLink, .itemNoteWrapper p.removeNoteLink {
    position: absolute;
    color: #01939A;
    opacity: 0;
    bottom: 5px; }
    .itemNoteWrapper p.editNoteLink:hover, .itemNoteWrapper p.removeNoteLink:hover {
      cursor: pointer; }
  .itemNoteWrapper p.editNoteLink {
    right: 15px; }
  .itemNoteWrapper p.removeNoteLink {
    right: 50px; }
  .itemNoteWrapper:hover p.editNoteLink, .itemNoteWrapper:active p.editNoteLink {
    opacity: 1; }
  .itemNoteWrapper:hover p.removeNoteLink, .itemNoteWrapper:active p.removeNoteLink {
    opacity: 1; }

.item-note-modal .icModalHeader {
  padding: 30px; }
  .item-note-modal .icModalHeader h1 {
    margin: 0;
    font-size: 32px; }
  .item-note-modal .icModalHeader p {
    font-size: 16px;
    color: #818a91;
    margin: 0; }

.item-note-modal .icModalBody {
  padding: 0; }

.item-note-modal .item-note-modal-body {
  padding: 0 30px;
  border-bottom: 1px solid #eee;
  font-size: 16px; }

.item-note-modal .item-note-modal-image {
  width: 90px;
  height: 90px;
  display: inline-block;
  float: left; }

.item-note-modal .item-note-modal-item-info {
  width: calc(100% - 90px);
  padding: 15px 15px 0 15px;
  display: inline-block;
  float: left; }
  .item-note-modal .item-note-modal-item-info p {
    font-size: 16px;
    margin: 0; }
  .item-note-modal .item-note-modal-item-info .text-muted {
    color: #818a91;
    font-size: 14px; }

.item-note-modal .item-note-modal-note-wrappper {
  padding: 30px; }
  .item-note-modal .item-note-modal-note-wrappper textarea {
    width: 100%;
    margin: 0;
    background-color: #f7f7f7; }
  .item-note-modal .item-note-modal-note-wrappper .actions-wrapper {
    margin-top: 15px;
    float: right; }
    .item-note-modal .item-note-modal-note-wrappper .actions-wrapper .ic-btn:first-child {
      margin-right: 11px; }
    .item-note-modal .item-note-modal-note-wrappper .actions-wrapper .ic-btn-secondary:hover, .item-note-modal .item-note-modal-note-wrappper .actions-wrapper .ic-btn-secondary:focus {
      color: #43B02A;
      background-color: #E2F3DF; }
    .item-note-modal .item-note-modal-note-wrappper .actions-wrapper .ic-btn-secondary:active {
      color: #43B02A;
      background-color: #C6E7BF; }

.locationInfoModal {
  background-color: #64B355;
  text-align: center;
  width: 560px; }
  .locationInfoModal h1 {
    color: white; }
  .locationInfoModal .notAvailableCircle, .locationInfoModal .shoppingBagCircle {
    background-image: url(circle-not-available-8b24478f5f91031f653d53505d8f3414.png);
    background-repeat: no-repeat;
    background-size: cover;
    height: 220px;
    width: 220px;
    margin: 20px auto; }
  .locationInfoModal .shoppingBagCircle {
    background-image: url(circle-shopping-bag-224eccfc72fc4461e807a13eba45acb1.png); }
  .locationInfoModal .modalContent {
    margin: 20px;
    color: #B3D9AD; }
    .locationInfoModal .modalContent .copy {
      margin: 10px; }
  .locationInfoModal .modalActions {
    margin: 20px; }
  .locationInfoModal .modalLink {
    color: #B3D9AD;
    font-weight: 600; }
  .locationInfoModal .modalButton {
    color: #89C6D7;
    background-color: #ffffff;
    padding: 20px;
    width: 300px;
    font-size: 18px;
    line-height: 20px;
    text-align: center;
    vertical-align: middle;
    cursor: pointer;
    border-radius: 4px;
    display: inline-block;
    font-weight: bold; }

.lowStockReplacement .low-stock-repl-header,
.lowStockReplacement .low-stock-repl-subheader {
  font-size: 32px;
  font-weight: 700;
  line-height: 1.43;
  color: #393939;
  padding: 10px 0 5px 0;
  text-align: center;
  margin: 0 auto;
  max-width: 500px; }
  @media (max-width: 540px) {
    .lowStockReplacement .low-stock-repl-header,
    .lowStockReplacement .low-stock-repl-subheader {
      font-size: 21px; } }
  @media (max-width: 360px) {
    .lowStockReplacement .low-stock-repl-header,
    .lowStockReplacement .low-stock-repl-subheader {
      font-size: 18px; } }

.lowStockReplacement .low-stock-repl-subheader {
  font-size: 22px;
  font-weight: 400;
  padding: 0;
  margin-bottom: 2px; }
  @media (max-width: 540px) {
    .lowStockReplacement .low-stock-repl-subheader {
      font-size: 19px; } }
  @media (max-width: 360px) {
    .lowStockReplacement .low-stock-repl-subheader {
      font-size: 16px; } }

.lowStockReplacement .low-stock-top {
  display: flex;
  flex-direction: row;
  justify-content: center;
  width: 100%; }
  .lowStockReplacement .low-stock-top .low-stock-inner-top {
    display: inline-flex;
    justify-content: center; }
  .lowStockReplacement .low-stock-top .low-stock-check-cirlce {
    display: flex;
    justify-content: center;
    align-items: center;
    width: 25px;
    height: 25px;
    min-width: 25px;
    min-height: 25px;
    background-color: #43B02A;
    border-radius: 25px; }
  .lowStockReplacement .low-stock-top .low-stock-repl-title {
    display: flex;
    font-weight: 400;
    font-size: 17px;
    text-align: center;
    color: #757575;
    margin-left: 10px;
    max-width: 300px;
    white-space: nowrap; }
    @media (max-width: 450px) {
      .lowStockReplacement .low-stock-top .low-stock-repl-title {
        font-size: 14px; } }
    @media (max-width: 450px) {
      .lowStockReplacement .low-stock-top .low-stock-repl-title {
        max-width: 250px; } }
    @media (max-width: 360px) {
      .lowStockReplacement .low-stock-top .low-stock-repl-title {
        max-width: 175px; } }
    .lowStockReplacement .low-stock-top .low-stock-repl-title .ic-truncate {
      max-width: 60%; }
      @media (max-width: 360px) {
        .lowStockReplacement .low-stock-top .low-stock-repl-title .ic-truncate {
          max-width: 45%; } }

.lowStockReplacement .ic-btn.ic-btn-lg.ic-btn-block.ic-btn-default {
  margin-top: 5px; }

.lowStockReplacement .low-stock-repl-item-wrap {
  position: relative;
  margin: 0 auto;
  max-width: 360px; }

.lowStockReplacement .low-stock-repl-simple-item-card-wrap {
  padding-top: 10px;
  width: 350px;
  margin: 0 auto; }
  .lowStockReplacement .low-stock-repl-simple-item-card-wrap .SimpleItemCard {
    display: flex; }
  .lowStockReplacement .low-stock-repl-simple-item-card-wrap .item-name {
    font-size: 14px;
    font-weight: normal; }
  .lowStockReplacement .low-stock-repl-simple-item-card-wrap .item-image {
    max-width: 140px; }
  .lowStockReplacement .low-stock-repl-simple-item-card-wrap .item-info {
    padding: 10px 0; }

.lowStockReplacement .line-above {
  margin-bottom: 0; }

.lowStockReplacement .ic-btn.ic-btn-lg.ic-btn-block.ic-btn-default {
  text-align: left; }

.lowStockReplacement .replacement-policy-dropdown {
  position: absolute;
  left: 0;
  right: 0;
  margin: 12px auto 0 auto;
  width: 300px; }
  .lowStockReplacement .replacement-policy-dropdown .icDropdownItems {
    width: 100%; }
    .lowStockReplacement .replacement-policy-dropdown .icDropdownItems .icDropdownItem {
      margin-left: 13px; }

.lowStockReplacement .line-above.first {
  margin-top: 90px; }

.lowStockReplacement .recommended-replacements {
  margin-top: 0; }
  .lowStockReplacement .recommended-replacements .replacement-search-box {
    margin-top: 88px !important; }
  .lowStockReplacement .recommended-replacements .replacements-results {
    padding: 15px 20px; }
    @media (max-width: 450px) {
      .lowStockReplacement .recommended-replacements .replacements-results {
        text-align: center; } }
  .lowStockReplacement .recommended-replacements .repl-item-card {
    display: inline-block;
    padding: 10px 20px;
    width: 180px;
    min-height: 255px;
    vertical-align: top; }
    .lowStockReplacement .recommended-replacements .repl-item-card .item-choose-btn {
      margin: 20px 10px;
      display: none; }
    .lowStockReplacement .recommended-replacements .repl-item-card:hover .item-choose-btn {
      display: block; }
    .lowStockReplacement .recommended-replacements .repl-item-card:hover .item-info {
      display: none; }
    .lowStockReplacement .recommended-replacements .repl-item-card .item-image {
      width: 100px; }
      @media (max-width: 450px) {
        .lowStockReplacement .recommended-replacements .repl-item-card .item-image {
          margin: 0 auto;
          width: 150px; } }
    .lowStockReplacement .recommended-replacements .repl-item-card .item-size {
      color: #757575; }
    .lowStockReplacement .recommended-replacements .repl-item-card .item-price {
      margin: 6px 0; }

.lowStockReplacement .accept-low-stock-btn {
  display: block;
  margin: 88px auto 0 auto;
  width: 220px;
  height: 60px;
  font-size: 22px; }

.loyaltyCardModal .subheader {
  margin-top: 25px; }
  .loyaltyCardModal .subheader h2 {
    color: white; }

.loyaltyCardModal .icModalBody {
  padding: 30px; }
  .loyaltyCardModal .icModalBody .form-horizontal {
    text-align: center; }
  .loyaltyCardModal .icModalBody .card-error span {
    display: inline-block;
    padding: 12px;
    background-color: rgba(191, 68, 55, 0.6);
    border: 1px solid #ce593d;
    -moz-border-radius-topleft: 4px !important;
    -moz-border-radius-topright: 4px !important;
    -moz-border-radius-bottomright: 4px !important;
    -moz-border-radius-bottomleft: 4px !important;
    -webkit-border-top-left-radius: 4px !important;
    -webkit-border-top-right-radius: 4px !important;
    -webkit-border-bottom-right-radius: 4px !important;
    -webkit-border-bottom-left-radius: 4px !important;
    border-top-left-radius: 4px !important;
    border-top-right-radius: 4px !important;
    border-bottom-right-radius: 4px !important;
    border-bottom-left-radius: 4px !important;
    color: white; }
  .loyaltyCardModal .icModalBody .card-number-input {
    width: 330px;
    text-align: center;
    margin-bottom: 15px;
    font-size: 18px;
    height: 46px;
    box-sizing: border-box; }
  .loyaltyCardModal .icModalBody .ic-btn-lg {
    width: 332px; }

.recurring-setup-notification h4 {
  font-size: 16px;
  color: #393939;
  font-weight: 600; }

.recurring-setup-notification p {
  color: #43B02A;
  font-weight: 600; }

.free-delivery-notification:focus {
  outline: none; }

.free-delivery-notification h3, .free-delivery-notification p,
.new-user-checkout-notification h3,
.new-user-checkout-notification p {
  white-space: normal; }

.free-delivery-notification .row h3,
.new-user-checkout-notification .row h3 {
  color: #393939;
  font-weight: 600;
  font-size: 22px; }

.free-delivery-notification p,
.new-user-checkout-notification p {
  font-size: 16px; }

.free-delivery-notification strong,
.new-user-checkout-notification strong {
  color: #43B02A; }

.free-delivery-notification .grocery-icon,
.new-user-checkout-notification .grocery-icon {
  background-image: url(ic-artwork-bag-c0159365992b2439da27c5d1d10fe53b.png);
  background-repeat: no-repeat;
  height: 142px;
  width: 134px;
  background-size: 134px;
  margin: 0 auto; }
  @media only screen and (-webkit-min-device-pixel-ratio: 1.3), only screen and (min--moz-device-pixel-ratio: 1.3), only screen and (-o-min-device-pixel-ratio: 1.3 / 1), only screen and (min-resolution: 125dpi), only screen and (min-resolution: 1.3dppx) {
    .free-delivery-notification .grocery-icon,
    .new-user-checkout-notification .grocery-icon {
      background-image: url(ic-artwork-bag@2x-d31675da2d960a3e1a7d26ac27547852.png);
      background-size: "134px"; } }

.free-delivery-notification .reserved-time-icon,
.new-user-checkout-notification .reserved-time-icon {
  background-image: url(clock-green-large-8ee927bbc1074f3b2e1f67146067808d.png);
  background-repeat: no-repeat;
  height: 147px;
  width: 209px;
  background-size: 209px;
  margin: 20px auto; }

.free-delivery-notification .price-cross-out,
.new-user-checkout-notification .price-cross-out {
  display: inline-block;
  position: relative; }
  .free-delivery-notification .price-cross-out .line,
  .new-user-checkout-notification .price-cross-out .line {
    display: block;
    position: absolute;
    top: 49%;
    width: 102%;
    height: 1px;
    background-color: #393939;
    transform: rotate(-25deg); }

.free-delivery-notification strong {
  text-transform: uppercase; }

.new-user-checkout-notification .ic-btn-success {
  margin-bottom: 15px;
  width: 200px;
  color: #fff; }

.recurring-setup-notification .ic-btn-success {
  margin-bottom: 15px; }

.order-in-progress-modal-item {
  display: flex;
  border: 1px solid #cccccc;
  border-radius: 5px;
  align-items: center;
  padding: 1em 2em; }

.order-in-progress-modal-item-image {
  width: 8em;
  margin-right: 2em; }

.order-in-progress-modal-item-description {
  max-width: 20em; }
  .order-in-progress-modal-item-description p {
    margin-bottom: 0; }

.order-in-progress-modal-item-left {
  display: flex;
  align-items: center;
  justify-content: space-between;
  max-width: 80%; }

.order-in-progress-modal-item-right {
  margin-left: auto; }

.order-in-progress-modal-qty {
  min-width: 6em;
  margin-right: 2em; }
  .order-in-progress-modal-qty .ic-icon {
    position: absolute;
    right: 8px;
    top: 10px; }

.order-in-progress-modal-controls {
  margin-top: 2em;
  text-align: center; }
  .order-in-progress-modal-controls button:first-child {
    margin-right: 1em; }

.order-modification-modal {
  width: 620px; }

.order-modification-search-container {
  background-color: #F7F7F7;
  border: 1px solid #DADAD9;
  padding: 10px 20px; }
  .order-modification-search-container input[type="search"] {
    border: none;
    margin: 0; }

.order-modification-search {
  position: relative;
  border-radius: 4px;
  border: 1px solid #e0e0e0; }

.order-modification-search-btn {
  font-size: 16px; }

.order-modification-modal-empty {
  text-align: center; }

.order-modification-modal-results {
  display: flex;
  flex-wrap: wrap;
  max-height: 570px;
  overflow: auto;
  margin: 0;
  min-width: 0;
  padding: 1px 0; }

.order-modification-modal-centered {
  min-height: 338px;
  display: flex;
  align-items: center;
  justify-content: center; }

.order-modification-modal-footer {
  text-align: right;
  padding: 2em; }

.order-modification-item-card {
  cursor: default; }
  .order-modification-item-card .info-group {
    padding: 7px !important;
    padding-bottom: 0 !important; }
  @media (max-width: 767px) {
    .order-modification-item-card {
      width: 50vw;
      max-width: 206px;
      height: 18em; }
      .order-modification-item-card .media {
        height: 9em; } }
  @media (max-width: 991px) {
    .order-modification-item-card .info-group {
      display: block !important; } }

.order-modification-item-card-actions button {
  text-transform: uppercase;
  font-weight: 700;
  line-height: 20px;
  padding: 6px 10px;
  -moz-border-radius-topleft: 4px !important;
  -moz-border-radius-topright: 4px !important;
  -moz-border-radius-bottomright: 4px !important;
  -moz-border-radius-bottomleft: 4px !important;
  -webkit-border-top-left-radius: 4px !important;
  -webkit-border-top-right-radius: 4px !important;
  -webkit-border-bottom-right-radius: 4px !important;
  -webkit-border-bottom-left-radius: 4px !important;
  border-top-left-radius: 4px !important;
  border-top-right-radius: 4px !important;
  border-bottom-right-radius: 4px !important;
  border-bottom-left-radius: 4px !important; }
  .order-modification-item-card-actions button.favorite-btn {
    font-size: 20px; }

.order-modification-item-card-quantity {
  -moz-border-radius-topleft: 4px !important;
  -moz-border-radius-topright: 4px !important;
  -moz-border-radius-bottomright: 4px !important;
  -moz-border-radius-bottomleft: 4px !important;
  -webkit-border-top-left-radius: 4px !important;
  -webkit-border-top-right-radius: 4px !important;
  -webkit-border-bottom-right-radius: 4px !important;
  -webkit-border-bottom-left-radius: 4px !important;
  border-top-left-radius: 4px !important;
  border-top-right-radius: 4px !important;
  border-bottom-right-radius: 4px !important;
  border-bottom-left-radius: 4px !important;
  padding: 0 7px;
  position: absolute;
  right: 7px;
  top: 7px;
  background-color: #43B02A;
  color: #fff;
  font-size: 11px;
  font-weight: 700;
  text-align: center;
  text-rendering: optimizeLegibility;
  text-transform: uppercase; }

.add-to-order-btn::after {
  content: 'add to order'; }
  @media (max-width: 375px) {
    .add-to-order-btn::after {
      content: 'add'; } }

.order-status-wrapper.container {
  padding-top: 15px;
  /***************************************
***** Order status specific styles *****
***************************************/
  /*******************************************************
***** Order changes education (delete eventually!) *****
********************************************************/
  /****************************
***** Responsive styles *****
*****************************/ }
  .order-status-wrapper.container * {
    box-sizing: border-box; }
  .order-status-wrapper.container .panel {
    padding: 30px;
    border-radius: 4px;
    background-color: #fff;
    z-index: 110;
    position: relative;
    border: 1px solid #efefef; }
  .order-status-wrapper.container .app-download-header {
    max-width: 430px;
    height: 150px;
    margin-left: auto;
    margin-right: auto;
    margin-bottom: -60px;
    overflow: hidden;
    z-index: 10;
    position: relative;
    float: center;
    background-size: contain;
    background-repeat: no-repeat;
    text-align: left; }
    .order-status-wrapper.container .app-download-header.multi-delivery {
      margin-bottom: -150px;
      float: right; }
    .order-status-wrapper.container .app-download-header a {
      color: #0088cc;
      font-weight: 600; }
    .order-status-wrapper.container .app-download-header .app-download-image {
      content: '';
      background-image: url(OrderStatus-Phone-3dc7c37b271f776b2d40263ee28142c8.jpg);
      width: 90px;
      height: 180px;
      position: absolute;
      display: block;
      background-size: contain;
      background-repeat: no-repeat;
      -webkit-animation: appDownloadSlideUpBounce 1s ease;
      -moz-animation: appDownloadSlideUpBounce 1s ease;
      animation: appDownloadSlideUpBounce 1s ease; }
    .order-status-wrapper.container .app-download-header .app-download-message {
      font-size: 14px;
      padding-left: 110px;
      position: absolute;
      top: 30px;
      font-weight: 600;
      -webkit-animation: appDownloadSlideUp 1.5s ease;
      -moz-animation: appDownloadSlideUp 1.5s ease;
      animation: appDownloadSlideUp 1.5s ease; }
      @media (max-width: 576px) {
        .order-status-wrapper.container .app-download-header .app-download-message {
          top: 10px; } }
      .order-status-wrapper.container .app-download-header .app-download-message p {
        margin: 0;
        margin-bottom: 5px; }
  .order-status-wrapper.container .order-status-header {
    overflow: hidden;
    background-color: #CAF3CA;
    min-height: 200px;
    padding: 10px 50px;
    margin-bottom: 15px;
    background-repeat: no-repeat;
    background-size: contain; }
    @media (max-width: 767px) {
      .order-status-wrapper.container .order-status-header {
        background-image: none !important; } }
    .order-status-wrapper.container .order-status-header.multi-store {
      margin-top: 0;
      border-top-left-radius: 0;
      border-top-right-radius: 0;
      border-top: 0; }
    .order-status-wrapper.container .order-status-header > p {
      font-size: 16px; }
    .order-status-wrapper.container .order-status-header .address-heading {
      margin: 5px 0 10px 0; }
  .order-status-wrapper.container .order-status-tracker .status-stages {
    margin: 0;
    padding: 0;
    border: 2px solid #43B02A;
    border-radius: 4px; }
  @media (max-width: 767px) {
    .order-status-wrapper.container .order-status-tracker {
      margin: 0 10px 0 0;
      width: 75%; } }
  .order-status-wrapper.container .order-status-tracker .status-stage {
    position: relative;
    list-style: none;
    padding: 12px 0;
    text-align: center;
    display: inline-block;
    width: 20%;
    background-color: #fff; }
    @media (min-width: 768px) {
      .order-status-wrapper.container .order-status-tracker .status-stage {
        border-right: 1px solid #43B02A; } }
    @media (max-width: 767px) {
      .order-status-wrapper.container .order-status-tracker .status-stage {
        display: block;
        padding: 8px !important;
        width: 100% !important; } }
    .order-status-wrapper.container .order-status-tracker .status-stage:last-child {
      border-right: none; }
      .order-status-wrapper.container .order-status-tracker .status-stage:last-child:after, .order-status-wrapper.container .order-status-tracker .status-stage:last-child:before {
        border-width: 0;
        z-index: -1; }
    .order-status-wrapper.container .order-status-tracker .status-stage:after, .order-status-wrapper.container .order-status-tracker .status-stage:before {
      left: 100%;
      top: -50%;
      border: solid transparent;
      content: " ";
      height: 0;
      width: 0;
      position: absolute;
      pointer-events: none;
      z-index: 1; }
    .order-status-wrapper.container .order-status-tracker .status-stage:after {
      border-left-color: #fff;
      border-width: 22px;
      margin-top: 22px; }
    .order-status-wrapper.container .order-status-tracker .status-stage:before {
      border-left-color: #43B02A;
      border-width: 24px;
      margin-top: 20px; }
    .order-status-wrapper.container .order-status-tracker .status-stage.completed {
      color: #43B02A; }
    .order-status-wrapper.container .order-status-tracker .status-stage.pick-up-state {
      width: 25%; }
    .order-status-wrapper.container .order-status-tracker .status-stage.active {
      color: #fff;
      animation: orderLivePulse 3s infinite;
      -webkit-animation: orderLivePulse 3s infinite; }
      .order-status-wrapper.container .order-status-tracker .status-stage.active:after {
        border-left-color: #43B02A;
        animation: orderLivePulseArrow 3s infinite;
        -webkit-animation: orderLivePulseArrow 3s infinite; }
  .order-status-wrapper.container .order-status-warehouse-selector {
    padding: 20px 30px 0 30px;
    border-top-left-radius: 4px;
    border-top-right-radius: 4px;
    margin-top: 15px;
    position: relative; }
    @media (max-width: 767px) {
      .order-status-wrapper.container .order-status-warehouse-selector {
        padding: 0 10px; } }
    .order-status-wrapper.container .order-status-warehouse-selector h2 {
      margin: 0;
      font-size: 24px; }
    .order-status-wrapper.container .order-status-warehouse-selector ul {
      margin: 0;
      margin-top: 20px;
      display: flex; }
    .order-status-wrapper.container .order-status-warehouse-selector li {
      font-size: 16px;
      list-style: none;
      display: inline-block;
      padding: 15px 30px;
      position: relative;
      border-top-left-radius: 4px;
      border-top-right-radius: 4px;
      margin-right: 5px;
      background-color: #a2cca2;
      transition: background-color .1s linear; }
      .order-status-wrapper.container .order-status-warehouse-selector li:hover {
        background-color: #CAF3CA;
        cursor: pointer; }
      .order-status-wrapper.container .order-status-warehouse-selector li.active {
        background-color: #CAF3CA; }
        .order-status-wrapper.container .order-status-warehouse-selector li.active a {
          color: #5dac55; }
      .order-status-wrapper.container .order-status-warehouse-selector li.canceled:before {
        content: '';
        background-image: url(cancel_icon_25x25-01815db164a3bb258c344beee8085f14.png);
        width: 20px;
        height: 20px;
        position: absolute;
        display: block;
        left: 5px;
        background-size: contain;
        background-repeat: no-repeat; }
      .order-status-wrapper.container .order-status-warehouse-selector li a {
        color: #393939;
        font-weight: 600; }
        .order-status-wrapper.container .order-status-warehouse-selector li a:hover, .order-status-wrapper.container .order-status-warehouse-selector li a:focus {
          text-decoration: none; }
    .order-status-wrapper.container .order-status-warehouse-selector.canceled {
      background-color: #fff;
      border: 1px solid #E5EDEC;
      border-bottom: 0; }
      .order-status-wrapper.container .order-status-warehouse-selector.canceled li.active {
        background-color: #F4CBCD;
        border-bottom: 0; }
        .order-status-wrapper.container .order-status-warehouse-selector.canceled li.active a {
          color: inherit; }
    .order-status-wrapper.container .order-status-warehouse-selector.small {
      padding: 5px 30px;
      border-radius: 4px;
      background-color: #CAF3CA; }
      .order-status-wrapper.container .order-status-warehouse-selector.small ul,
      .order-status-wrapper.container .order-status-warehouse-selector.small h2 {
        display: inline-block; }
      .order-status-wrapper.container .order-status-warehouse-selector.small h2 {
        font-size: 16px; }
      .order-status-wrapper.container .order-status-warehouse-selector.small ul {
        margin-top: 0; }
      .order-status-wrapper.container .order-status-warehouse-selector.small li {
        padding: 15px 20px;
        background: transparent; }
        .order-status-wrapper.container .order-status-warehouse-selector.small li:hover a, .order-status-wrapper.container .order-status-warehouse-selector.small li.active a, .order-status-wrapper.container .order-status-warehouse-selector.small li.active.canceled a {
          border-bottom: 2px solid;
          padding-bottom: 5px; }
        .order-status-wrapper.container .order-status-warehouse-selector.small li.canceled:before {
          display: none; }
  .order-status-wrapper.container .order-status-map-wrapper {
    width: 100%; }
    @media (min-width: 768px) {
      .order-status-wrapper.container .order-status-map-wrapper {
        height: 350px;
        margin-top: 80px;
        margin-bottom: 20px; } }
    .order-status-wrapper.container .order-status-map-wrapper:hover {
      cursor: auto; }
    .order-status-wrapper.container .order-status-map-wrapper .order-status-driver-icon {
      width: 50px;
      height: 50px; }
      .order-status-wrapper.container .order-status-map-wrapper .order-status-driver-icon:after {
        content: '';
        position: relative;
        top: -144px;
        left: -7px;
        background-image: url(map_icon_shadow-56738ab9394d24200da8e148a86888ae.png);
        width: 102px;
        height: 102px;
        display: block;
        z-index: -3; }
      .order-status-wrapper.container .order-status-map-wrapper .order-status-driver-icon .avatar-wrapper {
        border-radius: 50%;
        border: 5px solid #FF5600;
        position: relative;
        left: -24px;
        top: -58px; }
        .order-status-wrapper.container .order-status-map-wrapper .order-status-driver-icon .avatar-wrapper:after {
          content: '';
          width: 0;
          height: 0;
          border-style: solid;
          border-width: 16.3px 17.5px 0 17.5px;
          border-color: #FF5600 transparent transparent transparent;
          position: absolute;
          top: 38px;
          left: 3px;
          z-index: -1; }
        .order-status-wrapper.container .order-status-map-wrapper .order-status-driver-icon .avatar-wrapper img {
          border: 3px solid #fff;
          border-radius: 50%; }
      .order-status-wrapper.container .order-status-map-wrapper .order-status-driver-icon .eta-bubble {
        position: absolute;
        top: -58px;
        left: -16px;
        background: #fff;
        border-radius: 25px;
        z-index: -2;
        height: 50px;
        width: 220px;
        padding: 10px 0 0 50px; }
        .order-status-wrapper.container .order-status-map-wrapper .order-status-driver-icon .eta-bubble p {
          margin: 0;
          white-space: nowrap;
          font-weight: 600;
          line-height: 16px;
          font-size: 14px;
          font-family: "Open Sans", "Helvetica Neue", Helvetica, sans-serif; }
          .order-status-wrapper.container .order-status-map-wrapper .order-status-driver-icon .eta-bubble p.progress-txt {
            font-weight: normal;
            font-size: 12px; }
      .order-status-wrapper.container .order-status-map-wrapper .order-status-driver-icon .progress-clock {
        background-color: #FF5600;
        border-radius: 50%;
        height: 50px;
        width: 50px;
        position: absolute;
        top: 0;
        right: 0; }
        .order-status-wrapper.container .order-status-map-wrapper .order-status-driver-icon .progress-clock:before {
          color: #fff;
          display: block;
          text-align: center;
          position: relative;
          font-size: 26px;
          top: 50%;
          transform: translateY(-50%); }
    .order-status-wrapper.container .order-status-map-wrapper .leaflet-shadow-pane img {
      max-width: none;
      max-height: none; }
  .order-status-wrapper.container .post-order-status-message h1 {
    font-size: 18px;
    font-weight: 600;
    line-height: 18px;
    margin-top: 15px; }
  .order-status-wrapper.container .post-order-status-message p {
    margin-bottom: 0;
    font-size: 16px; }
  .order-status-wrapper.container .post-order-status-message .rating-link-wrapper {
    margin-top: 25px; }
  .order-status-wrapper.container .post-order-status-message .receipt-link {
    background-color: transparent;
    color: #61B450; }
    .order-status-wrapper.container .post-order-status-message .receipt-link.canceled {
      color: #D0232A;
      border-color: #D0232A; }
  .order-status-wrapper.container .order-status-message {
    margin-top: 75px; }
    @media (max-width: 767px) {
      .order-status-wrapper.container .order-status-message {
        margin-left: 0;
        margin-right: 0; } }
  .order-status-wrapper.container .multi-store .order-status-message {
    margin-top: 45px; }
  .order-status-wrapper.container .order-summary-items {
    margin-bottom: 60px; }
    .order-status-wrapper.container .order-summary-items.no-bottom-margin {
      margin-bottom: 0; }
  .order-status-wrapper.container .order-summary-item-list {
    margin-top: 15px; }
    @media (max-width: 576px) {
      .order-status-wrapper.container .order-summary-item-list {
        font-size: 12px; } }
    .order-status-wrapper.container .order-summary-item-list:first-child {
      margin-top: 45px; }
    .order-status-wrapper.container .order-summary-item-list h4 {
      font-weight: normal;
      color: inherit;
      font-size: 18px;
      margin-bottom: 0;
      background-color: #fff;
      border-bottom: 2px solid #43B02A;
      padding-bottom: 12px;
      z-index: 999; }
    .order-status-wrapper.container .order-summary-item-list .stick h4 {
      background: #fff;
      padding: 15px 30px 0 30px;
      margin-top: 0;
      border-bottom: 0; }
      .order-status-wrapper.container .order-summary-item-list .stick h4:before {
        display: none; }
      .order-status-wrapper.container .order-summary-item-list .stick h4 span {
        border-bottom: 2px solid #43B02A;
        padding-bottom: 12px;
        display: block; }
    .order-status-wrapper.container .order-summary-item-list .sticky-header-wrapper {
      min-height: 31px; }
    .order-status-wrapper.container .order-summary-item-list h4:before,
    .order-status-wrapper.container .order-summary-item-list .stick h4 span:before {
      content: '';
      width: 20px;
      height: 20px;
      display: inline-block;
      background-size: contain;
      margin-right: 5px;
      margin-bottom: -4px;
      background-repeat: no-repeat; }
    .order-status-wrapper.container .order-summary-item-list h4.items-found:before,
    .order-status-wrapper.container .order-summary-item-list .stick h4.items-found span:before {
      background-image: url(found_icon_25x25-30585a74805f59411cfb87d5d2234cbb.png); }
    .order-status-wrapper.container .order-summary-item-list h4.items-not-found:before,
    .order-status-wrapper.container .order-summary-item-list .stick h4.items-not-found span:before {
      background-image: url(not_found_icon_25x25-ab5bedf8d09469b672f6ecc322093956.png); }
    .order-status-wrapper.container .order-summary-item-list h4.items-to-refund:before,
    .order-status-wrapper.container .order-summary-item-list .stick h4.items-to-refund span:before {
      background-image: url(refund_icon_25x25-225129d5b50d5dc746117317846438ba.png); }
    .order-status-wrapper.container .order-summary-item-list h4.items-replaced:before,
    .order-status-wrapper.container .order-summary-item-list .stick h4.items-replaced span:before {
      background-image: url(replacement_icon_25x25-daf7bc5324992d51eae612eaf12b6064.png); }
    .order-status-wrapper.container .order-summary-item-list .to-be-shopped li.ic-icon-cart-filled:before {
      color: #43B02A;
      position: absolute;
      font-size: 24px;
      top: 0;
      left: -40px;
      bottom: 0;
      margin: auto; }
  .order-status-wrapper.container .order-summary-topper {
    background-color: #CAF3CA;
    margin-left: -30px;
    margin-right: -30px;
    margin-top: -30px;
    padding: 22px 30px;
    font-size: 16px; }
    @media (max-width: 767px) {
      .order-status-wrapper.container .order-summary-topper {
        margin-left: -15px;
        margin-right: -15px;
        margin-top: -15px; } }
    .order-status-wrapper.container .order-summary-topper > p {
      margin-bottom: 0; }
  .order-status-wrapper.container .order-summary-header {
    margin-top: 20px;
    font-weight: bold;
    font-size: 22px; }
    .order-status-wrapper.container .order-summary-header h3 {
      line-height: 26px;
      font-size: 20px;
      font-weight: bold; }
    .order-status-wrapper.container .order-summary-header .cancel-order {
      background-color: transparent;
      color: #61B450;
      margin-right: 8px; }
    @media (max-width: 991px) {
      .order-status-wrapper.container .order-summary-header .order-summary-header-text {
        text-align: center; } }
    .order-status-wrapper.container .order-summary-header .order-summary-header-text h3 {
      margin-top: 0;
      margin-bottom: 10px; }
    .order-status-wrapper.container .order-summary-header .order-summary-header-actions {
      display: flex;
      flex-wrap: wrap;
      justify-content: center; }
  .order-status-wrapper.container .order-status-item {
    list-style: none;
    border-bottom: 1px solid white;
    margin-top: 20px;
    padding-bottom: 20px;
    position: relative;
    will-change: max-height, margin-top, margin-bottom;
    -webkit-backface-visibility: hidden;
    backface-visibility: hidden; }
    .order-status-wrapper.container .order-status-item h5 {
      margin-top: 0;
      margin-bottom: 5px;
      font-size: 14px;
      font-weight: 600; }
      @media (max-width: 576px) {
        .order-status-wrapper.container .order-status-item h5 {
          font-size: 12px; } }
    .order-status-wrapper.container .order-status-item:last-child {
      border-bottom: none; }
    .order-status-wrapper.container .order-status-item.new-item {
      animation: slideInNewItem;
      animation-duration: 400ms;
      animation-timing-function: ease-in;
      z-index: 900; }
  .order-status-wrapper.container .order-status-item-details > p {
    color: #b0b0b0;
    margin-bottom: 5px; }
  .order-status-wrapper.container .order-status-item-details > h4 {
    margin-bottom: 5px; }
  .order-status-wrapper.container .order-status-item-qty .ic-btn {
    min-width: 55px;
    width: auto;
    padding: 3px 5px; }
    .order-status-wrapper.container .order-status-item-qty .ic-btn span {
      float: left;
      padding-left: 10px; }
  .order-status-wrapper.container .order-status-item-qty .icDropdownItems {
    width: 100px;
    min-width: 100px;
    max-width: 100px;
    text-align: center;
    left: -25px; }
  .order-status-wrapper.container .order-status-item-qty .item-custom-qty-wrapper input {
    margin-bottom: 0; }
  .order-status-wrapper.container .order-status-item-price {
    padding-right: 10px; }
    .order-status-wrapper.container .order-status-item-price p {
      font-weight: bold; }
    .order-status-wrapper.container .order-status-item-price .text-right {
      display: block; }
    .order-status-wrapper.container .order-status-item-price .ic-loading {
      padding-right: 13px; }
  .order-status-wrapper.container .order-status-item-image-wrapper {
    height: 80px; }
    .order-status-wrapper.container .order-status-item-image-wrapper img {
      max-height: 100%; }
    @media (max-width: 576px) {
      .order-status-wrapper.container .order-status-item-image-wrapper {
        padding: 0; } }
  .order-status-wrapper.container .order-status-item-actions {
    padding-right: 50px; }
    .order-status-wrapper.container .order-status-item-actions .item-note-wrapper {
      margin-top: 5px;
      margin-bottom: 10px; }
    .order-status-wrapper.container .order-status-item-actions .itemNoteWrapper {
      margin-bottom: 10px; }
    .order-status-wrapper.container .order-status-item-actions .replacement-item-detail {
      padding: 0; }
    .order-status-wrapper.container .order-status-item-actions p.no-item {
      font-size: 14px;
      margin-bottom: 5px; }
    .order-status-wrapper.container .order-status-item-actions .emph {
      color: #000;
      font-weight: bold; }
    .order-status-wrapper.container .order-status-item-actions .ic-icon-replace-bold {
      margin-right: 5px;
      vertical-align: middle; }
  .order-status-wrapper.container .order-summary-totals h4,
  .order-status-wrapper.container .order-total-wrapper h4 {
    font-weight: normal;
    color: inherit;
    font-size: 18px;
    border-bottom: 2px solid #43B02A;
    padding-bottom: 12px; }
  .order-status-wrapper.container .order-summary-totals table,
  .order-status-wrapper.container .order-total-wrapper table {
    width: 100%; }
  .order-status-wrapper.container .order-summary-totals .promotion,
  .order-status-wrapper.container .order-total-wrapper .promotion {
    text-align: left;
    font-weight: 600; }
  .order-status-wrapper.container .order-summary-totals .first-row,
  .order-status-wrapper.container .order-total-wrapper .first-row {
    padding-top: 15px; }
  .order-status-wrapper.container .order-summary-totals td,
  .order-status-wrapper.container .order-total-wrapper td {
    width: 50%; }
    .order-status-wrapper.container .order-summary-totals td:last-child,
    .order-status-wrapper.container .order-total-wrapper td:last-child {
      text-align: right;
      padding-right: 30px; }
    .order-status-wrapper.container .order-summary-totals td.you-saved,
    .order-status-wrapper.container .order-total-wrapper td.you-saved {
      text-align: left;
      font-weight: 600;
      margin-top: 15px;
      float: left; }
  .order-status-wrapper.container .order-summary-totals .total-help-text {
    margin-top: 25px;
    font-size: smaller; }
  .order-status-wrapper.container .order-total-wrapper {
    margin-top: 15px;
    z-index: 100; }
    .order-status-wrapper.container .order-total-wrapper .tooltip .tooltip-arrow {
      border-right-color: #ccc; }
    .order-status-wrapper.container .order-total-wrapper .tooltip .tooltip-inner {
      max-width: 300px;
      background-color: #ccc; }
    .order-status-wrapper.container .order-total-wrapper .ic-icon-info-filled {
      margin-left: 10px;
      font-size: 16px;
      vertical-align: middle;
      color: #ccc; }
      .order-status-wrapper.container .order-total-wrapper .ic-icon-info-filled:hover {
        cursor: pointer; }
  .order-status-wrapper.container .order-status-bulletin {
    padding-left: 0px; }
  .order-status-wrapper.container .order-status-order-info {
    position: relative; }
    .order-status-wrapper.container .order-status-order-info .update-tip {
      margin-right: 0.5em;
      margin-top: 0.5em; }
    .order-status-wrapper.container .order-status-order-info button.update-tip-button {
      width: auto;
      margin-top: 0.5em; }
    .order-status-wrapper.container .order-status-order-info .edit {
      position: absolute;
      top: 15px;
      right: 15px;
      color: #43B02A;
      font-weight: 600; }
      .order-status-wrapper.container .order-status-order-info .edit.cancel {
        right: 55px;
        font-weight: normal; }
  .order-status-wrapper.container .order-status-shopper-info {
    margin-bottom: 15px; }
    .order-status-wrapper.container .order-status-shopper-info .shopper-chat {
      margin: -15px; }
  .order-status-wrapper.container .order-info-heading-wrapper {
    margin-bottom: 15px; }
    .order-status-wrapper.container .order-info-heading-wrapper h3 {
      margin-bottom: 0;
      line-height: 26px;
      font-size: 20px;
      font-weight: bold;
      margin-top: 25px; }
  .order-status-wrapper.container .order-info-details-section {
    margin-bottom: 15px; }
    .order-status-wrapper.container .order-info-details-section > p {
      margin-bottom: 0; }
  .order-status-wrapper.container .order-info-details-editing-section {
    margin: 10px 0 15px 0; }
    .order-status-wrapper.container .order-info-details-editing-section button.order-status-tip-btn {
      padding-left: 0;
      padding-right: 0; }
      .order-status-wrapper.container .order-info-details-editing-section button.order-status-tip-btn > div {
        font-size: 12px;
        text-align: center; }
    .order-status-wrapper.container .order-info-details-editing-section [class*="span"] {
      min-height: 1px; }
    .order-status-wrapper.container .order-info-details-editing-section .ic-btn,
    .order-status-wrapper.container .order-info-details-editing-section .icDropdown,
    .order-status-wrapper.container .order-info-details-editing-section .icDropdownItems {
      width: 100%;
      text-align: left; }
    .order-status-wrapper.container .order-info-details-editing-section .icDropdownItems {
      padding: 8px 0; }
    .order-status-wrapper.container .order-info-details-editing-section .icDropdownItem {
      padding: 8px 14px; }
    .order-status-wrapper.container .order-info-details-editing-section .icDropdown {
      padding: 5px 0; }
      .order-status-wrapper.container .order-info-details-editing-section .icDropdown [class*="col-"] {
        padding: 0; }
    .order-status-wrapper.container .order-info-details-editing-section p {
      margin-bottom: 5px; }
    .order-status-wrapper.container .order-info-details-editing-section input[type="text"],
    .order-status-wrapper.container .order-info-details-editing-section textarea {
      display: block;
      width: 100%;
      height: 40px;
      margin: 0; }
    .order-status-wrapper.container .order-info-details-editing-section textarea {
      min-height: 40px;
      max-width: 100%; }
  .order-status-wrapper.container .order-delivery-wrapper.received .order-status-header {
    background-image: url(OrderStatus-Received-7486983e90cc0ecb3ad174466ebb999c.jpg); }
  .order-status-wrapper.container .order-delivery-wrapper.received .order-status-message {
    margin-top: 5px; }
  .order-status-wrapper.container .order-delivery-wrapper.received .order-status-shopper-info {
    display: none; }
  .order-status-wrapper.container .order-delivery-wrapper.inProgress .order-status-header {
    background-image: url(OrderStatus-InProgress-1be945def2e5d4a43ea2e27432eec921.jpg); }
  .order-status-wrapper.container .order-delivery-wrapper.staged .order-status-header {
    background-image: url(OrderStatus-Staged-51e5fb91213e0eafc33302129ced8295.jpg); }
  .order-status-wrapper.container .order-delivery-wrapper.staged .order-status-shopper-info {
    border-bottom: 0;
    border-bottom-left-radius: 0;
    border-bottom-right-radius: 0;
    margin-bottom: 0; }
  .order-status-wrapper.container .order-delivery-wrapper.staged .order-status-order-info {
    border-top: 0;
    border-top-left-radius: 0;
    border-top-right-radius: 0; }
  .order-status-wrapper.container .order-delivery-wrapper.inTransit .order-status-header {
    height: auto; }
  .order-status-wrapper.container .order-delivery-wrapper.delivered .order-status-header {
    background-image: url(OrderStatus-Delivered-2fa1e0c8da73e03efd479635228c6130.jpg);
    min-height: 100px; }
    .order-status-wrapper.container .order-delivery-wrapper.delivered .order-status-header .order-status-message {
      margin-top: 0; }
    .order-status-wrapper.container .order-delivery-wrapper.delivered .order-status-header h2 {
      margin: 0; }
  .order-status-wrapper.container .order-delivery-wrapper.delivered .order-status-shopper-info {
    border-bottom: 0;
    border-bottom-left-radius: 0;
    border-bottom-right-radius: 0;
    margin-bottom: 0;
    padding-bottom: 15px; }
  .order-status-wrapper.container .order-delivery-wrapper.delivered .order-status-order-info {
    border-top: 0;
    border-top-left-radius: 0;
    border-top-right-radius: 0;
    padding-top: 0; }
    .order-status-wrapper.container .order-delivery-wrapper.delivered .order-status-order-info .order-info-heading-wrapper h3 {
      margin-top: 0; }
  .order-status-wrapper.container .order-delivery-wrapper.canceled .order-status-header {
    background-color: #F4CBCD;
    height: 55px;
    min-height: 55px; }
    .order-status-wrapper.container .order-delivery-wrapper.canceled .order-status-header .order-status-message {
      margin-top: 0; }
    .order-status-wrapper.container .order-delivery-wrapper.canceled .order-status-header .address-heading {
      margin-bottom: 0; }
    .order-status-wrapper.container .order-delivery-wrapper.canceled .order-status-header .receipt-link {
      background-color: #D0232A;
      border-color: #D0232A; }
    .order-status-wrapper.container .order-delivery-wrapper.canceled .order-status-header h2 {
      margin: 0; }
  .order-status-wrapper.container .order-delivery-wrapper.canceled .canceled-text {
    color: #D02F37; }
  .order-status-wrapper.container .order-status-recommendations-wrapper {
    height: 135px;
    overflow: hidden; }
    @media (max-width: 767px) {
      .order-status-wrapper.container .order-status-recommendations-wrapper {
        display: none; } }
    .order-status-wrapper.container .order-status-recommendations-wrapper strong {
      font-size: 18px;
      font-weight: 600;
      color: #43B02A; }
    .order-status-wrapper.container .order-status-recommendations-wrapper p {
      font-size: 16px; }
    .order-status-wrapper.container .order-status-recommendations-wrapper ul {
      margin-bottom: 0; }
    .order-status-wrapper.container .order-status-recommendations-wrapper .order-status-recommendation-inner {
      height: 100%; }
    .order-status-wrapper.container .order-status-recommendations-wrapper .grocery-bag {
      background-image: url(shopping_bag-ca31828d1db8b8161a884b3fa08a5512.png);
      height: 135px;
      width: 13%;
      background-repeat: no-repeat;
      float: left;
      background-size: 65%;
      background-position: bottom center;
      display: inline-block;
      top: 5px;
      position: relative; }
      @media only screen and (-webkit-min-device-pixel-ratio: 1.3), only screen and (min--moz-device-pixel-ratio: 1.3), only screen and (-o-min-device-pixel-ratio: 1.3 / 1), only screen and (min-resolution: 125dpi), only screen and (min-resolution: 1.3dppx) {
        .order-status-wrapper.container .order-status-recommendations-wrapper .grocery-bag {
          background-image: url(shopping_bag@2x-49b26ea5a8eac0f62ae632a46c0ebd9f.png);
          background-size: 65%; } }
    .order-status-wrapper.container .order-status-recommendations-wrapper .order-status-recommendations-list-wrapper {
      -webkit-transition: all 150ms ease-in-out;
      -moz-transition: all 150ms ease-in-out;
      transition: all 150ms ease-in-out;
      transform: translateY(0px); }
    .order-status-wrapper.container .order-status-recommendations-wrapper .recommendations-headline {
      -webkit-transition: opacity 150ms ease-in-out;
      -moz-transition: opacity 150ms ease-in-out;
      transition: opacity 150ms ease-in-out;
      opacity: 1; }
    .order-status-wrapper.container .order-status-recommendations-wrapper:hover .order-status-recommendations-list-wrapper {
      transform: translateY(-43px); }
    .order-status-wrapper.container .order-status-recommendations-wrapper:hover .recommendations-headline {
      opacity: 0; }
    .order-status-wrapper.container .order-status-recommendations-wrapper.no-hover {
      height: auto; }
      .order-status-wrapper.container .order-status-recommendations-wrapper.no-hover:hover .order-status-recommendations-list-wrapper {
        transform: translateY(0); }
      .order-status-wrapper.container .order-status-recommendations-wrapper.no-hover:hover .recommendations-headline {
        opacity: 1; }
      .order-status-wrapper.container .order-status-recommendations-wrapper.no-hover .order-status-recommendation {
        border-bottom: 1px solid #efefef; }
    .order-status-wrapper.container .order-status-recommendations-wrapper .order-status-recommendations-list-inner-wrapper {
      width: 85%;
      float: left;
      position: relative; }
    .order-status-wrapper.container .order-status-recommendations-wrapper .order-status-recommendations-list {
      width: 100%;
      position: relative; }
    .order-status-wrapper.container .order-status-recommendations-wrapper .order-status-recommendation {
      height: 135px;
      width: 20%;
      border: 1px solid #efefef;
      border-right: 0;
      border-bottom: 0;
      background-color: #fff; }
      .order-status-wrapper.container .order-status-recommendations-wrapper .order-status-recommendation:last-child {
        border-right: 1px solid #efefef; }
      .order-status-wrapper.container .order-status-recommendations-wrapper .order-status-recommendation:hover .recommendation-action-wrapper {
        display: block; }
      .order-status-wrapper.container .order-status-recommendations-wrapper .order-status-recommendation .recommendation-img-wrapper {
        position: relative;
        height: 100%; }
        .order-status-wrapper.container .order-status-recommendations-wrapper .order-status-recommendation .recommendation-img-wrapper img {
          max-width: 65%; }
      .order-status-wrapper.container .order-status-recommendations-wrapper .order-status-recommendation .recommendation-action-wrapper {
        display: none;
        position: absolute;
        bottom: 0;
        left: 0;
        width: 100%;
        height: 100%;
        background-color: rgba(255, 255, 255, 0.85);
        padding: 10px; }
        .order-status-wrapper.container .order-status-recommendations-wrapper .order-status-recommendation .recommendation-action-wrapper .ic-btn {
          font-size: 18px;
          bottom: 10px;
          right: 10px;
          position: absolute; }
        .order-status-wrapper.container .order-status-recommendations-wrapper .order-status-recommendation .recommendation-action-wrapper p.item-price {
          position: absolute;
          bottom: 30px;
          font-size: 16px;
          font-weight: 700;
          margin: 0;
          float: left; }
        .order-status-wrapper.container .order-status-recommendations-wrapper .order-status-recommendation .recommendation-action-wrapper p.item-title {
          font-size: 14px;
          font-weight: 600;
          line-height: 16px; }
        .order-status-wrapper.container .order-status-recommendations-wrapper .order-status-recommendation .recommendation-action-wrapper p.item-size {
          font-size: 10px;
          margin: 0;
          bottom: 10px;
          position: absolute; }
  .order-status-wrapper.container .order-changes-education-banner {
    position: relative;
    margin-bottom: 15px; }
    .order-status-wrapper.container .order-changes-education-banner .order-changes-education-banner-inner {
      background-color: #fff;
      padding: 15px;
      padding-bottom: 0;
      border: 1px solid #efefef;
      border-radius: 4px; }
    .order-status-wrapper.container .order-changes-education-banner .order-changes-education-banner-inner-container {
      max-width: 420px;
      margin: 0 auto; }
    .order-status-wrapper.container .order-changes-education-banner .close-btn {
      position: absolute;
      top: 10px;
      right: 25px;
      font-size: 14px;
      color: #ccc;
      -webkit-transition: color 100ms linear;
      -moz-transition: color 100ms linear;
      transition: color 100ms linear; }
      .order-status-wrapper.container .order-changes-education-banner .close-btn:hover {
        cursor: pointer;
        color: #aaa; }
    .order-status-wrapper.container .order-changes-education-banner .phone-img {
      background-image: url(order_changes_phone-38de2dee0fa1c7c7bac20015314ba0d5.png);
      background-repeat: no-repeat;
      height: 81px;
      width: 66px;
      float: right; }
      @media only screen and (-webkit-min-device-pixel-ratio: 1.3), only screen and (min--moz-device-pixel-ratio: 1.3), only screen and (-o-min-device-pixel-ratio: 1.3 / 1), only screen and (min-resolution: 125dpi), only screen and (min-resolution: 1.3dppx) {
        .order-status-wrapper.container .order-changes-education-banner .phone-img {
          background-image: url(order_changes_phone@2x-c56f6ec240d1d3cc7914bf72aeb27e31.png);
          background-size: 66px; } }
      @media only screen and (-webkit-min-device-pixel-ratio: 3), only screen and (min-resolution: 3dppx), only screen and (min-resolution: 350dpi) {
        .order-status-wrapper.container .order-changes-education-banner .phone-img {
          background-image: url(order_changes_phone@3x-973799c7d4abfef42ff9e6120614c53d.png);
          background-size: 66px; } }
    .order-status-wrapper.container .order-changes-education-banner .order-changes-new-icon {
      position: absolute;
      top: -5px;
      left: 15px; }
    .order-status-wrapper.container .order-changes-education-banner p {
      margin-bottom: 5px; }
    .order-status-wrapper.container .order-changes-education-banner strong {
      font-weight: 600; }
    .order-status-wrapper.container .order-changes-education-banner a {
      color: #43B02A;
      font-weight: 600; }
  @media (max-width: 1200px) {
    .order-status-wrapper.container .order-status-recommendations-wrapper .order-status-recommendation .recommendation-action-wrapper p.item-title {
      font-size: 12px; }
    .order-status-wrapper.container .order-status-header {
      background-position-y: 38px;
      padding: 10px 15px; }
    .order-status-wrapper.container .order-status-charity-banner {
      height: 230px; }
    .order-status-wrapper.container .order-status-item-qty .item-custom-qty-wrapper input {
      font-size: 16px;
      text-align: left;
      line-height: 23px; }
    .order-status-wrapper.container .order-status-item-qty .item-custom-qty-wrapper .ic-input-append {
      font-size: 16px;
      line-height: 25px; }
    .order-status-wrapper.container .order-status-item-actions {
      padding-right: 30px; }
    .order-status-wrapper.container .order-delivery-wrapper.delivered .order-status-header {
      background-position-y: 18px; }
    .order-status-wrapper.container .order-summary-header .ic-btn {
      font-size: 12px; }
    .order-status-wrapper.container .order-info-details-editing-section .ic-btn {
      white-space: normal;
      padding: 6px; } }
  @media (max-width: 980px) {
    .order-status-wrapper.container .order-status-header {
      background-position-y: 75px;
      padding: 10px 15px 0 15px; }
      .order-status-wrapper.container .order-status-header .post-order-status-message .ic-btn {
        font-size: 12px;
        padding: 6px 0; }
    .order-status-wrapper.container .order-status-charity-banner {
      height: 180px; }
    .order-status-wrapper.container .order-status-tracker .status-stage {
      font-size: 12px; }
      .order-status-wrapper.container .order-status-tracker .status-stage:after, .order-status-wrapper.container .order-status-tracker .status-stage:before {
        display: none; }
    .order-status-wrapper.container .order-status-item-qty .item-custom-qty-wrapper input {
      font-size: 14px; }
    .order-status-wrapper.container .order-status-item-qty .item-custom-qty-wrapper .ic-input-append {
      display: none; }
    .order-status-wrapper.container .order-status-item-actions {
      padding-right: 0; }
    .order-status-wrapper.container .order-delivery-wrapper.delivered .order-status-header {
      background-position-y: 36px; } }
  @media (max-width: 768px) {
    .order-status-wrapper.container .order-status-message h2 {
      font-size: 22px; }
    .order-status-wrapper.container .order-status-tracker .status-stage {
      padding: 5px 0;
      white-space: nowrap;
      text-overflow: ellipsis; }
    .order-status-wrapper.container .order-delivery-wrapper.canceled .order-status-header {
      height: 100px;
      min-height: 100px; }
    .order-status-wrapper.container .order-delivery-wrapper .address-heading {
      text-align: center; }
    .order-status-wrapper.container .order-status-bulletin {
      margin-left: 0;
      margin-top: 15px;
      padding-left: 0.9375rem; } }
  @media (max-width: 480px) {
    .order-status-wrapper.container .order-delivery-wrapper .order-status-header {
      background-position-y: 0;
      background-size: cover;
      padding: 10px; }
    .order-status-wrapper.container .order-status-message h2 {
      font-size: 20px;
      line-height: 20px; }
    .order-status-wrapper.container .order-status-item-price {
      padding: 0; }
      .order-status-wrapper.container .order-status-item-price .text-right {
        text-align: center; }
    .order-status-wrapper.container .order-status-item-qty {
      padding: 0; } }

.order-changes-new-icon {
  background-color: #E8104A;
  padding: 2px 5px;
  color: #fff;
  text-transform: uppercase;
  border-radius: 4px;
  font-size: 10px;
  font-weight: 700;
  text-rendering: optimizeLegibility; }

@-webkit-keyframes slideInNewItem {
  0% {
    overflow: hidden;
    max-height: 0;
    margin-top: 0;
    padding-bottom: 0; }
  100% {
    overflow: auto;
    max-height: 180px;
    margin-top: 20px;
    padding-bottom: 20px; } }

@keyframes slideInNewItem {
  0% {
    overflow: hidden;
    max-height: 0;
    margin-top: 0;
    padding-bottom: 0; }
  100% {
    overflow: auto;
    max-height: 180px;
    margin-top: 20px;
    padding-bottom: 20px; } }

@-webkit-keyframes orderLivePulse {
  0% {
    background-color: #43B02A; }
  50% {
    background-color: #87c46f; }
  100% {
    background-color: #43B02A; } }

@keyframes orderLivePulse {
  0% {
    background-color: #43B02A; }
  50% {
    background-color: #87c46f; }
  100% {
    background-color: #43B02A; } }

@-webkit-keyframes orderLivePulseArrow {
  0% {
    border-left-color: #43B02A; }
  50% {
    border-left-color: #87c46f; }
  100% {
    border-left-color: #43B02A; } }

@keyframes orderLivePulseArrow {
  0% {
    border-left-color: #43B02A; }
  50% {
    border-left-color: #87c46f; }
  100% {
    border-left-color: #43B02A; } }

.responsive-break {
  display: block; }
  @media (max-width: 576px) {
    .responsive-break {
      display: inline; } }

.order-item-list {
  margin: 0; }

@media (max-width: 767px) {
  .order-summary-wrapper {
    padding: 15px !important; } }

@media (max-width: 767px) {
  .order-status-header-content {
    display: flex;
    justify-content: center; } }

@media (max-width: 767px) {
  .order-summary-outter-wrapper,
  .order-status-bulletin {
    padding-left: 0 !important;
    padding-right: 0 !important; } }

@media (max-width: 767px) {
  .order-delivery-main-content {
    margin-left: 0 !important;
    margin-right: 0 !important; } }

.store_overlay {
  width: 100%;
  height: 100%;
  position: fixed;
  top: 0;
  left: 0;
  background-color: rgba(0, 0, 0, 0.6);
  z-index: 1010;
  display: none;
  opacity: 0; }
  .store_overlay.below-header-hero {
    z-index: 1001; }
  .store_overlay.active {
    animation: overlay-fadein .5s; }
  .store_overlay.active-no-fade, .store_overlay.active {
    display: block;
    opacity: inherit; }

@-webkit-keyframes overlay-fadein {
  0% {
    opacity: 0; }
  100% {
    opacity: 1; } }

@-moz-keyframes overlay-fadein {
  0% {
    opacity: 0; }
  100% {
    opacity: 1; } }

@keyframes overlay-fadein {
  0% {
    opacity: 0; }
  100% {
    opacity: 1; } }

.price-transparency-banner {
  margin-top: -24px; }
  .price-transparency-banner a {
    color: #fff;
    text-decoration: underline; }
    .price-transparency-banner a.price-transparency-pricing-link {
      text-decoration: none; }
      .price-transparency-banner a.price-transparency-pricing-link:hover {
        text-decoration: underline; }
  .price-transparency-banner p {
    color: white;
    font-weight: 600; }
  .price-transparency-banner p:before {
    display: inline-block;
    height: 16px;
    width: 16px;
    border-radius: 50%;
    line-height: 16px;
    margin-right: 6px;
    font-family: 'ic-icons';
    -webkit-font-smoothing: antialiased;
    -moz-osx-font-smoothing: grayscale;
    vertical-align: middle; }
  .price-transparency-banner p.same:before {
    content: '\E03C';
    background-color: #43B02A;
    font-size: 10px; }
  .price-transparency-banner p.higher:before {
    content: '\E01E';
    color: #F7A700;
    background-color: #fff;
    font-size: 17px;
    font-weight: 100;
    line-height: 16px; }

.RatingCompleteModal {
  max-width: 580px;
  text-align: center;
  padding: 0 20px; }
  .RatingCompleteModal h3 {
    font-size: 24px;
    line-height: 1.7;
    font-weight: 600;
    margin-top: 22px;
    margin-bottom: 11px; }
  .RatingCompleteModal .RatingCompleteModal-image--sad {
    background-image: url(circle-star-art@2x-ee37fa56df5b91f8b4e63122968bcf00.png);
    background-size: contain;
    height: 100px;
    min-width: 50px;
    text-align: center;
    background-repeat: no-repeat;
    background-position: center; }

.Reactions {
  margin-top: 5px; }
  @media (max-width: 767px) {
    .Reactions {
      margin-top: 0; } }
  .Reactions .TotalScore {
    font-size: 11px;
    font-weight: 600;
    color: #757575;
    margin-left: 3px; }
  .Reactions .ReactionImage {
    height: 60px;
    width: 60px; }
  .Reactions .ReactionContainer {
    background-color: white;
    border-radius: 76px;
    position: absolute;
    left: 0px;
    top: 35px;
    z-index: 100;
    width: 360px;
    height: 133px;
    box-shadow: 0 3px 10px 0 rgba(0, 0, 0, 0.23);
    padding: 16px 24px; }
    @media (max-width: 576px) {
      .Reactions .ReactionContainer {
        left: -20px; } }
    @media (min-width: 768px) and (max-width: 1199px) {
      .Reactions .ReactionContainer {
        left: -55px; } }
    .Reactions .ReactionContainer .ReactionImage {
      margin: 6px; }
    .Reactions .ReactionContainer p {
      margin: 0px; }
  .Reactions .Reaction {
    display: inline-block;
    text-align: center;
    margin-right: 8px; }
    .Reactions .Reaction:last-child {
      margin-right: 0; }
    .Reactions .Reaction a {
      display: block;
      width: 60px;
      height: 65px;
      margin: 6px;
      transition: transform 200ms ease-in-out; }
      .Reactions .Reaction a:hover {
        transform: scale(1.1); }
      .Reactions .Reaction a:active {
        transform: scale(0.9); }
    .Reactions .Reaction .Label {
      font-weight: 600;
      line-height: 16px;
      text-align: center;
      margin-bottom: 4px; }
    .Reactions .Reaction .SubLabel {
      font-size: 11px;
      color: #757575; }
  .Reactions .ReactionOption {
    display: inline-block;
    width: 18.7px;
    height: 18.7px;
    margin-left: -5px; }
    .Reactions .ReactionOption img {
      width: 100%;
      height: 100%;
      border: 2px solid #fff;
      border-radius: 50%; }
    .Reactions .ReactionOption .ReactionSubLabel {
      display: none; }
  .Reactions .RateActionLink {
    display: inline-block;
    vertical-align: middle;
    color: #43B02A;
    text-align: center; }
    .Reactions .RateActionLink:hover {
      cursor: pointer; }
    .Reactions .RateActionLink span {
      display: inline-block;
      vertical-align: middle; }
  .Reactions .RateIcon {
    background-image: url(add-green-feaf0e7b6d8766b944b334a98aed4e14.png);
    background-repeat: no-repeat;
    display: inline-block;
    height: 22px;
    width: 22px;
    background-size: 22px;
    vertical-align: middle;
    margin-right: 5px; }
  @media (min-width: 992px) {
    .Reactions .NoReaction {
      min-width: 80px; } }
  .Reactions .NoReaction .NoReactionIcon {
    padding: 0 4px;
    position: relative;
    top: 4px; }
  @media (max-width: 991px) {
    .Reactions .NoReaction .NoReactionLabel {
      display: none; } }
  .Reactions .CurrentReaction {
    padding: 0 2px; }
    .Reactions .CurrentReaction a {
      display: block; }
    @media (min-width: 992px) {
      .Reactions .CurrentReaction {
        min-width: 80px; } }
    .Reactions .CurrentReaction .CurrentReactionLabel {
      margin-left: 4px;
      color: #e7003e;
      font-weight: 600;
      font-size: 11px; }
      @media (max-width: 991px) {
        .Reactions .CurrentReaction .CurrentReactionLabel {
          display: none; } }
      @media (min-width: 992px) and (max-width: 1199px) {
        .Reactions .CurrentReaction .CurrentReactionLabel {
          display: none; } }
    .Reactions .CurrentReaction .ReactionImage {
      width: 20px;
      height: 20px;
      border: none; }
  .Reactions.SpreadOptions .ReactionOption {
    display: inline-block;
    width: auto;
    min-width: 50px;
    height: 28px;
    margin-left: 0px;
    border: 2px solid #fff;
    border-radius: 50%; }
    .Reactions.SpreadOptions .ReactionOption img {
      width: 20px;
      height: 20px;
      border: none; }
    .Reactions.SpreadOptions .ReactionOption .ReactionSubLabel {
      color: #757575;
      display: inline-block;
      font-size: 11px;
      font-weight: 600;
      margin-left: 4px;
      margin-right: 10px; }
      @media (max-width: 991px) {
        .Reactions.SpreadOptions .ReactionOption .ReactionSubLabel {
          margin-left: 2px;
          margin-right: 4px; } }
      @media (min-width: 992px) and (max-width: 1199px) {
        .Reactions.SpreadOptions .ReactionOption .ReactionSubLabel {
          margin-left: 2px;
          margin-right: 4px; } }

.ReactionsDetailContainer {
  line-height: 28px;
  margin-top: -5px; }
  .ReactionsDetailContainer .col-md-9, .ReactionsDetailContainer .col-xs-10,
  .ReactionsDetailContainer .col-md-3, .ReactionsDetailContainer .col-xs-2 {
    padding: 0 8px; }

.change-item-modal {
  max-width: 800px; }
  .change-item-modal .item-li {
    display: inline-block; }
    .change-item-modal .item-li:hover {
      cursor: pointer; }
  .change-item-modal .item-name {
    overflow: hidden; }
  .change-item-modal .item-container {
    display: flex;
    justify-content: center; }
    .change-item-modal .item-container .item-details {
      display: flex;
      justify-content: center;
      flex-direction: column;
      margin-left: 10px; }
  .change-item-modal .no-results {
    text-align: center; }
  .change-item-modal .change-item-modal-content {
    width: 98%;
    margin: 0 auto; }
    .change-item-modal .change-item-modal-content ul {
      text-align: left; }
    @media (min-width: 992px) and (max-width: 1199px) {
      .change-item-modal .change-item-modal-content {
        width: 95%; } }
    @media (min-width: 768px) and (max-width: 991px) {
      .change-item-modal .change-item-modal-content {
        width: 71%; } }
    @media (max-width: 767px) {
      .change-item-modal .change-item-modal-content {
        width: 76%; } }
  @media (max-width: 1199px) {
    .change-item-modal {
      padding: 20px; } }

.current-retailer-card {
  text-align: center; }
  .current-retailer-card .RetailerLogo {
    margin: 0 auto; }
  .current-retailer-card .retailer-name {
    margin-top: 10px;
    font-weight: 600; }
  .current-retailer-card .retailer-button {
    width: 150px;
    display: block;
    margin: 0 auto; }

.partner-recipe-table {
  max-width: 1200px;
  margin: auto;
  border: 1px solid #E0E0E0;
  background-color: #fff;
  border-radius: 4px; }
  .partner-recipe-table .flex-vertical {
    display: flex;
    flex-direction: column; }
    .partner-recipe-table .flex-vertical .flex-spacer {
      min-height: 1px; }
  .partner-recipe-table .flex-horizontal {
    display: flex;
    justify-content: flex-start; }
    .partner-recipe-table .flex-horizontal .flex-spacer {
      min-width: 1px; }
  .partner-recipe-table .flex-spacer {
    flex: 1; }
  .partner-recipe-table .flex-between {
    justify-content: space-between; }
  .partner-recipe-table .flex-center {
    justify-content: center; }
  .partner-recipe-table .flex-small {
    flex-basis: 25%; }
  .partner-recipe-table .flex-large {
    flex-basis: 50%; }
  .partner-recipe-table .action-row {
    padding: 15px; }
  .partner-recipe-table .add-to-cart-button {
    font-size: 18px; }
  .partner-recipe-table .select-button {
    margin-top: 5px; }
  .partner-recipe-table .green-button {
    background-color: #fff;
    color: #43B02A;
    border: 1px solid #43B02A; }
    .partner-recipe-table .green-button:hover {
      background-color: #f0efec; }
    .partner-recipe-table .green-button:focus, .partner-recipe-table .green-button:active {
      outline: none;
      box-shadow: none; }
  .partner-recipe-table .header {
    color: #747474;
    font-weight: 600;
    font-size: 14px;
    border-top: 1px solid #E0E0E0;
    border-bottom: 1px solid #E0E0E0;
    padding: 10px 15px; }
    .partner-recipe-table .header.common-items-header {
      border-top: 0; }
      @media (max-width: 767px) {
        .partner-recipe-table .header.common-items-header .flex-small {
          flex-basis: 100%; } }

.PartnerRecipeRow {
  padding: 15px;
  border-bottom: 1px solid #E0E0E0;
  min-height: 80px; }
  .PartnerRecipeRow .item-quantity {
    color: #9e9e9e;
    font-size: 12px;
    margin-top: 3px; }
  .PartnerRecipeRow.unchecked:not(.unmatched) {
    opacity: 0.4; }
  .PartnerRecipeRow .fa-refresh {
    margin-right: 10px; }
  .PartnerRecipeRow .change-button-container {
    padding-left: 10px; }
  .PartnerRecipeRow .SimpleItemCard {
    display: flex;
    min-height: 50px; }
    .PartnerRecipeRow .SimpleItemCard .item-image {
      max-width: 80px; }
    .PartnerRecipeRow .SimpleItemCard .item-info {
      padding: 0;
      padding-left: 10px;
      display: flex;
      flex-direction: column;
      justify-content: center;
      flex-basis: 80%; }
      .PartnerRecipeRow .SimpleItemCard .item-info .item-name {
        font-size: 16px;
        font-weight: 600; }
      .PartnerRecipeRow .SimpleItemCard .item-info .item-details {
        font-weight: 600;
        font-size: 14px;
        color: #9e9e9e; }
        .PartnerRecipeRow .SimpleItemCard .item-info .item-details a {
          color: #43B02A; }
  .PartnerRecipeRow .no-match {
    padding-left: 60px; }
    .PartnerRecipeRow .no-match .no-match-text {
      color: #9e9e9e;
      font-size: 16px;
      font-weight: 600; }
    .PartnerRecipeRow .no-match .no-match-link {
      color: #43B02A;
      font-size: 12px; }
      .PartnerRecipeRow .no-match .no-match-link:hover {
        cursor: pointer; }
    @media (max-width: 767px) {
      .PartnerRecipeRow .no-match {
        text-align: center;
        margin-top: 15px; } }
  @media (max-width: 767px) {
    .PartnerRecipeRow {
      flex-wrap: wrap; }
      .PartnerRecipeRow .item-quantity {
        text-align: center; }
      .PartnerRecipeRow .flex-small,
      .PartnerRecipeRow .flex-large {
        flex-basis: 100%; }
      .PartnerRecipeRow .Checkbox {
        margin: 0 auto; }
      .PartnerRecipeRow .QtyStepper {
        margin: 0 auto;
        margin-top: 15px;
        margin-bottom: 15px; }
      .PartnerRecipeRow .item-container {
        flex-wrap: wrap; }
      .PartnerRecipeRow .SimpleItemCard {
        flex-basis: 100%;
        flex-wrap: wrap; }
        .PartnerRecipeRow .SimpleItemCard .item-image {
          flex-basis: 100%;
          margin: 0 auto; }
        .PartnerRecipeRow .SimpleItemCard .item-info {
          flex-basis: 100%;
          text-align: center; }
      .PartnerRecipeRow .change-button-container {
        flex-basis: 100%;
        margin-top: 20px; } }

.partner-recipe-checkout-modal {
  max-width: 550px; }
  .partner-recipe-checkout-modal .checkout-modal-header {
    text-align: center;
    padding: 15px;
    border-bottom: 2px solid #f2f2f2; }
    .partner-recipe-checkout-modal .checkout-modal-header h2 {
      font-weight: 600; }
  .partner-recipe-checkout-modal .checkout-modal-body {
    padding: 30px;
    text-align: center; }
  .partner-recipe-checkout-modal .current-retailer-card {
    margin-bottom: 10px; }
  .partner-recipe-checkout-modal button {
    width: 150px;
    display: block;
    margin: 0 auto; }
  .partner-recipe-checkout-modal .shopping-button {
    margin-bottom: 20px; }
  .partner-recipe-checkout-modal .green-button {
    background-color: #fff;
    color: #43B02A;
    border: 1px solid #43B02A; }
    .partner-recipe-checkout-modal .green-button:hover {
      background-color: #f0efec; }
    .partner-recipe-checkout-modal .green-button:focus, .partner-recipe-checkout-modal .green-button:active {
      outline: none;
      box-shadow: none; }
  .partner-recipe-checkout-modal .checkout-details {
    font-size: 12px;
    max-width: 400px;
    margin: 0 auto; }

.partner-recipe-current-retailer {
  max-width: 400px;
  margin: 0 auto;
  background: #fff;
  border: 1px solid #e0e0e0;
  position: relative;
  margin-bottom: 20px;
  padding: 10px;
  padding-right: 90px; }
  .partner-recipe-current-retailer .logo-container {
    display: table-cell; }
  .partner-recipe-current-retailer .retailer-name {
    font-size: 16px;
    font-weight: 600;
    display: inline-block;
    margin-left: 20px;
    margin-bottom: 0;
    display: table-cell;
    vertical-align: middle;
    padding-left: 15px; }
  .partner-recipe-current-retailer .ic-btn-white {
    color: #43B02A;
    border: 1px solid #43B02A;
    position: absolute;
    right: 10px;
    top: 34px; }
    .partner-recipe-current-retailer .ic-btn-white:hover {
      background-color: #f0efec; }
    .partner-recipe-current-retailer .ic-btn-white:focus, .partner-recipe-current-retailer .ic-btn-white:active {
      outline: none;
      box-shadow: none; }

.partner-recipe-info-modal {
  max-width: 815px; }
  .partner-recipe-info-modal .ic-loading {
    padding: 20px 0; }
  .partner-recipe-info-modal .ic-btn-white {
    color: #43B02A;
    border: 1px solid #43B02A; }
    .partner-recipe-info-modal .ic-btn-white:hover {
      background-color: #f0efec; }
    .partner-recipe-info-modal .ic-btn-white:focus, .partner-recipe-info-modal .ic-btn-white:active {
      outline: none;
      box-shadow: none; }
  .partner-recipe-info-modal .info-modal-header .location-container {
    padding: 15px;
    text-align: center; }
    .partner-recipe-info-modal .info-modal-header .location-container span {
      font-weight: 600;
      margin-right: 15px; }
  .partner-recipe-info-modal .info-modal-header .education-hero .content .outer-box .content-card {
    padding: 3px; }
    .partner-recipe-info-modal .info-modal-header .education-hero .content .outer-box .content-card .image-container {
      width: 3vw; }
    .partner-recipe-info-modal .info-modal-header .education-hero .content .outer-box .content-card h6, .partner-recipe-info-modal .info-modal-header .education-hero .content .outer-box .content-card p {
      font-size: 12px; }
  .partner-recipe-info-modal .current-retailer-card {
    padding: 15px; }
  .partner-recipe-info-modal .retailers {
    padding: 15px;
    background-color: #f7f7f7;
    border-top: 1px solid #e5edec; }
    .partner-recipe-info-modal .retailers .title {
      text-align: center; }
      .partner-recipe-info-modal .retailers .title h5 {
        color: #393939;
        font-size: 18px; }
      .partner-recipe-info-modal .retailers .title p {
        font-size: 14px; }
  .partner-recipe-info-modal .retailers-list {
    display: flex;
    flex-wrap: wrap; }
    .partner-recipe-info-modal .retailers-list .retailer-card {
      display: inline-block;
      text-align: center;
      width: 185px;
      padding: 15px 10px 15px 10px;
      margin: 5px;
      background-color: #FFF;
      border: 1px solid #e5edec;
      overflow: hidden; }
      .partner-recipe-info-modal .retailers-list .retailer-card:hover {
        cursor: pointer; }
      .partner-recipe-info-modal .retailers-list .retailer-card .RetailerLogo {
        margin: 0 auto; }
      .partner-recipe-info-modal .retailers-list .retailer-card .retailer-name {
        font-size: 16px;
        font-weight: 600;
        margin-bottom: 0;
        height: 50px;
        margin-top: 10px;
        margin-bottom: 10px; }
    .partner-recipe-info-modal .retailers-list .match-container {
      text-align: center; }
      .partner-recipe-info-modal .retailers-list .match-container p {
        margin: 0; }
      .partner-recipe-info-modal .retailers-list .match-container .match-circle {
        position: relative;
        height: 20px;
        width: 20px;
        border-radius: 50%;
        margin: 0 auto;
        margin-bottom: 5px; }
        .partner-recipe-info-modal .retailers-list .match-container .match-circle.all {
          background-color: #43B02A; }
        .partner-recipe-info-modal .retailers-list .match-container .match-circle.most {
          background-color: #f4a92b; }
        .partner-recipe-info-modal .retailers-list .match-container .match-circle.some {
          background-color: #fa580d; }
        .partner-recipe-info-modal .retailers-list .match-container .match-circle .match-checkmark {
          transform: rotate(45deg);
          position: absolute;
          top: 32%;
          left: 44%;
          width: 7px;
          height: 12px;
          margin-top: -4px;
          margin-left: -2px;
          border-style: solid;
          border-top: none;
          border-left: none;
          border-right-width: 2px;
          border-bottom-width: 2px;
          border-color: #FFF;
          transform: rotate(45deg); }

.search-modal {
  max-width: 800px; }
  .search-modal h2 {
    padding: 10px;
    text-align: center;
    font-size: 24px; }
  .search-modal .search-bar-background {
    background-color: #f7f7f7;
    padding: 10px 20px; }
    .search-modal .search-bar-background .search-bar-container {
      position: relative; }
  .search-modal .search-modal-content {
    padding: 20px; }
    .search-modal .search-modal-content li {
      display: inline-block; }
  .search-modal .no-results {
    text-align: center; }
  .search-modal .search-modal-content {
    width: 98%;
    margin: 0 auto; }
    .search-modal .search-modal-content ul {
      text-align: left; }
    @media (min-width: 992px) and (max-width: 1199px) {
      .search-modal .search-modal-content {
        width: 95%; } }
    @media (min-width: 768px) and (max-width: 991px) {
      .search-modal .search-modal-content {
        width: 71%; } }
    @media (max-width: 767px) {
      .search-modal .search-modal-content {
        width: 76%; } }

.select-item-card {
  display: inline-block;
  position: relative;
  width: 180px;
  height: auto;
  height: 260px;
  vertical-align: top;
  background: #fff;
  text-align: left;
  color: #5a5a5a;
  font-weight: 400;
  margin: 0 -1px -1px 0;
  cursor: pointer;
  white-space: initial;
  padding: 5px;
  padding-bottom: 42px;
  text-align: center; }
  .select-item-card .item-image {
    margin: 0 auto;
    width: 125px; }
  .select-item-card .item-name {
    max-height: 60px;
    font-weight: 600;
    margin: 0;
    font-size: 14px; }
  .select-item-card .item-price {
    margin: 0;
    color: #989898;
    font-size: 12px; }
  .select-item-card .select-button-container {
    position: absolute;
    bottom: 10px;
    left: 10px;
    right: 10px; }
  .select-item-card .select-button {
    width: 100%;
    background-color: #fff;
    color: #43B02A;
    border: 1px solid #43B02A; }
    .select-item-card .select-button:hover {
      background-color: #f0efec; }
    .select-item-card .select-button:focus, .select-item-card .select-button:active {
      outline: none;
      box-shadow: none; }
    .select-item-card .select-button i {
      margin-right: 10px; }

.recurring {
  overflow: visible !important; }
  .recurring .success-message {
    background-color: #43B02A;
    margin: 0;
    padding: 20px 20px;
    border-radius: 4px 4px 0 0; }
    .recurring .success-message .text-box {
      color: #FFFFFF;
      font-size: 16px;
      margin: 0 1em; }
      .recurring .success-message .text-box span.delivery-time {
        font-weight: 800; }
  .recurring .reserved-time-details {
    border-top: 1px solid #F0EFEC; }
    .recurring .reserved-time-details .section-subhead {
      color: #393939; }
    .recurring .reserved-time-details .address {
      display: inline-block; }
    .recurring .reserved-time-details i {
      color: #b0b0b0;
      display: inline-block;
      margin-right: 20px;
      margin-top: 3px;
      vertical-align: top; }
    .recurring .reserved-time-details .detail {
      display: flex;
      color: #5f5f5f; }
  .recurring .reserved-time-description {
    margin: 20px 0;
    font-weight: 800;
    font-size: 16px; }
    .recurring .reserved-time-description .delivery-time {
      color: #01939A; }
  .recurring .buttons-container {
    margin-bottom: 2em; }
    @media (max-width: 991px) {
      .recurring .buttons-container {
        text-align: center; } }
    @media (min-width: 992px) {
      .recurring .buttons-container .ic-btn {
        margin-right: 20px; } }
    @media (max-width: 320px) {
      .recurring .buttons-container .ic-btn {
        font-size: 12px; } }
  .recurring .reserved-time-form {
    padding: 10px 40px; }
    .recurring .reserved-time-form .section-title {
      font-size: 20px;
      font-weight: 500; }
    .recurring .reserved-time-form .dropdown-toggle-button, .recurring .reserved-time-form .icDropdown, .recurring .reserved-time-form .address-dropdown-wrapper > .ic-btn {
      width: 100%;
      text-align: left; }
    .recurring .reserved-time-form .icDropdownItems .icDropdownItem :not(:last-child) {
      border-bottom: 1px solid white;
      width: 100%;
      text-align: left;
      padding-left: 10px; }
    .recurring .reserved-time-form .section-subhead {
      color: #393939;
      font-weight: 600;
      font-size: 14px; }
    .recurring .reserved-time-form label {
      color: #5f5f5f; }
    .recurring .reserved-time-form .form-group {
      margin-top: 10px; }
    .recurring .reserved-time-form .control-label {
      font-size: 14px; }
    .recurring .reserved-time-form .control-label, .recurring .reserved-time-form .form-control {
      text-align: left;
      display: table-cell;
      white-space: nowrap; }
  .recurring .section-header {
    background-image: url(clock-green-80e525b9082e4306dff7db536460bd6e.png);
    background-repeat: no-repeat;
    background-position: top left;
    padding-left: 75px;
    padding-bottom: 16px; }
  .recurring .section-title {
    font-size: 18px;
    font-weight: 600;
    margin-bottom: 0;
    color: #393939; }
  .recurring .section-subhead {
    margin-top: 6px;
    font-size: 16px;
    font-weight: normal;
    color: #5f5f5f; }
  .recurring .container {
    border: 1px solid #F0EFEC;
    border-radius: 4px;
    padding: 20px 30px;
    background-color: #fff;
    min-height: 450px;
    margin-bottom: 50px; }
  .recurring .container.reserved-time-form {
    border: none;
    margin-bottom: 0; }
  @media (min-width: 992px) {
    .recurring .instructions-container {
      background-image: url(kale-bag-cropped-6eb8d4bc64398481bd2857764b289760.jpg);
      background-repeat: no-repeat;
      background-position: top right;
      background-size: contain; } }
  .recurring .instructions-container .loading-reservation {
    padding-left: 75px; }
  .recurring .instructions-container .next-delivery {
    color: #8e8e8e; }
    .recurring .instructions-container .next-delivery span.delivery-time {
      color: #438ead;
      font-weight: 800; }
  @media (min-width: 992px) {
    .recurring .instructions-container .buttons-container {
      margin-left: 70px; } }
  .recurring .instructions-container .intro {
    border-top: 1px solid #F0EFEC;
    color: #5f5f5f;
    margin-top: 1.2em;
    margin-bottom: 2em;
    margin-left: 5px;
    margin-right: 5px;
    vertical-align: baseline; }
    .recurring .instructions-container .intro strong {
      font-weight: 600;
      color: #393939; }
    .recurring .instructions-container .intro .fa-ul {
      margin-top: 16px;
      margin-left: 54px; }
      .recurring .instructions-container .intro .fa-ul i {
        color: #43B02A;
        font-size: 175%; }
      .recurring .instructions-container .intro .fa-ul li {
        margin-top: 2em; }
        .recurring .instructions-container .intro .fa-ul li p {
          margin-left: 8px; }
  @media (min-width: 992px) {
    .recurring .instructions {
      width: 60%; } }
  .recurring .row {
    margin-top: 20px;
    margin-bottom: 20px; }
  .recurring .section-divider {
    font-weight: 800; }

.recurring-callout-banner {
  display: flex;
  justify-content: space-between;
  align-items: center;
  border: 1px solid #F0EFEC;
  border-radius: 4px;
  width: 100%;
  background-color: #CBF1C4;
  color: #393939;
  margin-bottom: 30px; }
  @media (max-width: 1200px) {
    .recurring-callout-banner {
      padding: 10px;
      justify-content: space-between; } }
  .recurring-callout-banner .recurring-text {
    display: flex;
    align-items: center; }
  .recurring-callout-banner.recurring-callout-large {
    border: none;
    background-color: transparent; }
    .recurring-callout-banner.recurring-callout-large .recurring-right-clock {
      width: 130px;
      height: 105px; }
    .recurring-callout-banner.recurring-callout-large .recurring-left-dashes {
      width: 130px;
      height: 105px;
      background-position: 20px 25px; }
    .recurring-callout-banner.recurring-callout-large .recurring-text {
      font-size: 20px; }
    .recurring-callout-banner.recurring-callout-large .recurring-badge {
      position: relative;
      top: -12px;
      width: 52px;
      height: 52px; }
  .recurring-callout-banner.dark {
    background-color: #393939;
    color: white; }
    .recurring-callout-banner.dark .recurring-text {
      font-size: 17px; }
    .recurring-callout-banner.dark .recurring-banner-content .emphatic {
      font-weight: 800;
      border-bottom: 1px solid #FF5600; }
    .recurring-callout-banner.dark .recurring-banner-content .recurring-link {
      color: white;
      margin-left: 10px; }
    .recurring-callout-banner.dark .left-clock-dashes {
      background-image: url(left-clock-dash@2x-4055a09617641453c0061f2cf5a54ed4.png);
      background-repeat: no-repeat;
      background-position: 0 center;
      background-size: 104px 47px;
      width: 104px;
      height: 60px; }
    .recurring-callout-banner.dark .right-dashes {
      background-image: url(right-dash@2x-4ee70677040a20e1f75ea3108a23acef.png);
      background-repeat: no-repeat;
      background-position: right center;
      background-size: 44px 21px;
      width: 104px;
      height: 60px; }
  .recurring-callout-banner .recurring-callout-side {
    display: table-cell; }
  .recurring-callout-banner .recurring-text {
    font-size: 16px; }
  .recurring-callout-banner .recurring-left-dashes {
    background-image: url(banner-left-dashes-553866c84141c4d2cdd02df1f2300235.png);
    background-repeat: no-repeat;
    background-position: 30px 75px;
    width: 120px;
    height: 105px; }
  .recurring-callout-banner .recurring-right-clock {
    background-image: url(banner-right-clock-47103c2ea44c5f691a90fe24b6581042.png);
    background-repeat: no-repeat;
    background-position: 0 10px;
    width: 120px;
    height: 105px; }
  .recurring-callout-banner .recurring-banner-content {
    display: flex;
    align-items: center;
    justify-content: center;
    margin: 0 auto; }
    .recurring-callout-banner .recurring-banner-content .recurring-link {
      color: #01939A;
      font-weight: 600; }
      .recurring-callout-banner .recurring-banner-content .recurring-link:hover {
        cursor: pointer; }
  @media (max-width: 1200px) {
    .recurring-callout-banner .recurring-callout-side {
      display: none; }
    .recurring-callout-banner .recurring-badge {
      display: block;
      margin: 0 auto; } }

.retailer-chooser {
  background-color: #f7f7f7;
  border-top: 1px solid #e5edec; }
  .retailer-chooser.fade-in {
    animation: fadeIn;
    animation-duration: .5s; }
  .retailer-chooser .retailer-chooser-arrow {
    /* overriden in header to make it appear */
    display: none;
    width: 0px;
    height: 0px;
    border-left: 15px solid transparent;
    border-right: 15px solid transparent;
    border-bottom: 15px solid #fff;
    position: absolute;
    top: -15px;
    left: 205px;
    filter: drop-shadow(0px 0px 4px rgba(0, 0, 0, 0.2)); }
  .retailer-chooser .banner {
    background-color: #fff;
    width: 100%;
    text-align: center;
    font-size: 18px;
    font-weight: 100;
    padding: 15px 0px;
    margin-top: 15px; }
    .retailer-chooser .banner p {
      color: inherit; }
    .retailer-chooser .banner strong {
      color: #43B02A; }
  .retailer-chooser .filter-text {
    display: inline-block;
    margin-top: 10px;
    vertical-align: middle;
    padding: 6px 14px;
    font-weight: 600;
    font-size: 14px;
    color: #8e8e8e; }
  .retailer-chooser .legal-footer {
    text-align: center;
    margin: 30px 15px 15px 15px;
    color: #9B9A99; }
  .retailer-chooser .inventory-area-link a {
    color: #43B02A; }
  .retailer-chooser .retailer-option {
    width: 25%;
    display: block;
    position: relative;
    padding: 0; }
    @media (max-width: 767px) {
      .retailer-chooser .retailer-option {
        width: 50vw; } }
  .retailer-chooser .retailer-chooser-header {
    padding: 22px;
    border-bottom: 1px solid #E0E0E0;
    position: relative;
    background-color: #fff;
    border-top-left-radius: 4px;
    border-top-right-radius: 4px; }
    .retailer-chooser .retailer-chooser-header .header-text {
      font-size: 24px; }
      @media (max-width: 767px) {
        .retailer-chooser .retailer-chooser-header .header-text {
          font-size: 18px; } }
    .retailer-chooser .retailer-chooser-header h1 {
      font-size: 22px;
      font-weight: 500;
      margin: 0;
      line-height: 1; }
    .retailer-chooser .retailer-chooser-header h4 {
      font-weight: 500; }
    .retailer-chooser .retailer-chooser-header a {
      font-size: 16px;
      color: #43B02A; }
    .retailer-chooser .retailer-chooser-header p {
      margin: 0;
      color: #43B02A; }
      .retailer-chooser .retailer-chooser-header p .ic-icon-location-marker {
        font-size: 20px;
        vertical-align: middle;
        color: #43B02A; }
    .retailer-chooser .retailer-chooser-header .header-location-link {
      position: absolute;
      top: 22px;
      right: 22px; }
      @media (max-width: 767px) {
        .retailer-chooser .retailer-chooser-header .header-location-link {
          display: block;
          position: static;
          margin-top: 10px;
          margin-bottom: -10px; } }
    .retailer-chooser .retailer-chooser-header .retailer-chooser-close {
      position: absolute;
      top: 24px;
      left: 22px;
      color: #9E9E9E;
      text-decoration: none; }
      @media (max-width: 767px) {
        .retailer-chooser .retailer-chooser-header .retailer-chooser-close {
          top: 36px; } }
  .retailer-chooser .retailer-option-inner-wrapper {
    display: block;
    position: relative;
    margin: auto;
    padding: 15px;
    color: #393939;
    border-radius: 4px;
    -webkit-transition: background-color 150ms ease-in;
    -moz-transition: background-color 150ms ease-in;
    transition: background-color 150ms ease-in; }
    .retailer-chooser .retailer-option-inner-wrapper:hover {
      cursor: pointer;
      background-color: #f7f7f7;
      text-decoration: none; }
  .retailer-chooser .retailer-option-logo-wrapper {
    display: block;
    width: 128px;
    height: 128px;
    position: relative;
    margin: auto; }
    .retailer-chooser .retailer-option-logo-wrapper img {
      width: 100%;
      height: 100%;
      box-shadow: 0px 0px 0px 1px rgba(0, 0, 0, 0.15);
      border-radius: 50%;
      background-color: #fff; }
  .retailer-chooser .retailer-option-body {
    margin-top: 5px; }
    .retailer-chooser .retailer-option-body h3 {
      color: #424242;
      font-size: 18px;
      line-height: 24px;
      font-weight: bold;
      margin: 0;
      text-align: center; }
    .retailer-chooser .retailer-option-body p {
      margin: 0; }
    .retailer-chooser .retailer-option-body .ic-icon {
      margin-right: 5px;
      font-size: 16px; }
    @media (max-width: 991px) {
      .retailer-chooser .retailer-option-body {
        max-width: calc(100vw - (98px + 16px)); } }
  .retailer-chooser .retailer-option-price-policy .ic-icon-check-bold:before {
    background-color: #43B02A;
    font-size: 10px;
    color: #fff;
    text-align: center;
    display: inline-block;
    height: 16px;
    width: 16px;
    border-radius: 50%;
    line-height: 16px;
    margin: 5px 0; }
  .retailer-chooser .retailer-option-badge {
    display: inline-block;
    transform: translate3d(0, 0, 0);
    -webkit-font-smoothing: antialiased; }
    .retailer-chooser .retailer-option-badge .badge-body {
      text-transform: uppercase;
      font-size: 11px;
      padding: 2.5px 5px;
      font-weight: 600;
      border-radius: 4px;
      color: #fff;
      z-index: 1;
      position: relative; }
    .retailer-chooser .retailer-option-badge .badge-arrow {
      width: 15px;
      height: 15px;
      position: absolute;
      top: -3px;
      left: 10px;
      z-index: 0;
      border: 1px solid #757575;
      border-radius: 4px;
      transform: rotate(135deg);
      background-color: transparent; }
      .retailer-chooser .retailer-option-badge .badge-arrow:before {
        content: '';
        background-color: #F7A700;
        width: 4px;
        height: 4px;
        position: absolute;
        display: block;
        top: 9px;
        left: 0;
        border-radius: 50%; }
  .retailer-chooser .retailer-option-popular-badge,
  .retailer-chooser .retailer-option-admin-badge,
  .retailer-chooser .retailer-option-new-badge {
    position: absolute;
    top: 10px; }
  .retailer-chooser .retailer-option-admin-badge {
    right: 10px; }
    .retailer-chooser .retailer-option-admin-badge .badge-body {
      background-color: #AB00E7; }
    .retailer-chooser .retailer-option-admin-badge .badge-arrow {
      left: 16px; }
      .retailer-chooser .retailer-option-admin-badge .badge-arrow:before {
        background-color: #424242; }
  .retailer-chooser .retailer-option-new-badge {
    left: 10px; }
    .retailer-chooser .retailer-option-new-badge .badge-body {
      background-color: #F7A700; }
  .retailer-chooser .retailer-option-popular-badge {
    left: 10px;
    z-index: 100; }
    .retailer-chooser .retailer-option-popular-badge .badge-arrow:before {
      background-color: #FF467E; }
    .retailer-chooser .retailer-option-popular-badge .badge-body {
      right: 10px;
      background-color: #FF467E; }
  .retailer-chooser .retailer-option-categories {
    color: #757575;
    font-size: 14px;
    text-align: center; }
  .retailer-chooser .retailer-option-next-availability {
    font-size: 14px;
    color: #757575;
    opacity: 0;
    -webkit-transition: opacity 150ms ease-in-out;
    -moz-transition: opacity 150ms ease-in-out;
    transition: opacity 150ms ease-in-out; }
    .retailer-chooser .retailer-option-next-availability.loading, .retailer-chooser .retailer-option-next-availability.error {
      opacity: 0; }
    .retailer-chooser .retailer-option-next-availability.loaded {
      opacity: 1; }
    .retailer-chooser .retailer-option-next-availability .ic-icon-clock-filled {
      color: #939291;
      -webkit-transition: color 150ms ease-in-out;
      -moz-transition: color 150ms ease-in-out;
      transition: color 150ms ease-in-out;
      margin-right: 8px;
      vertical-align: middle; }
  .retailer-chooser .retailer-chooser-retailer-option-list-wrapper {
    margin: 0 auto;
    border-top: 1px solid #E0E0E0; }
  .retailer-chooser .retailer-group-label {
    padding: 0 24px;
    font-weight: 500;
    font-size: 14px;
    min-height: 4px;
    max-height: 24px;
    color: #8e8e8e;
    background-color: #f7f7f7; }
  .retailer-chooser .retailer-options-wrapper {
    padding: 8px 10px;
    background-color: #fff;
    display: flex;
    flex-wrap: wrap;
    border-top: 1px solid #E0E0E0;
    border-bottom: 1px solid #E0E0E0; }
    @media (max-width: 767px) {
      .retailer-chooser .retailer-options-wrapper {
        padding: 0; } }

@keyframes swing {
  0% {
    transform: rotate(-12deg); }
  25% {
    transform: rotate(10deg); }
  50% {
    transform: rotate(-8deg); }
  75% {
    transform: rotate(8deg); }
  100% {
    transform: rotate(0deg); } }

.swing {
  -webkit-transform-origin: 50% 0;
  -moz-transform-origin: 50% 0;
  -ms-transform-origin: 50% 0;
  -o-transform-origin: 50% 0;
  transform-origin: 50% 0;
  animation: swing 2s ease-in-out forwards 1; }

/* high-contrast-mode */
.high-contrast-mode .retailer-chooser .retailer-option-categories .retailer-group-label {
  color: #424242; }

.retailerDeliveryTimesModal {
  width: 680px; }
  .retailerDeliveryTimesModal .icModalRow {
    padding: 15px 30px; }
  .retailerDeliveryTimesModal .is-loading {
    padding: 150px; }

.deliveryOption {
  font-size: 14px;
  color: #757575;
  height: 37px;
  line-height: 36px;
  border-bottom: 1px solid #F0EFEC; }
  .deliveryOption:first-child {
    border-top: 1px solid #F0EFEC; }
  .deliveryOption .window {
    color: #393939;
    font-weight: 500; }
  .deliveryOption .price {
    color: #757575; }

.deliveryOption.is-unavailable .window {
  color: #b0b0b0; }

.deliveryOption.is-unavailable .price {
  color: #b0b0b0; }

.deliveryOption.is-surging .price {
  color: #F7A700; }

.deliveryOption.is-sale .price {
  color: #43B02A; }

.retailerModalHeader.icModalHeader {
  color: #fff;
  text-align: center; }
  .retailerModalHeader.icModalHeader h1 {
    color: #fff;
    font-weight: 600; }

.retailerModalHeader .logo {
  max-width: 280px;
  height: 100px;
  background-size: contain;
  background-repeat: no-repeat;
  background-position: center;
  width: 100%;
  margin: 0 auto; }

.branded-search-btn {
  position: absolute;
  right: 0px;
  top: 0;
  height: 100%;
  width: 50px;
  border-top-right-radius: 5px;
  border-bottom-right-radius: 5px;
  border: 0;
  border-left: 1px solid #e0e0e0;
  -webkit-appearance: none;
  background-color: white;
  background-repeat: no-repeat;
  color: #43B02A;
  padding: 0;
  margin: 0; }
  .branded-search-btn:hover {
    background-color: #f2f2f2; }
  .branded-search-btn:before {
    top: 2px;
    position: relative; }

.autocomplete-input {
  position: relative; }
  .autocomplete-input .list-input {
    padding: 5px 35px 5px 10px;
    width: 100%; }
    .autocomplete-input .list-input.tt-input {
      background-color: white !important; }
  .autocomplete-input .ic-icon-search {
    color: #43B02A;
    width: 31px;
    height: 100%;
    width: 35px;
    padding-top: 7px;
    vertical-align: middle;
    display: table;
    cursor: pointer;
    border: none;
    background: transparent;
    border-left: 1px solid #cccccc;
    position: absolute;
    right: 0px;
    top: 0px; }

@keyframes checkbox-expand {
  0% {
    transform: rotate(70deg);
    height: 6px; }
  100% {
    transform: rotate(45deg);
    height: 12px; } }

.Checkbox {
  display: flex; }
  .Checkbox.checked .checkbox-box {
    background-color: #43B02A;
    border-color: #43B02A; }
  .Checkbox.checked .checkbox-checkmark {
    display: inline-block;
    animation: checkbox-expand 140ms ease-out forwards; }
  .Checkbox.disabled {
    pointer-events: none;
    cursor: inherit; }
    .Checkbox.disabled .checkbox-box {
      background-color: #f0f0f0;
      border-color: #cccccc; }
    .Checkbox.disabled .checkbox-checkmark {
      border-color: #b6b6b6; }
    .Checkbox.disabled .checkbox-label {
      color: #b1b1b1; }
  .Checkbox .checkbox-centerer {
    display: flex;
    flex-direction: column;
    justify-content: center; }
  .Checkbox .checkbox-container {
    display: inline-block;
    white-space: nowrap;
    outline: 0;
    height: 18px;
    width: 18px;
    line-height: 18px;
    position: relative;
    cursor: pointer;
    transform: translateZ(0);
    -webkit-transform: translateZ(0);
    -webkit-tap-highlight-color: transparent; }
  .Checkbox .checkbox-box {
    position: absolute;
    display: inline-block;
    width: 18px;
    height: 18px;
    top: 50%;
    left: 50%;
    margin-top: -9px;
    margin-left: -9px;
    box-sizing: border-box;
    border: solid 1px #cccccc;
    border-radius: 3px;
    pointer-events: none;
    transition: background-color 140ms, border-color 140ms;
    border-color: #cccccc; }
  .Checkbox .checkbox-checkmark {
    transform: rotate(45deg);
    position: absolute;
    display: none;
    top: 30%;
    left: 43%;
    width: 7px;
    height: 12px;
    margin-top: -4px;
    margin-left: -2px;
    border-style: solid;
    border-top: none;
    border-left: none;
    border-right-width: 2px;
    border-bottom-width: 2px;
    border-color: #FFF;
    transform: rotate(45deg); }
  .Checkbox .checkbox-label {
    margin-left: 10px;
    text-transform: capitalize; }
    .Checkbox .checkbox-label:hover {
      cursor: pointer; }

.QtyStepper {
  display: flex;
  width: 150px;
  border-radius: 4px;
  border: 1px solid #d1d1d1;
  overflow: hidden; }
  .QtyStepper .qty-adjustment {
    color: #43B02A;
    flex-basis: 30%;
    border: none;
    border-radius: 0; }
    .QtyStepper .qty-adjustment:first-child {
      border-right: 1px solid #d1d1d1; }
    .QtyStepper .qty-adjustment:last-child {
      border-left: 1px solid #d1d1d1; }
    .QtyStepper .qty-adjustment:focus {
      box-shadow: none;
      background-color: inherit; }
    .QtyStepper .qty-adjustment:active, .QtyStepper .qty-adjustment:hover {
      background-color: rgba(67, 176, 42, 0.1); }
  .QtyStepper .display-qty {
    flex-basis: 70%;
    text-align: center;
    display: flex;
    flex-direction: column;
    justify-content: center; }
  .QtyStepper button:disabled {
    color: gray;
    background: #ececec; }

.RetailerLogo {
  box-shadow: 0px 0px 0px 1px rgba(0, 0, 0, 0.15);
  border-radius: 50%;
  background-color: #fff;
  overflow: hidden;
  position: relative; }

.shop-with-friends-main-modal {
  width: 650px;
  max-width: 100vw;
  margin: 0 auto;
  -webkit-transition: height 0.5s ease-in-out;
  -moz-transition: height 0.5s ease-in-out;
  transition: height 0.5s ease-in-out; }
  .shop-with-friends-main-modal .icModalRow {
    border: none; }
  .shop-with-friends-main-modal .icModalHeader {
    height: 160px;
    padding: 0;
    background-image: url(Fruit-517d1f1b7b97fb8a5976331cc2b40c03.png);
    background-repeat: no-repeat;
    background-position: center 20px;
    background-color: #E6E9F0; }
    @media only screen and (-webkit-min-device-pixel-ratio: 1.3), only screen and (min--moz-device-pixel-ratio: 1.3), only screen and (-o-min-device-pixel-ratio: 1.3 / 1), only screen and (min-resolution: 125dpi), only screen and (min-resolution: 1.3dppx) {
      .shop-with-friends-main-modal .icModalHeader {
        background-image: url(Fruit@2x-0bbff0e43e7f6109ecbfadfb18255028.png);
        background-size: 175px 191px; } }
  .shop-with-friends-main-modal .body-header {
    text-align: center; }
    .shop-with-friends-main-modal .body-header h1 {
      color: #43B02A;
      margin: 0;
      font-size: 32px;
      font-weight: 500; }
    .shop-with-friends-main-modal .body-header p {
      font-size: 18px;
      font-weight: 400;
      margin: 0; }
  .shop-with-friends-main-modal .body-action .ic-btn {
    padding: 10px 14px;
    font-size: 18px; }
  .shop-with-friends-main-modal .body-action .ic-btn-secondary {
    color: #43B02A;
    border-color: #43B02A; }
  .shop-with-friends-main-modal .icModalRow .ic-btn + .ic-btn {
    float: right;
    margin: 0; }

.shop-with-friends-main-modal .body-content {
  padding: 0 40px; }
  .shop-with-friends-main-modal .body-content ul {
    margin: 0;
    margin-top: 20px; }
  .shop-with-friends-main-modal .body-content input[type="text"] {
    margin: 20px auto;
    display: block;
    width: 50%;
    text-align: center;
    font-size: 16px;
    font-weight: 300; }
    @media (max-width: 991px) {
      .shop-with-friends-main-modal .body-content input[type="text"] {
        width: 100%; } }
  .shop-with-friends-main-modal .body-content .ic-loading {
    height: 66px;
    padding-top: 30px; }
  .shop-with-friends-main-modal .body-content .shared-carts-list li {
    padding: 10px 14px; }
    .shop-with-friends-main-modal .body-content .shared-carts-list li:hover p {
      color: #43B02A; }
    .shop-with-friends-main-modal .body-content .shared-carts-list li p {
      text-align: left;
      display: inline-block;
      margin: 0;
      font-size: 16px;
      font-weight: 400; }
    .shop-with-friends-main-modal .body-content .shared-carts-list li a {
      text-align: right;
      display: inline-block;
      font-size: 12px;
      line-height: 21px; }
    .shop-with-friends-main-modal .body-content .shared-carts-list li strong {
      font-weight: 600; }
    .shop-with-friends-main-modal .body-content .shared-carts-list li .ic-text-truncate {
      max-width: 75%; }
      @media (max-width: 500px) {
        .shop-with-friends-main-modal .body-content .shared-carts-list li .ic-text-truncate {
          max-width: 64%; } }
  .shop-with-friends-main-modal .body-content .shared-link-wrapper {
    padding-bottom: 20px; }
    .shop-with-friends-main-modal .body-content .shared-link-wrapper a {
      font-size: 16px;
      color: #43B02A;
      margin-right: 20px; }
    .shop-with-friends-main-modal .body-content .shared-link-wrapper .ic-btn-secondary {
      color: #43B02A;
      border: 1px solid #43B02A;
      background-color: #fff;
      border-radius: 15px; }
  @media (max-width: 991px) {
    .shop-with-friends-main-modal .body-content {
      padding: 0; } }

.shop-with-friends-common-modal {
  width: 522px;
  max-width: 100vw;
  margin: 0 auto;
  -webkit-transition: height 0.5s ease-in-out;
  -moz-transition: height 0.5s ease-in-out;
  transition: height 0.5s ease-in-out; }
  .shop-with-friends-common-modal .body-header {
    text-align: center; }
    .shop-with-friends-common-modal .body-header h1 {
      margin: 0;
      margin-bottom: 10px;
      font-size: 28px;
      font-weight: bold;
      text-align: center;
      color: #424242; }
  .shop-with-friends-common-modal .subheader-text {
    font-size: 20px;
    text-align: center;
    color: #757575; }
  .shop-with-friends-common-modal .body-action button {
    display: block;
    margin: 0 auto;
    font-size: 18px; }

.shop-with-friends-invited-modal .icModalHeader {
  height: 220px;
  padding: 0;
  background-image: url(group-cart-lifestyle-image@2x-5a8821bfc65ea3d9b6f00148073b950a.png);
  background-repeat: no-repeat;
  background-size: cover;
  background-color: #E6E9F0; }

.shop-with-friends-invited-modal .decline-link {
  color: #43B02A;
  display: block;
  text-align: center;
  margin-top: 20px; }
  .shop-with-friends-invited-modal .decline-link:hover {
    cursor: pointer; }

.shop-with-friends-invited-modal .subheader-text {
  margin: 0; }

.shop-with-friends-invited-modal .collaborators {
  text-align: center;
  padding: 10px 0; }

.shop-with-friends-invited-modal .cart-collaborator {
  background-repeat: no-repeat;
  height: 65px;
  width: 65px;
  border-radius: 50%;
  overflow: hidden;
  display: inline-block;
  margin: 5px; }
  .shop-with-friends-invited-modal .cart-collaborator p {
    margin: 0;
    font-size: 36px;
    line-height: 1.7em;
    text-align: center;
    color: #ffffff;
    text-transform: uppercase; }

.shared-cart-guest-invited-modal {
  overflow: hidden; }
  .shared-cart-guest-invited-modal .ic-btn {
    height: 48px; }
  .shared-cart-guest-invited-modal form.error .guest-name-field {
    border-color: #FF5600; }
  .shared-cart-guest-invited-modal label {
    font-size: 16px;
    font-weight: 600;
    text-align: center;
    color: #333333;
    width: 100%;
    margin-top: 15px; }
  .shared-cart-guest-invited-modal .guest-name-field {
    width: 100%;
    border-radius: 4px;
    background-color: #fefefe;
    border: solid 1px #e3e2df;
    margin-bottom: 30px; }

@-webkit-keyframes skeleton-item-loading {
  0% {
    background-position: -468px 0; }
  100% {
    background-position: 468px 0; } }

@-moz-keyframes skeleton-item-loading {
  0% {
    background-position: -468px 0; }
  100% {
    background-position: 468px 0; } }

@keyframes skeleton-item-loading {
  0% {
    background-position: -468px 0; }
  100% {
    background-position: 468px 0; } }

.skeleton-item-loading {
  animation-duration: 11s;
  animation-fill-mode: forwards;
  animation-iteration-count: infinite;
  animation-name: skeleton-item-loading;
  animation-timing-function: linear;
  background: #f6f7f8;
  background: linear-gradient(to right, #eeeeee 8%, #dddddd 18%, #eeeeee 33%);
  position: relative; }

.skeleton-item {
  -webkit-transition: opacity 250ms linear;
  -moz-transition: opacity 250ms linear;
  transition: opacity 250ms linear; }
  .skeleton-item .circle {
    border: 0;
    border-radius: 50%;
    background: #e5e5e5;
    margin: auto; }
  .skeleton-item .bar {
    border: 0;
    margin: auto; }
  .skeleton-item.small .circle {
    height: 84px;
    width: 84px;
    margin-top: 15px; }
  .skeleton-item.small .bar {
    height: 5px;
    width: 80px;
    margin-top: 15px; }
  .skeleton-item.large {
    width: 100%;
    height: 100%; }
    .skeleton-item.large .circle {
      height: 70%;
      width: 70%;
      margin-top: 15px; }
    .skeleton-item.large .bar {
      height: 7px;
      width: 65%;
      margin-top: 20px; }
  .skeleton-item.retailer .circle {
    height: 128px;
    width: 128px; }
  .skeleton-item.retailer .bar {
    height: 12px;
    width: 60%;
    margin: 15px auto; }
  .skeleton-item.retailer.old {
    padding-top: 14px; }
    .skeleton-item.retailer.old .circle {
      height: 94px;
      width: 94px;
      float: left;
      top: -5px;
      left: 15px; }
    .skeleton-item.retailer.old .bar {
      height: 8px;
      width: 50%;
      margin-top: 15px;
      margin-left: 40px;
      margin-bottom: 0;
      float: left; }
  .skeleton-item.fade-out {
    opacity: 0; }

.splashgateModal {
  width: 475px;
  max-width: 475px;
  text-align: center; }
  @media (max-width: 767px) {
    .splashgateModal {
      width: 100%; } }
  .splashgateModal .rcp-slash-banner {
    background: #FFF;
    padding: 40px 20px 20px 20px;
    color: #4A4A4A;
    position: relative; }
    @media (max-width: 767px) {
      .splashgateModal .rcp-slash-banner {
        padding: 20px; } }
    .splashgateModal .rcp-slash-banner .head-stone {
      position: absolute;
      top: -47px;
      left: 0;
      right: 0; }
      .splashgateModal .rcp-slash-banner .head-stone i {
        display: block;
        margin: auto;
        height: 80px;
        width: 80px;
        border-radius: 160px;
        font-size: 40px;
        background-color: #CAF2C2;
        color: #61B450;
        line-height: 80px; }
        @media (max-width: 767px) {
          .splashgateModal .rcp-slash-banner .head-stone i {
            height: 40px;
            width: 40px;
            border-radius: 40px;
            font-size: 40px; } }
      @media (max-width: 767px) {
        .splashgateModal .rcp-slash-banner .head-stone {
          top: -27px; } }
    .splashgateModal .rcp-slash-banner h3 {
      margin: 0;
      font-size: 24px;
      line-height: 34px;
      font-weight: 600;
      color: inherit; }
      .splashgateModal .rcp-slash-banner h3 .br {
        display: block; }
        @media (max-width: 767px) {
          .splashgateModal .rcp-slash-banner h3 .br {
            display: inline; }
            .splashgateModal .rcp-slash-banner h3 .br:before {
              content: " "; } }
      @media (max-width: 767px) {
        .splashgateModal .rcp-slash-banner h3 {
          font-size: 21px;
          line-height: 30px; } }
    .splashgateModal .rcp-slash-banner p {
      margin-top: 10px;
      line-height: 24px;
      font-size: 16px;
      color: inherit; }
      .splashgateModal .rcp-slash-banner p span {
        display: block; }
      @media (max-width: 767px) {
        .splashgateModal .rcp-slash-banner p {
          font-size: 14px;
          display: inline; } }
  .splashgateModal .rcp-signup-widget {
    margin: auto;
    max-width: none;
    background-color: #F5F5F5; }
    @media (max-width: 767px) {
      .splashgateModal .rcp-signup-widget {
        padding: 0 20px; } }
    .splashgateModal .rcp-signup-widget fieldset {
      margin: 0 0 0 0; }
    .splashgateModal .rcp-signup-widget .rcp-form {
      max-width: 340px;
      margin: auto; }
    .splashgateModal .rcp-signup-widget .rcp-terms-of-service {
      position: relative;
      top: 10px;
      color: #8f8f8f; }
      .splashgateModal .rcp-signup-widget .rcp-terms-of-service div {
        display: inline; }
        .splashgateModal .rcp-signup-widget .rcp-terms-of-service div:after {
          content: " "; }
    .splashgateModal .rcp-signup-widget .ic-btn {
      line-height: 28px; }
      .splashgateModal .rcp-signup-widget .ic-btn i {
        top: 3px;
        left: 10px; }
      .splashgateModal .rcp-signup-widget .ic-btn.ic-btn-facebook i, .splashgateModal .rcp-signup-widget .ic-btn.ic-btn-gplus i {
        top: 10px; }

.stacked-item-card {
  display: inline-block;
  position: relative;
  width: 410px;
  height: 96px;
  vertical-align: center;
  background: #fff;
  border: none;
  text-align: left;
  color: #5a5a5a;
  font-weight: 400;
  margin: 0;
  cursor: pointer;
  white-space: initial; }
  .stacked-item-card .stacked-item-card-image-wrapper {
    float: right; }
  .stacked-item-card .hover-overlay {
    display: none;
    position: absolute;
    bottom: 0;
    right: 0;
    left: 0;
    width: 100%;
    height: 50%;
    z-index: 40;
    background-image: linear-gradient(rgba(255, 255, 255, 0.75), #fff); }
    .stacked-item-card .hover-overlay .pull-left {
      padding: 4px 0 0 8px; }
    .stacked-item-card .hover-overlay .pull-right {
      padding: 4px 16px 0 0; }
      .stacked-item-card .hover-overlay .pull-right .dec {
        margin-right: 4px; }
  .stacked-item-card .favorite-btn {
    position: absolute;
    display: none; }
  .stacked-item-card.loading {
    pointer-events: none; }
    .stacked-item-card.loading .item-info {
      padding: 10px 20px 0 20px;
      max-width: 60%; }
    .stacked-item-card.loading .item-name .full-item-name {
      width: 90%;
      margin-bottom: 5px; }
    .stacked-item-card.loading .item-size {
      display: block;
      width: 25%; }
    .stacked-item-card.loading .item-price {
      display: block;
      width: 35%; }
    .stacked-item-card.loading .item-name .full-item-name,
    .stacked-item-card.loading .item-size,
    .stacked-item-card.loading .item-price {
      height: 15px; }
    .stacked-item-card.loading .media .image-loading-placeholder {
      background-color: #f7f7f7; }
  .stacked-item-card.unavailable .item-image {
    opacity: 0.4; }
  .stacked-item-card.unavailable .out-of-stock-text {
    color: #757575; }
  .stacked-item-card .choice {
    text-align: center;
    border-bottom: 1px solid #eee;
    margin-bottom: 4px;
    color: #999; }
  .stacked-item-card:hover .hover-overlay, .stacked-item-card:focus .hover-overlay {
    display: block; }
    @media (max-width: 767px) {
      .stacked-item-card:hover .hover-overlay, .stacked-item-card:focus .hover-overlay {
        display: none; } }
    @media (min-width: 768px) and (max-width: 991px) {
      .stacked-item-card:hover .hover-overlay, .stacked-item-card:focus .hover-overlay {
        display: none; } }
  .stacked-item-card:hover .favorite-btn, .stacked-item-card:focus .favorite-btn {
    display: block; }
  .stacked-item-card:hover.test-with-link-styles .full-item-name, .stacked-item-card:focus.test-with-link-styles .full-item-name {
    color: #01939A; }
    .stacked-item-card:hover.test-with-link-styles .full-item-name:hover, .stacked-item-card:focus.test-with-link-styles .full-item-name:hover {
      text-decoration: underline; }
  .stacked-item-card:hover .media, .stacked-item-card:focus .media {
    -webkit-user-select: none;
    -moz-user-select: none;
    -ms-user-select: none;
    user-select: none; }
    .stacked-item-card:hover .media .ic-btn-success, .stacked-item-card:focus .media .ic-btn-success {
      left: 14px;
      position: relative; }
    .stacked-item-card:hover .media .info-group, .stacked-item-card:focus .media .info-group {
      display: block; }
    .stacked-item-card:hover .media .btn-group, .stacked-item-card:focus .media .btn-group {
      display: block; }
  .stacked-item-card.in-cart .media .item-quantity-small {
    display: block; }
  .stacked-item-card.in-cart .media .info-group .qty-buttons .dec {
    display: inline-block; }
  .stacked-item-card.in-cart:hover .hover-overlay, .stacked-item-card.in-cart:focus .hover-overlay {
    display: block; }
    @media (max-width: 767px) {
      .stacked-item-card.in-cart:hover .hover-overlay, .stacked-item-card.in-cart:focus .hover-overlay {
        display: none; } }
    @media (min-width: 768px) and (max-width: 991px) {
      .stacked-item-card.in-cart:hover .hover-overlay, .stacked-item-card.in-cart:focus .hover-overlay {
        display: none; } }
  .stacked-item-card.in-cart:hover .favorite-btn, .stacked-item-card.in-cart:focus .favorite-btn {
    display: block; }
  .stacked-item-card.in-cart:hover .item-quantity, .stacked-item-card.in-cart:focus .item-quantity {
    display: block; }
  .stacked-item-card.in-cart:hover .on-sale-banner,
  .stacked-item-card.in-cart:hover .item-coupon, .stacked-item-card.in-cart:focus .on-sale-banner,
  .stacked-item-card.in-cart:focus .item-coupon {
    display: none; }
  .stacked-item-card.in-cart:hover .media .btn-group, .stacked-item-card.in-cart:focus .media .btn-group {
    display: none; }
  .stacked-item-card.in-cart:hover .media .item-quantity, .stacked-item-card.in-cart:focus .media .item-quantity {
    display: block; }
  .stacked-item-card .media {
    margin-top: 0;
    position: relative;
    overflow: visible;
    float: right;
    margin: 16px;
    width: 64px;
    height: 64px; }
    .stacked-item-card .media .item-image {
      display: block;
      width: 64px;
      height: 64px; }
    .stacked-item-card .media .btn-group {
      display: none;
      position: absolute; }
    .stacked-item-card .media .item-quantity {
      display: none;
      position: absolute;
      left: 0;
      top: -10px;
      width: 100%;
      height: 112px;
      color: #fff;
      font-weight: 300;
      background-color: rgba(0, 0, 0, 0.5); }
      .stacked-item-card .media .item-quantity .item-quantity-amount {
        margin-top: 30px;
        font-size: 40px;
        display: block;
        text-align: center;
        line-height: 38px; }
      .stacked-item-card .media .item-quantity .item-quantity-label {
        text-align: center;
        display: block;
        font-size: 16px; }
    .stacked-item-card .media .item-quantity-small {
      -moz-border-radius-topleft: 20px !important;
      -moz-border-radius-topright: 20px !important;
      -moz-border-radius-bottomright: 20px !important;
      -moz-border-radius-bottomleft: 20px !important;
      -webkit-border-top-left-radius: 20px !important;
      -webkit-border-top-right-radius: 20px !important;
      -webkit-border-bottom-right-radius: 20px !important;
      -webkit-border-bottom-left-radius: 20px !important;
      border-top-left-radius: 20px !important;
      border-top-right-radius: 20px !important;
      border-bottom-right-radius: 20px !important;
      border-bottom-left-radius: 20px !important;
      padding: 4px 9px;
      min-width: 10px;
      position: absolute;
      display: none;
      top: -10px;
      right: -10px;
      background-color: #43B02A;
      color: #fff;
      font-size: 16px;
      text-align: center;
      font-weight: normal;
      text-rendering: optimizeLegibility; }
    .stacked-item-card .media .info-group {
      position: absolute;
      bottom: 0;
      display: none;
      width: 100%;
      height: 53px;
      padding: 10px;
      top: -10px;
      padding-bottom: 0;
      border-top: 1px solid #e5edec;
      background-image: -webkit-linear-gradient(rgba(255, 255, 255, 0.75), white);
      background-image: linear-gradient(rgba(255, 255, 255, 0.75), white);
      filter: progid:DXImageTransform.Microsoft.gradient( startColorstr='#d9ffffff', endColorstr='#ffffff',GradientType=0 ); }
      .stacked-item-card .media .info-group .info-price {
        background-color: #929292;
        background-color: rgba(146, 146, 146, 0.75);
        padding: 8px;
        font-size: 14px;
        text-align: center;
        color: #fff;
        display: inline-block;
        font-weight: 300;
        letter-spacing: 1px;
        -moz-border-radius-topleft: 4px !important;
        -moz-border-radius-topright: 4px !important;
        -moz-border-radius-bottomright: 4px !important;
        -moz-border-radius-bottomleft: 4px !important;
        -webkit-border-top-left-radius: 4px !important;
        -webkit-border-top-right-radius: 4px !important;
        -webkit-border-bottom-right-radius: 4px !important;
        -webkit-border-bottom-left-radius: 4px !important;
        border-top-left-radius: 4px !important;
        border-top-right-radius: 4px !important;
        border-bottom-right-radius: 4px !important;
        border-bottom-left-radius: 4px !important;
        max-width: 64px;
        line-height: 15px; }
      .stacked-item-card .media .info-group .item-full-price {
        display: inline-block;
        padding-left: 5px; }
      .stacked-item-card .media .info-group .qty-buttons {
        margin-right: 4px;
        margin-left: 0; }
        .stacked-item-card .media .info-group .qty-buttons .dec {
          display: none;
          margin-right: 5px; }
        .stacked-item-card .media .info-group .qty-buttons button {
          text-decoration: none;
          font-weight: 700;
          letter-spacing: 0.1em;
          line-height: 20px;
          padding: 6px 10px;
          -moz-border-radius-topleft: 4px !important;
          -moz-border-radius-topright: 4px !important;
          -moz-border-radius-bottomright: 4px !important;
          -moz-border-radius-bottomleft: 4px !important;
          -webkit-border-top-left-radius: 4px !important;
          -webkit-border-top-right-radius: 4px !important;
          -webkit-border-bottom-right-radius: 4px !important;
          -webkit-border-bottom-left-radius: 4px !important;
          border-top-left-radius: 4px !important;
          border-top-right-radius: 4px !important;
          border-bottom-right-radius: 4px !important;
          border-bottom-left-radius: 4px !important; }
          .stacked-item-card .media .info-group .qty-buttons button.favorite-btn {
            font-size: 20px; }
    .stacked-item-card .media .on-sale-banner {
      width: 36px;
      height: 18px;
      position: absolute;
      top: 46px;
      right: 5px;
      padding: 0; }
  .stacked-item-card .item-row {
    margin-bottom: 4px; }
  .stacked-item-card .item-name {
    line-height: 1.5em; }
    .stacked-item-card .item-name .full-item-name {
      max-height: 55px;
      overflow: hidden;
      white-space: nowrap;
      display: block;
      text-overflow: ellipsis;
      line-height: 1.4em; }
  .stacked-item-card .item-aisle-link, .stacked-item-card .item-es-score {
    position: absolute;
    visibility: hidden;
    left: 0;
    right: 0;
    bottom: 0;
    margin-bottom: 10px;
    text-align: center;
    padding: 0 20px 0 20px;
    color: #43B02A; }
    @media (max-width: 767px) {
      .stacked-item-card .item-aisle-link, .stacked-item-card .item-es-score {
        display: none; } }
  .stacked-item-card .item-es-score {
    bottom: 22px; }
  .stacked-item-card .item-coupon {
    position: absolute;
    z-index: 100;
    width: 100%;
    text-align: center;
    background: #8AAFB0;
    margin-bottom: 0;
    color: #fff;
    font-size: 11px;
    line-height: 11px;
    letter-spacing: 1px;
    padding: 2px 0; }
    .stacked-item-card .item-coupon .expires {
      color: #eee;
      font-weight: 300;
      font-size: 12px; }
  .stacked-item-card .item-info {
    height: 96px;
    background: #fff;
    min-height: 61px;
    font-size: 13px;
    padding: 16px 0 0 16px; }
    .stacked-item-card .item-info .muted {
      color: #999; }
  .stacked-item-card .input-qty {
    width: 25px;
    text-align: center;
    padding-top: 2px;
    padding-bottom: 2px; }
  @media (max-width: 767px) {
    .stacked-item-card {
      width: 100%;
      height: 96px; }
      .stacked-item-card:hover .media .info-group, .stacked-item-card:focus .media .info-group {
        display: none; }
      .stacked-item-card .media .item-image {
        width: 64px;
        height: 64px; }
      .stacked-item-card .item-info {
        padding: 16px; } }
  @media (min-width: 768px) and (max-width: 991px) {
    .stacked-item-card {
      width: 96px; }
      .stacked-item-card:hover .media .info-group, .stacked-item-card:focus .media .info-group {
        display: none; }
      .stacked-item-card .media .item-image {
        width: 64px;
        height: 64px; }
      .stacked-item-card .item-info {
        padding: 16px; } }
  .stacked-item-card .detail-progress-indicator {
    display: none; }
  .stacked-item-card .badge--coupon-clipping,
  .stacked-item-card .badge--coupon-clipping-applied {
    display: none; }

.flex-grid {
  display: flex;
  flex-wrap: wrap; }

.item-loading {
  animation-name: item-loading;
  animation-duration: 2s;
  animation-direction: alternate;
  animation-timing-function: ease-in-out;
  animation-iteration-count: 100; }

@media (max-width: 991px) {
  .items-list .stacked-item-card {
    margin: 0;
    border-right: 0; } }

@media (min-width: 768px) and (max-width: 991px) {
  .items-list .stacked-item-card {
    width: calc(100vw / 3.5); } }

@media (max-width: 767px) {
  .items-grid .stacked-item-card {
    width: 100%;
    border-right: 0;
    border-left: 0;
    margin-right: 0; }
    .items-grid .stacked-item-card:nth-child(even) {
      border-left: 1px solid #e5edec; }
    .items-grid .stacked-item-card .media .item-image {
      width: 64px;
      height: 64px; } }

@media (min-width: 768px) and (max-width: 991px) {
  .items-grid .stacked-item-card {
    margin-right: 0;
    border-right: 0;
    width: 50%; }
    .items-grid .stacked-item-card:nth-child(4n+1) {
      border-left: 0; }
    .items-grid .stacked-item-card:last-child {
      border-right: 1px solid #e5edec; }
    .items-grid .stacked-item-card:nth-child(4n+0) {
      /* in case the last child is the 4th in the row */
      border-right: 0; } }

@-webkit-keyframes item-loading {
  0% {
    background-color: #efefef; }
  100% {
    background-color: #ddd; } }

@-moz-keyframes item-loading {
  0% {
    background-color: #efefef; }
  100% {
    background-color: #ddd; } }

@keyframes item-loading {
  0% {
    background-color: #efefef; }
  100% {
    background-color: #ddd; } }

.CardCarouselContainer {
  max-width: 1950px;
  margin: auto; }
  @media (max-width: 767px) {
    .CardCarouselContainer {
      max-width: none;
      white-space: nowrap;
      overflow-y: hidden;
      overflow-x: scroll;
      -ms-overflow-style: none;
      overflow: -moz-scrollbars-none;
      -webkit-overflow-scrolling: touch; }
      .CardCarouselContainer::-webkit-scrollbar {
        display: none; } }
  .CardCarouselContainer .CarouselCard {
    display: inline-block;
    padding: 0 5px;
    vertical-align: top;
    position: relative;
    text-align: center; }
    .CardCarouselContainer .CarouselCard .CardLogo {
      position: absolute;
      display: block;
      max-width: 135px;
      max-height: 65px;
      width: auto;
      height: auto;
      bottom: 0px;
      margin: 20px;
      right: 0px; }
  .CardCarouselContainer .banner-short {
    border: none; }
    @media (max-width: 576px) {
      .CardCarouselContainer .banner-short {
        display: none; } }
  .CardCarouselContainer .CardContainer {
    display: block;
    text-align: left; }
  .CardCarouselContainer .Message {
    padding-left: 10px;
    color: white; }
    .CardCarouselContainer .Message .MessageHeader {
      font-weight: 900;
      font-size: 28px;
      line-height: 32px; }
    .CardCarouselContainer .Message .MessageBody {
      font-weight: 600;
      font-size: 16px;
      line-height: 20px;
      margin-top: 4px; }
  .CardCarouselContainer .carousel-card {
    position: relative;
    display: inline-block;
    padding: 0 5px;
    vertical-align: top; }
    .CardCarouselContainer .carousel-card .card-container {
      display: block;
      height: 160px;
      border-radius: 4px;
      background-position: center;
      background-repeat: no-repeat;
      background-size: cover;
      text-align: left; }
      @media (max-width: 767px) {
        .CardCarouselContainer .carousel-card .card-container {
          width: 342px; } }
      @media (max-width: 576px) {
        .CardCarouselContainer .carousel-card .card-container {
          height: 130px; } }
      .CardCarouselContainer .carousel-card .card-container .card-content {
        position: relative;
        width: inherit;
        height: inherit;
        padding: 0 25px; }
        .CardCarouselContainer .carousel-card .card-container .card-content > div {
          position: relative;
          display: inline-block;
          vertical-align: middle; }
          .CardCarouselContainer .carousel-card .card-container .card-content > div:first-child {
            width: 65%;
            padding-right: 5px; }
          .CardCarouselContainer .carousel-card .card-container .card-content > div:last-child {
            width: 35%; }
        .CardCarouselContainer .carousel-card .card-container .card-content.gift-card {
          padding: 0 0 0 25px; }
          .CardCarouselContainer .carousel-card .card-container .card-content.gift-card .body-container {
            z-index: 1; }
          .CardCarouselContainer .carousel-card .card-container .card-content.gift-card .logo-container {
            z-index: 0; }
        .CardCarouselContainer .carousel-card .card-container .card-content .message {
          padding-bottom: 13px; }
          @media (max-width: 576px) {
            .CardCarouselContainer .carousel-card .card-container .card-content .message {
              padding-bottom: 3px; } }
          .CardCarouselContainer .carousel-card .card-container .card-content .message .message-header {
            padding-bottom: 2px;
            font-size: 20px;
            line-height: 26px;
            font-weight: bold; }
            @media (max-width: 576px) {
              .CardCarouselContainer .carousel-card .card-container .card-content .message .message-header {
                font-size: 18px;
                line-height: 22px; } }
          .CardCarouselContainer .carousel-card .card-container .card-content .message .message-body {
            font-size: 14px;
            line-height: 20px;
            white-space: normal; }
        .CardCarouselContainer .carousel-card .card-container .card-content .logo-container {
          height: 100%; }
          .CardCarouselContainer .carousel-card .card-container .card-content .logo-container .logo-bg {
            position: absolute;
            width: 100px;
            height: 100px;
            margin: auto;
            top: 0;
            bottom: 0;
            right: 0;
            border-radius: 50px;
            background-color: white; }
            .CardCarouselContainer .carousel-card .card-container .card-content .logo-container .logo-bg.small {
              width: 70px;
              height: 70px; }
            .CardCarouselContainer .carousel-card .card-container .card-content .logo-container .logo-bg .card-logo {
              position: absolute;
              max-width: 80%;
              max-height: 50%;
              margin: auto;
              top: 0;
              bottom: 0;
              left: 0;
              right: 0; }
          .CardCarouselContainer .carousel-card .card-container .card-content .logo-container .gift-card-graphic {
            position: absolute;
            width: auto;
            height: auto;
            margin: 0;
            bottom: 0;
            right: 0; }

/* high-contrast-mode */
.high-contrast-mode .CardCarouselContainer .carousel-card .card-container {
  background-color: #000 !important; }
  .high-contrast-mode .CardCarouselContainer .carousel-card .card-container .card-content .message {
    color: #fff !important; }

.store-prices p {
  font-weight: 400;
  color: #868686; }

.store-prices .ic-loading {
  margin-top: 20px; }

.store-prices .prices {
  font-weight: 600;
  color: #43B02A;
  font-size: 18px;
  line-height: 20px;
  margin: 10px 0px; }

.store-prices .prices.highest {
  color: #F7A700; }

.store-prices .card-body {
  min-height: 50px;
  max-height: 50px; }

.store-prices .ic-loading {
  margin: 20px; }

.store-prices .fine-print {
  background-color: #fff;
  border: 1px solid #F0EFEC;
  padding: 20px;
  -moz-border-radius-topleft: 4px !important;
  -moz-border-radius-topright: 4px !important;
  -moz-border-radius-bottomright: 4px !important;
  -moz-border-radius-bottomleft: 4px !important;
  -webkit-border-top-left-radius: 4px !important;
  -webkit-border-top-right-radius: 4px !important;
  -webkit-border-bottom-right-radius: 4px !important;
  -webkit-border-bottom-left-radius: 4px !important;
  border-top-left-radius: 4px !important;
  border-top-right-radius: 4px !important;
  border-bottom-right-radius: 4px !important;
  border-bottom-left-radius: 4px !important; }

.store-prices .fine-print a {
  display: block;
  margin-top: 10px; }

.store-prices .retailer-card .logo {
  width: 96px;
  height: 96px; }

.navigation-tabs {
  height: 100%;
  width: 100%;
  text-align: center; }

.navigation-tabs-inner-wrapper {
  height: 100%;
  display: inline-block;
  margin: 0 auto;
  position: relative;
  overflow: hidden; }

.navigation-tab {
  height: 100%;
  color: #939291;
  font-size: 16px;
  font-weight: 600;
  margin: 0;
  padding: 0 16px; }
  .navigation-tab:hover {
    color: #43B02A; }
  .navigation-tab.active {
    color: #43B02A; }
    .navigation-tab.active a {
      color: #43B02A; }
  .navigation-tab a {
    color: #939291;
    height: 100%;
    display: inline-block;
    padding-top: 18px;
    -webkit-transition: color 200ms linear;
    -moz-transition: color 200ms linear;
    transition: color 200ms linear; }
    .navigation-tab a:hover, .navigation-tab a:active, .navigation-tab a:focus {
      text-decoration: none;
      color: #43B02A; }

.navigation-tab-seeker {
  background-color: #43B02A;
  height: 4px;
  left: 0;
  bottom: 0;
  position: absolute;
  -webkit-transition: -webkit-transform 200ms ease-in-out, bottom 200ms ease-in-out, width 200ms ease-in-out;
  -moz-transition: -moz-transform 200ms ease-in-out, bottom 200ms ease-in-out, width 200ms ease-in-out;
  transition: transform 200ms ease-in-out, bottom 200ms ease-in-out, width 200ms ease-in-out;
  -webkit-backface-visibility: hidden;
  backface-visibility: hidden;
  -webkit-transform: translateZ(0);
  -moz-transform: translateZ(0);
  -ms-transform: translateZ(0);
  -o-transform: translateZ(0);
  transform: translateZ(0);
  will-change: transform, bottom, width; }

#toast-container {
  position: fixed;
  left: 16px;
  bottom: 0;
  width: 480px;
  z-index: 99999; }
  #store.order-changes #toast-container {
    display: none; }
  #toast-container .toast-inner > ul {
    margin-bottom: 0; }
  #toast-container .toast-message {
    width: 100%;
    height: auto;
    background-color: #212121;
    color: #fff !important;
    margin-bottom: 16px;
    box-shadow: 0px 1px 5px 0px rgba(0, 0, 0, 0.16), 0px 1px 2px 0px rgba(0, 0, 0, 0.26);
    border-radius: 4px;
    animation: toast-slide-in 500ms ease-in-out;
    will-change: translate3d, transform;
    backface-visibility: hidden;
    transform: translateZ(0);
    padding: 12px;
    line-height: 1.75;
    z-index: 10; }
    #toast-container .toast-message.static {
      height: auto;
      background: #fff; }
      #toast-container .toast-message.static .toast-main-content {
        color: #212121 !important; }
      #toast-container .toast-message.static .toast-action {
        background-color: #fff; }
        #toast-container .toast-message.static .toast-action:hover {
          background-color: #f2f2f2; }
    #toast-container .toast-message .toast-dismiss {
      display: block;
      float: right;
      position: absolute;
      vertical-align: middle;
      font-size: 12px;
      border: none;
      top: -13px;
      right: -13px;
      width: 24px;
      height: 24px;
      border-radius: 24px;
      -webkit-backdrop-filter: blur(20px);
      backdrop-filter: blur(20px);
      background-color: #f7f7f7;
      color: #212121;
      box-shadow: 0 1px 2px 0 rgba(0, 0, 0, 0.24); }
      @media (max-width: 544px) {
        #toast-container .toast-message .toast-dismiss {
          right: -10px;
          top: -10px; } }
      #toast-container .toast-message .toast-dismiss:hover, #toast-container .toast-message .toast-dismiss:active, #toast-container .toast-message .toast-dismiss:focus {
        border: none;
        color: #62C94B;
        cursor: pointer; }
    #toast-container .toast-message.animating-out {
      animation: toast-slide-out 500ms ease-in-out; }
  #toast-container .toast-main-content {
    color: #fff;
    height: 100%;
    width: 100%;
    padding-left: 8px; }
    #toast-container .toast-main-content:hover, #toast-container .toast-main-content:focus, #toast-container .toast-main-content:active {
      text-decoration: none; }
    #toast-container .toast-main-content p {
      max-width: 362px;
      font-size: 16px;
      color: #aaa;
      line-height: 20px;
      margin: 0;
      max-width: 400px; }
  #toast-container .toast-actions {
    line-height: auto;
    display: inline; }
    #toast-container .toast-actions .toast-action {
      float: right;
      display: inline;
      color: #62C94B;
      font-weight: bold;
      padding: 2px 8px;
      border-radius: 4px;
      border: none;
      background: #212121; }
      #toast-container .toast-actions .toast-action:hover {
        color: #62C94B;
        cursor: pointer; }
    @media (max-width: 991px) {
      #toast-container .toast-actions {
        padding-right: 0; } }
  #toast-container .default-toast-module {
    height: 100%;
    overflow: hidden; }
  @media (max-width: 544px) {
    #toast-container {
      left: 10px;
      width: calc(100% - 20px); }
      #toast-container .toast-message {
        margin-bottom: 10px; } }

@-webkit-keyframes toast-slide-in {
  0% {
    transform: translate3d(0, auto16px, 0);
    opacity: 0; }
  100% {
    transform: translate3d(0, 0, 0);
    opacity: 1; } }

@-moz-keyframes toast-slide-in {
  0% {
    transform: translate3d(0, auto16px, 0);
    opacity: 0; }
  100% {
    transform: translate3d(0, 0, 0);
    opacity: 1; } }

@keyframes toast-slide-in {
  0% {
    transform: translate3d(0, auto16px, 0);
    opacity: 0; }
  100% {
    transform: translate3d(0, 0, 0);
    opacity: 1; } }

@-webkit-keyframes toast-slide-out {
  0% {
    transform: translate3d(0, 0, 0);
    opacity: 1; }
  100% {
    transform: translate3d(0, auto16px, 0);
    opacity: 0; } }

@-moz-keyframes toast-slide-out {
  0% {
    transform: translate3d(0, 0, 0);
    opacity: 1; }
  100% {
    transform: translate3d(0, auto16px, 0);
    opacity: 0; } }

@keyframes toast-slide-out {
  0% {
    transform: translate3d(0, 0, 0);
    opacity: 1; }
  100% {
    transform: translate3d(0, auto16px, 0);
    opacity: 0; } }

@-webkit-keyframes toast-slide-in-static {
  0% {
    transform: translate3d(0, auto16px, 0);
    opacity: 0; }
  100% {
    transform: translate3d(0, 0, 0);
    opacity: 1; } }

@-moz-keyframes toast-slide-in-static {
  0% {
    transform: translate3d(0, auto16px, 0);
    opacity: 0; }
  100% {
    transform: translate3d(0, 0, 0);
    opacity: 1; } }

@keyframes toast-slide-in-static {
  0% {
    transform: translate3d(0, auto16px, 0);
    opacity: 0; }
  100% {
    transform: translate3d(0, 0, 0);
    opacity: 1; } }

@-webkit-keyframes toast-slide-out-static {
  0% {
    transform: translate3d(0, 0, 0);
    opacity: 1; }
  100% {
    transform: translate3d(0, auto16px, 0);
    opacity: 0; } }

@-moz-keyframes toast-slide-out-static {
  0% {
    transform: translate3d(0, 0, 0);
    opacity: 1; }
  100% {
    transform: translate3d(0, auto16px, 0);
    opacity: 0; } }

@keyframes toast-slide-out-static {
  0% {
    transform: translate3d(0, 0, 0);
    opacity: 1; }
  100% {
    transform: translate3d(0, auto16px, 0);
    opacity: 0; } }

.ic-tooltip {
  background: #fff;
  position: absolute;
  border: 1px solid #ccc;
  padding: 10px 20px;
  border-radius: 6px;
  box-shadow: 0px 0px 5px 0px #474747; }
  .ic-tooltip .arrow {
    position: relative; }
    .ic-tooltip .arrow:before {
      content: '';
      border-style: solid;
      border-width: 0 7.5px 10px 8.5px;
      border-color: transparent transparent #B3B3B3 transparent;
      top: -21px;
      left: -2px;
      position: absolute; }
    .ic-tooltip .arrow:after {
      content: '';
      border-style: solid;
      border-width: 0 6.5px 9px 6.5px;
      border-color: transparent transparent #ffffff transparent;
      top: -19px;
      left: 0;
      position: absolute; }
  .ic-tooltip.bounceIn {
    -webkit-animation: bounceIn 400ms linear both;
    animation: bounceIn 400ms linear both; }

@keyframes bounceIn {
  from {
    transform: scale3d(1, 1, 1); }
  50% {
    transform: scale3d(1.02, 1.02, 1.02); }
  to {
    transform: scale3d(1, 1, 1); } }

.aisle-breadcrumb {
  margin-top: 16px;
  margin-bottom: -28px; }
  .aisle-breadcrumb .link {
    cursor: pointer;
    color: #43B02A;
    font-weight: 700; }
  @media (max-width: 767px) {
    .aisle-breadcrumb {
      margin-bottom: 0;
      margin-left: 12px; } }

.browse-footer {
  background-color: white;
  border-top: 1px solid #e5edec;
  border-bottom: 1px solid #e5edec;
  text-align: center;
  margin-top: 48px;
  height: 192px; }
  .browse-footer h2 {
    font-size: 20px; }
  .browse-footer h3 {
    font-size: 16px;
    color: #7a7a7a; }
  .browse-footer .inner-container {
    height: 190px; }
  .browse-footer .vertical-align-container {
    height: 100%;
    padding: 36px 0; }
  .browse-footer .content-container {
    display: inline-block;
    padding: 0 20vw;
    background: white;
    /* Permalink - use to edit and share this gradient: http://colorzilla.com/gradient-editor/#ffffff+0,ffffff+100&0+0,1+30,1+70,0+100 */
    background: -moz-linear-gradient(left, rgba(255, 255, 255, 0) 0%, white 30%, white 70%, rgba(255, 255, 255, 0) 100%);
    /* FF3.6-15 */
    background: -webkit-linear-gradient(left, rgba(255, 255, 255, 0) 0%, white 30%, white 70%, rgba(255, 255, 255, 0) 100%);
    /* Chrome10-25,Safari5.1-6 */
    background: linear-gradient(to right, rgba(255, 255, 255, 0) 0%, white 30%, white 70%, rgba(255, 255, 255, 0) 100%);
    /* W3C, IE10+, FF16+, Chrome26+, Opera12+, Safari7+ */ }
    .browse-footer .content-container h2 {
      font-size: 28px;
      font-weight: 600;
      text-align: center;
      color: #424242; }
    .browse-footer .content-container h3 {
      font-size: 16px;
      line-height: 1;
      text-align: center;
      color: #757575; }
  .browse-footer .ic-btn-secondary {
    margin-right: 24px;
    color: #43B02A; }

.module-renderer .browse-header {
  margin-top: -24px; }
  .module-renderer .browse-header.with-image .hero {
    padding: 30px !important; }
    .module-renderer .browse-header.with-image .hero h1 {
      text-align: center !important;
      width: 100% !important;
      font-weight: 600 !important; }
  .module-renderer .browse-header.generic .hero {
    padding: 30px;
    border-bottom: 1px solid #F0EFEC; }
  .module-renderer .browse-header .hero {
    padding: 30px 0 0 0;
    border-bottom: none; }
    .module-renderer .browse-header .hero h1 {
      font-weight: 600; }
  .module-renderer .browse-header.department .hero {
    background-color: inherit; }
    .module-renderer .browse-header.department .hero h1 {
      font-size: 44px;
      text-align: left; }
  .module-renderer .browse-header.aisle .hero {
    background-color: inherit; }
    .module-renderer .browse-header.aisle .hero h1 {
      width: 67%;
      text-align: left;
      font-size: 28px; }
  .module-renderer .browse-header.modal-header {
    padding: 0px;
    border-bottom: 0px; }
    .module-renderer .browse-header.modal-header .hero {
      padding: 0px;
      border-bottom: 0px; }
      .module-renderer .browse-header.modal-header .hero h1 {
        font-size: 28px; }
      .module-renderer .browse-header.modal-header .hero p {
        font-size: 18px; }
  @media (max-width: 767px) {
    .module-renderer .browse-header {
      margin-top: 26px; } }

.header-modules-wrapper .browse-header {
  margin-top: 0px; }

@media only screen and (max-width: 616px) {
  .browse-header .hero {
    padding: 10px; }
  .browse-header .navigation-pills {
    margin-top: 0px; }
    .browse-header .navigation-pills .ic-btn {
      margin-top: 5px; } }

.cart-container {
  height: 100%;
  visibility: hidden;
  position: fixed;
  background-color: #ffffff;
  z-index: 1020;
  top: 0px;
  will-change: translateX;
  -webkit-transform: translateX(100vw);
  -moz-transform: translateX(100vw);
  -ms-transform: translateX(100vw);
  -o-transform: translateX(100vw);
  transform: translateX(100vw);
  -webkit-transition: 450ms cubic-bezier(0.23, 1, 0.32, 1);
  -moz-transition: 450ms cubic-bezier(0.23, 1, 0.32, 1);
  transition: 450ms cubic-bezier(0.23, 1, 0.32, 1); }
  .cart-container.open {
    -webkit-transform: translateX(100vw) translateX(-535px);
    -moz-transform: translateX(100vw) translateX(-535px);
    -ms-transform: translateX(100vw) translateX(-535px);
    -o-transform: translateX(100vw) translateX(-535px);
    transform: translateX(100vw) translateX(-535px); }
  @supports not (-webkit-line-clamp: 2) {
    .cart-container .clamped-name {
      position: relative;
      height: 3em;
      overflow: hidden; }
    .cart-container .clamped-name:after {
      content: "";
      text-align: right;
      position: absolute;
      bottom: 0;
      right: 0;
      width: 50%;
      height: 1.2em;
      background: linear-gradient(to right, rgba(255, 255, 255, 0), white 80%); } }
  @supports (-webkit-line-clamp: 2) {
    .cart-container .clamped-name {
      overflow: hidden;
      text-overflow: ellipsis;
      display: -webkit-box;
      -webkit-line-clamp: 2;
      -webkit-box-orient: vertical; }
    .cart-container .clamped-name:after {
      display: none; } }
  .cart-container .cart-container-inner {
    position: relative;
    height: 100%; }
  .cart-container .module-renderer {
    display: flex;
    flex-direction: column;
    height: 100%;
    margin: 0;
    padding: 0; }
    .cart-container .module-renderer .header-modules-wrapper .module-wrapper {
      margin: 0 auto; }
    .cart-container .module-renderer .module-component-retailerheader:not(:first-child) {
      margin-top: 16px; }
    .cart-container .module-renderer .module-wrapper {
      width: 100%;
      margin: 0 auto;
      background-color: #fff; }
    .cart-container .module-renderer .module-renderer {
      overflow-y: auto;
      position: relative;
      padding: 0; }
      .cart-container .module-renderer .module-renderer .module-wrapper {
        margin: 0 auto;
        width: 100%;
        background-color: white; }
  .cart-container .remove-item-wrapper {
    padding: 0;
    border: 0;
    background-color: white;
    position: absolute;
    top: -36px;
    right: 4px;
    font-size: 18px;
    font-weight: 100;
    line-height: 38px;
    text-shadow: none;
    margin-right: 10px;
    color: #929292;
    cursor: pointer; }

.cart-progress {
  background: white;
  padding-bottom: 15px;
  padding-top: 15px;
  max-width: 1225px;
  margin: auto;
  border: 1px solid #e5edec;
  border-radius: 4px; }
  .cart-progress p {
    font-size: 24px;
    text-align: center;
    margin-bottom: 5px; }
  .cart-progress .muted {
    display: block;
    font-size: 14px; }
  .cart-progress .progress-bar {
    margin: auto;
    display: inline-block;
    width: 80%;
    max-width: 400px;
    margin-bottom: 12px; }
  .cart-progress .ic-icon-check-bold {
    display: inline-block;
    color: #43B02A;
    margin-left: 10px;
    font-size: 20px;
    vertical-align: middle; }
  .cart-progress .bar {
    height: 12px;
    width: 80%;
    max-width: 400px;
    margin: auto;
    margin-top: 15px; }
  @media (max-width: 767px) {
    .cart-progress {
      flex-direction: row;
      flex-grow: 4;
      width: 100%;
      padding-left: 10%;
      padding-right: 10%; }
      .cart-progress p {
        font-size: 16px; }
      .cart-progress .muted {
        font-size: 11px; } }

.loading-state {
  animation-name: loading-state;
  animation-duration: 2s;
  animation-direction: alternate;
  animation-timing-function: ease-in-out;
  animation-iteration-count: 100; }

@-webkit-keyframes loading-state {
  0% {
    background-color: #efefef; }
  100% {
    background-color: #ddd; } }

@-moz-keyframes loading-state {
  0% {
    background-color: #efefef; }
  100% {
    background-color: #ddd; } }

@keyframes loading-state {
  0% {
    background-color: #efefef; }
  100% {
    background-color: #ddd; } }

@media (max-width: 991px) {
  .CheckoutContainerBody .ic-nav-checkout {
    position: absolute;
    min-width: auto; }
    .CheckoutContainerBody .ic-nav-checkout .Topbar {
      position: absolute; } }

.condensed-retailer-chooser .condensed-retailer-chooser-retailer-option-list-wrapper.expanded .condensed-retailer-group-container {
  height: inherit; }

.condensed-retailer-chooser .condensed-retailer-group-container {
  height: 154px;
  overflow: hidden;
  display: flex;
  flex-wrap: wrap;
  justify-content: center; }

.condensed-retailer-chooser .see-all:hover {
  text-decoration: underline; }

.condensed-retailer-chooser.fade-in {
  animation: fadeIn;
  animation-duration: .5s; }

.condensed-retailer-chooser .retailer-option {
  margin: 0 6px;
  display: inline-block; }

.condensed-retailer-chooser .retailer-option-inner-wrapper {
  display: block;
  height: 154px;
  width: 115px;
  margin-bottom: 16px;
  position: relative; }

.condensed-retailer-chooser .retailer-option-logo-wrapper {
  display: block;
  width: 112px;
  height: 112px;
  position: relative; }
  .condensed-retailer-chooser .retailer-option-logo-wrapper img {
    width: 96px;
    height: 96px;
    box-shadow: 0px 0px 0px 1px rgba(0, 0, 0, 0.15);
    border-radius: 50%;
    background-color: #fff; }

.condensed-retailer-chooser .retailer-option-body {
  text-align: center;
  color: #393939;
  font-size: 1em; }
  .condensed-retailer-chooser .retailer-option-body h3 {
    color: #424242;
    font-size: 18px;
    line-height: 22px;
    font-weight: bold;
    margin: 0;
    margin-bottom: 2px;
    max-width: 252px; }
  .condensed-retailer-chooser .retailer-option-body p {
    margin: 0; }
  .condensed-retailer-chooser .retailer-option-body .ic-icon {
    margin-right: 5px;
    font-size: 16px; }

.condensed-retailer-chooser .retailer-option-badge {
  text-transform: uppercase;
  font-size: 10px;
  padding: 0 5px;
  font-weight: 600;
  border-radius: 4px;
  color: #fff;
  display: inline-block; }

.condensed-retailer-chooser .retailer-option-admin-badge {
  background-color: #AB00E7;
  position: absolute;
  right: 10px;
  bottom: 10px;
  z-index: 10; }

.condensed-retailer-chooser .retailer-group-label {
  color: #6e6e6e;
  margin-top: 24px;
  font-weight: 600;
  margin-bottom: 14px;
  margin-left: 8px;
  text-align: center; }

.condensed-retailer-chooser .retailer-chooser-retailer-option-list-wrapper {
  margin: 0 auto;
  max-width: 1704px; }

.container-navigation-mobile {
  display: none;
  padding: 16px 0 0 16px; }
  @media (max-width: 767px) {
    .container-navigation-mobile {
      display: block;
      background: #fff; } }
  .container-navigation-mobile li {
    list-style: none; }
    .container-navigation-mobile li a {
      white-space: normal;
      color: black; }
    .container-navigation-mobile li.subcontainer {
      min-width: 60px;
      max-width: 185px;
      border-radius: 4px;
      margin-right: 4px; }
  .container-navigation-mobile .container-name {
    line-height: 1;
    font-weight: 600;
    font-size: 20px;
    padding-bottom: 6px; }
    .container-navigation-mobile .container-name.subcontainer-name {
      font-size: 16px !important; }
  .container-navigation-mobile .subcontainer {
    background-color: #f7f7f7;
    display: inline-block;
    padding: 10px; }
    .container-navigation-mobile .subcontainer:hover {
      background-color: #eee; }
  @media (hover: hover) {
    .container-navigation-mobile .container-navigation-mobile-inner-wrapper:hover .button-wrapper {
      display: block; } }
  .container-navigation-mobile .container-navigation-mobile-inner-wrapper .button-wrapper {
    display: none;
    position: absolute;
    z-index: 2;
    width: 70px; }
    .container-navigation-mobile .container-navigation-mobile-inner-wrapper .button-wrapper i {
      top: 1px;
      margin: 0 auto;
      display: block;
      line-height: 36px; }
    .container-navigation-mobile .container-navigation-mobile-inner-wrapper .button-wrapper.right-side {
      right: 0;
      background: linear-gradient(to right, rgba(255, 255, 255, 0.2), white, rgba(255, 255, 255, 0.8)); }
      .container-navigation-mobile .container-navigation-mobile-inner-wrapper .button-wrapper.right-side i {
        width: 20px; }
    .container-navigation-mobile .container-navigation-mobile-inner-wrapper .button-wrapper.left-side {
      left: 0;
      background: linear-gradient(to left, rgba(255, 255, 255, 0.2), white, rgba(255, 255, 255, 0.8)); }
      .container-navigation-mobile .container-navigation-mobile-inner-wrapper .button-wrapper.left-side i {
        width: 23px; }
  .container-navigation-mobile .container-navigation-mobile-inner-wrapper .navigation-button {
    cursor: pointer;
    color: #43B02A;
    height: 36px;
    width: 36px;
    border: solid 1px #43B02A;
    border-radius: 50%;
    background-color: white;
    margin: 0 auto; }
  .container-navigation-mobile .container-navigation-mobile-inner-wrapper i {
    font-size: 22px; }
  .container-navigation-mobile ul.subcontainer-list {
    height: 36px;
    overflow: hidden;
    margin: 0; }
    .container-navigation-mobile ul.subcontainer-list .subcontainer-list-inner-wrapper {
      padding-left: 15px;
      white-space: nowrap;
      overflow-x: scroll;
      overflow-y: hidden;
      height: 80px;
      display: inline-block;
      width: 100%; }
    .container-navigation-mobile ul.subcontainer-list .subcontainers-wrapper {
      transition: left 200ms ease-in-out;
      white-space: nowrap;
      display: inline-block;
      padding-right: 10px; }
    .container-navigation-mobile ul.subcontainer-list li.subcontainer {
      height: 36px;
      line-height: 16px;
      font-weight: normal;
      display: inline-block; }
      .container-navigation-mobile ul.subcontainer-list li.subcontainer .action-wrapper {
        text-align: center; }
        .container-navigation-mobile ul.subcontainer-list li.subcontainer .action-wrapper a {
          overflow: hidden;
          text-overflow: ellipsis;
          max-width: 165px;
          white-space: nowrap;
          display: inline-block; }
          .container-navigation-mobile ul.subcontainer-list li.subcontainer .action-wrapper a:hover {
            text-decoration: none; }
    .container-navigation-mobile ul.subcontainer-list li {
      font-weight: 600; }

.education-hero {
  border: 1px solid #e5edec;
  text-align: center;
  background-color: white;
  color: #6e6e6e; }
  .education-hero .title {
    border-bottom: 1px solid #e5edec;
    padding: 15px;
    margin: 0;
    font-weight: 600; }
  .education-hero button.cta {
    margin-bottom: 25px;
    width: 220px; }
  .education-hero .content {
    margin: 25px 0; }
    .education-hero .content.text-below-icon .row-icon {
      height: 70px;
      text-align: center; }
      .education-hero .content.text-below-icon .row-icon img {
        max-width: 100px;
        max-height: 55px; }
    .education-hero .content.text-below-icon .row-text td {
      padding-top: 10px; }
    .education-hero .content.text-below-icon .row-text p {
      font-size: 15px;
      text-align: center;
      font-weight: 600; }
    .education-hero .content .outer-box {
      width: 85%;
      margin: auto; }
      .education-hero .content .outer-box .content-card {
        text-align: initial;
        margin-bottom: 10px;
        padding: 0 0.5vw; }
        .education-hero .content .outer-box .content-card .image-container {
          width: 5vw;
          min-width: 60px;
          max-width: 80px;
          padding-right: 12px; }
        @media (max-width: 767px) {
          .education-hero .content .outer-box .content-card table {
            width: 100%; } }
      .education-hero .content .outer-box h6 {
        margin: 0;
        font-weight: 600; }
      .education-hero .content .outer-box p {
        color: #757575;
        margin: 0; }

.error-module {
  margin: 0 auto;
  padding: 42px 20px 60px 20px;
  text-align: center;
  border-radius: 4px;
  color: #424242;
  letter-spacing: 1px;
  background-color: white; }
  .error-module.error-inline {
    background-color: transparent;
    border: none; }
  .error-module h1 {
    margin-top: 0px;
    font-weight: 900; }
  .error-module h1.error-inline {
    font-size: 36px;
    font-weight: 700;
    margin-bottom: 0; }
    @media (max-width: 767px) {
      .error-module h1.error-inline {
        font-size: 23px;
        max-width: 90%;
        margin: 0 auto; } }
  .error-module img {
    max-width: 250px;
    max-height: 250px;
    margin-bottom: 10px; }
  .error-module p {
    margin-bottom: 5px; }
  .error-module p.error-inline {
    font-size: 22px; }
    @media (max-width: 767px) {
      .error-module p.error-inline {
        font-size: 16px;
        max-width: 90%;
        margin: 0 auto; } }

.featured-products-impulse-header {
  background: #fff;
  margin: 0 -1px -1px 0;
  padding: 0.8em .5em;
  font-size: 20px;
  border: 1px solid #e5edec;
  border-bottom: 0;
  -moz-border-radius-topleft: 4px !important;
  -moz-border-radius-topright: 4px !important;
  -moz-border-radius-bottomright: 0 !important;
  -moz-border-radius-bottomleft: 0 !important;
  -webkit-border-top-left-radius: 4px !important;
  -webkit-border-top-right-radius: 4px !important;
  -webkit-border-bottom-right-radius: 0 !important;
  -webkit-border-bottom-left-radius: 0 !important;
  border-top-left-radius: 4px !important;
  border-top-right-radius: 4px !important;
  border-bottom-right-radius: 0 !important;
  border-bottom-left-radius: 0 !important; }
  .featured-products-impulse-header .ic-icon-add-to-order {
    color: #43B02A;
    font-size: .9em;
    margin: .3em; }

.featured-products-impulse-header-label {
  margin-right: .3em;
  font-weight: 800; }

.featured-products-impulse-header-action {
  cursor: pointer;
  display: inline-block;
  float: right;
  color: #b0b0b0;
  font-size: .6em;
  padding-top: .5em; }
  .featured-products-impulse-header-action .ic-icon-info-filled {
    margin: .3em; }

@media (max-width: 991px) {
  .featured-products-impulse-header-sublabel {
    display: none; } }

.free-delivery-banner {
  height: 56px;
  background-color: #43B02A;
  margin: -25px -15px 44px -15px; }
  .free-delivery-banner p {
    color: white;
    font-size: 16px;
    font-weight: 600;
    line-height: 56px; }
    .free-delivery-banner p img {
      max-height: 20px;
      margin-right: 12px;
      margin-top: -3px; }
    .free-delivery-banner p a {
      font-weight: 500;
      text-decoration: underline;
      color: white; }

.image-banner {
  min-height: 105px;
  position: relative;
  border: 1px solid #e5edec;
  background-color: white; }
  .image-banner:hover {
    background-color: #e5edec;
    cursor: pointer; }
  .image-banner .dp-header {
    display: inline-block;
    position: relative;
    width: 100%; }
    .image-banner .dp-header .dp-header-image {
      width: 84px;
      height: 84px;
      position: relative;
      display: inline-block;
      margin: 10px 15px;
      vertical-align: middle; }
      .image-banner .dp-header .dp-header-image img {
        position: absolute;
        margin: auto;
        top: 0;
        right: 0;
        bottom: 0;
        left: 0; }
    .image-banner .dp-header .dp-header-content {
      display: inline-block;
      position: relative;
      width: calc(100% - (115px + 97px));
      margin: 10px 0;
      vertical-align: middle; }
      .image-banner .dp-header .dp-header-content .dp-header-title {
        padding-bottom: 5px;
        font-weight: 600;
        font-size: 16px;
        color: black; }
        .image-banner .dp-header .dp-header-content .dp-header-title:hover {
          text-decoration: underline; }
      @media (max-width: 767px) {
        .image-banner .dp-header .dp-header-content {
          width: calc(100% - (115px + 25px)); } }
      .image-banner .dp-header .dp-header-content .dp-header-body {
        color: #929292; }
        .image-banner .dp-header .dp-header-content .dp-header-body span.action-link {
          color: #01939A; }
          .image-banner .dp-header .dp-header-content .dp-header-body span.action-link:hover {
            color: #3c5555; }
      .image-banner .dp-header .dp-header-content .bar {
        height: 12px;
        width: 60%;
        margin: 15px 5px; }
  .image-banner .dp-nav-arrow {
    height: 5px;
    width: 20px;
    position: absolute;
    margin: auto 15px auto auto;
    top: 0;
    bottom: 0;
    right: 0;
    color: #929292; }
  .image-banner .dp-cta {
    height: 35px;
    width: 97px;
    position: absolute;
    margin: auto 15px auto auto;
    top: 0;
    bottom: 0;
    right: 0;
    overflow: hidden; }
    @media (max-width: 767px) {
      .image-banner .dp-cta {
        display: none; } }

.banner-loading {
  animation-name: banner-loading;
  animation-duration: 2s;
  animation-direction: alternate;
  animation-timing-function: ease-in-out;
  animation-iteration-count: 100; }

@-webkit-keyframes banner-loading {
  0% {
    background-color: #efefef; }
  100% {
    background-color: #ddd; } }

@-moz-keyframes banner-loading {
  0% {
    background-color: #efefef; }
  100% {
    background-color: #ddd; } }

@keyframes banner-loading {
  0% {
    background-color: #efefef; }
  100% {
    background-color: #ddd; } }

.image-text-cta {
  height: 388px;
  position: relative;
  border: 1px solid #e5edec;
  background-color: white;
  height: auto;
  margin: 0 auto; }
  .image-text-cta .inner-content {
    position: relative;
    text-align: center;
    margin-left: auto;
    margin-right: auto;
    margin-top: 56px;
    margin-bottom: 65px; }
    .image-text-cta .inner-content .cta-image {
      height: 120px;
      width: 120px;
      margin-bottom: 16px; }
    .image-text-cta .inner-content .cta-header {
      font-weight: bold;
      letter-spacing: -0.3px;
      font-size: 28px; }
    .image-text-cta .inner-content .cta-body {
      color: #757575;
      font-size: 16px;
      line-height: 1.5;
      letter-spacing: -0.1px;
      margin-top: 8px;
      margin-bottom: 12px; }
    .image-text-cta .inner-content .cta-button {
      width: 280px;
      height: 48px;
      border-radius: 4px;
      background-color: #43b02a;
      font-size: 18px;
      font-weight: 600;
      text-align: center;
      color: #ffffff; }
    .image-text-cta .inner-content .cta-button-content {
      margin-top: 4px; }

.item-detail-module {
  background-color: #fff;
  border-bottom: 1px solid #F0EFEC;
  padding: 16px;
  border-radius: 6px; }
  .item-detail-module .item-detail-breadcrumbs {
    margin-bottom: 5px; }
  .item-detail-module .item-image-selector {
    margin-top: 10px; }
    .item-detail-module .item-image-selector .item-image-selector-preview {
      cursor: pointer;
      display: inline-block;
      max-width: 74px;
      padding: 5px; }
      .item-detail-module .item-image-selector .item-image-selector-preview.active {
        outline: 1px solid #43B02A; }
  .item-detail-module .item-price {
    font-size: 26px;
    line-height: 26px;
    font-weight: 700;
    display: block; }
    .item-detail-module .item-price .full-price-label {
      display: initial !important; }
    .item-detail-module .item-price .item-full-price {
      margin: 0; }
    .item-detail-module .item-price .muted {
      color: #8e8e8e;
      font-size: initial;
      font-weight: 400;
      font-size: 14px; }
  .item-detail-module .item-flag-form {
    padding: 10px 30px; }
    .item-detail-module .item-flag-form textarea {
      width: 100%; }
  .item-detail-module .image-container {
    text-align: center;
    padding-bottom: 100%;
    position: relative; }
    @media (max-width: 991px) {
      .item-detail-module .image-container {
        width: 50%;
        padding-bottom: calc(50% + 10px);
        margin: 0 auto; } }
    .item-detail-module .image-container .ic-image-zoomer {
      max-height: 500px;
      max-width: 500px;
      position: absolute;
      margin: auto;
      top: 0;
      left: 0;
      right: 0;
      bottom: 0; }
  .item-detail-module .badge {
    font-size: 14px;
    line-height: 24px;
    display: inline-block;
    max-width: initial; }
    .item-detail-module .badge.badge--sale {
      height: 24px;
      padding: 0 8px; }
  .item-detail-module .ic-btn-link {
    display: block; }
    .item-detail-module .ic-btn-link.admin-action {
      padding: 4px 6px;
      font-size: 14px;
      line-height: 20px; }
    .item-detail-module .ic-btn-link:hover {
      text-decoration: none; }
  .item-detail-module .QuantityForm select, .item-detail-module .QuantityForm input {
    height: 43px;
    text-align: center;
    text-align-last: center;
    width: 100%;
    font-size: 18px;
    line-height: 1.33333; }
  .item-detail-module .coupon-badge-container {
    position: relative;
    width: inherit;
    margin: 10px 0; }
    .item-detail-module .coupon-badge-container .price-info {
      display: inline-block;
      width: 50%;
      margin: 0;
      padding-right: 7px;
      vertical-align: top; }
      .item-detail-module .coupon-badge-container .price-info .badge-label, .item-detail-module .coupon-badge-container .price-info .badge-sublabel {
        font-size: 14px; }
    .item-detail-module .coupon-badge-container .discount-button {
      width: 50%;
      margin: 0; }
    @media (max-width: 1199px) {
      .item-detail-module .coupon-badge-container .price-info {
        width: 100%;
        height: auto; }
      .item-detail-module .coupon-badge-container .discount-button {
        width: 100%;
        margin-top: 10px; } }

.ModalContainerRenderer .item-detail-module {
  padding: 0;
  border: 0; }

@media (max-width: 767px) {
  .items-grid {
    padding-top: 1px; } }

.items-grid .search-bar-wrapper {
  position: relative; }
  .items-grid .search-bar-wrapper .search-bar,
  .items-grid .search-bar-wrapper .items-list-header-wrapper {
    display: inline-flex; }
  @media (max-width: 400px) {
    .items-grid .search-bar-wrapper {
      height: 40px; }
      .items-grid .search-bar-wrapper form {
        width: 100%; } }
  .items-grid .search-bar-wrapper .search-bar {
    position: absolute;
    right: 15px;
    top: -61px; }
    @media (max-width: 400px) {
      .items-grid .search-bar-wrapper .search-bar {
        position: relative;
        width: 100%;
        top: -10px;
        padding-left: 29px; } }
    .items-grid .search-bar-wrapper .search-bar .search-field {
      width: 416px;
      font-size: 16px;
      background-color: #f7f7f7; }
      @media (max-width: 600px) {
        .items-grid .search-bar-wrapper .search-bar .search-field {
          width: 320px; } }
      @media (max-width: 500px) {
        .items-grid .search-bar-wrapper .search-bar .search-field {
          width: 220px; } }
      @media (max-width: 400px) {
        .items-grid .search-bar-wrapper .search-bar .search-field {
          width: 100%; } }
  .items-grid .search-bar-wrapper .clear-btn {
    position: absolute;
    right: 40px;
    top: 0;
    height: 40px;
    width: 26px;
    border-top: 1px solid #e5edec;
    border-bottom: 1px solid #e5edec;
    -webkit-appearance: none;
    background-color: #f7f7f7;
    background-repeat: no-repeat;
    margin: 0;
    padding-top: 12px;
    padding-left: 2px;
    color: #999; }
    .items-grid .search-bar-wrapper .clear-btn:hover {
      cursor: pointer; }
  .items-grid .search-bar-wrapper .ic-icon-search {
    font-size: 20px; }
  .items-grid .search-bar-wrapper .search-btn {
    position: absolute;
    right: 0px;
    top: 0;
    height: 40px;
    width: 40px;
    border-top-right-radius: 5px;
    border-bottom-right-radius: 5px;
    border: 1px solid #e5edec;
    border-left: none;
    -webkit-appearance: none;
    background-color: #f7f7f7;
    background-repeat: no-repeat;
    color: #43B02A;
    padding: 0;
    margin: 0; }
    .items-grid .search-bar-wrapper .search-btn:before {
      top: 2px;
      position: relative; }

.items-grid.wide-images {
  border-radius: 4px;
  overflow: hidden;
  display: inline-block; }
  @media (max-width: 991px) {
    .items-grid.wide-images {
      display: flex;
      flex-wrap: wrap; } }
  @media (min-width: 992px) and (max-width: 1199px) {
    .items-grid.wide-images {
      display: flex;
      flex-wrap: wrap; } }
  .items-grid.wide-images .item-card {
    width: 416px;
    height: 362px;
    border: none; }
    @media (max-width: 767px) {
      .items-grid.wide-images .item-card {
        width: 50%;
        height: auto; } }
    @media (min-width: 768px) and (max-width: 991px) {
      .items-grid.wide-images .item-card {
        width: 33.33%;
        height: auto; } }
    @media (min-width: 992px) and (max-width: 1199px) {
      .items-grid.wide-images .item-card {
        width: 33.33%;
        height: auto; } }
    @media (min-width: 1200px) {
      .items-grid.wide-images .item-card {
        width: 411px;
        height: 362px; } }
    @media (min-width: 1200px) {
      .items-grid.wide-images .item-card.loading {
        width: 411px;
        height: 405px; }
        .items-grid.wide-images .item-card.loading .media {
          padding: 15px; } }
    .items-grid.wide-images .item-card .item-card-image-wrapper {
      overflow: hidden; }
    .items-grid.wide-images .item-card .item-name .full-item-name {
      width: 100%;
      white-space: nowrap; }
    @media (max-width: 767px) {
      .items-grid.wide-images .item-card .item-quantity {
        height: 100%; }
        .items-grid.wide-images .item-card .item-quantity .item-quantity-amount {
          margin-top: 40%; } }
    @media (min-width: 768px) and (max-width: 991px) {
      .items-grid.wide-images .item-card .item-quantity {
        height: 100%; }
        .items-grid.wide-images .item-card .item-quantity .item-quantity-amount {
          margin-top: 40%; } }
    @media (min-width: 992px) and (max-width: 1199px) {
      .items-grid.wide-images .item-card .item-quantity {
        height: 232px; }
        .items-grid.wide-images .item-card .item-quantity .item-quantity-amount {
          margin-top: 128px; } }
    @media (min-width: 1200px) {
      .items-grid.wide-images .item-card .item-quantity {
        height: 216px; }
        .items-grid.wide-images .item-card .item-quantity .item-quantity-amount {
          margin-top: 88px; } }
    .items-grid.wide-images .item-card .media .item-image {
      min-width: 258px;
      max-height: 258px;
      margin: auto;
      padding: 16px;
      height: auto; }
      @media (min-width: 1200px) {
        .items-grid.wide-images .item-card .media .item-image {
          transform: scale(1.6); } }
      .items-grid.wide-images .item-card .media .item-image.image-loading-placeholder {
        height: 258px;
        margin: 16px;
        width: calc(100% - 32px); }
      @media (max-width: 991px) {
        .items-grid.wide-images .item-card .media .item-image {
          width: 100%;
          height: auto;
          min-width: auto;
          max-height: initial; }
          .items-grid.wide-images .item-card .media .item-image.image-loading-placeholder {
            height: 200px; } }
      @media (min-width: 992px) and (max-width: 1199px) {
        .items-grid.wide-images .item-card .media .item-image {
          width: 100%;
          height: auto;
          min-width: auto;
          max-height: initial; }
          .items-grid.wide-images .item-card .media .item-image.image-loading-placeholder {
            height: 200px; } }

.items-list {
  background-color: #fff;
  border-radius: 4px;
  max-width: 100vw; }
  @media (max-width: 991px) {
    .items-list.items-grid {
      margin-top: 0px; } }
  .items-list .skeleton-item.retailer {
    padding-top: 0px; }
    .items-list .skeleton-item.retailer .circle {
      height: 96px;
      width: 96px;
      vertical-align: baseline;
      float: none;
      top: 0px;
      left: 0px;
      margin: 0px; }
  .items-list .links {
    vertical-align: bottom;
    padding: 24px 32px; }
  .items-list .logo-wrapper {
    display: inline-block;
    width: 112px;
    height: 105px;
    position: relative; }
    .items-list .logo-wrapper img {
      width: 96px;
      height: 96px;
      box-shadow: 0px 0px 0px 1px rgba(0, 0, 0, 0.15);
      border-radius: 50%;
      background-color: #fff; }
  .items-list .thumb-wrapper {
    display: inline-block;
    width: 40px;
    height: 40px; }
    .items-list .thumb-wrapper img {
      background-color: #fff; }
  .items-list .items-list-header-wrapper h4 {
    display: inline-block;
    font-size: 18px;
    font-weight: normal;
    color: #424242;
    margin: 0;
    padding: 0; }
    @media (max-width: 991px) {
      .items-list .items-list-header-wrapper h4 {
        font-size: 14px;
        line-height: 18px; } }
    .items-list .items-list-header-wrapper h4.item-loading {
      height: 27px;
      width: 175px;
      margin-left: 1px;
      margin-bottom: 9px;
      color: transparent; }
    .items-list .items-list-header-wrapper h4 a {
      vertical-align: middle;
      text-transform: none;
      border: none;
      font-size: inherit;
      color: inherit; }
      .items-list .items-list-header-wrapper h4 a .item-list-header-product {
        font-weight: 600; }
      .items-list .items-list-header-wrapper h4 a:hover {
        color: #43B02A; }
    .items-list .items-list-header-wrapper h4 a:not([href]) {
      color: inherit; }
      .items-list .items-list-header-wrapper h4 a:not([href]):hover {
        color: inherit;
        text-decoration: initial; }
  .items-list .items-list-header-wrapper .icon-angle-right {
    margin-left: 5px; }
  @media (max-width: 991px) {
    .items-list .items-list-header-wrapper .items-list-carousel {
      overflow: hidden; } }
  .items-list .items-list-carousel,
  .items-list .items-list-non-carousel {
    position: relative;
    white-space: nowrap; }
    .items-list .items-list-carousel .item-card,
    .items-list .items-list-non-carousel .item-card {
      margin-bottom: 0; }
  .items-list .items-list-non-carousel {
    overflow: hidden; }
    @media (max-width: 991px) {
      .items-list .items-list-non-carousel {
        padding-bottom: 3px;
        overflow-y: hidden;
        overflow-x: scroll;
        -ms-overflow-style: none;
        overflow: -moz-scrollbars-none;
        -webkit-overflow-scrolling: touch; }
        .items-list .items-list-non-carousel::-webkit-scrollbar {
          display: none; } }
  .items-list .items-list-carousel .slick-slider {
    overflow: hidden; }
  .items-list .items-list-carousel .slick-next, .items-list .items-list-carousel .slick-prev {
    position: absolute;
    top: 0;
    bottom: 0;
    z-index: 900;
    width: 1000px;
    width: 100vw;
    border: 1px solid #e5edec;
    padding: 0;
    font-size: 50px;
    text-align: center;
    color: #43B02A;
    background: rgba(255, 255, 255, 0.9); }
    .items-list .items-list-carousel .slick-next:focus, .items-list .items-list-carousel .slick-prev:focus {
      outline: none; }
    .items-list .items-list-carousel .slick-next:hover, .items-list .items-list-carousel .slick-prev:hover {
      background: #fff; }
    .items-list .items-list-carousel .slick-next:focus .ic-icon-arrow-right-small, .items-list .items-list-carousel .slick-next:focus .ic-icon-arrow-left-small, .items-list .items-list-carousel .slick-next:hover .ic-icon-arrow-right-small, .items-list .items-list-carousel .slick-next:hover .ic-icon-arrow-left-small, .items-list .items-list-carousel .slick-prev:focus .ic-icon-arrow-right-small, .items-list .items-list-carousel .slick-prev:focus .ic-icon-arrow-left-small, .items-list .items-list-carousel .slick-prev:hover .ic-icon-arrow-right-small, .items-list .items-list-carousel .slick-prev:hover .ic-icon-arrow-left-small {
      visibility: visible; }
    .items-list .items-list-carousel .slick-next .ic-icon-arrow-right-small, .items-list .items-list-carousel .slick-next .ic-icon-arrow-left-small, .items-list .items-list-carousel .slick-prev .ic-icon-arrow-right-small, .items-list .items-list-carousel .slick-prev .ic-icon-arrow-left-small {
      visibility: hidden;
      width: 50px; }
  .items-list .items-list-carousel .slick-next {
    right: -1000px;
    right: -100vw;
    right: calc(-100vw + 1px); }
    .items-list .items-list-carousel .slick-next.show-spinner .ic-icon-arrow-right-small {
      visibility: hidden; }
    .items-list .items-list-carousel .slick-next .loading .spinner {
      width: 30px;
      height: 30px;
      border-left-color: #43B02A;
      background: #fcfcfc;
      position: absolute;
      top: 50%;
      margin-top: -20px;
      left: 10px;
      font-size: 4px;
      margin: auto; }
    @media (max-width: 991px) {
      .items-list .items-list-carousel .slick-next {
        right: 0;
        background: #fff; }
        .items-list .items-list-carousel .slick-next .ic-icon-arrow-right-small, .items-list .items-list-carousel .slick-next .ic-icon-arrow-left-small {
          visibility: visible; } }
    @media (max-width: 767px) {
      .items-list .items-list-carousel .slick-next {
        /* width of half a card when row shows 2.5 cards */
        width: calc((100vw / 2.5) / 2); } }
    @media (min-width: 768px) and (max-width: 991px) {
      .items-list .items-list-carousel .slick-next {
        /* width of half a card when row shows 3.5 cards */
        width: calc((100vw / 3.5) / 2); } }
  .items-list .items-list-carousel .slick-prev {
    left: -1000px;
    left: -100vw;
    left: calc(-100vw + 1px); }
    .items-list .items-list-carousel .slick-prev .ic-icon-arrow-left-small {
      float: right; }

.ModalContainerRenderer .items-list .items-list-carousel {
  overflow: hidden;
  margin: 0 -24px; }

@media (max-width: 991px) {
  .ModalContainerRenderer .items-list .items-list-non-carousel {
    margin: 0 -24px; } }

.CheckoutAddItemsModal {
  min-height: calc(100vh - 30px); }
  .CheckoutAddItemsModal .items-list .items-list-carousel {
    margin-left: 0 !important;
    margin-right: 0 !important; }
  @media (max-width: 991px) {
    .CheckoutAddItemsModal .items-list .items-list-non-carousel {
      margin-left: 0 !important;
      margin-right: 0 !important; } }

.item-sort {
  background-color: inherit;
  display: block;
  height: 36px;
  margin: 12px 0 24px 0; }
  .item-sort .nav-pills:not(.pull-right) {
    padding-left: 10px; }
  @media (max-width: 767px) {
    .item-sort {
      display: none; } }
  .item-sort .nav-pills > li > button {
    padding-top: 8px;
    padding-bottom: 8px;
    margin-top: 2px;
    margin-bottom: 2px;
    padding-right: 12px;
    padding-left: 12px;
    line-height: 14px;
    display: block;
    text-align: left; }
    .item-sort .nav-pills > li > button.dropdown-toggle {
      color: #393939;
      background-color: #fff;
      border-radius: 4px;
      border: 1px solid #e0e0e0;
      font-weight: 600;
      min-width: 260px; }
      .item-sort .nav-pills > li > button.dropdown-toggle i {
        padding-left: 15px;
        color: #a9a9a9; }
  .item-sort .nav-dropdown .dropdown-menu > li:last-child {
    border: none;
    padding: 0;
    margin-top: 0; }
  .item-sort .nav-pills > li > ul.dropdown-menu {
    min-width: 260px; }
  .item-sort .dropdown-menu .active > a {
    color: #43b02a;
    background-color: transparent; }
    .item-sort .dropdown-menu .active > a.disabled {
      padding: 0px; }
    .item-sort .dropdown-menu .active > a i {
      margin: 0 10px; }
  .item-sort .dropdown-menu li a,
  .item-sort .dropdown-menu li .checkbox {
    color: #43b02a; }
  .item-sort .dropdown-menu li a {
    padding: 0 0 0 36px;
    color: #757575; }
    .item-sort .dropdown-menu li a:hover {
      color: white;
      background-color: #43b02a; }

.list-builder .shopping-list {
  list-style-type: none;
  margin-top: 20px;
  margin-left: 0;
  margin-bottom: 0; }
  .list-builder .shopping-list li {
    line-height: 26px;
    color: #212121;
    position: relative;
    padding-right: 20px;
    text-transform: capitalize; }
    .list-builder .shopping-list li:hover {
      color: #43B02A; }
      .list-builder .shopping-list li:hover i.ic-icon-x {
        display: block; }
    .list-builder .shopping-list li.active {
      color: #757575;
      text-decoration: line-through; }
      .list-builder .shopping-list li.active i.icon-checkbox {
        background-position: -18px 0px; }
    .list-builder .shopping-list li i.icon-checkbox {
      background-image: url(filter-checkbox-faf2c627d671a58c911c69eb6dec0b76.png);
      background-repeat: no-repeat;
      width: 18px;
      height: 18px;
      display: inline-block;
      position: relative;
      top: 3px;
      margin-right: 10px; }
      @media only screen and (-webkit-min-device-pixel-ratio: 1.3), only screen and (min--moz-device-pixel-ratio: 1.3), only screen and (-o-min-device-pixel-ratio: 1.3 / 1), only screen and (min-resolution: 125dpi), only screen and (min-resolution: 1.3dppx) {
        .list-builder .shopping-list li i.icon-checkbox {
          background-image: url(filter-checkbox@2x-3acbf79e8c0df23414dd84f61c99764b.png);
          background-size: 36px 18px; } }
      .list-builder .shopping-list li i.icon-checkbox:hover {
        cursor: pointer; }
    .list-builder .shopping-list li i.ic-icon-x {
      display: none;
      position: absolute;
      right: 0;
      color: #43B02A;
      font-size: 10px;
      padding-left: 5px;
      padding-right: 5px; }
      .list-builder .shopping-list li i.ic-icon-x:hover {
        cursor: pointer; }

.list-builder .popular-terms {
  margin-top: 20px; }
  .list-builder .popular-terms.hide-popular-terms .popular-terms-list {
    display: none; }
  .list-builder .popular-terms .popular-title {
    color: #393939;
    font-weight: 600; }
    .list-builder .popular-terms .popular-title:hover {
      text-decoration: none; }
    .list-builder .popular-terms .popular-title .show-hide {
      font-size: 12px;
      color: #43B02A;
      margin-left: 10px; }
      .list-builder .popular-terms .popular-title .show-hide:hover {
        color: #338620;
        cursor: pointer; }
  .list-builder .popular-terms .popular-terms-list {
    margin-top: 15px; }
    .list-builder .popular-terms .popular-terms-list i {
      opacity: 0.3;
      cursor: not-allowed !important; }

.ModalContainerRenderer {
  width: 86vw; }
  .ModalContainerRenderer .module-renderer {
    padding-top: 0;
    margin: 0; }
    .ModalContainerRenderer .module-renderer .module-wrapper {
      padding: 24px;
      margin: 0;
      border-bottom: 1px solid #F0EFEC;
      width: 100%; }
      .ModalContainerRenderer .module-renderer .module-wrapper:empty {
        display: none; }
      .ModalContainerRenderer .module-renderer .module-wrapper:last-of-type {
        padding-bottom: 0;
        border-bottom: 0; }

@media (min-width: 768px) {
  .ModalContainerRenderer.RetailerInfoModal {
    position: absolute;
    top: 60px;
    right: 0;
    left: 0; } }

.module-renderer {
  width: auto;
  padding: 24px 0; }
  .module-renderer:focus {
    outline: none; }
  .module-renderer .module-wrapper {
    width: auto;
    margin: 0 auto 24px auto; }
    @media (max-width: 991px) {
      .module-renderer .module-wrapper {
        margin: 0 auto 12px auto; } }
    .module-renderer .module-wrapper:empty {
      margin: 0; }
    .module-renderer .module-wrapper.full-width-module {
      width: 100%; }
  .module-renderer.with-navigation-modules .modules-wrapper .module-wrapper,
  .module-renderer .modules-wrapper .module-wrapper {
    /* this selector is here to override the below for $items selector */ }
    @media (max-width: 991px) {
      .module-renderer.with-navigation-modules .modules-wrapper .module-wrapper,
      .module-renderer .modules-wrapper .module-wrapper {
        width: 100%; } }
  @media (max-width: 767px) {
    .module-renderer {
      padding-bottom: 0; }
      .module-renderer:empty {
        display: none; } }
  @media (max-width: 991px) {
    .module-renderer {
      margin: 0; } }

.icModalContentContainer .module-wrapper {
  max-width: 100%; }
  .icModalContentContainer .module-wrapper:last-of-type {
    margin-bottom: 0; }

.header-modules-wrapper .module-wrapper {
  margin-bottom: 0; }

.footer-modules-wrapper .module-wrapper {
  margin-bottom: 0; }

@media (max-width: 991px) {
  .module-renderer.with-navigation-modules {
    background-color: white;
    padding: 0;
    margin: 0; } }

.module-renderer.with-navigation-modules .navigation-modules {
  width: 280px;
  position: absolute; }
  .module-renderer.with-navigation-modules .navigation-modules .module-wrapper {
    width: 280px; }
    @media (max-width: 991px) {
      .module-renderer.with-navigation-modules .navigation-modules .module-wrapper {
        margin: 0 auto 12px auto;
        width: 100%; }
        .module-renderer.with-navigation-modules .navigation-modules .module-wrapper:last-child {
          margin: 0 auto; } }
  @media (max-width: 991px) {
    .module-renderer.with-navigation-modules .navigation-modules {
      width: 100%;
      position: static; } }

.module-renderer.with-navigation-modules .modules-wrapper {
  overflow-x: hidden;
  margin-left: 280px; }
  @media (max-width: 991px) {
    .module-renderer.with-navigation-modules .modules-wrapper {
      background-color: #f7f7f7;
      margin-left: 0px; } }

.all-modules-container .json-payload {
  font-size: 12px;
  background-color: black;
  color: lightgrey; }

.all-modules-container .module-container {
  margin-bottom: 24px;
  border: 1px dashed rgba(0, 0, 0, 0.1); }

.tab-navigation-wrapper {
  position: relative;
  height: 146px; }
  .tab-navigation-wrapper.locked-wrapper {
    margin: 0 auto 0px auto; }

.module-tab-navigation {
  left: 0;
  z-index: 1000;
  width: 100%;
  height: 146px;
  background-color: #fff; }
  .module-tab-navigation.locked {
    z-index: 50; }
  .module-tab-navigation .media .item-quantity {
    height: 216px; }
  .module-tab-navigation.meals-nav {
    border: solid 1px #e0e0e0; }
    .module-tab-navigation.meals-nav .navigation-tabs-inner-wrapper {
      overflow: initial; }
    .module-tab-navigation.meals-nav .item-card {
      width: 411px; }
  .module-tab-navigation .meals-wrapper .navigation-tabs-inner-wrapper {
    height: 100%;
    margin: 0 auto;
    display: block; }
  .module-tab-navigation .active-tab {
    color: #43B02A; }
  .module-tab-navigation .navigation-tabs {
    text-align: left; }
  .module-tab-navigation .navigation-tab-meals {
    padding: 16px;
    display: inline-block; }
    .module-tab-navigation .navigation-tab-meals:hover {
      color: #43B02A; }
  .module-tab-navigation .module-tab-navigation-header {
    margin: 0 auto;
    font-size: 28px;
    font-weight: bold;
    color: #424242;
    padding: 32px 0; }
    @media (max-width: 767px) {
      .module-tab-navigation .module-tab-navigation-header {
        text-align: center;
        font-size: 22px; } }
  .module-tab-navigation .module-tab-navigation-tabs {
    margin: 0 auto;
    height: 56px; }
    .module-tab-navigation .module-tab-navigation-tabs .no-scroll-track {
      overflow-x: scroll;
      white-space: nowrap;
      position: relative; }
  @media screen and (min-width: 992px) {
    .module-tab-navigation .module-tab-navigation-header, .module-tab-navigation .module-tab-navigation-tabs {
      width: 821px; } }
  @media screen and (min-width: 1106px) {
    .module-tab-navigation .module-tab-navigation-header, .module-tab-navigation .module-tab-navigation-tabs {
      width: 1026px; } }
  @media screen and (min-width: 1311px) {
    .module-tab-navigation .module-tab-navigation-header, .module-tab-navigation .module-tab-navigation-tabs {
      width: 1231px; } }
  @media screen and (min-width: 1516px) {
    .module-tab-navigation .module-tab-navigation-header, .module-tab-navigation .module-tab-navigation-tabs {
      width: 1436px; } }
  @media screen and (min-width: 1721px) {
    .module-tab-navigation .module-tab-navigation-header, .module-tab-navigation .module-tab-navigation-tabs {
      width: 1641px; } }
  @media screen and (min-width: 1926px) {
    .module-tab-navigation .module-tab-navigation-header, .module-tab-navigation .module-tab-navigation-tabs {
      width: 1846px; } }
  @media screen and (min-width: 2131px) {
    .module-tab-navigation .module-tab-navigation-header, .module-tab-navigation .module-tab-navigation-tabs {
      width: 2051px; } }
  @media screen and (min-width: 2336px) {
    .module-tab-navigation .module-tab-navigation-header, .module-tab-navigation .module-tab-navigation-tabs {
      width: 2256px; } }
  @media screen and (min-width: 2541px) {
    .module-tab-navigation .module-tab-navigation-header, .module-tab-navigation .module-tab-navigation-tabs {
      width: 2461px; } }
  .module-tab-navigation .navigation-tab-seeker {
    -webkit-transition: left 150ms ease-in-out, bottom 200ms ease-in-out, width 150ms ease-in-out;
    -moz-transition: left 150ms ease-in-out, bottom 200ms ease-in-out, width 150ms ease-in-out;
    transition: left 150ms ease-in-out, bottom 200ms ease-in-out, width 150ms ease-in-out; }

.nav-footer .nav-links {
  margin-top: 20px;
  height: 80px;
  background-image: url(green-wallpaper-min-69d7704d1c6c8f6e1c11e3c02a1d850a.jpg); }
  .nav-footer .nav-links .nav-links-inner-wrapper {
    display: block;
    max-width: 1000px;
    margin: 10px auto; }
    .nav-footer .nav-links .nav-links-inner-wrapper ul {
      list-style-type: none;
      display: inline-block;
      padding: 0;
      text-align: center;
      line-height: 80px; }
      .nav-footer .nav-links .nav-links-inner-wrapper ul li {
        display: inline; }
        .nav-footer .nav-links .nav-links-inner-wrapper ul li a {
          color: white;
          padding: 0 .6em;
          font-size: 16px; }
  @media (max-width: 767px) {
    .nav-footer .nav-links {
      height: auto; }
      .nav-footer .nav-links .nav-links-inner-wrapper {
        max-width: 100%; }
        .nav-footer .nav-links .nav-links-inner-wrapper ul {
          line-height: 30px;
          margin: 0; }
          .nav-footer .nav-links .nav-links-inner-wrapper ul li {
            display: inline-block;
            width: 50%; } }

.nav-footer .legal-footer {
  text-align: center;
  margin-top: 20px;
  color: #9B9A99; }

.navigation-link-box {
  display: inline-flex;
  width: 128px;
  height: 128px;
  border-radius: 4px;
  background-color: #ffffff;
  margin-right: 24px;
  position: relative; }
  .navigation-link-box .action-label-arrow-right {
    display: none; }
  .navigation-link-box.loading {
    pointer-events: none; }
    .navigation-link-box.loading .loading-placeholder {
      width: 40px;
      height: 22px; }
    .navigation-link-box.loading .action-label-content-container {
      width: 80px;
      height: 22px; }
    .navigation-link-box.loading .loading-placeholder,
    .navigation-link-box.loading .action-label-content-container,
    .navigation-link-box.loading .action-label-icon {
      background-color: #757575;
      animation-name: item-loading;
      animation-duration: 2s;
      animation-direction: alternate;
      animation-timing-function: ease-in-out;
      animation-iteration-count: 100; }
  .navigation-link-box .action-label-content {
    width: 96px;
    height: 48px;
    font-size: 18px;
    font-weight: 600;
    line-height: 1.33;
    left: 0;
    text-align: left;
    color: #424242;
    position: absolute;
    margin: 64px 16px 16px 16px; }
    .navigation-link-box .action-label-content .action-label-content-container {
      bottom: 0;
      position: absolute; }
  .navigation-link-box .action-label-icon {
    margin: 4px;
    width: 48px;
    height: 48px;
    border: solid 1px #e0e0e0;
    margin-left: 72px;
    border-radius: 24px; }
    .navigation-link-box .action-label-icon i {
      font-size: 24px;
      top: 8px;
      left: 12px;
      color: #757575;
      text-decoration: none; }
  @media (max-width: 767px) {
    .navigation-link-box {
      display: block;
      width: 100%;
      height: 56px;
      border-top: 1px solid #eeeeee; }
      .navigation-link-box .action-label-icon {
        border: none;
        border-radius: 0px;
        display: inline-block;
        margin-left: 12px; }
      .navigation-link-box .action-label-content {
        display: inline-flex;
        left: initial;
        margin: 4px 0;
        width: 100%; } }
    @media all and (max-width: 767px) and (-ms-high-contrast: none), (max-width: 767px) and (-ms-high-contrast: active) {
      .navigation-link-box .action-label-content {
        /* IE10+ special case */
        width: 256px;
        margin-left: 54px; } }
    @media (max-width: 767px) and (max-width: 400px) {
      .navigation-link-box .action-label-content {
        width: calc(100% - 48px - 16px); } }
  @media (max-width: 767px) {
      .navigation-link-box .action-label-content:last-of-type {
        display: none; }
      .navigation-link-box .action-label-content .action-label-content-container {
        bottom: 14px; }
      .navigation-link-box .action-label-arrow-right {
        display: inline-flex;
        color: #9e9e9e;
        position: absolute;
        right: 18px;
        margin-top: 16px; }
        .navigation-link-box .action-label-arrow-right i {
          font-size: 24px;
          font-weight: bold; } }

.navigation-links-list ul {
  margin: 0;
  border-bottom: none;
  padding-bottom: 16px; }
  @media (max-width: 767px) {
    .navigation-links-list ul {
      border-bottom: 1px solid #eeeeee; } }

.navigation-links-list:hover .label-action-handler, .navigation-links-list:focus .label-action-handler {
  text-decoration: none; }

.navigation-links-list .label-action-handler {
  text-decoration: none; }

.navigation-links-list .page-header-container {
  width: 100%;
  height: 56px;
  padding: 0px; }
  .navigation-links-list .page-header-container .page-header-content {
    font-size: 28px;
    font-weight: bold;
    text-align: left; }
    @media (max-width: 767px) {
      .navigation-links-list .page-header-container .page-header-content {
        font-size: 24px;
        text-align: center; } }

.module-renderer .navigation-modules .plain-header {
  display: none;
  margin-top: 0; }
  .module-renderer .navigation-modules .plain-header .hero {
    padding: 5px 0 0 15px;
    margin: 0; }
    .module-renderer .navigation-modules .plain-header .hero h1 {
      font-size: 20px !important; }
  @media (max-width: 991px) {
    .module-renderer .navigation-modules .plain-header {
      display: block; }
      .module-renderer .navigation-modules .plain-header .hero {
        padding: 13px 0 0 16px; }
        .module-renderer .navigation-modules .plain-header .hero h1 {
          margin: 0;
          font-size: 16px !important; } }

@media (max-width: 991px) {
  .module-renderer .modules-wrapper .plain-header {
    display: none; } }

@media (max-width: 991px) {
  .module-renderer .modules-wrapper .plain-header.nested {
    display: block;
    line-height: 48px;
    margin-top: 0; }
    .module-renderer .modules-wrapper .plain-header.nested .hero {
      padding: 0 16px;
      margin: 0;
      background-color: white; }
      .module-renderer .modules-wrapper .plain-header.nested .hero .module-wrapper {
        margin: 0; }
        .module-renderer .modules-wrapper .plain-header.nested .hero .module-wrapper .ic-text-truncate {
          margin: 0;
          font-size: 16px; } }

.module-renderer .plain-header.with-image .hero {
  padding: 30px !important; }
  .module-renderer .plain-header.with-image .hero h1 {
    text-align: center !important;
    width: 100% !important;
    font-weight: 600 !important; }

.module-renderer .plain-header .hero {
  padding: 30px 0 0 0;
  border-bottom: none;
  background-color: inherit; }
  .module-renderer .plain-header .hero h1 {
    font-size: 44px;
    text-align: left;
    font-weight: 600; }

.module-renderer .plain-header.nested .hero {
  background-color: inherit; }
  .module-renderer .plain-header.nested .hero h1 {
    width: 67%;
    text-align: left;
    font-size: 28px; }
    @media (max-width: 991px) {
      .module-renderer .plain-header.nested .hero h1 {
        width: 90%; } }

.product-attributes-module {
  background-color: white;
  border: 1px solid #F0EFEC;
  margin: 0 auto;
  max-width: 1456px;
  padding: 2vw;
  white-space: pre-wrap; }

.ModalContainerRenderer .product-attributes-module {
  padding: 0;
  border: 0; }

.module-renderer .responsive-graphics-0, .module-renderer .responsive-graphics-768 {
  display: none;
  margin: auto; }

@media only screen and (max-width: 767px) {
  .module-renderer .responsive-graphics-0 {
    display: block; } }

@media only screen and (min-width: 768px) {
  .module-renderer .responsive-graphics-768 {
    display: block; } }

.module-renderer .retailer-chooser .retailer-group-label {
  color: #393939;
  font-size: 24px; }

.module-renderer .promo-options-wrapper {
  display: flex;
  flex-wrap: wrap; }

.module-renderer .retailer-option {
  display: inline-block;
  background-color: #fff; }
  @media (max-width: 991px) {
    .module-renderer .retailer-option {
      width: 50%; } }

.ic-btn-green {
  background: #fff;
  border-color: #e0e0e0; }
  .ic-btn-green:hover {
    background-color: #E2F3DF;
    border-color: #43B02A; }

.search-filters-view {
  display: block;
  padding: 16px 16px 16px 0; }
  @media (max-width: 767px) {
    .search-filters-view {
      padding: 0; } }

.aisle-filter-web, .department-aisle {
  padding: 0px 15px 12px 0px; }
  .filter-container .aisle-filter-web .title, .filter-container .department-aisle .title {
    font-weight: 700;
    font-size: 14px;
    font-weight: bold;
    color: #212121;
    text-transform: uppercase;
    padding-bottom: 5px; }
  @media (max-width: 767px) {
    .aisle-filter-web, .department-aisle {
      display: none; } }
  .aisle-filter-web h4, .department-aisle h4 {
    padding: 5px 0;
    margin: 0; }

.department-aisle {
  padding: 0;
  padding-right: 16px; }
  .department-aisle li.aisle {
    padding-left: 15px; }
  .department-aisle .aisle-filter .title {
    font-weight: 700;
    font-size: 18px;
    font-weight: bold;
    padding-bottom: 5px; }
    .department-aisle .aisle-filter .title a {
      color: #212121; }
  @media (max-width: 767px) {
    .department-aisle {
      display: none; } }

.aisle-filter-web .loading-placeholder, .department-aisle .loading-placeholder {
  display: block;
  width: 90%;
  height: 16px;
  margin-top: 4px;
  margin-bottom: 4px; }

.aisle-filter-web .aisle-loading, .department-aisle .aisle-loading {
  animation-name: aisle-loading;
  animation-duration: 2s;
  animation-direction: alternate;
  animation-timing-function: ease-in-out;
  animation-iteration-count: 100; }

@-webkit-keyframes aisle-loading {
  0% {
    background-color: #efefef; }
  100% {
    background-color: #ddd; } }

@-moz-keyframes aisle-loading {
  0% {
    background-color: #efefef; }
  100% {
    background-color: #ddd; } }

@keyframes aisle-loading {
  0% {
    background-color: #efefef; }
  100% {
    background-color: #ddd; } }

.aisle-filter-web .aisle-loading-lighter, .department-aisle .aisle-loading-lighter {
  animation-name: aisle-loading-lighter;
  animation-duration: 2s;
  animation-direction: alternate;
  animation-timing-function: ease-in-out;
  animation-iteration-count: 100; }

@-webkit-keyframes aisle-loading-lighter {
  0% {
    background-color: #f0f0f0; }
  100% {
    background-color: #eee; } }

@-moz-keyframes aisle-loading-lighter {
  0% {
    background-color: #f0f0f0; }
  100% {
    background-color: #eee; } }

@keyframes aisle-loading-lighter {
  0% {
    background-color: #f0f0f0; }
  100% {
    background-color: #eee; } }

.aisle-filter-web ul.department-selector, .department-aisle ul.department-selector {
  font-size: 14px;
  margin: 0px;
  list-style: none; }
  .aisle-filter-web ul.department-selector li, .department-aisle ul.department-selector li {
    line-height: 26px;
    text-overflow: ellipsis; }
  .aisle-filter-web ul.department-selector li.department a, .department-aisle ul.department-selector li.department a {
    font-weight: 600; }
  .aisle-filter-web ul.department-selector li.department-selector__more, .department-aisle ul.department-selector li.department-selector__more {
    padding-top: 5px;
    font-weight: 600;
    font-size: 12px; }
    .aisle-filter-web ul.department-selector li.department-selector__more a, .department-aisle ul.department-selector li.department-selector__more a {
      color: #43B02A; }
      .aisle-filter-web ul.department-selector li.department-selector__more a:hover, .department-aisle ul.department-selector li.department-selector__more a:hover {
        color: #338620; }
  .aisle-filter-web ul.department-selector a, .department-aisle ul.department-selector a {
    color: #757575; }
    .aisle-filter-web ul.department-selector a.department, .department-aisle ul.department-selector a.department {
      font-weight: 600; }
    .aisle-filter-web ul.department-selector a:hover, .department-aisle ul.department-selector a:hover, .aisle-filter-web ul.department-selector a:active, .department-aisle ul.department-selector a:active, .aisle-filter-web ul.department-selector a:focus, .department-aisle ul.department-selector a:focus {
      text-decoration: none; }
    .aisle-filter-web ul.department-selector a:hover, .department-aisle ul.department-selector a:hover {
      color: #43B02A; }
    .aisle-filter-web ul.department-selector a.active, .department-aisle ul.department-selector a.active, .aisle-filter-web ul.department-selector a.action-active, .department-aisle ul.department-selector a.action-active {
      color: #000;
      font-weight: 600; }

@media (max-width: 767px) {
  .filter-container {
    display: none; } }

.filter-container .separator {
  height: 1px;
  background: #e0e0e0;
  margin-bottom: 8px;
  max-width: 260px;
  margin-right: 5px; }

.filter-container a {
  color: #43B02A; }
  .filter-container a:hover, .filter-container a:active, .filter-container a:focus {
    text-decoration: none; }
  .filter-container a:hover {
    color: #338620; }

.filter-container .title {
  font-weight: 700;
  font-size: 18px;
  padding-bottom: 10px; }

.filter-container .clear-all {
  font-weight: 600;
  font-size: 12px;
  color: #43B02A;
  font-stretch: normal;
  cursor: pointer;
  padding-top: 7px;
  margin-right: 5px; }
  .filter-container .clear-all:hover {
    color: #338620; }

.filter-container .more {
  padding-top: 5px;
  font-weight: 600;
  font-size: 12px; }

.filter-container .search-filter-view {
  margin-bottom: 20px; }
  .filter-container .search-filter-view .title {
    font-size: 14px;
    text-transform: uppercase;
    color: #212121;
    font-weight: bold;
    padding-bottom: 5px; }

.filter-container .empty-filter {
  color: #757575;
  font-size: 14px;
  font-weight: normal; }

.filter-container li {
  margin: 0;
  padding: 0;
  list-style: none; }

.filter-container .filter-option, .filter-container .multi-filter-option, .filter-container .single-filter-option, .filter-container .sort-and-filter-container-mobile .filter-container-mobile .multi-filter-option, .sort-and-filter-container-mobile .filter-container-mobile .filter-container .multi-filter-option, .filter-container .sort-and-filter-container-mobile .filter-container-mobile .single-filter-option, .sort-and-filter-container-mobile .filter-container-mobile .filter-container .single-filter-option {
  line-height: 30px;
  color: #424242; }
  .filter-container .filter-option:hover, .filter-container .multi-filter-option:hover, .filter-container .single-filter-option:hover {
    cursor: pointer;
    color: #43b02a; }
  .filter-container .filter-option .badge.badge--exclusive, .filter-container .multi-filter-option .badge.badge--exclusive, .filter-container .single-filter-option .badge.badge--exclusive {
    padding: 0px 9px;
    border-radius: 12px;
    background-color: grey;
    display: inline-block;
    font-size: 12px;
    font-weight: 600;
    text-align: center;
    letter-spacing: 0.01em;
    text-shadow: none;
    color: white;
    height: 21px;
    line-height: 21px;
    margin-left: 10px; }
  .filter-container .filter-option.active, .filter-container .active.multi-filter-option, .filter-container .active.single-filter-option {
    color: #000; }
  .filter-container .filter-option div.check, .filter-container .multi-filter-option div.check, .filter-container .single-filter-option div.check {
    margin-top: 1px;
    width: 20px;
    height: 20px;
    border: solid;
    border-width: 1px;
    border-color: #757575;
    color: #f7f7f7;
    margin-right: 10px;
    margin-bottom: -5px;
    position: relative; }
  .filter-container .filter-option div.check.active, .filter-container .multi-filter-option div.check.active, .filter-container .single-filter-option div.check.active {
    background-color: #43B02A;
    border-width: 0px; }
  .filter-container .filter-option div.inline, .filter-container .multi-filter-option div.inline, .filter-container .single-filter-option div.inline {
    display: inline-block; }

.filter-container .multi-filter-option div.check {
  border-radius: 15%; }

.filter-container .single-filter-option div.check {
  border-radius: 50%; }

.search-footer-box {
  max-width: 960px;
  margin: 11px auto 0px auto;
  background: white;
  border: solid 1px #E0E0E0;
  border-radius: 4px;
  padding-top: 15px !important;
  padding-bottom: 15px; }
  .search-footer-box .title {
    color: #424242;
    font-size: 14px;
    font-weight: 600;
    margin-right: 12px; }
    @media (max-width: 767px) {
      .search-footer-box .title {
        display: block;
        margin: 5px 0; } }
  .search-footer-box .divider {
    margin-left: 15px;
    margin-right: 15px;
    border-left: 1px solid #E0E0E0; }
    @media (max-width: 767px) {
      .search-footer-box .divider {
        display: none; } }
  .search-footer-box .storeChooser .store-link {
    color: #3EA327;
    font-size: 14px;
    font-weight: 600;
    cursor: pointer; }
    .search-footer-box .storeChooser .store-link .left-icon {
      margin-right: 8px; }
    .search-footer-box .storeChooser .store-link .store-name:hover {
      text-decoration: underline; }
  .search-footer-box .warehouse-dropdown {
    display: inline-block;
    max-width: 260px;
    width: 100%; }
    .search-footer-box .warehouse-dropdown .dropdown-toggle-button {
      text-align: left;
      width: 100%; }
      .search-footer-box .warehouse-dropdown .dropdown-toggle-button .left-icon {
        margin-right: 8px; }
    .search-footer-box .warehouse-dropdown .icDropdownItems {
      text-align: left;
      max-width: 260px;
      width: 100%; }
    .search-footer-box .warehouse-dropdown .icDropdownItem {
      padding-left: 36px; }
      .search-footer-box .warehouse-dropdown .icDropdownItem:before {
        content: "\E009";
        font-family: 'ic-icons' !important;
        font-style: normal !important;
        font-weight: normal !important;
        font-variant: normal !important;
        text-transform: none !important;
        speak: none;
        line-height: 1;
        -webkit-font-smoothing: antialiased;
        -moz-osx-font-smoothing: grayscale;
        box-sizing: border-box;
        position: absolute;
        left: 14px;
        top: 3px;
        padding: 9px 0;
        font-size: 14px; }
    @media (max-width: 767px) {
      .search-footer-box .warehouse-dropdown {
        display: block;
        margin: 0 auto; } }
  .search-footer-box .specialRequestLink {
    display: inline-block; }
  .search-footer-box .special-request {
    color: #3EA327;
    font-size: 14px;
    font-weight: 600; }

.special-request-v2 {
  color: #3EA327;
  font-size: 14px;
  font-weight: 600; }

.search-messaging {
  margin-top: 8px; }
  .search-messaging h3 {
    margin: 0; }

.search-pagination {
  width: 100%;
  margin-top: 20px;
  margin-bottom: 25px; }
  .search-pagination a {
    color: #3EA327; }
    .search-pagination a:hover {
      text-decoration: none; }
  .search-pagination .pagination-info {
    padding-left: 15px;
    padding-right: 15px;
    font-size: 14px;
    color: #424242;
    font-weight: 600; }
  .search-pagination .ic-icon {
    font-size: 22px;
    cursor: pointer;
    top: 7px; }

.related-searches {
  padding-left: 18px;
  padding-right: 18px; }
  .related-searches .title {
    font-size: 14px;
    font-weight: 600;
    line-height: 34px;
    color: #4e4e4e;
    margin-bottom: 5px; }
  .related-searches .terms a {
    color: #3EA327;
    font-size: 14px;
    font-weight: 600;
    border: none; }
    .related-searches .terms a i {
      padding-right: 5px; }
  .related-searches .terms a:not(:first-child) {
    margin-left: 8px; }

.search-feedback-modal .feedback-form {
  width: 500px;
  margin: 0 auto; }
  @media (max-width: 576px) {
    .search-feedback-modal .feedback-form {
      width: 100%; } }
  .search-feedback-modal .feedback-form .icDropdown {
    margin-bottom: 17px;
    width: 320px; }
  .search-feedback-modal .feedback-form .ic-btn-feedback-category {
    width: 320px;
    text-align: left;
    height: 36px;
    border-radius: 4px;
    background-color: #fbfaf9;
    border: solid 1px rgba(56, 56, 56, 0.1);
    color: #393939;
    font-weight: 600;
    padding-left: 14px;
    font-size: 14px; }
    .search-feedback-modal .feedback-form .ic-btn-feedback-category i {
      top: 3px;
      float: right; }
  .search-feedback-modal .feedback-form .icDropdownItem {
    padding-left: 14px;
    width: 320px; }

@media (max-width: 576px) {
  .search-feedback-modal .send-button {
    display: flex;
    flex-direction: column-reverse;
    align-items: center; } }

.search-feedback-modal .feedback-icon {
  background-image: url(feedback-icon-c3c27510390028cbc9f64e81a3a45072.png);
  display: block;
  width: 110px;
  height: 110px;
  margin: 0 auto; }
  @media only screen and (-webkit-min-device-pixel-ratio: 1.3), only screen and (min--moz-device-pixel-ratio: 1.3), only screen and (-o-min-device-pixel-ratio: 1.3 / 1), only screen and (min-resolution: 125dpi), only screen and (min-resolution: 1.3dppx) {
    .search-feedback-modal .feedback-icon {
      background-image: url(feedback-icon@2x-7dc92f6c77bf44449ba51c70f251ed2e.png);
      background-size: 110px 110px; } }

.search-feedback-modal h1 {
  font-size: 28px;
  font-weight: bold;
  color: #393939;
  margin-bottom: 5px; }

.search-feedback-modal h2 {
  margin-top: 0px;
  margin-bottom: 31px;
  font-size: 20px;
  color: #626262;
  font-weight: normal;
  font-style: normal; }

.search-feedback-modal .comment-box {
  width: 500px;
  height: 100px;
  margin-bottom: 33px; }
  @media (max-width: 576px) {
    .search-feedback-modal .comment-box {
      width: 100%; } }

.search-feedback-modal .ic-btn {
  width: 185px; }
  .search-feedback-modal .ic-btn:first-child {
    margin-right: 10px; }
    @media (max-width: 576px) {
      .search-feedback-modal .ic-btn:first-child {
        margin-right: 0;
        width: 100%;
        margin-top: 10px;
        height: 48px; } }
  @media (max-width: 576px) {
    .search-feedback-modal .ic-btn:nth-child(2) {
      width: 100%;
      height: 48px; } }

.search-empty-result-box {
  max-width: 960px;
  background: white;
  border: solid 1px #E0E0E0;
  border-radius: 4px;
  padding: 35px 50px 35px 50px;
  margin: 17px auto 0px auto; }
  .search-empty-result-box .no-results-img-normal {
    height: 100px;
    width: 100px;
    margin: 0 auto 10px auto;
    background-image: url(no-results-gray-fbe734dd93ab4c73729aad6d3dc30987.png);
    background-repeat: none; }
    @media only screen and (-webkit-min-device-pixel-ratio: 1.3), only screen and (min--moz-device-pixel-ratio: 1.3), only screen and (-o-min-device-pixel-ratio: 1.3 / 1), only screen and (min-resolution: 125dpi), only screen and (min-resolution: 1.3dppx) {
      .search-empty-result-box .no-results-img-normal {
        background-image: url(no-results-gray@2x-98005d4ed1c443c077c57f25b27065d0.png);
        background-size: 100px 100px; } }
  .search-empty-result-box .title {
    font-size: 32px;
    font-weight: 700;
    color: #212121; }
  .search-empty-result-box .subtitle {
    font-size: 20px;
    font-weight: normal;
    line-height: 34px;
    color: #757575;
    margin-bottom: 16px; }
    .search-empty-result-box .subtitle .term {
      font-weight: 600; }
  .search-empty-result-box .suggestions .title {
    font-size: 14px;
    font-weight: 600;
    line-height: 34px;
    color: #4e4e4e;
    margin-bottom: 5px; }
  .search-empty-result-box .suggestions .terms a {
    color: #3EA327;
    font-size: 14px;
    font-weight: 600; }
    .search-empty-result-box .suggestions .terms a i {
      padding-right: 5px; }
  .search-empty-result-box .suggestions .terms a:not(:first-child) {
    margin-left: 8px; }

.search-feedback {
  height: 80px;
  position: relative; }
  .search-feedback textarea::-webkit-input-placeholder {
    color: #616161; }
  .search-feedback textarea:-moz-placeholder {
    /* Firefox 18- */
    color: #616161; }
  .search-feedback textarea::-moz-placeholder {
    /* Firefox 19+ */
    color: #616161; }
  .search-feedback textarea:-ms-input-placeholder {
    color: #616161; }
  .search-feedback .round-button {
    display: inline-block;
    width: 36px;
    height: 36px;
    border-radius: 50%;
    overflow: hidden;
    background: #fff;
    border: solid 1px #C0D3D1;
    cursor: pointer;
    float: left; }
  .search-feedback .round-button:hover {
    background: #EEF5F4;
    border: solid 1px #01939A; }
  .search-feedback .slideUp {
    -webkit-animation: fadeInUp 0.5s 1;
    -moz-animation: fadeInUp 0.5s 1;
    animation: fadeInUp 0.5s 1; }
  .search-feedback .success {
    font-size: 14px;
    font-weight: 600;
    text-color: #393939;
    line-height: 22px; }
  .search-feedback .searchlink {
    margin-top: 7px;
    text-color: #01939A;
    font-size: 14px;
    line-height: 22px; }
  .search-feedback .comment-form {
    padding-top: 15px;
    width: 630px;
    margin: auto; }
  .search-feedback .comment-box {
    width: 100%;
    height: 80px; }
  .search-feedback .tip {
    float: left;
    font-size: 12px;
    line-height: 22px;
    color: #757575; }
  .search-feedback .sendbutton {
    float: right; }
  .search-feedback .center {
    margin: auto;
    position: absolute;
    top: 0;
    left: 0;
    bottom: 0;
    right: 0;
    text-align: center; }
  .search-feedback .title {
    color: #757575;
    font-size: 12px;
    line-height: 22px;
    font-weight: 600; }
  .search-feedback .question {
    color: #393939;
    font-size: 14px;
    font-weight: 600;
    line-height: 22px;
    margin-bottom: 8px; }
  .search-feedback .title-middle {
    color: #424242;
    font-size: 14px;
    line-height: 22px;
    font-weight: 600;
    margin-right: 5px; }
  .search-feedback .question-middle {
    color: #757575;
    font-size: 14px;
    font-weight: 600;
    line-height: 22px; }
  .search-feedback .thumbs-middle {
    display: inline-block;
    position: relative;
    top: 11px;
    left: 8px; }

.subset-search-v2 .filter-menu {
  opacity: 0;
  background: #fff;
  margin-top: 0 !important;
  position: fixed;
  top: 150px;
  z-index: 900;
  border-radius: 0 0.5em 0.5em 0;
  box-shadow: 0 2px 1px rgba(0, 0, 0, 0.1), 0 0 1px rgba(0, 0, 0, 0.1);
  height: 36px;
  line-height: 36px;
  padding-left: 3px;
  padding-right: 3px; }
  .subset-search-v2 .filter-menu .filter-pill-row {
    font-size: 14px; }
    .subset-search-v2 .filter-menu .filter-pill-row .ic-icon-filter {
      margin-right: 12px;
      margin-left: 8px;
      font-size: 14px; }
    .subset-search-v2 .filter-menu .filter-pill-row .filter-pill .ic-icon {
      font-size: 11px;
      margin-left: 5px;
      top: 2px;
      color: #666; }
  .subset-search-v2 .filter-menu .filter-close {
    color: #01939A;
    margin-left: 8px;
    margin-right: 8px;
    cursor: pointer; }
  .subset-search-v2 .filter-menu .filter-open {
    color: #01939A;
    margin-left: 3px;
    margin-right: 3px;
    cursor: pointer; }

.subset-search-v2 .navigation-pill.navigation-active {
  background-color: #FFF;
  color: #43b02a; }

.subset-search-v2 .navigation-pill:hover {
  color: #43b02a; }

.subset-search-v2 .navigation-pill .ic-icon-x {
  color: #43b02a;
  font-size: 12px;
  position: relative;
  top: 1px;
  margin-left: 10px; }

/* high-contrast-mode */
.high-contrast-mode .filter-container .single-filter-option .badge.badge--exclusive {
  background-color: #757575; }

.container-over-header-showing .sort-and-filter-container-mobile .links-wrapper {
  top: 181px !important; }

.sort-and-filter-container-mobile {
  margin-top: 8px;
  padding-top: 8px;
  display: none;
  border-bottom: #F0EFEC solid 1px; }
  @media (max-width: 767px) {
    .sort-and-filter-container-mobile {
      display: block; } }
  .sort-and-filter-container-mobile .links-wrapper {
    transition: margin-top 300ms; }
    .sort-and-filter-container-mobile .links-wrapper.fixed {
      top: 111px;
      position: fixed;
      z-index: 1009;
      background-color: white;
      width: 100%;
      padding-top: 10px;
      border-bottom: #F0EFEC solid 1px; }
    .sort-and-filter-container-mobile .links-wrapper.hideTop {
      margin-top: -49px; }
  .sort-and-filter-container-mobile .loading {
    padding-left: 16px; }
    .sort-and-filter-container-mobile .loading .ic-loading {
      margin-bottom: 10px; }
      .sort-and-filter-container-mobile .loading .ic-loading .ic-spinner {
        margin: 0; }
  .sort-and-filter-container-mobile .links {
    font-size: 14px;
    font-weight: 600;
    padding-left: 16px;
    color: #43B02A;
    margin: 0;
    list-style: none; }
    .sort-and-filter-container-mobile .links li:first-child {
      margin-left: 0 !important; }
    .sort-and-filter-container-mobile .links .filter-link-wrapper, .sort-and-filter-container-mobile .links .sort-link-wrapper {
      display: inline-block;
      padding-bottom: 10px; }
    .sort-and-filter-container-mobile .links .filter-link, .sort-and-filter-container-mobile .links .sort-link {
      border: 0;
      padding: 5px 0;
      display: inline-block;
      background-color: transparent; }
      .sort-and-filter-container-mobile .links .filter-link.active, .sort-and-filter-container-mobile .links .sort-link.active {
        background-color: #43B02A;
        border-radius: 4px;
        color: white;
        padding: 5px 10px;
        width: 72px;
        display: inline-block; }
      .sort-and-filter-container-mobile .links .filter-link i, .sort-and-filter-container-mobile .links .sort-link i {
        margin-right: 4px; }
    .sort-and-filter-container-mobile .links .sort-link {
      margin-left: 8px; }
  .sort-and-filter-container-mobile .filter-container-mobile, .sort-and-filter-container-mobile .sort-container-mobile {
    position: fixed;
    top: 0;
    z-index: 100000;
    width: 100%;
    background-color: #f7f7f7;
    height: 100%;
    overflow-y: scroll; }
    .sort-and-filter-container-mobile .filter-container-mobile .header, .sort-and-filter-container-mobile .sort-container-mobile .header {
      width: 100%;
      background-color: white;
      height: 50px;
      padding: 10px 20px;
      text-align: center;
      border-bottom: #F0EFEC solid 1px; }
      .sort-and-filter-container-mobile .filter-container-mobile .header .reset, .sort-and-filter-container-mobile .sort-container-mobile .header .reset {
        color: #b0b0b0;
        display: inline-block;
        font-size: 14px;
        font-weight: 600;
        cursor: pointer;
        line-height: 30px; }
        .sort-and-filter-container-mobile .filter-container-mobile .header .reset.active, .sort-and-filter-container-mobile .sort-container-mobile .header .reset.active {
          color: #43B02A; }
      .sort-and-filter-container-mobile .filter-container-mobile .header .name, .sort-and-filter-container-mobile .sort-container-mobile .header .name {
        display: inline-block;
        font-size: 16px;
        font-weight: 600; }
      .sort-and-filter-container-mobile .filter-container-mobile .header .done, .sort-and-filter-container-mobile .sort-container-mobile .header .done {
        color: #43B02A;
        display: inline-block;
        font-weight: 600;
        font-size: 14px;
        cursor: pointer;
        line-height: 30px; }
    .sort-and-filter-container-mobile .filter-container-mobile .body, .sort-and-filter-container-mobile .sort-container-mobile .body {
      border-top: #F0EFEC solid 1px;
      border-bottom: #F0EFEC solid 1px;
      margin-top: 8px;
      background-color: white;
      padding: 10px 20px; }
    .sort-and-filter-container-mobile .filter-container-mobile .aisle-filter-mobile, .sort-and-filter-container-mobile .sort-container-mobile .aisle-filter-mobile {
      display: none; }
      @media (max-width: 767px) {
        .sort-and-filter-container-mobile .filter-container-mobile .aisle-filter-mobile, .sort-and-filter-container-mobile .sort-container-mobile .aisle-filter-mobile {
          display: block; } }
      .sort-and-filter-container-mobile .filter-container-mobile .aisle-filter-mobile .title, .sort-and-filter-container-mobile .sort-container-mobile .aisle-filter-mobile .title {
        font-size: 12px;
        text-transform: uppercase;
        color: #212121;
        font-weight: bold;
        padding-bottom: 5px; }
      .sort-and-filter-container-mobile .filter-container-mobile .aisle-filter-mobile li, .sort-and-filter-container-mobile .sort-container-mobile .aisle-filter-mobile li {
        margin: 20px 0; }
      .sort-and-filter-container-mobile .filter-container-mobile .aisle-filter-mobile h4, .sort-and-filter-container-mobile .sort-container-mobile .aisle-filter-mobile h4 {
        padding: 0 0 15px;
        margin: 0; }
      .sort-and-filter-container-mobile .filter-container-mobile .aisle-filter-mobile .more-mobile a, .sort-and-filter-container-mobile .sort-container-mobile .aisle-filter-mobile .more-mobile a {
        color: #43B02A; }
        .sort-and-filter-container-mobile .filter-container-mobile .aisle-filter-mobile .more-mobile a:hover, .sort-and-filter-container-mobile .filter-container-mobile .aisle-filter-mobile .more-mobile a:active, .sort-and-filter-container-mobile .filter-container-mobile .aisle-filter-mobile .more-mobile a:focus, .sort-and-filter-container-mobile .sort-container-mobile .aisle-filter-mobile .more-mobile a:hover, .sort-and-filter-container-mobile .sort-container-mobile .aisle-filter-mobile .more-mobile a:active, .sort-and-filter-container-mobile .sort-container-mobile .aisle-filter-mobile .more-mobile a:focus {
          text-decoration: none; }
        .sort-and-filter-container-mobile .filter-container-mobile .aisle-filter-mobile .more-mobile a:hover, .sort-and-filter-container-mobile .sort-container-mobile .aisle-filter-mobile .more-mobile a:hover {
          color: #338620; }
      .sort-and-filter-container-mobile .filter-container-mobile .aisle-filter-mobile .aisle-filter-full-list, .sort-and-filter-container-mobile .sort-container-mobile .aisle-filter-mobile .aisle-filter-full-list {
        height: 100%;
        width: 100%;
        background-color: #f7f7f7;
        z-index: 10;
        overflow: scroll;
        position: fixed;
        top: 0;
        left: 0;
        transition: left 300ms;
        font-size: 14px;
        margin: 0px;
        list-style: none; }
        .sort-and-filter-container-mobile .filter-container-mobile .aisle-filter-mobile .aisle-filter-full-list.full-list-hide, .sort-and-filter-container-mobile .sort-container-mobile .aisle-filter-mobile .aisle-filter-full-list.full-list-hide {
          left: 100%;
          visibility: hidden; }
        .sort-and-filter-container-mobile .filter-container-mobile .aisle-filter-mobile .aisle-filter-full-list .full-list-back, .sort-and-filter-container-mobile .sort-container-mobile .aisle-filter-mobile .aisle-filter-full-list .full-list-back {
          color: #43B02A;
          position: absolute;
          left: 13px;
          display: inline-block;
          font-size: 22px;
          cursor: pointer;
          line-height: 30px; }
        .sort-and-filter-container-mobile .filter-container-mobile .aisle-filter-mobile .aisle-filter-full-list .name, .sort-and-filter-container-mobile .sort-container-mobile .aisle-filter-mobile .aisle-filter-full-list .name {
          display: inline-block;
          font-size: 16px;
          font-weight: 600; }
        .sort-and-filter-container-mobile .filter-container-mobile .aisle-filter-mobile .aisle-filter-full-list li, .sort-and-filter-container-mobile .sort-container-mobile .aisle-filter-mobile .aisle-filter-full-list li {
          line-height: 42px;
          overflow-x: hidden;
          text-overflow: ellipsis;
          white-space: nowrap; }
        .sort-and-filter-container-mobile .filter-container-mobile .aisle-filter-mobile .aisle-filter-full-list li.aisle, .sort-and-filter-container-mobile .sort-container-mobile .aisle-filter-mobile .aisle-filter-full-list li.aisle {
          padding-left: 15px; }
        .sort-and-filter-container-mobile .filter-container-mobile .aisle-filter-mobile .aisle-filter-full-list li.department a, .sort-and-filter-container-mobile .sort-container-mobile .aisle-filter-mobile .aisle-filter-full-list li.department a {
          font-weight: 600; }
        .sort-and-filter-container-mobile .filter-container-mobile .aisle-filter-mobile .aisle-filter-full-list a, .sort-and-filter-container-mobile .sort-container-mobile .aisle-filter-mobile .aisle-filter-full-list a {
          color: #757575; }
          .sort-and-filter-container-mobile .filter-container-mobile .aisle-filter-mobile .aisle-filter-full-list a.department, .sort-and-filter-container-mobile .sort-container-mobile .aisle-filter-mobile .aisle-filter-full-list a.department {
            font-weight: 600; }
          .sort-and-filter-container-mobile .filter-container-mobile .aisle-filter-mobile .aisle-filter-full-list a:hover, .sort-and-filter-container-mobile .filter-container-mobile .aisle-filter-mobile .aisle-filter-full-list a:active, .sort-and-filter-container-mobile .filter-container-mobile .aisle-filter-mobile .aisle-filter-full-list a:focus, .sort-and-filter-container-mobile .sort-container-mobile .aisle-filter-mobile .aisle-filter-full-list a:hover, .sort-and-filter-container-mobile .sort-container-mobile .aisle-filter-mobile .aisle-filter-full-list a:active, .sort-and-filter-container-mobile .sort-container-mobile .aisle-filter-mobile .aisle-filter-full-list a:focus {
            text-decoration: none; }
          .sort-and-filter-container-mobile .filter-container-mobile .aisle-filter-mobile .aisle-filter-full-list a:hover, .sort-and-filter-container-mobile .sort-container-mobile .aisle-filter-mobile .aisle-filter-full-list a:hover {
            color: #43B02A; }
          .sort-and-filter-container-mobile .filter-container-mobile .aisle-filter-mobile .aisle-filter-full-list a.active, .sort-and-filter-container-mobile .sort-container-mobile .aisle-filter-mobile .aisle-filter-full-list a.active {
            color: #000;
            font-weight: 600; }
  .sort-and-filter-container-mobile .sort-container-mobile .body {
    height: 90%; }
  .sort-and-filter-container-mobile .sort-container-mobile .sort-options-wrapper {
    list-style: none;
    margin: 0; }
    .sort-and-filter-container-mobile .sort-container-mobile .sort-options-wrapper .sort-option {
      border-left: #F0EFEC solid 1px;
      border-right: #F0EFEC solid 1px;
      border-top: #F0EFEC solid 1px;
      padding: 10px;
      display: flex;
      cursor: pointer; }
      .sort-and-filter-container-mobile .sort-container-mobile .sort-options-wrapper .sort-option:first-child {
        border-top-right-radius: 4px;
        border-top-left-radius: 4px; }
      .sort-and-filter-container-mobile .sort-container-mobile .sort-options-wrapper .sort-option:last-child {
        border-bottom-right-radius: 4px;
        border-bottom-left-radius: 4px;
        border-bottom: #F0EFEC solid 1px; }
      .sort-and-filter-container-mobile .sort-container-mobile .sort-options-wrapper .sort-option.active {
        background-color: #f7f7f7;
        border: #43B02A solid 1px; }
        .sort-and-filter-container-mobile .sort-container-mobile .sort-options-wrapper .sort-option.active .circle {
          background-color: #43B02A;
          border: #43B02A solid 1px; }
        .sort-and-filter-container-mobile .sort-container-mobile .sort-options-wrapper .sort-option.active i {
          color: white; }
        .sort-and-filter-container-mobile .sort-container-mobile .sort-options-wrapper .sort-option.active .sort-option--label {
          font-size: 14px;
          font-weight: 600;
          color: #43B02A; }
    .sort-and-filter-container-mobile .sort-container-mobile .sort-options-wrapper .sort-option--label {
      line-height: 25px;
      display: inline-block; }
    .sort-and-filter-container-mobile .sort-container-mobile .sort-options-wrapper .circle {
      border-radius: 50%;
      border: #b0b0b0 solid 1px;
      height: 25px;
      width: 25px;
      display: inline-block;
      margin-right: 12px; }
    .sort-and-filter-container-mobile .sort-container-mobile .sort-options-wrapper i {
      top: 3px;
      left: 4px; }
  .sort-and-filter-container-mobile .filter-container-mobile .separator {
    height: 1px;
    background: #e0e0e0;
    margin-bottom: 8px; }
  .sort-and-filter-container-mobile .filter-container-mobile .search-filter-full-list {
    height: 100%;
    width: 100%;
    background-color: #f7f7f7;
    z-index: 10;
    overflow: scroll;
    position: fixed;
    top: 0;
    left: 0;
    transition: left 300ms; }
    .sort-and-filter-container-mobile .filter-container-mobile .search-filter-full-list.full-list-hide {
      left: 100%;
      visibility: hidden; }
    .sort-and-filter-container-mobile .filter-container-mobile .search-filter-full-list .separator {
      margin: 0; }
    .sort-and-filter-container-mobile .filter-container-mobile .search-filter-full-list .full-list-back {
      color: #43B02A;
      position: absolute;
      left: 13px;
      display: inline-block;
      font-size: 22px;
      cursor: pointer;
      line-height: 30px; }
  .sort-and-filter-container-mobile .filter-container-mobile .search-filter-options li {
    margin: 20px 0; }
  .sort-and-filter-container-mobile .filter-container-mobile a {
    color: #43B02A; }
    .sort-and-filter-container-mobile .filter-container-mobile a:hover, .sort-and-filter-container-mobile .filter-container-mobile a:active, .sort-and-filter-container-mobile .filter-container-mobile a:focus {
      text-decoration: none; }
    .sort-and-filter-container-mobile .filter-container-mobile a:hover {
      color: #338620; }
  .sort-and-filter-container-mobile .filter-container-mobile .title {
    font-weight: 700;
    font-size: 16px;
    padding-bottom: 10px; }
  .sort-and-filter-container-mobile .filter-container-mobile .clear-all {
    font-weight: 600;
    font-size: 12px;
    color: #e7003e;
    font-stretch: normal;
    cursor: pointer; }
    .sort-and-filter-container-mobile .filter-container-mobile .clear-all:hover {
      color: #BA0031; }
  .sort-and-filter-container-mobile .filter-container-mobile .more {
    padding-top: 5px;
    font-weight: 600;
    font-size: 12px;
    display: block; }
    @media (max-width: 767px) {
      .sort-and-filter-container-mobile .filter-container-mobile .more {
        display: none; } }
  .sort-and-filter-container-mobile .filter-container-mobile .more-mobile {
    padding-top: 5px;
    font-weight: 600;
    font-size: 12px;
    display: none; }
    @media (max-width: 767px) {
      .sort-and-filter-container-mobile .filter-container-mobile .more-mobile {
        display: block; } }
  .sort-and-filter-container-mobile .filter-container-mobile .search-filter-view {
    margin-bottom: 20px; }
    .sort-and-filter-container-mobile .filter-container-mobile .search-filter-view .title {
      font-size: 12px;
      text-transform: uppercase;
      color: #212121;
      font-weight: bold;
      padding-bottom: 5px; }
  .sort-and-filter-container-mobile .filter-container-mobile li {
    margin: 0;
    padding: 0;
    list-style: none;
    white-space: nowrap; }
  .sort-and-filter-container-mobile .filter-container-mobile .filter-option, .sort-and-filter-container-mobile .filter-container-mobile .multi-filter-option, .sort-and-filter-container-mobile .filter-container-mobile .single-filter-option {
    line-height: 26px;
    color: #757575; }
    .sort-and-filter-container-mobile .filter-container-mobile .filter-option:hover, .sort-and-filter-container-mobile .filter-container-mobile .multi-filter-option:hover, .sort-and-filter-container-mobile .filter-container-mobile .single-filter-option:hover {
      cursor: pointer;
      color: #43b02a; }
    .sort-and-filter-container-mobile .filter-container-mobile .filter-option.active, .sort-and-filter-container-mobile .filter-container-mobile .active.multi-filter-option, .sort-and-filter-container-mobile .filter-container-mobile .active.single-filter-option {
      color: #212121; }
  .sort-and-filter-container-mobile .filter-container-mobile div.check {
    margin-top: 1px;
    width: 20px;
    height: 20px;
    border: solid;
    border-width: 1px;
    border-color: #757575;
    color: #f7f7f7;
    margin-right: 10px;
    margin-bottom: -5px;
    position: relative; }
  .sort-and-filter-container-mobile .filter-container-mobile div.check.active {
    background-color: #43B02A;
    border-width: 0px; }
  .sort-and-filter-container-mobile .filter-container-mobile div.inline {
    display: inline-block; }
  .sort-and-filter-container-mobile .filter-container-mobile .multi-filter-option div.check {
    border-radius: 15%; }
  .sort-and-filter-container-mobile .filter-container-mobile .single-filter-option div.check {
    border-radius: 50%; }

.store-banner-container {
  height: 200px;
  margin: 0 auto;
  position: relative;
  width: 100%; }
  .store-banner-container .store-overlay {
    position: absolute;
    bottom: 20px;
    text-align: center;
    width: 100%;
    font-weight: bolder; }

.store-banner {
  cursor: pointer;
  height: 200px;
  margin: 0 auto;
  margin-top: 30px;
  background-size: auto 100%;
  background-repeat: no-repeat;
  background-position: center;
  color: #fff;
  position: relative;
  text-align: center;
  border-radius: 4px; }

.text-banner {
  height: 56px;
  background-color: #43B02A; }
  .text-banner p {
    color: white;
    font-size: 1.6em;
    font-weight: 600;
    line-height: 56px; }

.wide-item-card {
  display: -webkit-box;
  display: -moz-box;
  display: box;
  display: -webkit-flex;
  display: -moz-flex;
  display: -ms-flexbox;
  display: flex;
  flex-flow: flex-wrap;
  flex-wrap: wrap;
  flex-direction: row;
  position: relative;
  background-color: #fff;
  min-width: 245px;
  min-height: 175px;
  flex-grow: 1;
  border: 1px solid #e5edec;
  margin: 0 -1px -1px 0;
  padding: 16px; }

.wide-item-card-media, .wide-item-card-info {
  padding: 8px;
  overflow: visible; }

.wide-item-card-media {
  width: 40%; }

.wide-item-card-info {
  width: 60%; }

.wide-item-card-info-size {
  color: #9e9e9e; }

.wide-item-card-item-button-group-button {
  height: 32px;
  padding: 5px 10px;
  margin-right: 16px; }

.wide-item-card-item-button-group-button-label {
  font-weight: 600;
  margin-left: 8px; }

.wide-item-card-qty-badge {
  -moz-border-radius-topleft: 20px !important;
  -moz-border-radius-topright: 20px !important;
  -moz-border-radius-bottomright: 20px !important;
  -moz-border-radius-bottomleft: 20px !important;
  -webkit-border-top-left-radius: 20px !important;
  -webkit-border-top-right-radius: 20px !important;
  -webkit-border-bottom-right-radius: 20px !important;
  -webkit-border-bottom-left-radius: 20px !important;
  border-top-left-radius: 20px !important;
  border-top-right-radius: 20px !important;
  border-bottom-right-radius: 20px !important;
  border-bottom-left-radius: 20px !important;
  padding: 4px 9px;
  min-width: 10px;
  position: absolute;
  left: 16px;
  top: 16px;
  background-color: #43B02A;
  color: #fff;
  font-size: 16px;
  text-align: center;
  font-weight: normal;
  text-rendering: optimizeLegibility; }

.wide-item-card-info {
  font-size: 14px;
  padding-bottom: 3em; }
  .wide-item-card-info .item-price {
    font-size: 14px; }

.wide-item-card-info-name {
  display: -webkit-box;
  -webkit-line-clamp: 3;
  -webkit-box-orient: vertical;
  overflow: hidden; }

.container-wide-item-card {
  width: 100%;
  display: -webkit-box;
  display: -moz-box;
  display: box;
  display: -webkit-flex;
  display: -moz-flex;
  display: -ms-flexbox;
  display: flex;
  flex-flow: flex-wrap;
  flex-wrap: wrap;
  flex-direction: row; }

.container-wide-item-card .wide-item-card {
  width: 33.3%; }

.featured-products-checkout-list {
  max-width: 980px;
  margin: auto; }

.app-store-link {
  background: transparent scroll no-repeat top left;
  width: 234px;
  height: 62px;
  display: inline-block; }

#invite_form {
  margin-top: 20px;
  display: none; }

/* BOOTSTRAP OVERRIDES */
.btn {
  -moz-border-radius: 0 !important;
  -webkit-border-radius: 0 !important;
  border-radius: 0 !important; }

.alert {
  -moz-border-radius: 0 !important;
  -webkit-border-radius: 0 !important;
  border-radius: 0 !important; }

.dropdown-menu {
  -moz-border-radius: 0 !important;
  -webkit-border-radius: 0 !important;
  border-radius: 0 !important; }

input[type="text"], input[type="search"], input[type="password"], input[type="email"], input[type="number"], input[type="tel"], input[type="date"], textarea {
  -moz-border-radius: 0 !important;
  -webkit-border-radius: 0 !important;
  border-radius: 0 !important; }

input:focus:required:invalid:focus, textarea:focus:required:invalid:focus, select:focus:required:invalid:focus {
  border-color: #ccc; }

.u-pullLeft {
  float: left; }

.u-pullRight {
  float: right; }

.u-clearfix:before, .u-clearfix:after {
  display: table;
  content: " "; }

.u-clearfix:after {
  clear: both; }

.u-textCenter {
  text-align: center; }

.u-table {
  display: table; }

.u-tableCell {
  display: table-cell; }

.u-verticalAlignMiddle {
  vertical-align: middle !important; }

@media (max-width: 850px) {
  .u-hideOnTablet {
    display: none !important; } }

.u-overflowHidden {
  overflow: hidden; }

.clearfix:before, .clearfix:after {
  content: " ";
  display: table; }

.clearfix:after {
  clear: both; }

.center-block {
  display: block;
  margin-left: auto;
  margin-right: auto; }

.pull-right {
  float: right !important; }

.pull-left {
  float: left !important; }

.show {
  display: block !important; }

.invisible {
  visibility: hidden; }

.text-hide {
  font: 0/0 a;
  color: transparent;
  text-shadow: none;
  background-color: transparent;
  border: 0; }

.hidden {
  display: none !important; }

.affix {
  position: fixed; }

.sr-only {
  position: absolute;
  width: 1px;
  height: 1px;
  margin: -1px;
  padding: 0;
  overflow: hidden;
  clip: rect(0, 0, 0, 0);
  border: 0; }

.sr-only-focusable:active, .sr-only-focusable:focus {
  position: static;
  width: auto;
  height: auto;
  margin: 0;
  overflow: visible;
  clip: auto; }

.ic-btn {
  display: inline-block;
  margin-bottom: 0;
  font-weight: 600;
  text-align: center;
  vertical-align: middle;
  touch-action: manipulation;
  cursor: pointer;
  background-image: none;
  border: 1px solid transparent;
  white-space: nowrap;
  -webkit-font-smoothing: antialiased;
  padding: 6px 14px;
  font-size: 14px;
  line-height: 1.42857;
  border-radius: 4px;
  -webkit-user-select: none;
  -moz-user-select: none;
  -ms-user-select: none;
  user-select: none; }
  .ic-btn:focus, .ic-btn.focus, .ic-btn:active:focus, .ic-btn:active.focus, .ic-btn.active:focus, .ic-btn.active.focus {
    outline: none;
    box-shadow: 0 0 0 1px #fff, 0 0 0 3px #36DAE3; }
  .ic-btn:hover, .ic-btn:focus, .ic-btn.focus {
    color: #333;
    text-decoration: none; }
  .ic-btn:active, .ic-btn.active {
    outline: 0;
    background-image: none;
    -webkit-box-shadow: inset 0 3px 5px rgba(0, 0, 0, 0.125);
    box-shadow: inset 0 3px 5px rgba(0, 0, 0, 0.125); }
  .ic-btn.disabled, .ic-btn[disabled],
  fieldset[disabled] .ic-btn {
    cursor: not-allowed;
    pointer-events: none;
    opacity: 0.65;
    filter: alpha(opacity=65);
    -webkit-box-shadow: none;
    box-shadow: none; }

.ic-btn-default {
  color: #333;
  background-color: #FBFAF9;
  border-color: #E7E6E5; }
  .ic-btn-default:hover, .ic-btn-default:focus, .ic-btn-default.focus, .ic-btn-default:active, .ic-btn-default.active,
  .open > .ic-btn-default.dropdown-toggle {
    color: #333;
    background-color: #e7e1da;
    border-color: #cac7c5; }
  .ic-btn-default:active, .ic-btn-default.active,
  .open > .ic-btn-default.dropdown-toggle {
    background-image: none; }
  .ic-btn-default.disabled, .ic-btn-default.disabled:hover, .ic-btn-default.disabled:focus, .ic-btn-default.disabled.focus, .ic-btn-default.disabled:active, .ic-btn-default.disabled.active, .ic-btn-default[disabled], .ic-btn-default[disabled]:hover, .ic-btn-default[disabled]:focus, .ic-btn-default[disabled].focus, .ic-btn-default[disabled]:active, .ic-btn-default[disabled].active,
  fieldset[disabled] .ic-btn-default,
  fieldset[disabled] .ic-btn-default:hover,
  fieldset[disabled] .ic-btn-default:focus,
  fieldset[disabled] .ic-btn-default.focus,
  fieldset[disabled] .ic-btn-default:active,
  fieldset[disabled] .ic-btn-default.active {
    background-color: #FBFAF9;
    border-color: #E7E6E5; }
  .ic-btn-default .badge {
    color: #FBFAF9;
    background-color: #333; }
  .ic-btn-default:hover {
    background-color: #F0EFEC;
    border: 1px solid #DDDCD9; }

.ic-btn-white {
  color: #333;
  background-color: #fff;
  border-color: #E7E6E5; }
  .ic-btn-white:hover, .ic-btn-white:focus, .ic-btn-white.focus, .ic-btn-white:active, .ic-btn-white.active,
  .open > .ic-btn-white.dropdown-toggle {
    color: #333;
    background-color: #e6e6e6;
    border-color: #cac7c5; }
  .ic-btn-white:active, .ic-btn-white.active,
  .open > .ic-btn-white.dropdown-toggle {
    background-image: none; }
  .ic-btn-white.disabled, .ic-btn-white.disabled:hover, .ic-btn-white.disabled:focus, .ic-btn-white.disabled.focus, .ic-btn-white.disabled:active, .ic-btn-white.disabled.active, .ic-btn-white[disabled], .ic-btn-white[disabled]:hover, .ic-btn-white[disabled]:focus, .ic-btn-white[disabled].focus, .ic-btn-white[disabled]:active, .ic-btn-white[disabled].active,
  fieldset[disabled] .ic-btn-white,
  fieldset[disabled] .ic-btn-white:hover,
  fieldset[disabled] .ic-btn-white:focus,
  fieldset[disabled] .ic-btn-white.focus,
  fieldset[disabled] .ic-btn-white:active,
  fieldset[disabled] .ic-btn-white.active {
    background-color: #fff;
    border-color: #E7E6E5; }
  .ic-btn-white .badge {
    color: #fff;
    background-color: #333; }
  .ic-btn-white:hover {
    background-color: #F0EFEC;
    border: 1px solid #DDDCD9; }

.ic-btn-white-selected {
  color: #01939A;
  background-color: #F3F8F7;
  border-color: #36dae3;
  z-index: 2; }
  .ic-btn-white-selected:hover, .ic-btn-white-selected:focus, .ic-btn-white-selected.focus, .ic-btn-white-selected:active, .ic-btn-white-selected.active,
  .open > .ic-btn-white-selected.dropdown-toggle {
    color: #01939A;
    background-color: #d3e5e2;
    border-color: #1bb8c1; }
  .ic-btn-white-selected:active, .ic-btn-white-selected.active,
  .open > .ic-btn-white-selected.dropdown-toggle {
    background-image: none; }
  .ic-btn-white-selected.disabled, .ic-btn-white-selected.disabled:hover, .ic-btn-white-selected.disabled:focus, .ic-btn-white-selected.disabled.focus, .ic-btn-white-selected.disabled:active, .ic-btn-white-selected.disabled.active, .ic-btn-white-selected[disabled], .ic-btn-white-selected[disabled]:hover, .ic-btn-white-selected[disabled]:focus, .ic-btn-white-selected[disabled].focus, .ic-btn-white-selected[disabled]:active, .ic-btn-white-selected[disabled].active,
  fieldset[disabled] .ic-btn-white-selected,
  fieldset[disabled] .ic-btn-white-selected:hover,
  fieldset[disabled] .ic-btn-white-selected:focus,
  fieldset[disabled] .ic-btn-white-selected.focus,
  fieldset[disabled] .ic-btn-white-selected:active,
  fieldset[disabled] .ic-btn-white-selected.active {
    background-color: #F3F8F7;
    border-color: #36dae3; }
  .ic-btn-white-selected .badge {
    color: #F3F8F7;
    background-color: #01939A; }

.ic-btn-primary {
  color: #fff;
  background-color: #FF5600;
  border-color: #FF5600; }
  .ic-btn-primary:hover, .ic-btn-primary:focus, .ic-btn-primary.focus, .ic-btn-primary:active, .ic-btn-primary.active,
  .open > .ic-btn-primary.dropdown-toggle {
    color: #fff;
    background-color: #cc4500;
    border-color: #c24100; }
  .ic-btn-primary:active, .ic-btn-primary.active,
  .open > .ic-btn-primary.dropdown-toggle {
    background-image: none; }
  .ic-btn-primary.disabled, .ic-btn-primary.disabled:hover, .ic-btn-primary.disabled:focus, .ic-btn-primary.disabled.focus, .ic-btn-primary.disabled:active, .ic-btn-primary.disabled.active, .ic-btn-primary[disabled], .ic-btn-primary[disabled]:hover, .ic-btn-primary[disabled]:focus, .ic-btn-primary[disabled].focus, .ic-btn-primary[disabled]:active, .ic-btn-primary[disabled].active,
  fieldset[disabled] .ic-btn-primary,
  fieldset[disabled] .ic-btn-primary:hover,
  fieldset[disabled] .ic-btn-primary:focus,
  fieldset[disabled] .ic-btn-primary.focus,
  fieldset[disabled] .ic-btn-primary:active,
  fieldset[disabled] .ic-btn-primary.active {
    background-color: #FF5600;
    border-color: #FF5600; }
  .ic-btn-primary .badge {
    color: #FF5600;
    background-color: #fff; }

.ic-btn-success {
  color: #fff;
  background-color: #43B02A;
  border-color: #43B02A; }
  .ic-btn-success:hover, .ic-btn-success:focus, .ic-btn-success.focus, .ic-btn-success:active, .ic-btn-success.active,
  .open > .ic-btn-success.dropdown-toggle {
    color: #fff;
    background-color: #338720;
    border-color: #307f1e; }
  .ic-btn-success:active, .ic-btn-success.active,
  .open > .ic-btn-success.dropdown-toggle {
    background-image: none; }
  .ic-btn-success.disabled, .ic-btn-success.disabled:hover, .ic-btn-success.disabled:focus, .ic-btn-success.disabled.focus, .ic-btn-success.disabled:active, .ic-btn-success.disabled.active, .ic-btn-success[disabled], .ic-btn-success[disabled]:hover, .ic-btn-success[disabled]:focus, .ic-btn-success[disabled].focus, .ic-btn-success[disabled]:active, .ic-btn-success[disabled].active,
  fieldset[disabled] .ic-btn-success,
  fieldset[disabled] .ic-btn-success:hover,
  fieldset[disabled] .ic-btn-success:focus,
  fieldset[disabled] .ic-btn-success.focus,
  fieldset[disabled] .ic-btn-success:active,
  fieldset[disabled] .ic-btn-success.active {
    background-color: #43B02A;
    border-color: #43B02A; }
  .ic-btn-success .badge {
    color: #43B02A;
    background-color: #fff; }

.ic-btn-success-secondary {
  color: #43B02A;
  background-color: #fff;
  border-color: #43B02A; }
  .ic-btn-success-secondary:hover, .ic-btn-success-secondary:focus, .ic-btn-success-secondary.focus, .ic-btn-success-secondary:active, .ic-btn-success-secondary.active,
  .open > .ic-btn-success-secondary.dropdown-toggle {
    color: #43B02A;
    background-color: #e6e6e6;
    border-color: #307f1e; }
  .ic-btn-success-secondary:active, .ic-btn-success-secondary.active,
  .open > .ic-btn-success-secondary.dropdown-toggle {
    background-image: none; }
  .ic-btn-success-secondary.disabled, .ic-btn-success-secondary.disabled:hover, .ic-btn-success-secondary.disabled:focus, .ic-btn-success-secondary.disabled.focus, .ic-btn-success-secondary.disabled:active, .ic-btn-success-secondary.disabled.active, .ic-btn-success-secondary[disabled], .ic-btn-success-secondary[disabled]:hover, .ic-btn-success-secondary[disabled]:focus, .ic-btn-success-secondary[disabled].focus, .ic-btn-success-secondary[disabled]:active, .ic-btn-success-secondary[disabled].active,
  fieldset[disabled] .ic-btn-success-secondary,
  fieldset[disabled] .ic-btn-success-secondary:hover,
  fieldset[disabled] .ic-btn-success-secondary:focus,
  fieldset[disabled] .ic-btn-success-secondary.focus,
  fieldset[disabled] .ic-btn-success-secondary:active,
  fieldset[disabled] .ic-btn-success-secondary.active {
    background-color: #fff;
    border-color: #43B02A; }
  .ic-btn-success-secondary .badge {
    color: #fff;
    background-color: #43B02A; }
  .ic-btn-success-secondary:hover {
    background-color: #F6FFF4; }
  .ic-btn-success-secondary:focus, .ic-btn-success-secondary.focus, .ic-btn-success-secondary:active, .ic-btn-success-secondary.active {
    background-color: #EDFFE9; }

.ic-btn-secondary {
  color: #01939A;
  background-color: #fff;
  border-color: #E5EDEC; }
  .ic-btn-secondary:hover, .ic-btn-secondary:focus, .ic-btn-secondary.focus, .ic-btn-secondary:active, .ic-btn-secondary.active,
  .open > .ic-btn-secondary.dropdown-toggle {
    color: #01939A;
    background-color: #e6e6e6;
    border-color: #c1d4d2; }
  .ic-btn-secondary:active, .ic-btn-secondary.active,
  .open > .ic-btn-secondary.dropdown-toggle {
    background-image: none; }
  .ic-btn-secondary.disabled, .ic-btn-secondary.disabled:hover, .ic-btn-secondary.disabled:focus, .ic-btn-secondary.disabled.focus, .ic-btn-secondary.disabled:active, .ic-btn-secondary.disabled.active, .ic-btn-secondary[disabled], .ic-btn-secondary[disabled]:hover, .ic-btn-secondary[disabled]:focus, .ic-btn-secondary[disabled].focus, .ic-btn-secondary[disabled]:active, .ic-btn-secondary[disabled].active,
  fieldset[disabled] .ic-btn-secondary,
  fieldset[disabled] .ic-btn-secondary:hover,
  fieldset[disabled] .ic-btn-secondary:focus,
  fieldset[disabled] .ic-btn-secondary.focus,
  fieldset[disabled] .ic-btn-secondary:active,
  fieldset[disabled] .ic-btn-secondary.active {
    background-color: #fff;
    border-color: #E5EDEC; }
  .ic-btn-secondary .badge {
    color: #fff;
    background-color: #01939A; }
  .ic-btn-secondary:hover, .ic-btn-secondary:focus {
    background-color: #F2F9FA; }
  .ic-btn-secondary:active {
    background-color: #E5EDEC; }

.ic-btn-danger {
  color: #E8104A;
  background-color: #fff;
  border-color: #E8104A; }
  .ic-btn-danger:hover, .ic-btn-danger:focus, .ic-btn-danger.focus, .ic-btn-danger:active, .ic-btn-danger.active,
  .open > .ic-btn-danger.dropdown-toggle {
    color: #E8104A;
    background-color: #e6e6e6;
    border-color: #af0c38; }
  .ic-btn-danger:active, .ic-btn-danger.active,
  .open > .ic-btn-danger.dropdown-toggle {
    background-image: none; }
  .ic-btn-danger.disabled, .ic-btn-danger.disabled:hover, .ic-btn-danger.disabled:focus, .ic-btn-danger.disabled.focus, .ic-btn-danger.disabled:active, .ic-btn-danger.disabled.active, .ic-btn-danger[disabled], .ic-btn-danger[disabled]:hover, .ic-btn-danger[disabled]:focus, .ic-btn-danger[disabled].focus, .ic-btn-danger[disabled]:active, .ic-btn-danger[disabled].active,
  fieldset[disabled] .ic-btn-danger,
  fieldset[disabled] .ic-btn-danger:hover,
  fieldset[disabled] .ic-btn-danger:focus,
  fieldset[disabled] .ic-btn-danger.focus,
  fieldset[disabled] .ic-btn-danger:active,
  fieldset[disabled] .ic-btn-danger.active {
    background-color: #fff;
    border-color: #E8104A; }
  .ic-btn-danger .badge {
    color: #fff;
    background-color: #E8104A; }
  .ic-btn-danger:hover {
    background-color: rgba(253, 232, 237, 0.3); }

.ic-btn-ng {
  color: #FF5600;
  background-color: #fff;
  border-color: #FFD5BF; }
  .ic-btn-ng:hover, .ic-btn-ng:focus, .ic-btn-ng.focus, .ic-btn-ng:active, .ic-btn-ng.active,
  .open > .ic-btn-ng.dropdown-toggle {
    color: #FF5600;
    background-color: #e6e6e6;
    border-color: #ffad82; }
  .ic-btn-ng:active, .ic-btn-ng.active,
  .open > .ic-btn-ng.dropdown-toggle {
    background-image: none; }
  .ic-btn-ng.disabled, .ic-btn-ng.disabled:hover, .ic-btn-ng.disabled:focus, .ic-btn-ng.disabled.focus, .ic-btn-ng.disabled:active, .ic-btn-ng.disabled.active, .ic-btn-ng[disabled], .ic-btn-ng[disabled]:hover, .ic-btn-ng[disabled]:focus, .ic-btn-ng[disabled].focus, .ic-btn-ng[disabled]:active, .ic-btn-ng[disabled].active,
  fieldset[disabled] .ic-btn-ng,
  fieldset[disabled] .ic-btn-ng:hover,
  fieldset[disabled] .ic-btn-ng:focus,
  fieldset[disabled] .ic-btn-ng.focus,
  fieldset[disabled] .ic-btn-ng:active,
  fieldset[disabled] .ic-btn-ng.active {
    background-color: #fff;
    border-color: #FFD5BF; }
  .ic-btn-ng .badge {
    color: #fff;
    background-color: #FF5600; }
  .ic-btn-ng:hover {
    background-color: #FFF6F2; }
  .ic-btn-ng:focus, .ic-btn-ng.focus, .ic-btn-ng:active, .ic-btn-ng.active {
    background-color: #FFD5BF; }

.ic-btn-hollow {
  color: #fff;
  background-color: transparent;
  border-color: #fff; }
  .ic-btn-hollow:hover, .ic-btn-hollow:focus, .ic-btn-hollow.focus, .ic-btn-hollow:active, .ic-btn-hollow.active,
  .open > .ic-btn-hollow.dropdown-toggle {
    color: #fff;
    background-color: rgba(0, 0, 0, 0);
    border-color: #e0e0e0; }
  .ic-btn-hollow:active, .ic-btn-hollow.active,
  .open > .ic-btn-hollow.dropdown-toggle {
    background-image: none; }
  .ic-btn-hollow.disabled, .ic-btn-hollow.disabled:hover, .ic-btn-hollow.disabled:focus, .ic-btn-hollow.disabled.focus, .ic-btn-hollow.disabled:active, .ic-btn-hollow.disabled.active, .ic-btn-hollow[disabled], .ic-btn-hollow[disabled]:hover, .ic-btn-hollow[disabled]:focus, .ic-btn-hollow[disabled].focus, .ic-btn-hollow[disabled]:active, .ic-btn-hollow[disabled].active,
  fieldset[disabled] .ic-btn-hollow,
  fieldset[disabled] .ic-btn-hollow:hover,
  fieldset[disabled] .ic-btn-hollow:focus,
  fieldset[disabled] .ic-btn-hollow.focus,
  fieldset[disabled] .ic-btn-hollow:active,
  fieldset[disabled] .ic-btn-hollow.active {
    background-color: transparent;
    border-color: #fff; }
  .ic-btn-hollow .badge {
    color: transparent;
    background-color: #fff; }

.ic-btn-link {
  color: #01939A;
  font-weight: normal;
  border-radius: 0; }
  .ic-btn-link.is-muted {
    color: #b0b0b0; }
  .ic-btn-link, .ic-btn-link:active, .ic-btn-link.active, .ic-btn-link[disabled],
  fieldset[disabled] .ic-btn-link {
    background-color: transparent;
    -webkit-box-shadow: none;
    box-shadow: none; }
  .ic-btn-link, .ic-btn-link:hover, .ic-btn-link:focus, .ic-btn-link:active {
    border-color: transparent; }
  .ic-btn-link:hover, .ic-btn-link:focus {
    color: #014a4e;
    text-decoration: underline;
    background-color: transparent; }
  .ic-btn-link[disabled]:hover, .ic-btn-link[disabled]:focus,
  fieldset[disabled] .ic-btn-link:hover,
  fieldset[disabled] .ic-btn-link:focus {
    color: #b0b0b0;
    text-decoration: none; }

.ic-btn-lg, .ic-btn-group-lg > .ic-btn {
  padding: 10px 18px;
  font-size: 18px;
  line-height: 1.33333;
  border-radius: 4px; }

.ic-btn-sm, .ic-btn-group-sm > .ic-btn {
  padding: 5px 10px;
  font-size: 12px;
  line-height: 1.5;
  border-radius: 4px; }

.ic-btn-xs, .ic-btn-group-xs > .ic-btn {
  padding: 1px 8px;
  font-size: 12px;
  line-height: 1.5;
  border-radius: 4px;
  text-transform: uppercase; }

.ic-btn-block {
  display: block;
  width: 100%; }

.ic-btn-block + .ic-btn-block {
  margin-top: 5px; }

input[type="submit"].ic-btn-block,
input[type="reset"].ic-btn-block,
input[type="button"].ic-btn-block {
  width: 100%; }

.ic-btn > .ic-icon {
  position: relative;
  top: 0.148em; }

.ic-btn-facebook {
  background-color: #4267B2;
  color: #fff; }
  .ic-btn-facebook:hover, .ic-btn-facebook:active, .ic-btn-facebook:focus {
    background-color: #34518d;
    color: #fff; }

.ic-btn-twitter {
  background-color: #55ACEE;
  color: #fff; }
  .ic-btn-twitter:hover, .ic-btn-twitter:active, .ic-btn-twitter:focus {
    background-color: #2795e9;
    color: #fff; }

.ic-btn-group,
.ic-btn-group-vertical {
  position: relative;
  display: inline-block;
  vertical-align: middle; }
  .ic-btn-group > .ic-btn,
  .ic-btn-group-vertical > .ic-btn {
    position: relative;
    float: left; }
    .ic-btn-group > .ic-btn:hover, .ic-btn-group > .ic-btn:focus, .ic-btn-group > .ic-btn:active, .ic-btn-group > .ic-btn.active,
    .ic-btn-group-vertical > .ic-btn:hover,
    .ic-btn-group-vertical > .ic-btn:focus,
    .ic-btn-group-vertical > .ic-btn:active,
    .ic-btn-group-vertical > .ic-btn.active {
      z-index: 2; }

.ic-btn-group .ic-btn + .ic-btn,
.ic-btn-group .ic-btn + .ic-btn-group,
.ic-btn-group .ic-btn-group + .ic-btn,
.ic-btn-group .ic-btn-group + .ic-btn-group {
  margin-left: -1px; }

.ic-btn-toolbar {
  margin-left: -5px; }
  .ic-btn-toolbar:before, .ic-btn-toolbar:after {
    content: " ";
    display: table; }
  .ic-btn-toolbar:after {
    clear: both; }
  .ic-btn-toolbar .ic-btn-group,
  .ic-btn-toolbar .input-group {
    float: left; }
  .ic-btn-toolbar > .ic-btn,
  .ic-btn-toolbar > .ic-btn-group,
  .ic-btn-toolbar > .input-group {
    margin-left: 5px; }

.ic-btn-group > .ic-btn:not(:first-child):not(:last-child):not(.dropdown-toggle) {
  border-radius: 0; }

.ic-btn-group > .ic-btn:first-child {
  margin-left: 0; }
  .ic-btn-group > .ic-btn:first-child:not(:last-child):not(.dropdown-toggle) {
    border-bottom-right-radius: 0;
    border-top-right-radius: 0; }

.ic-btn-group > .ic-btn:last-child:not(:first-child),
.ic-btn-group > .dropdown-toggle:not(:first-child) {
  border-bottom-left-radius: 0;
  border-top-left-radius: 0; }

.ic-btn-group > .ic-btn-group {
  float: left; }

.ic-btn-group > .ic-btn-group:not(:first-child):not(:last-child) > .ic-btn {
  border-radius: 0; }

.ic-btn-group > .ic-btn-group:first-child:not(:last-child) > .ic-btn:last-child,
.ic-btn-group > .ic-btn-group:first-child:not(:last-child) > .dropdown-toggle {
  border-bottom-right-radius: 0;
  border-top-right-radius: 0; }

.ic-btn-group > .ic-btn-group:last-child:not(:first-child) > .ic-btn:first-child {
  border-bottom-left-radius: 0;
  border-top-left-radius: 0; }

.ic-btn-group .dropdown-toggle:active,
.ic-btn-group.open .dropdown-toggle {
  outline: 0; }

.ic-btn-group > .ic-btn + .dropdown-toggle {
  padding-left: 8px;
  padding-right: 8px; }

.ic-btn-group > .ic-btn-lg + .dropdown-toggle, .ic-btn-group-lg.ic-btn-group > .ic-btn + .dropdown-toggle {
  padding-left: 12px;
  padding-right: 12px; }

.ic-btn-group.open .dropdown-toggle {
  -webkit-box-shadow: inset 0 3px 5px rgba(0, 0, 0, 0.125);
  box-shadow: inset 0 3px 5px rgba(0, 0, 0, 0.125); }
  .ic-btn-group.open .dropdown-toggle.ic-btn-link {
    -webkit-box-shadow: none;
    box-shadow: none; }

.ic-btn-group-vertical > .ic-btn,
.ic-btn-group-vertical > .ic-btn-group,
.ic-btn-group-vertical > .ic-btn-group > .ic-btn {
  display: block;
  float: none;
  width: 100%;
  max-width: 100%; }

.ic-btn-group-vertical > .ic-btn-group:before, .ic-btn-group-vertical > .ic-btn-group:after {
  content: " ";
  display: table; }

.ic-btn-group-vertical > .ic-btn-group:after {
  clear: both; }

.ic-btn-group-vertical > .ic-btn-group > .ic-btn {
  float: none; }

.ic-btn-group-vertical > .ic-btn + .ic-btn,
.ic-btn-group-vertical > .ic-btn + .ic-btn-group,
.ic-btn-group-vertical > .ic-btn-group + .ic-btn,
.ic-btn-group-vertical > .ic-btn-group + .ic-btn-group {
  margin-top: -1px;
  margin-left: 0; }

.ic-btn-group-vertical > .ic-btn:not(:first-child):not(:last-child) {
  border-radius: 0; }

.ic-btn-group-vertical > .ic-btn:first-child:not(:last-child) {
  border-top-right-radius: 4px;
  border-bottom-right-radius: 0;
  border-bottom-left-radius: 0; }

.ic-btn-group-vertical > .ic-btn:last-child:not(:first-child) {
  border-bottom-left-radius: 4px;
  border-top-right-radius: 0;
  border-top-left-radius: 0; }

.ic-btn-group-vertical > .ic-btn-group:not(:first-child):not(:last-child) > .ic-btn {
  border-radius: 0; }

.ic-btn-group-vertical > .ic-btn-group:first-child:not(:last-child) > .ic-btn:last-child,
.ic-btn-group-vertical > .ic-btn-group:first-child:not(:last-child) > .dropdown-toggle {
  border-bottom-right-radius: 0;
  border-bottom-left-radius: 0; }

.ic-btn-group-vertical > .ic-btn-group:last-child:not(:first-child) > .ic-btn:first-child {
  border-top-right-radius: 0;
  border-top-left-radius: 0; }

.ic-btn-group-justified {
  display: table;
  width: 100%;
  table-layout: fixed;
  border-collapse: separate; }
  .ic-btn-group-justified > .ic-btn,
  .ic-btn-group-justified > .ic-btn-group {
    float: none;
    display: table-cell;
    width: 1%; }
  .ic-btn-group-justified > .ic-btn-group .ic-btn {
    width: 100%; }
  .ic-btn-group-justified > .ic-btn-group .dropdown-menu {
    left: auto; }

[data-toggle="buttons"] > .ic-btn input[type="radio"],
[data-toggle="buttons"] > .ic-btn input[type="checkbox"],
[data-toggle="buttons"] > .ic-btn-group > .ic-btn input[type="radio"],
[data-toggle="buttons"] > .ic-btn-group > .ic-btn input[type="checkbox"] {
  position: absolute;
  clip: rect(0, 0, 0, 0);
  pointer-events: none; }

@font-face {
  font-family: 'ic-icons';
  src: url(ic-icons-e61100aef1575fa25b943081fac79aa2.eot);
  src: url(ic-icons-e61100aef1575fa25b943081fac79aa2.eot?#iefix) format("embedded-opentype"), url(ic-icons-33cf798c56148b448b156e26d7edf4e0.woff) format("woff"), url(ic-icons-e6ac5bcf47ca23acf91b1ae5535eb25e.ttf) format("truetype"), url(ic-icons-6f71a6518feaeb99a494d3c78e296d6e.svg#ic-icons) format("svg");
  font-weight: normal;
  font-style: normal; }

[data-icon]:before {
  font-family: "ic-icons" !important;
  content: attr(data-icon);
  font-style: normal !important;
  font-weight: normal !important;
  font-variant: normal !important;
  text-transform: none !important;
  speak: none;
  line-height: 1;
  -webkit-font-smoothing: antialiased;
  -moz-osx-font-smoothing: grayscale; }

[class^="ic-icon-"]:before,
[class*=" ic-icon-"]:before {
  font-family: "ic-icons" !important;
  font-style: normal !important;
  font-weight: normal !important;
  font-variant: normal !important;
  text-transform: none !important;
  speak: none;
  line-height: 1;
  -webkit-font-smoothing: antialiased;
  -moz-osx-font-smoothing: grayscale; }

.ic-icon-x:before {
  content: "\E000"; }

.ic-icon-info:before {
  content: "\E001"; }

.ic-icon-lists-and-recipes:before {
  content: "\E002"; }

.ic-icon-location-marker:before {
  content: "\E003"; }

.ic-icon-logout:before {
  content: "\E004"; }

.ic-icon-money:before {
  content: "\E005"; }

.ic-icon-more:before {
  content: "\E006"; }

.ic-icon-order-history:before {
  content: "\E007"; }

.ic-icon-search:before {
  content: "\E008"; }

.ic-icon-store:before {
  content: "\E009"; }

.ic-icon-ticket:before {
  content: "\E00A"; }

.ic-icon-help:before {
  content: "\E00B"; }

.ic-icon-arrow-up-small:before {
  content: "\E00E"; }

.ic-icon-arrow-right-small-bold:before {
  content: "\E00F"; }

.ic-icon-arrow-right-small:before {
  content: "\E010"; }

.ic-icon-arrow-left-small-bold:before {
  content: "\E011"; }

.ic-icon-arrow-left-small:before {
  content: "\E012"; }

.ic-icon-arrow-down-small-bold:before {
  content: "\E013"; }

.ic-icon-arrow-down-small:before {
  content: "\E014"; }

.ic-icon-tip:before {
  content: "\E016"; }

.ic-icon-clock:before {
  content: "\E017"; }

.ic-icon-lock:before {
  content: "\E018"; }

.ic-icon-bell:before {
  content: "\E01A"; }

.ic-icon-alcohol:before {
  content: "\E01B"; }

.ic-icon-pricing-filled:before {
  content: "\E01E"; }

.ic-icon-pricing-same:before {
  content: "\E01F"; }

.ic-icon-loyalty-card:before {
  content: "\E021"; }

.ic-icon-picture:before {
  content: "\E024"; }

.ic-icon-star:before {
  content: "\E025"; }

.ic-icon-star-filled:before {
  content: "\E026"; }

.ic-icon-arrow-right:before {
  content: "\E027"; }

.ic-icon-receipt:before {
  content: "\E028"; }

.ic-icon-happy:before {
  content: "\E029"; }

.ic-icon-plus-bold:before {
  content: "\E02B"; }

.ic-icon-email-filled:before {
  content: "\E02F"; }

.ic-icon-facebook-filled:before {
  content: "\E030"; }

.ic-icon-share-android-filled:before {
  content: "\E032"; }

.ic-icon-share-android:before {
  content: "\E033"; }

.ic-icon-twitter-filled:before {
  content: "\E034"; }

.ic-icon-tobacco:before {
  content: "\E035"; }

.ic-icon-ticket-filled:before {
  content: "\E036"; }

.ic-icon-bag:before {
  content: "\E037"; }

.ic-icon-bag-filled:before {
  content: "\E038"; }

.ic-icon-share-android-2:before {
  content: "\E039"; }

.ic-icon-share-android-2-filled:before {
  content: "\E03A"; }

.ic-icon-check:before {
  content: "\E03B"; }

.ic-icon-check-bold:before {
  content: "\E03C"; }

.ic-icon-phone-filled:before {
  content: "\E03D"; }

.ic-icon-no-filled:before {
  content: "\E03F"; }

.ic-icon-no:before {
  content: "\E040"; }

.ic-icon-message:before {
  content: "\E041"; }

.ic-icon-bell-filled:before {
  content: "\E047"; }

.ic-icon-alcohol-filled:before {
  content: "\E049"; }

.ic-icon-arrow-enter:before {
  content: "\E04A"; }

.ic-icon-arrow-left:before {
  content: "\E04B"; }

.ic-icon-clock-filled:before {
  content: "\E04C"; }

.ic-icon-info-filled:before {
  content: "\E052"; }

.ic-icon-help-filled:before {
  content: "\E053"; }

.ic-icon-guaranteed-fresh-filled:before {
  content: "\E054"; }

.ic-icon-guaranteed-fresh:before {
  content: "\E055"; }

.ic-icon-loyalty-card-filled:before {
  content: "\E056"; }

.ic-icon-minus:before {
  content: "\E057"; }

.ic-icon-minus-bold:before {
  content: "\E058"; }

.ic-icon-more-filled:before {
  content: "\E059"; }

.ic-icon-organic:before {
  content: "\E05A"; }

.ic-icon-organic-filled:before {
  content: "\E05B"; }

.ic-icon-tip-filled:before {
  content: "\E05D"; }

.ic-icon-note:before {
  content: "\E060"; }

.ic-icon-faq:before {
  content: "\E031"; }

.ic-icon-note-filled:before {
  content: "\E061"; }

.ic-icon-office:before {
  content: "\E062"; }

.ic-icon-office-filled:before {
  content: "\E063"; }

.ic-icon-order-problem:before {
  content: "\E064"; }

.ic-icon-phone-android:before {
  content: "\E065"; }

.ic-icon-phone-android-filled:before {
  content: "\E066"; }

.ic-icon-replace:before {
  content: "\E067"; }

.ic-icon-specials-filled:before {
  content: "\E068"; }

.ic-icon-specials:before {
  content: "\E069"; }

.ic-icon-phone-iphone-filled:before {
  content: "\E06A"; }

.ic-icon-phone-iphone:before {
  content: "\E06B"; }

.ic-icon-replace-bold:before {
  content: "\E06C"; }

.ic-icon-x-circle:before {
  content: "\E06D"; }

.ic-icon-x-circle-filled:before {
  content: "\E06E"; }

.ic-icon-order-review:before {
  content: "\E071"; }

.ic-icon-popular:before {
  content: "\E072"; }

.ic-icon-scissors:before {
  content: "\E074"; }

.ic-icon-store-filled:before {
  content: "\E075"; }

.ic-icon-filter-android:before {
  content: "\E076"; }

.ic-icon-filter:before {
  content: "\E077"; }

.ic-icon-filter-filled:before {
  content: "\E078"; }

.ic-icon-in-season:before {
  content: "\E070"; }

.ic-icon-in-season-filled:before {
  content: "\E079"; }

.ic-icon-x-bold:before {
  content: "\E07A"; }

.ic-icon-lightbulb-android:before {
  content: "\E07D"; }

.ic-icon-lightbulb-filled:before {
  content: "\E07E"; }

.ic-icon-lists-and-recipes-filled:before {
  content: "\E07F"; }

.ic-icon-like:before {
  content: "\E080"; }

.ic-icon-like-filled:before {
  content: "\E081"; }

.ic-icon-view:before {
  content: "\E082"; }

.ic-icon-view-filled:before {
  content: "\E083"; }

.ic-icon-lightbulb:before {
  content: "\E07C"; }

.ic-icon-pricing-same-filled:before {
  content: "\E020"; }

.ic-icon-message-filled:before {
  content: "\E042"; }

.ic-icon-refund:before {
  content: "\E085"; }

.ic-icon-plus:before {
  content: "\E02A"; }

.ic-icon-arrow-up-small-bold:before {
  content: "\E00D"; }

.ic-icon-account-filled:before {
  content: "\E044"; }

.ic-icon-phone:before {
  content: "\E03E"; }

.ic-icon-request:before {
  content: "\E086"; }

.ic-icon-adjustment:before {
  content: "\E087"; }

.ic-icon-check-progress-complete:before {
  content: "\E088"; }

.ic-icon-check-progress-dashed:before {
  content: "\E089"; }

.ic-icon-google:before {
  content: "\E04F"; }

.ic-icon-google-filled:before {
  content: "\E050"; }

.ic-icon-grid:before {
  content: "\E08A"; }

.ic-icon-grid-filled:before {
  content: "\E08B"; }

.ic-icon-home-filled:before {
  content: "\E05F"; }

.ic-icon-icon-exit:before {
  content: "\E08D"; }

.ic-icon-icon-person:before {
  content: "\E08E"; }

.ic-icon-icon-person-add:before {
  content: "\E08F"; }

.ic-icon-icon-person-add-filled:before {
  content: "\E090"; }

.ic-icon-icon-person-filled:before {
  content: "\E091"; }

.ic-icon-home:before {
  content: "\E022"; }

.ic-icon-hamburger:before {
  content: "\E02E"; }

.ic-icon-account:before {
  content: "\E043"; }

.ic-icon-add-to-order-android:before {
  content: "\E092"; }

.ic-icon-add-to-order-filled:before {
  content: "\E093"; }

.ic-icon-thumbs-up:before {
  content: "\E095"; }

.ic-icon-thumbs-down:before {
  content: "\E096"; }

.ic-icon-add-to-order:before {
  content: "\E094"; }

.ic-icon-instagram:before {
  content: "\E073"; }

.ic-icon-bogo:before {
  content: "\E02C"; }

.ic-icon-bogo-filled:before {
  content: "\E097"; }

.ic-icon-weight:before {
  content: "\E09A"; }

.ic-icon-browse:before {
  content: "\E09B"; }

.ic-icon-sort:before {
  content: "\E09D"; }

.ic-icon-location-marker-filled:before {
  content: "\E051"; }

.ic-icon-reaction-add:before {
  content: "\E0A0"; }

.ic-icon-browse-filled:before {
  content: "\E00C"; }

.ic-icon-calendar:before {
  content: "\E015"; }

.ic-icon-car:before {
  content: "\E019"; }

.ic-icon-car-filled:before {
  content: "\E01C"; }

.ic-icon-cart:before {
  content: "\E023"; }

.ic-icon-cart-filled:before {
  content: "\E02D"; }

.ic-icon-compass-filled:before {
  content: "\E046"; }

.ic-icon-credit-card:before {
  content: "\E048"; }

.ic-icon-credit-card-filled:before {
  content: "\E04D"; }

.ic-icon-deals:before {
  content: "\E04E"; }

.ic-icon-deals-filled:before {
  content: "\E05E"; }

.ic-icon-deals-icon:before {
  content: "\E07B"; }

.ic-icon-email:before {
  content: "\E084"; }

.ic-icon-flag:before {
  content: "\E08C"; }

.ic-icon-flag-filled:before {
  content: "\E098"; }

.ic-icon-gear:before {
  content: "\E099"; }

.ic-icon-gear-filled:before {
  content: "\E09C"; }

.ic-icon-gift:before {
  content: "\E09E"; }

.ic-icon-giftcard:before {
  content: "\E09F"; }

.ic-icon-giftcard-filled:before {
  content: "\E0A1"; }

.ic-icon-trash:before {
  content: "\E0A4"; }

.ic-icon-trash-filled:before {
  content: "\E0A5"; }

.ic-icon-quick-add:before {
  content: "\E0A6"; }

.ic-icon-pricing:before {
  content: "\E01D"; }

.ic-icon-categories:before {
  content: "\E0A9"; }

.ic-icon-pinterest-filled:before {
  content: "\E05C"; }

.ic-icon-items:before {
  content: "\E0A2"; }

.ic-icon-items-filled:before {
  content: "\E06F"; }

.ic-icon-items-youve-ordered:before {
  content: "\E0A3"; }

.ic-icon-lists-add:before {
  content: "\E045"; }

.ic-icon-reccuring:before {
  content: "\E0A7"; }

.ic-icon-save:before {
  content: "\E0A8"; }

.ic-icon-save-filled:before {
  content: "\E0AA"; }

.label {
  color: #fff;
  border-top-right-radius: 0.25em;
  border-top-left-radius: 0.25em;
  border-bottom-right-radius: 0.25em;
  border-bottom-left-radius: 0.25em;
  display: inline;
  font-size: 75%;
  font-weight: 500;
  line-height: 1;
  padding: .2em .6em .3em;
  text-align: center;
  text-shadow: none;
  vertical-align: baseline;
  white-space: nowrap; }
  .label:empty {
    display: none; }
  .btn .label {
    position: relative;
    top: -1px; }
  .label.label-pill {
    border-top-right-radius: 16px;
    border-top-left-radius: 16px;
    border-bottom-right-radius: 16px;
    border-bottom-left-radius: 16px;
    padding: 5px 10px; }

a.label:hover, a.label:focus {
  color: #fff;
  text-decoration: none;
  cursor: pointer; }

.label-default {
  background-color: #b0b0b0; }
  .label-default[href]:hover, .label-default[href]:focus {
    background-color: #979797; }

.label-primary {
  background-color: #FF5600; }
  .label-primary[href]:hover, .label-primary[href]:focus {
    background-color: #cc4500; }

.label-success {
  background-color: #43B02A; }
  .label-success[href]:hover, .label-success[href]:focus {
    background-color: #338720; }

.label-info {
  background-color: #5bc0de; }
  .label-info[href]:hover, .label-info[href]:focus {
    background-color: #31b0d5; }

.label-warning {
  background-color: #f0ad4e; }
  .label-warning[href]:hover, .label-warning[href]:focus {
    background-color: #ec971f; }

.label-danger {
  background-color: #FF5600; }
  .label-danger[href]:hover, .label-danger[href]:focus {
    background-color: #cc4500; }

.hero {
  text-align: center;
  text-rendering: optimizeLegibility; }

.hero-inner {
  max-width: 600px;
  min-height: 200px;
  margin: 0px auto;
  padding-bottom: 50px; }

.hero--static {
  color: #fff;
  background-color: #43B02A;
  margin-top: 56px; }
  @media (max-width: 850px) {
    .hero--static {
      margin-top: 100px; } }

.hero-title {
  font-size: 48px;
  font-weight: bold;
  margin-bottom: 15px; }

.spinner {
  margin: 6em auto;
  font-size: 10px;
  position: relative;
  text-indent: -9999em;
  border-top: 1.1em solid rgba(255, 255, 255, 0.2);
  border-right: 1.1em solid rgba(255, 255, 255, 0.2);
  border-bottom: 1.1em solid rgba(255, 255, 255, 0.2);
  border-left: 1.1em solid #ffffff;
  -webkit-transform: translateZ(0);
  -ms-transform: translateZ(0);
  transform: translateZ(0);
  -webkit-animation: load8 1.1s infinite linear;
  animation: load8 1.1s infinite linear; }

.spinner,
.spinner:after {
  border-radius: 50%;
  width: 10em;
  height: 10em; }

@-webkit-keyframes load8 {
  0% {
    -webkit-transform: rotate(0deg);
    transform: rotate(0deg); }
  100% {
    -webkit-transform: rotate(360deg);
    transform: rotate(360deg); } }

@keyframes load8 {
  0% {
    -webkit-transform: rotate(0deg);
    transform: rotate(0deg); }
  100% {
    -webkit-transform: rotate(360deg);
    transform: rotate(360deg); } }

.ic-loading {
  width: 100%;
  background: transparent; }
  .ic-loading *,
  .ic-loading *:before,
  .ic-loading *:after {
    -webkit-box-sizing: content-box !important;
    -moz-box-sizing: content-box !important;
    box-sizing: content-box !important; }
  .ic-loading .ic-spinner {
    height: 20px;
    width: 20px;
    margin: 0 auto;
    position: relative;
    -webkit-animation: rotation .6s infinite linear;
    -moz-animation: rotation .6s infinite linear;
    -o-animation: rotation .6s infinite linear;
    animation: rotation .6s infinite linear;
    border: 3px solid rgba(163, 163, 163, 0.3);
    border-radius: 100%; }
  .ic-loading .ic-spinner:before {
    content: "";
    display: block;
    position: absolute;
    left: -3px;
    top: -3px;
    height: 100%;
    width: 100%;
    border-top: 3px solid rgba(186, 186, 186, 0.8);
    border-left: 3px solid transparent;
    border-bottom: 3px solid transparent;
    border-right: 3px solid transparent;
    border-radius: 100%; }

@-webkit-keyframes rotation {
  from {
    -webkit-transform: rotate(0deg); }
  to {
    -webkit-transform: rotate(359deg); } }

@-moz-keyframes rotation {
  from {
    -moz-transform: rotate(0deg); }
  to {
    -moz-transform: rotate(359deg); } }

@-o-keyframes rotation {
  from {
    -o-transform: rotate(0deg); }
  to {
    -o-transform: rotate(359deg); } }

@keyframes rotation {
  from {
    transform: rotate(0deg); }
  to {
    transform: rotate(359deg); } }

.topbar,
.Topbar {
  z-index: 500;
  background-color: #43B02A;
  position: fixed;
  top: 0;
  left: 0;
  right: 0;
  border-bottom: 1px solid #68BF54; }

.topbar-inner,
.Topbar-inner {
  height: 56px; }

.Topbar--inverted {
  background-color: #fff;
  border-bottom: 1px solid #E3E2DE; }

.topbar--static {
  color: #b0e9a3;
  line-height: 56px; }
  @media (max-width: 850px) {
    .topbar--static {
      border-bottom: 1px solid #01abb3; } }

.topbar--static .logo {
  position: absolute;
  height: 56px;
  text-align: center;
  width: 100%; }

.topbar--static .logo a {
  display: inline-block;
  background-image: asset-url("beetstrap/brand/instacart-logo-white@2x.png");
  background-size: 149px 30px;
  background-repeat: no-repeat;
  background-position: center;
  height: 56px;
  width: 149px;
  margin: 0px;
  opacity: 0.95;
  z-index: 100; }
  .topbar--static .logo a:hover {
    opacity: 1; }

.topbar--static .links {
  position: relative;
  z-index: 200; }
  @media (max-width: 850px) {
    .topbar--static .links {
      display: block;
      float: none;
      background-color: #01939A;
      top: 56px;
      text-align: center;
      height: 44px;
      line-height: 44px;
      border-top: 1px solid #68BF54; } }

.topbar--static ul {
  margin: 0;
  padding: 0; }

.topbar--static ul.right > li {
  float: right; }

.topbar--static ul li {
  display: block;
  float: left;
  list-style: none;
  position: relative; }
  @media (max-width: 850px) {
    .topbar--static ul li {
      display: inline;
      float: none; } }

.topbar--static ul li.has-button {
  line-height: 52px; }

.topbar--static .left li a {
  color: #fff;
  font-size: 16px;
  font-weight: 400;
  line-height: 20px;
  opacity: 0.8;
  padding: 18px 6px;
  text-decoration: none; }
  .topbar--static .left li a:hover {
    opacity: 1; }
  .topbar--static .left li a:focus {
    box-shadow: none; }

.topbar--static li a.ic-button {
  color: #01939A;
  background-color: #fff;
  line-height: 0px; }

.topbar--static .left {
  float: left;
  padding-left: 10px; }
  @media (max-width: 850px) {
    .topbar--static .left {
      float: none; } }

.topbar--static .right {
  float: right;
  padding-right: 10px; }

@-webkit-keyframes fadeIn {
  0% {
    opacity: 0; }
  60% {
    opacity: 1; } }

@-moz-keyframes fadeIn {
  0% {
    opacity: 0; }
  60% {
    opacity: 1; } }

@keyframes fadeIn {
  0% {
    opacity: 0; }
  60% {
    opacity: 1; } }

@-webkit-keyframes fadeInUp {
  0% {
    opacity: 0;
    -webkit-transform: translate3d(0, 100%, 0); }
  100% {
    opacity: 1;
    -webkit-transform: translate3d(none); } }

@-moz-keyframes fadeInUp {
  0% {
    opacity: 0;
    -moz-transform: translate3d(0, 100%, 0); }
  100% {
    opacity: 1;
    -moz-transform: translate3d(none); } }

@keyframes fadeInUp {
  0% {
    opacity: 0;
    -webkit-transform: translate3d(0, 100%, 0);
    -moz-transform: translate3d(0, 100%, 0);
    -ms-transform: translate3d(0, 100%, 0);
    -o-transform: translate3d(0, 100%, 0);
    transform: translate3d(0, 100%, 0); }
  100% {
    opacity: 1;
    -webkit-transform: translate3d(none);
    -moz-transform: translate3d(none);
    -ms-transform: translate3d(none);
    -o-transform: translate3d(none);
    transform: translate3d(none); } }

@-webkit-keyframes fadeOutDown {
  0% {
    opacity: 1;
    -webkit-transform: translate3d(none); }
  100% {
    opacity: 0;
    -webkit-transform: translate3d(0, 200%, 0); } }

@-moz-keyframes fadeOutDown {
  0% {
    opacity: 1;
    -moz-transform: translate3d(none); }
  100% {
    opacity: 0;
    -moz-transform: translate3d(0, 200%, 0); } }

@keyframes fadeOutDown {
  0% {
    opacity: 1;
    -webkit-transform: translate3d(none);
    -moz-transform: translate3d(none);
    -ms-transform: translate3d(none);
    -o-transform: translate3d(none);
    transform: translate3d(none); }
  100% {
    opacity: 0;
    -webkit-transform: translate3d(0, 200%, 0);
    -moz-transform: translate3d(0, 200%, 0);
    -ms-transform: translate3d(0, 200%, 0);
    -o-transform: translate3d(0, 200%, 0);
    transform: translate3d(0, 200%, 0); } }

@-webkit-keyframes shakeHorizontal {
  0% {
    -webkit-transform: translate(0px, 0px) rotate(0deg); }
  20% {
    -webkit-transform: translate(-6px, 0px) rotate(0deg); }
  40% {
    -webkit-transform: translate(4px, 0px) rotate(0deg); }
  60% {
    -webkit-transform: translate(-2px, 0px) rotate(0deg); }
  80% {
    -webkit-transform: translate(1px, 0px) rotate(0deg); }
  100% {
    -webkit-transform: translate(0px, 0px) rotate(0deg); } }

@-moz-keyframes shakeHorizontal {
  0% {
    -moz-transform: translate(0px, 0px) rotate(0deg); }
  20% {
    -moz-transform: translate(-6px, 0px) rotate(0deg); }
  40% {
    -moz-transform: translate(4px, 0px) rotate(0deg); }
  60% {
    -moz-transform: translate(-2px, 0px) rotate(0deg); }
  80% {
    -moz-transform: translate(1px, 0px) rotate(0deg); }
  100% {
    -moz-transform: translate(0px, 0px) rotate(0deg); } }

@keyframes shakeHorizontal {
  0% {
    -webkit-transform: translate(0px, 0px) rotate(0deg);
    -moz-transform: translate(0px, 0px) rotate(0deg);
    -ms-transform: translate(0px, 0px) rotate(0deg);
    -o-transform: translate(0px, 0px) rotate(0deg);
    transform: translate(0px, 0px) rotate(0deg); }
  20% {
    -webkit-transform: translate(-6px, 0px) rotate(0deg);
    -moz-transform: translate(-6px, 0px) rotate(0deg);
    -ms-transform: translate(-6px, 0px) rotate(0deg);
    -o-transform: translate(-6px, 0px) rotate(0deg);
    transform: translate(-6px, 0px) rotate(0deg); }
  40% {
    -webkit-transform: translate(4px, 0px) rotate(0deg);
    -moz-transform: translate(4px, 0px) rotate(0deg);
    -ms-transform: translate(4px, 0px) rotate(0deg);
    -o-transform: translate(4px, 0px) rotate(0deg);
    transform: translate(4px, 0px) rotate(0deg); }
  60% {
    -webkit-transform: translate(-2px, 0px) rotate(0deg);
    -moz-transform: translate(-2px, 0px) rotate(0deg);
    -ms-transform: translate(-2px, 0px) rotate(0deg);
    -o-transform: translate(-2px, 0px) rotate(0deg);
    transform: translate(-2px, 0px) rotate(0deg); }
  80% {
    -webkit-transform: translate(1px, 0px) rotate(0deg);
    -moz-transform: translate(1px, 0px) rotate(0deg);
    -ms-transform: translate(1px, 0px) rotate(0deg);
    -o-transform: translate(1px, 0px) rotate(0deg);
    transform: translate(1px, 0px) rotate(0deg); }
  100% {
    -webkit-transform: translate(0px, 0px) rotate(0deg);
    -moz-transform: translate(0px, 0px) rotate(0deg);
    -ms-transform: translate(0px, 0px) rotate(0deg);
    -o-transform: translate(0px, 0px) rotate(0deg);
    transform: translate(0px, 0px) rotate(0deg); } }

@-webkit-keyframes appDownloadSlideUpBounce {
  0% {
    -webkit-transform: translateY(180%); }
  60% {
    -webkit-transform: translateY(-8%); }
  70% {
    -webkit-transform: translateY(4%); }
  80% {
    -webkit-transform: translateY(-4%); }
  95% {
    -webkit-transform: translateY(2%); }
  100% {
    -webkit-transform: translateY(0%); } }

@-moz-keyframes appDownloadSlideUpBounce {
  0% {
    -moz-transform: translateY(180%); }
  60% {
    -moz-transform: translateY(-8%); }
  70% {
    -moz-transform: translateY(4%); }
  80% {
    -moz-transform: translateY(-4%); }
  95% {
    -moz-transform: translateY(2%); }
  100% {
    -moz-transform: translateY(0%); } }

@keyframes appDownloadSlideUpBounce {
  0% {
    -webkit-transform: translateY(180%);
    -moz-transform: translateY(180%);
    -ms-transform: translateY(180%);
    -o-transform: translateY(180%);
    transform: translateY(180%); }
  60% {
    -webkit-transform: translateY(-8%);
    -moz-transform: translateY(-8%);
    -ms-transform: translateY(-8%);
    -o-transform: translateY(-8%);
    transform: translateY(-8%); }
  70% {
    -webkit-transform: translateY(4%);
    -moz-transform: translateY(4%);
    -ms-transform: translateY(4%);
    -o-transform: translateY(4%);
    transform: translateY(4%); }
  80% {
    -webkit-transform: translateY(-4%);
    -moz-transform: translateY(-4%);
    -ms-transform: translateY(-4%);
    -o-transform: translateY(-4%);
    transform: translateY(-4%); }
  95% {
    -webkit-transform: translateY(2%);
    -moz-transform: translateY(2%);
    -ms-transform: translateY(2%);
    -o-transform: translateY(2%);
    transform: translateY(2%); }
  100% {
    -webkit-transform: translateY(0%);
    -moz-transform: translateY(0%);
    -ms-transform: translateY(0%);
    -o-transform: translateY(0%);
    transform: translateY(0%); } }

@-webkit-keyframes appDownloadSlideUp {
  0% {
    -webkit-transform: translateY(150%); }
  67% {
    -webkit-transform: translateY(150%); }
  100% {
    -webkit-transform: translateY(0%); } }

@-moz-keyframes appDownloadSlideUp {
  0% {
    -moz-transform: translateY(150%); }
  67% {
    -moz-transform: translateY(150%); }
  100% {
    -moz-transform: translateY(0%); } }

@keyframes appDownloadSlideUp {
  0% {
    -webkit-transform: translateY(150%);
    -moz-transform: translateY(150%);
    -ms-transform: translateY(150%);
    -o-transform: translateY(150%);
    transform: translateY(150%); }
  67% {
    -webkit-transform: translateY(150%);
    -moz-transform: translateY(150%);
    -ms-transform: translateY(150%);
    -o-transform: translateY(150%);
    transform: translateY(150%); }
  100% {
    -webkit-transform: translateY(0%);
    -moz-transform: translateY(0%);
    -ms-transform: translateY(0%);
    -o-transform: translateY(0%);
    transform: translateY(0%); } }

.btn {
  border: 0;
  -webkit-font-smoothing: antialiased;
  font-weight: 700;
  color: #1f1f1f;
  padding-bottom: 7px;
  background-color: #e5edec;
  -moz-border-radius-topleft: 4px !important;
  -moz-border-radius-topright: 4px !important;
  -moz-border-radius-bottomright: 4px !important;
  -moz-border-radius-bottomleft: 4px !important;
  -webkit-border-top-left-radius: 4px !important;
  -webkit-border-top-right-radius: 4px !important;
  -webkit-border-bottom-right-radius: 4px !important;
  -webkit-border-bottom-left-radius: 4px !important;
  border-top-left-radius: 4px !important;
  border-top-right-radius: 4px !important;
  border-bottom-right-radius: 4px !important;
  border-bottom-left-radius: 4px !important;
  background-color: none !important;
  background-repeat: no-repeat;
  background-image: none;
  filter: progid:DXImageTransform.Microsoft.Gradient(enabled = false);
  -ms-filter: progid:DXImageTransform.Microsoft.Gradient(enabled = false);
  -moz-box-shadow: none;
  -webkit-box-shadow: none;
  box-shadow: none;
  text-shadow: none;
  font-size: 13px;
  outline: none; }
  .btn:focus {
    outline: none; }
  .btn:hover:not(.disabled):not([disabled]) {
    background-color: #d7e3e2 !important;
    outline: none; }
  .btn:active:not(.disabled):not([disabled]), .btn.active:not(.disabled):not([disabled]) {
    padding-bottom: 7px;
    margin-top: 0;
    margin-bottom: -1px;
    background-color: #c0d3d1 !important;
    outline: none; }
  .btn.btn-large {
    -webkit-font-smoothing: antialiased;
    color: #1f1f1f;
    font-weight: 700;
    padding-bottom: 11px;
    font-size: 15px; }
    .btn.btn-large:active:not(.disabled):not([disabled]), .btn.btn-large.active:not(.disabled):not([disabled]) {
      padding-bottom: 12px;
      margin-top: 0;
      margin-bottom: 0; }
  .btn.btn-mini {
    -webkit-font-smoothing: antialiased;
    font-weight: 400;
    color: #1f1f1f;
    font-weight: 700;
    padding-bottom: 2px;
    font-size: 10px; }
    .btn.btn-mini:active:not(.disabled):not([disabled]), .btn.btn-mini.active:not(.disabled):not([disabled]) {
      padding-bottom: 2px;
      margin-top: -1px; }
  .btn.btn-primary {
    color: #ffffff;
    background-color: #438ead; }
    .btn.btn-primary:hover:not(.disabled):not([disabled]) {
      background-color: #407f99; }
    .btn.btn-primary:active:not(.disabled):not([disabled]), .btn.btn-primary.active:not(.disabled):not([disabled]) {
      background-color: #3a7188; }
  .btn.btn-success {
    color: #ffffff !important;
    background-color: #43B02A !important; }
    .btn.btn-success:hover:not(.disabled):not([disabled]) {
      background-color: #43B02A !important; }
    .btn.btn-success:active:not(.disabled):not([disabled]), .btn.btn-success.active:not(.disabled):not([disabled]) {
      background-color: #487943 !important; }
  .btn.btn-subtle {
    color: #939291;
    border: 2px solid #f0efec;
    background-color: rgba(255, 255, 255, 0) !important; }
    .btn.btn-subtle:hover:not(.disabled):not([disabled]) {
      border-color: #e3e2df;
      background-color: rgba(255, 255, 255, 0) !important; }
    .btn.btn-subtle:active:not(.disabled):not([disabled]), .btn.btn-subtle.active:not(.disabled):not([disabled]) {
      border-color: #bfbebb;
      background-color: rgba(255, 255, 255, 0) !important;
      -moz-box-shadow: none;
      -webkit-box-shadow: none;
      box-shadow: none; }
  .btn.btn.btn-twitter {
    background-color: #68BFEB !important;
    background-repeat: no-repeat;
    background-image: none;
    filter: progid:DXImageTransform.Microsoft.Gradient(enabled = false);
    -ms-filter: progid:DXImageTransform.Microsoft.Gradient(enabled = false);
    color: white; }
    .btn.btn.btn-twitter:hover {
      background-color: #95d2f1 !important;
      background-repeat: no-repeat;
      background-image: none;
      filter: progid:DXImageTransform.Microsoft.Gradient(enabled = false);
      -ms-filter: progid:DXImageTransform.Microsoft.Gradient(enabled = false); }
  .btn.btn.btn-facebook {
    background-color: #4C66A4 !important;
    background-repeat: no-repeat;
    background-image: none;
    filter: progid:DXImageTransform.Microsoft.Gradient(enabled = false);
    -ms-filter: progid:DXImageTransform.Microsoft.Gradient(enabled = false);
    color: white; }
    .btn.btn.btn-facebook:hover {
      background-color: #6981ba !important;
      background-repeat: no-repeat;
      background-image: none;
      filter: progid:DXImageTransform.Microsoft.Gradient(enabled = false);
      -ms-filter: progid:DXImageTransform.Microsoft.Gradient(enabled = false); }

.btn-hollow {
  -moz-border-radius-topleft: 4px !important;
  -moz-border-radius-topright: 4px !important;
  -moz-border-radius-bottomright: 4px !important;
  -moz-border-radius-bottomleft: 4px !important;
  -webkit-border-top-left-radius: 4px !important;
  -webkit-border-top-right-radius: 4px !important;
  -webkit-border-bottom-right-radius: 4px !important;
  -webkit-border-bottom-left-radius: 4px !important;
  border-top-left-radius: 4px !important;
  border-top-right-radius: 4px !important;
  border-bottom-right-radius: 4px !important;
  border-bottom-left-radius: 4px !important;
  -webkit-font-smoothing: antialiased;
  padding-bottom: 7px;
  -moz-box-shadow: none;
  -webkit-box-shadow: none;
  box-shadow: none;
  text-shadow: none;
  font-size: 13px;
  line-height: 20px;
  outline: none;
  text-decoration: none;
  color: #438ead;
  border: 1px solid #438ead;
  padding: 12px 24px;
  font-weight: 600;
  letter-spacing: 1px;
  text-align: center;
  cursor: pointer;
  background: none;
  white-space: nowrap;
  text-wrap: none;
  background-color: transparent;
  -webkit-box-sizing: border-box;
  -moz-box-sizing: border-box;
  box-sizing: border-box; }
  .btn-hollow.hide {
    display: none; }
  .btn-hollow.disabled, .btn-hollow [disabled] {
    opacity: 0.6; }
    .btn-hollow.disabled:hover, .btn-hollow [disabled]:hover {
      cursor: default; }
  .btn-hollow:hover, .btn-hollow:active {
    text-decoration: none; }
  .btn-hollow:hover:not(.disabled):not([disabled]) {
    color: #357088;
    border-color: #357088;
    text-decoration: none;
    outline: none;
    -webkit-transition: all, 0.2s, ease-in-out;
    -o-transition: all, 0.2s, ease-in-out;
    transition: all, 0.2s, ease-in-out; }
  .btn-hollow:active:not(.disabled):not([disabled]), .btn-hollow.active:not(.disabled):not([disabled]) {
    background-color: #438ead;
    color: #fff;
    text-decoration: none;
    outline: none; }
  .btn-hollow.btn-white {
    color: #fff;
    border: 1px solid #fff;
    background: none !important;
    background-color: transparent !important; }
    .btn-hollow.btn-white:hover:not(.disabled):not([disabled]) {
      color: #e6e6e6;
      border-color: #e6e6e6;
      background: none !important;
      background-color: transparent !important; }
    .btn-hollow.btn-white:active:not(.disabled):not([disabled]), .btn-hollow.btn-white.active:not(.disabled):not([disabled]) {
      background-color: #fff !important;
      border-color: #fff !important;
      color: #000; }
  .btn-hollow.btn-mini {
    font-weight: 300;
    padding: 6px 22px;
    font-size: 10px;
    line-height: 11px; }
  .btn-hollow.btn-small {
    font-weight: 300;
    padding: 8px 28px;
    font-size: 11px;
    line-height: 12px; }
  .btn-hollow.btn-large {
    font-weight: 700;
    padding: 16px 30px;
    font-size: 15px;
    border-width: 2px; }
  .btn-hollow.btn-xl {
    font-weight: 700;
    padding: 20px 34px;
    font-size: 18px;
    border-width: 2px; }

.u-overflowHidden {
  overflow: hidden !important; }

.u-listInline li {
  display: inline; }

.u-textTruncate {
  text-overflow: ellipsis;
  overflow: hidden;
  white-space: nowrap; }

.u-textCenter {
  text-align: center; }

.u-verticalCenter {
  display: table;
  height: 100%;
  width: 100%; }

.u-vcCell {
  display: table-cell;
  vertical-align: middle; }

.u-prepend-1 {
  margin-top: 10px; }

.u-prepend-2 {
  margin-top: 20px; }

.u-prepend-3 {
  margin-top: 30px; }

.u-prepend-4 {
  margin-top: 40px; }

.u-prepend-5 {
  margin-top: 50px; }

.u-prepend-6 {
  margin-top: 60px; }

.u-prepend-7 {
  margin-top: 70px; }

.u-prepend-8 {
  margin-top: 80px; }

.u-prepend-9 {
  margin-top: 90px; }

.u-prepend-10 {
  margin-top: 100px; }

.u-append-1 {
  margin-bottom: 10px; }

.u-append-2 {
  margin-bottom: 20px; }

.u-append-3 {
  margin-bottom: 30px; }

.u-append-4 {
  margin-bottom: 40px; }

.u-append-5 {
  margin-bottom: 50px; }

.u-append-6 {
  margin-bottom: 60px; }

.u-append-7 {
  margin-bottom: 70px; }

.u-append-8 {
  margin-bottom: 80px; }

.u-append-9 {
  margin-bottom: 90px; }

.u-append-10 {
  margin-bottom: 100px; }

.u-cursorPointer, .cursor-pointer {
  cursor: pointer; }

.centered {
  text-align: center; }

.absolute-center {
  position: absolute;
  top: 0;
  bottom: 0;
  left: 0;
  right: 0;
  margin: auto;
  display: block; }

.table-no-border {
  border: 0; }

.table-no-border td,
.table-no-border th {
  border: 0; }

.ic-text-truncate {
  text-overflow: ellipsis;
  white-space: nowrap;
  overflow: hidden;
  max-width: 100%; }

.ic-horizontal-rule-text,
p.ic-horizontal-rule-text,
.ic-fresh p.ic-horizontal-rule-text {
  color: #43B02A;
  overflow: hidden;
  text-align: center;
  padding: 0 0px;
  margin: 20px 0;
  font-size: 20px;
  font-weight: 300; }
  .ic-horizontal-rule-text:before, .ic-horizontal-rule-text:after,
  p.ic-horizontal-rule-text:before,
  p.ic-horizontal-rule-text:after,
  .ic-fresh p.ic-horizontal-rule-text:before,
  .ic-fresh p.ic-horizontal-rule-text:after {
    background-color: #43B02A;
    content: "";
    display: inline-block;
    height: 1px;
    position: relative;
    vertical-align: middle;
    width: 50%; }
  .ic-horizontal-rule-text:before,
  p.ic-horizontal-rule-text:before,
  .ic-fresh p.ic-horizontal-rule-text:before {
    right: 1.2em;
    margin-left: -50%; }
  .ic-horizontal-rule-text:after,
  p.ic-horizontal-rule-text:after,
  .ic-fresh p.ic-horizontal-rule-text:after {
    left: 1.2em;
    margin-right: -50%; }

.background-white {
  background-color: #ffffff; }

.color-white {
  color: #ffffff; }

.background-black {
  background-color: #393939; }

.color-black {
  color: #393939; }

.background-black-lighter {
  background-color: #5f5f5f; }

.color-black-lighter {
  color: #5f5f5f; }

.background-gray-dark {
  background-color: #6c6c6c; }

.color-gray-dark {
  color: #6c6c6c; }

.background-gray {
  background-color: #8e8e8e; }

.color-gray {
  color: #8e8e8e; }

.background-gray-light {
  background-color: #b0b0b0; }

.color-gray-light {
  color: #b0b0b0; }

.background-gray-lighter {
  background-color: white; }

.color-gray-lighter {
  color: white; }

.background-max-light-gray {
  background-color: #e6e6e6; }

.color-max-light-gray {
  color: #e6e6e6; }

.background-green-light {
  background-color: #CBF1C4; }

.color-green-light {
  color: #CBF1C4; }

.background-green {
  background-color: #43B02A; }

.color-green {
  color: #43B02A; }

.background-green-dark {
  background-color: #487943; }

.color-green-dark {
  color: #487943; }

.background-pink {
  background-color: #E8104A; }

.color-pink {
  color: #E8104A; }

.background-grey-border {
  background-color: #F0EFEC; }

.color-grey-border {
  color: #F0EFEC; }

.ic-weight-100 {
  font-weight: 100; }

.ic-weight-500 {
  font-weight: 500; }

.ic-weight-600 {
  font-weight: 600; }

.ic-weight-700 {
  font-weight: 700; }

.ic-fresh h1, .ic-fresh h2, .ic-fresh h3, .ic-fresh h4, .ic-fresh h5, .ic-fresh p {
  color: #393939; }

.ic-fresh h1 {
  font-weight: 700;
  font-size: 36px; }

.ic-fresh h2 {
  font-size: 26px;
  font-weight: 700; }

.ic-fresh h3 {
  font-size: 16px;
  font-weight: 700;
  line-height: 22px; }

.ic-fresh h4 {
  color: #8e8e8e;
  font-size: 16px;
  font-weight: 500;
  letter-spacing: normal; }

.ic-fresh a:hover {
  text-decoration: none; }

.ic-fresh a.admin-action {
  color: #AB00E7;
  display: block;
  margin: 2px; }
  .ic-fresh a.admin-action:hover {
    color: #8500b4; }

.ic-fresh a.disabled {
  pointer-events: none; }

.ic-fresh a .ic-icon {
  display: inline-block; }

.ic-fresh a.link--orange {
  color: #FF5600; }

.ic-fresh a.link--green {
  color: #43B02A; }

.ic-fresh .ic-btn-link:hover, .ic-fresh .ic-btn-link:focus {
  text-decoration: none; }

.ic-fresh .hero {
  background-color: #fff;
  margin-left: -15px;
  margin-right: -15px;
  padding: 30px;
  text-align: center;
  border-bottom: 1px solid #F0EFEC; }
  .ic-fresh .hero a h1, .ic-fresh .hero h1 a {
    color: #393939; }
  .ic-fresh .hero .navigation-pills {
    margin-top: 10px;
    max-width: 100vw;
    margin-left: auto;
    margin-right: auto; }
    .ic-fresh .hero .navigation-pills :last-child {
      margin-right: 0px; }
  .ic-fresh .hero .navigation-active, .ic-fresh .hero .action-active {
    background-color: #43B02A;
    color: white;
    border-color: #43B02A; }
  .ic-fresh .hero .navigation-pill {
    margin-right: 6px;
    border-radius: 18px;
    margin-top: 10px; }
  @media (max-width: 767px) {
    .ic-fresh .hero {
      margin-left: 0;
      margin-right: 0; } }

.ic-fresh .ic-container {
  margin: 0px auto;
  padding-left: 8px;
  padding-right: 8px;
  width: 960px; }
  .ic-fresh .ic-container:before, .ic-fresh .ic-container:after {
    content: " ";
    display: table; }
  .ic-fresh .ic-container:after {
    clear: both; }

.ic-icon {
  position: relative;
  top: 2px; }

.icModalOverlay.ReactModal__Overlay {
  opacity: 0; }

.icModalOverlay.ReactModal__Overlay--after-open {
  opacity: 1;
  transition: opacity 200ms linear; }

.icModal.ReactModal__Content {
  opacity: 0;
  transition: opacity 200ms linear; }

.icModal.ReactModal__Content--after-open {
  opacity: 1; }

.icModalOverlay.ReactModal__Overlay--before-close {
  opacity: 0; }

.icModal.ReactModal__Content--before-close {
  opacity: 0; }

.icModalOverlay {
  position: fixed;
  top: 0;
  left: 0;
  right: 0;
  bottom: 0;
  background-color: rgba(0, 0, 0, 0.6);
  z-index: 1100; }

.icModalDialog {
  position: fixed;
  left: 0;
  right: 0;
  top: 0;
  bottom: 0;
  background-color: rgba(1, 1, 1, 0.6);
  z-index: 1040;
  overflow: auto; }
  .icModalDialog.clear-background {
    background-color: transparent; }
    @media (max-width: 767px) {
      .icModalDialog.clear-background {
        background-color: #FFF; } }
  @media (max-width: 767px) {
    .icModalDialog {
      background-color: #FFF; } }

.icModalContentContainer {
  padding: 30px; }
  .icModalContentContainer > .icModalContentContainer {
    padding-bottom: 0px; }
  @media (max-width: 991px) {
    .icModalContentContainer > .icModalContent {
      /* included here for specificty */
      width: 100vw; } }
  @media (max-width: 767px) {
    .icModalContentContainer > .icModalContent {
      /* included here for specificty */
      border: none;
      box-shadow: none;
      position: initial; } }

.icModalContent {
  position: relative;
  background-color: #fff;
  -webkit-background-clip: padding-box;
  background-clip: padding-box;
  border: 1px solid #999;
  border: 1px solid rgba(0, 0, 0, 0.2);
  border-radius: 6px;
  outline: 0;
  -webkit-box-shadow: 0 3px 9px rgba(0, 0, 0, 0.5);
  box-shadow: 0 3px 9px rgba(0, 0, 0, 0.5);
  margin: 0px auto;
  z-index: 1001;
  max-width: 100vw; }

.icModalClose {
  color: #fff;
  cursor: pointer;
  font-size: 20px;
  position: absolute;
  right: -35px;
  top: 3px; }
  .icModalClose button {
    background: none;
    border: none;
    font-size: 20px; }
  .icModalClose.dark {
    color: #000;
    right: 5px; }
  @media (max-width: 991px) {
    .icModalClose {
      color: #757575;
      top: 10px;
      right: 10px; } }

@media (max-width: 991px) {
  .CheckoutAddItemsModal .icModalClose {
    top: 18px;
    right: 0;
    left: 18px; } }

@media (max-width: 991px) {
  .StorefrontTrialOfferModal .icModalClose {
    color: #FFF; } }

.icModalHeader {
  border-top-right-radius: 4px;
  border-top-left-radius: 4px;
  padding: 30px; }

.icModalHeader,
.icModalHeader.icModalRow {
  border-top: none; }

.icModalBody {
  border-bottom-right-radius: 4px;
  border-bottom-left-radius: 4px;
  background-color: #fff; }

.icModalRow {
  border-top: 1px solid #F0EFEC;
  padding: 30px; }
  .icModalRow:before, .icModalRow:after {
    content: " ";
    display: table; }
  .icModalRow:after {
    clear: both; }
  .icModalRow .leftCol {
    float: left;
    margin: 0px auto;
    width: 380px; }
    @media (max-width: 767px) {
      .icModalRow .leftCol {
        width: auto; } }
  .icModalRow .rightCol {
    float: right;
    width: 380px;
    border-top-right-radius: 4px; }

.icModalDivider {
  border-bottom: 1px solid #F0EFEC; }

.itemModalFooter > .leftCol > div + div {
  border-top: 1px solid #F0EFEC; }

.icModalContent.loadingModal {
  width: 850px; }
  .icModalContent.loadingModal .ic-loading {
    padding: 30px 0px; }
  @media (max-width: 767px) {
    .icModalContent.loadingModal {
      width: 100vw; } }

.icModalContent.icModal-default .icModalHeader {
  padding: 25px;
  background-color: #e5edec;
  text-align: center; }

.icModalContent.icModal-xs {
  max-width: 380px; }
  .icModalContent.icModal-xs .header {
    margin-top: 0px;
    margin-bottom: 20px;
    text-align: center; }
  .icModalContent.icModal-xs .body {
    padding: 30px; }

.icModalContent.icModal-sm {
  width: 500px; }

@media (max-width: 520px) {
  .icModalContent.icModal-sm {
    width: 90%;
    margin: 0 5%; } }

.icModalContent.icModal-md {
  max-width: 700px; }

.icModalContent.icModal-default {
  max-width: 1200px; }

.icDropdown {
  position: relative; }

.icDropdown.is-open > .icDropdownItems {
  display: block; }

.icDropdownItems {
  -moz-border-radius-topleft: 4px !important;
  -moz-border-radius-topright: 4px !important;
  -moz-border-radius-bottomright: 4px !important;
  -moz-border-radius-bottomleft: 4px !important;
  -webkit-border-top-left-radius: 4px !important;
  -webkit-border-top-right-radius: 4px !important;
  -webkit-border-bottom-right-radius: 4px !important;
  -webkit-border-bottom-left-radius: 4px !important;
  border-top-left-radius: 4px !important;
  border-top-right-radius: 4px !important;
  border-bottom-right-radius: 4px !important;
  border-bottom-left-radius: 4px !important;
  background-color: #fff;
  box-shadow: 0px 3px 10px 0px rgba(0, 0, 0, 0.23), 0px 3px 10px 0px rgba(0, 0, 0, 0.16);
  display: none;
  left: 0;
  min-width: 160px;
  padding: 10px 0px;
  position: absolute;
  top: 100%;
  z-index: 200; }

.dropdown-action {
  color: #333; }

.icDropdownItem {
  cursor: pointer;
  padding: 8px;
  position: relative; }
  .icDropdownItem.is-selected {
    background-color: #01939A;
    color: #fff; }
    .icDropdownItem.is-selected:hover, .icDropdownItem.is-selected:focus {
      color: #fff; }
  .icDropdownItem:focus {
    outline: none;
    color: #01939A; }
  .icDropdownItem:hover {
    color: #01939A; }
  .icDropdownItem .ic-icon {
    float: right; }

.icDropdownItem.divider {
  background-color: #F0EFEC;
  cursor: auto;
  height: 1px;
  margin: 9px 0;
  overflow: hidden;
  padding: 0px; }
  .icDropdownItem.divider:hover {
    background-color: none;
    color: initial; }

.icModalRow .ic-btn + .ic-btn {
  margin-left: 5px; }

.icModalRow .ic-btn-group > .ic-btn + .ic-btn, .icModalRow .ic-btn-group-vertical > .ic-btn + .ic-btn {
  margin-left: 0px; }

@media (max-width: 1200px) {
  .icModalContentContainer {
    padding: 30px 0; } }

@media (max-width: 767px) {
  .icModalContentContainer {
    padding: 0; } }

.ic-panel {
  -moz-border-radius-topleft: 4px !important;
  -moz-border-radius-topright: 4px !important;
  -moz-border-radius-bottomright: 4px !important;
  -moz-border-radius-bottomleft: 4px !important;
  -webkit-border-top-left-radius: 4px !important;
  -webkit-border-top-right-radius: 4px !important;
  -webkit-border-bottom-right-radius: 4px !important;
  -webkit-border-bottom-left-radius: 4px !important;
  border-top-left-radius: 4px !important;
  border-top-right-radius: 4px !important;
  border-bottom-right-radius: 4px !important;
  border-bottom-left-radius: 4px !important;
  background-color: #fff;
  border: 1px solid #e5edec;
  margin: 0 auto; }

a.ic-pill {
  -moz-border-radius-topleft: 16px !important;
  -moz-border-radius-topright: 16px !important;
  -moz-border-radius-bottomright: 16px !important;
  -moz-border-radius-bottomleft: 16px !important;
  -webkit-border-top-left-radius: 16px !important;
  -webkit-border-top-right-radius: 16px !important;
  -webkit-border-bottom-right-radius: 16px !important;
  -webkit-border-bottom-left-radius: 16px !important;
  border-top-left-radius: 16px !important;
  border-top-right-radius: 16px !important;
  border-bottom-right-radius: 16px !important;
  border-bottom-left-radius: 16px !important;
  background-color: #fff;
  padding: 0px 14px;
  padding-left: 34px;
  margin: 0px 7px;
  font-size: 14px;
  position: relative;
  display: inline-block;
  height: 32px;
  line-height: 32px; }
  a.ic-pill.ic-pill--prices {
    color: #43B02A; }
    a.ic-pill.ic-pill--prices:hover {
      color: #2b721b; }
    a.ic-pill.ic-pill--prices.highest {
      color: #F7A700; }
      a.ic-pill.ic-pill--prices.highest:hover {
        color: #ab7300; }
  a.ic-pill:hover {
    background-color: #e6e6e6;
    color: #014a4e; }

.ic-pill-icon {
  background-size: 28px;
  height: 28px;
  width: 28px;
  display: inline-block;
  position: absolute !important;
  left: 2px;
  background-repeat: no-repeat;
  font-size: 28px !important; }

.instacart-modal-bg {
  position: fixed;
  background-color: rgba(0, 0, 0, 0.5);
  top: 0;
  left: 0;
  right: 0;
  bottom: 0;
  z-index: 1021;
  overflow: hidden; }

.instacart-modal-bg, .instacart-modal {
  -webkit-transition: all 0.3s ease-in-out;
  -moz-transition: all 0.25s ease-out;
  -o-transition: all 0.25s ease-out;
  transition: all 0.25s ease-out;
  opacity: 0;
  text-align: center; }

.instacart-modal-bg.instacart-modal-visible,
.instacart-modal.instacart-modal-visible {
  opacity: 1; }

.instacart-modal {
  position: fixed;
  padding-top: 10%;
  top: 0;
  left: 0;
  right: 0;
  z-index: 1022;
  -webkit-transform: scale(1.1) translateY(-50px);
  bottom: 0;
  overflow: auto;
  box-sizing: border-box;
  -moz-box-sizing: border-box; }

.instacart-modal.instacart-modal-visible {
  -webkit-transform: scale(1) translateY(0); }

.instacart-modal .instacart-list {
  margin: 0 auto;
  border-radius: 5px;
  box-shadow: 0 22px 70px 4px rgba(0, 0, 0, 0.56); }
  .instacart-modal .instacart-list.is_recipe {
    width: 900px; }
    .instacart-modal .instacart-list.is_recipe .instacart-list-tabs {
      display: none; }
    .instacart-modal .instacart-list.is_recipe .instacart-list-tab-containers {
      position: relative; }
    .instacart-modal .instacart-list.is_recipe .instacart-list-tab-containers > div {
      width: 50%;
      display: inline-block; }
    .instacart-modal .instacart-list.is_recipe .instacart-list-directions {
      float: right;
      min-height: 363px;
      max-height: 500px;
      width: 50%;
      background-color: #F7FBFF; }
    .instacart-modal .instacart-list.is_recipe .instacart-list-directions {
      padding: 30px 50px;
      font-size: 14px; }
    .instacart-modal .instacart-list.is_recipe .instacart-list-directions li {
      line-height: 1.5;
      margin-bottom: 5px; }
    .instacart-modal .instacart-list.is_recipe .instacart-list-link {
      margin-top: 30px;
      font-size: 13px; }

.instacart-list-container {
  display: inline-block;
  margin: 0 auto;
  border-radius: 5px; }

.instacart-list {
  width: 450px;
  font-family: "Helvetica Neue", Helvetica, Arial, sans-serif;
  font-weight: 300;
  position: relative;
  text-align: left;
  display: block !important;
  border-radius: 5px;
  color: #393939;
  -webkit-box-shadow: 0px 3px 15px 0px rgba(50, 50, 50, 0.64);
  -moz-box-shadow: 0px 3px 15px 0px rgba(50, 50, 50, 0.64);
  box-shadow: 0px 3px 15px 0px rgba(50, 50, 50, 0.64); }

.instacart-list * {
  box-sizing: border-box;
  -moz-box-sizing: border-box; }

.instacart-list-header {
  height: 240px;
  background-size: cover;
  position: relative;
  color: white;
  background-position: center;
  border-top-right-radius: 5px;
  border-top-left-radius: 5px; }

.instacart-list-header:before {
  content: " ";
  width: 100%;
  height: 100%;
  background-color: rgba(0, 0, 0, 0.5);
  position: absolute;
  left: 0;
  top: 0;
  border-top-right-radius: 5px;
  border-top-left-radius: 5px; }

.instacart-list-header-links {
  position: absolute;
  top: 20px;
  right: 10px;
  color: white; }

.instacart-list-header-links > div {
  display: inline-block;
  padding: 0 10px;
  cursor: pointer;
  position: relative; }

.instacart-list-header-links > div .fa {
  margin-right: 5px;
  font-size: 18px; }

.instacart-list-header-links > div .text {
  display: inline-block;
  line-height: 18px;
  position: relative;
  top: -1px; }

.instacart-list-header-dropdown {
  position: absolute;
  top: 50px;
  right: 10px;
  width: 200px;
  background-color: white;
  border-radius: 10px;
  -webkit-box-shadow: 0px 3px 15px 0px rgba(50, 50, 50, 0.84);
  -moz-box-shadow: 0px 3px 15px 0px rgba(50, 50, 50, 0.84);
  box-shadow: 0px 3px 15px 0px rgba(50, 50, 50, 0.84);
  z-index: 1;
  visibility: hidden;
  opacity: 0;
  transition: visibility 0s linear 0.2s, opacity 0.2s linear, top .2s linear; }

.instacart-list-header-dropdown:before, .carret:before {
  position: absolute;
  top: -10px;
  right: 20px;
  display: inline-block;
  border-right: 10px solid transparent;
  border-bottom: 10px solid #fff;
  border-left: 10px solid transparent;
  content: ''; }

.instacart-list-dropdown-active {
  visibility: visible;
  opacity: 1;
  transition-delay: 0s;
  top: 40px; }

.instacart-list-header-dropdown > * {
  padding: 15px;
  color: #747379;
  cursor: pointer;
  -webkit-transition: all 0.1s ease-in-out;
  -moz-transition: all 0.1s ease-in-out;
  -o-transition: all 0.1s ease-in-out;
  transition: all 0.1s ease-in-out;
  display: block; }

.instacart-list-header-dropdown > * .fa {
  margin-right: 5px;
  float: left;
  display: block;
  width: 20px;
  text-align: center; }

.instacart-list-header-dropdown > *:hover {
  background-color: #458eab;
  color: white; }

.instacart-list-header-dropdown > *:first-child {
  border-top-right-radius: 5px;
  border-top-left-radius: 5px; }

.instacart-list-header-dropdown > *:last-child {
  border-bottom-right-radius: 5px;
  border-bottom-left-radius: 5px; }

.instacart-list .instacart-list-header-dropdown-share-link input {
  border: none;
  width: 145px;
  display: inline-block;
  cursor: pointer;
  background-color: none;
  margin: 0;
  color: #747379; }

.instacart-list-header-details {
  position: absolute;
  bottom: 0;
  left: 0;
  width: 100%;
  padding: 20px 30px; }

.instacart-list-header-bg-edit {
  padding: 5px 7px;
  background-color: #ccc;
  color: #444;
  cursor: pointer;
  display: none;
  border-radius: 5px; }

.instacart-list-edit-mode .instacart-list-header-bg-edit {
  display: inline-block; }

.instacart-list-header-title {
  font-size: 40px;
  font-weight: 100;
  line-height: 40px; }

.instacart-list-header-avatar img {
  float: left;
  margin-right: 10px;
  width: 30px;
  height: 30px;
  border-radius: 15px; }

.instacart-list-header-name {
  line-height: 30px;
  color: white;
  cursor: pointer; }

.instacart-list-header-name:hover {
  color: #F58823; }

.instacart-list-content {
  border-bottom-right-radius: 5px;
  border-bottom-left-radius: 5px;
  min-height: 363px;
  background-color: white;
  overflow: hidden; }

.instacart-list-embed {
  padding: 10px; }

.instacart-list-embed .instacart-list-content {
  height: 500px;
  overflow-y: scroll; }

.instacart-list-tabs {
  height: 50px;
  background-color: white; }

.instacart-list-tab {
  width: 50%;
  float: left;
  padding: 15px 0;
  text-transform: uppercase;
  text-align: center;
  color: #8d8d8d;
  cursor: pointer;
  font-size: 12px;
  font-weight: 500;
  letter-spacing: 1px; }

.instacart-list-tab-text {
  display: inline-block;
  border-bottom: 4px solid transparent;
  -webkit-transition: all 0.2s ease-in-out;
  -moz-transition: all 0.2s ease-in-out;
  -o-transition: all 0.2s ease-in-out;
  transition: all 0.2s ease-in-out;
  padding-bottom: 10px; }

.instacart-list-tab-active .instacart-list-tab-text {
  color: #5a5a64;
  border-bottom: 2px solid #f58823;
  padding-bottom: 2px; }

.instacart-list-nodirections .instacart-list-tabs {
  display: none; }

.instacart-list-edit-mode .instacart-list-nodirections .instacart-list-tabs {
  display: block; }

.instacart-list-products {
  background-color: white;
  color: #747379; }

.instacart-list-product-content {
  border-top: 1px dashed #ccc;
  padding: 20px;
  min-height: 90px;
  background-color: white; }

.instacart-list-logged-in .instacart-list-product-content {
  cursor: pointer; }

.instacart-list-product:first-child .instacart-list-product-content {
  border-top: none; }

.instacart-list-product-image {
  position: relative;
  height: 50px;
  width: 50px;
  float: left;
  margin-right: 20px;
  z-index: 1; }

.instacart-list-product-image img {
  width: 50px;
  height: 50px; }

.instacart-list-product-image span {
  position: absolute;
  bottom: -3px;
  left: -10px;
  white-space: nowrap; }

.instacart-list-product-name {
  white-space: nowrap;
  text-overflow: ellipsis;
  overflow: hidden;
  position: absolute;
  width: 100%;
  padding-left: 70px; }

/*
  Why using absolute positioning you ask?
  Well in certain browsers, having a text elipsis on a div is actually no enough, the size of the ghost text will impact the parent width (if it's using a percentage width).

  So by using absolute positioning we make sure that the div gets taken away from the dom flow and does not impact our fluid width.


*/
.instacart-list-product-name,
.instacart-list-product-size {
  line-height: 25px; }

.instacart-list-product-size {
  color: #b1afaf;
  position: relative;
  top: 23px; }

.instacart-list-product-size > * {
  vertical-align: middle; }

.instacart-list-product[data-cart-qty="0"] span.incart {
  visibility: hidden;
  max-width: 0; }

.instacart-list-product[data-cart-qty="0"] span.incart:after {
  content: ""; }

.instacart-list-product:not([data-cart-qty="0"]) span.incart {
  visibility: visible;
  max-width: 100px; }

.instacart-list-product:not([data-cart-qty="0"]) span.incart:after {
  content: " in cart"; }

.instacart-list-product span.incart {
  display: inline-block;
  background-color: rgba(0, 0, 0, 0.5);
  color: white;
  padding: 0 6px;
  height: 25px;
  visibility: visible;
  max-width: 100px;
  border-radius: 3px;
  margin-left: 5px;
  overflow: hidden;
  line-height: 24px;
  -webkit-transition: all 0.2s ease-in-out;
  -moz-transition: all 0.2s ease-in-out;
  -o-transition: all 0.2s ease-in-out;
  transition: all 0.2s ease-in-out; }

.instacart-list-product span.status {
  padding: 2px 5px;
  color: white;
  font-weight: bold;
  font-size: 11px; }

.instacart-list-product.found span.status {
  background-color: #43B02A; }

.instacart-list-product.replaced span.status {
  background-color: #ff853a; }

.instacart-list-product.to_refund span.status {
  background-color: #e74c3c; }

.instacart-list-products-children {
  max-height: 0;
  overflow: hidden;
  -webkit-transition: all 0.2s ease-in-out;
  -moz-transition: all 0.2s ease-in-out;
  -o-transition: all 0.2s ease-in-out;
  transition: all 0.2s ease-in-out;
  opacity: 0; }

.instacart-list-products-children-active .instacart-list-products-children {
  height: auto;
  opacity: 1;
  max-height: 600px; }

.instacart-list-product-toggle .fa {
  -webkit-transition: all 0.2s ease-in-out;
  -moz-transition: all 0.2s ease-in-out;
  -o-transition: all 0.2s ease-in-out;
  transition: all 0.2s ease-in-out; }

.instacart-list-products-children-active .instacart-list-product-toggle .fa {
  -ms-transform: scaleY(-1);
  /* IE 9 */
  -webkit-transform: scaleY(-1);
  /* Chrome, Safari, Opera */
  transform: scaleY(-1); }

.instacart-list-products-children .instacart-list-product-content {
  padding: 10px 20px;
  min-height: 60px;
  border-left: 10px solid #43B02A;
  border-top: 1px dashed #eee; }

.instacart-list-products-children .instacart-list-product-name,
.instacart-list-products-children .instacart-list-product-size {
  line-height: 20px; }

.instacart-list-product .instacart-list-product-content > * {
  float: left;
  width: 0%;
  overflow: hidden;
  -webkit-transition: all 0.2s ease-in-out;
  -moz-transition: all 0.2s ease-in-out;
  -o-transition: all 0.2s ease-in-out;
  transition: all 0.2s ease-in-out;
  opacity: 0; }

.instacart-list-product[data-item-qty="1.0"] .instacart-list-product-name span.qty {
  display: none; }

.instacart-list-product:not([data-item-id=""]):hover {
  cursor: pointer; }

.instacart-list-product-name span.qty {
  font-size: 16px;
  margin-right: 3px; }

.instacart-list-product-name span.qty:after {
  content: "x"; }

.instacart-list-short-description .instacart-list-view-mode,
.instacart-list-edit-mode .instacart-list-short-description {
  padding: 20px; }

.instacart-list-edit-mode .instacart-list-header-links {
  display: none; }

.instacart-list-edit-input {
  display: none; }

.instacart-list-edit-mode .instacart-list-view-mode {
  display: none; }

.instacart-list-edit-mode .instacart-list-edit-input {
  display: block;
  position: relative; }

/*.instacart-list-edit-mode .instacart-list-edit-input:after  {content: "\f044"; position: absolute; top: 3px; right: 3px; font-family: FontAwesome; opacity: .7; font-size: 20px;}*/
.instacart-list-edit-input input[type="text"], .instacart-list-edit-input input[type="number"], .instacart-list-edit-input textarea {
  border: 1px solid transparent !important;
  background-color: transparent !important;
  padding: 0 !important;
  margin: 0 !important;
  height: auto !important;
  width: 100%;
  border-radius: 0px !important; }

.instacart-list-header-title .instacart-list-edit-input input {
  color: white !important;
  font-size: 40px !important;
  font-weight: 100 !important;
  line-height: 40px !important; }

.instacart-list-edit-input:hover input {
  border-bottom: 1px solid #eee !important; }

.instacart-list-visible, .instacart-list-show-user-name {
  display: none; }

.instacart-list-edit-input input[type="text"]:focus,
.instacart-list-edit-input textarea:focus,
.instacart-list-edit-mode input[type="number"]:focus {
  box-shadow: none !important;
  background-color: rgba(0, 0, 0, 0.1) !important; }

.instacart-list-products:empty:after {
  content: "This list is empty! How sad.";
  width: 100%;
  display: block;
  text-align: center;
  color: #ccc;
  padding: 20px 0; }

.instacart-list-edit-input.instacart-list-ingredients textarea,
.instacart-list-edit-input.instacart-list-description textarea {
  height: 100px !important;
  margin-bottom: 10px !important; }

.instacart-list-header-edit-saved {
  display: none;
  position: absolute;
  left: 10px;
  top: 10px;
  color: #FFF;
  font-variant: small-caps;
  background: #43B02A;
  padding: 3px 5px;
  font-size: 10px;
  text-transform: uppercase; }

.instacart-list-product .instacart-list-product-details {
  width: 80%;
  opacity: 1;
  overflow: visible;
  position: relative; }

.instacart-list-product .instacart-list-item-unavailable {
  float: right;
  opacity: 1;
  width: 102px;
  cursor: default;
  padding: 10px;
  text-transform: uppercase;
  display: inline-block;
  background-color: #c4c4c4;
  text-shadow: none; }

.instacart-list-product .instacart-list-adding-and-removing {
  width: 20%;
  opacity: 1;
  text-align: right;
  line-height: 60px;
  white-space: nowrap;
  border-radius: 4px;
  font-weight: 200; }

.instacart-list-product .instacart-list-adding-and-removing > *, .instacart-list-add-all {
  text-transform: uppercase;
  background-color: #43B02A;
  font-size: 12px;
  color: white;
  cursor: pointer;
  display: inline-block;
  padding: 5px 7px;
  border-radius: 4px;
  height: 30px;
  line-height: 22px;
  text-decoration: none;
  font-weight: 500; }

.instacart-list-product[data-cart-qty="0"] .instacart-list-product-remove-from-cart {
  display: none; }

.instacart-list-product:not([data-cart-qty="0"]) .instacart-list-product-remove-from-cart {
  display: inline-block; }

.instacart-list-product .instacart-list-product-add:hover, .instacart-list-add-all:hover {
  background-color: #58d13c;
  text-decoration: none;
  color: rgba(0, 0, 0, 0.4); }

.instacart-list-product .instacart-list-adding-and-removing > *:active {
  -webkit-transform: scale(0.9);
  -moz-transform: scale(0.9);
  transform: scale(0.9); }

.instacart-list-add-all {
  text-align: center;
  display: block;
  margin: 0 8px 8px 8px;
  padding: 15px 10px;
  line-height: 12px;
  height: 40px; }
  .instacart-list-add-all:active {
    -webkit-transform: scale(0.95);
    -moz-transform: scale(0.95);
    transform: scale(0.95); }

.instacart-list-edit-mode .instacart-list-add-all, .mobile-instacart-list-container .instacart-list-add-all {
  display: none; }

.instacart-list-product .instacart-list-product-toggle {
  width: 20%;
  opacity: 1;
  cursor: pointer;
  color: #ccc;
  display: block;
  text-align: right;
  padding-right: 3%; }

.instacart-list-product-no-children .instacart-list-product-toggle {
  display: none; }

.instacart-list-edit-mode .instacart-list-product-toggle {
  padding-right: 0; }

.instacart-list-edit-mode .instacart-list-product-details {
  width: 65%;
  opacity: 1; }

.instacart-list-edit-mode .instacart-list-product-reorder {
  width: 10%;
  opacity: 1;
  cursor: move;
  cursor: drag;
  cursor: -webkit-grab;
  cursor: -moz-grab; }

.instacart-list-product-qty input[type="number"] {
  width: 90%;
  height: 50px;
  color: #444;
  text-align: center;
  padding: 0;
  line-height: 50px;
  border: none !important; }

.instacart-list-edit-mode span.qty {
  display: none; }

.instacart-list-edit-mode .instacart-list-product-qty {
  width: 15%;
  opacity: 1; }

.instacart-list-edit-mode .instacart-list-product-remove {
  width: 10%;
  opacity: 1;
  cursor: pointer; }

.instacart-list-edit-mode .instacart-list-adding-and-removing {
  width: 0%;
  opacity: 0; }

.instacart-list-edit-mode .instacart-list-product-toggle {
  width: 0%;
  opacity: 0; }

.instacart-list-product-add, .instacart-list-product-reorder, .instacart-list-product-remove, .instacart-list-product-toggle {
  text-align: center;
  line-height: 50px;
  font-size: 18px;
  -webkit-touch-callout: none;
  -webkit-user-select: none;
  -khtml-user-select: none;
  -moz-user-select: none;
  -ms-user-select: none;
  user-select: none; }

/*.instacart-list-ingredients {padding: 20px;}*/
.instacart-list-directions {
  padding: 20px; }

.instacart-list-link {
  padding: 20px;
  text-align: center;
  display: block;
  color: white !important;
  text-decoration: none;
  background-color: #6eb568 !important;
  text-transform: uppercase; }

.instacart-list-link span.author {
  font-weight: bold; }

.instacart-list-tab-containers > div {
  display: none;
  overflow: auto;
  float: left;
  width: 100%; }

.instacart-list-tab-containers > .instacart-list-tab-content-active {
  display: block; }

.instacart-list-logged-out .instacart-list-favorite {
  display: none; }

.instacart-list-favorite {
  -webkit-transition: all 0.2s ease-in-out;
  -moz-transition: all 0.2s ease-in-out;
  -o-transition: all 0.2s ease-in-out;
  transition: all 0.2s ease-in-out; }

.instacart-list-favorited {
  color: gold; }

.instacart-list-product:before,
.instacart-list-product:after,
.instacart-list-product-content:before,
.instacart-list-product-content:after {
  content: " ";
  /* 1 */
  display: table;
  /* 2 */ }

.instacart-list-product:after, .instacart-list-product-content:after {
  clear: both; }

.instacart-list-best-viewed {
  background: #EEE;
  padding: 14px 0;
  font-size: 12px;
  line-height: 16px;
  text-align: center;
  text-transform: uppercase;
  font-weight: 500;
  color: #BBB; }

.instacart-list-embed .instacart-list-footer {
  display: block; }

.instacart-list-embed .instacart-logo {
  position: absolute;
  top: 20px;
  left: 25px;
  display: block; }

.instacart-list-embed .instacart-logo img {
  width: 120px; }

.instacart-logo {
  display: none; }

.instacart-list-footer {
  background-color: white;
  text-align: center;
  display: none;
  border-bottom-right-radius: 5px;
  border-bottom-left-radius: 5px;
  position: absolute;
  width: 100%;
  bottom: 0;
  left: 0;
  height: 50px; }

.instacart-list-embed .instacart-list {
  padding-bottom: 40px; }

.instacart-list-footer a {
  line-height: 50px;
  text-decoration: none;
  font-size: 13px;
  color: #444; }

.instacart-list-footer a span {
  color: #458eab; }

.circleImgWrap {
  position: relative;
  width: 100%;
  height: auto;
  background-color: transparent; }
  @media (max-width: 768px) {
    .circleImgWrap {
      margin-top: 30px; } }

.circleImg {
  position: relative;
  margin: 0 auto;
  width: 104px;
  height: 104px;
  background-image: url(circle-replacements@3x-94d2770c0b5b1a7a00e84f6c985d4107.png);
  background-size: cover;
  background-repeat: no-repeat; }
  @media (max-width: 750px) {
    .circleImg {
      display: none !important; } }

.headerCopyWrap {
  position: relative; }

.headerCopy {
  position: relative;
  text-align: center;
  font-size: 20px;
  line-height: 24px;
  color: #424242;
  margin: 25px auto 0 auto;
  max-width: 95%; }
  @media (max-width: 750px) {
    .headerCopy {
      width: 320px;
      font-size: 19px; } }
  .headerCopy .headerCopyBold {
    font-size: 20px;
    font-weight: 700; }
    @media (max-width: 750px) {
      .headerCopy .headerCopyBold {
        font-size: 19px; } }

.bottomInnerWrap {
  position: relative;
  margin: 25px auto 25px auto;
  width: 80%;
  height: auto;
  background-color: transparent; }

.replacementLine {
  width: 80%;
  height: 1px;
  background-color: #B7B5B7; }

.replacementSection {
  position: relative;
  display: flex;
  flex-direction: row;
  width: 100%;
  height: 200px;
  background-color: white;
  border-bottom: 1px solid #e0e0e0; }
  @media (max-width: 750px) {
    .replacementSection {
      height: 255px; } }

.innerReplacementWrapLeft {
  position: relative;
  display: flex;
  flex-direction: column;
  justify-content: center;
  width: 65%;
  height: 100%;
  min-width: 110px;
  background-color: transparent; }
  @media (max-width: 750px) {
    .innerReplacementWrapLeft {
      width: 100%; } }

.innerReplacementWrapRight {
  position: relative;
  display: flex;
  flex-direction: row;
  justify-content: flex-end;
  align-items: center;
  width: 35%;
  height: 100%;
  background-color: transparent; }
  @media (max-width: 750px) {
    .innerReplacementWrapRight {
      display: none !important; } }

.originalItem {
  position: relative;
  display: flex;
  flex-direction: row;
  width: 100%;
  height: 85px;
  margin-top: 0;
  background-color: transparent; }
  @media (max-width: 750px) {
    .originalItem {
      height: 85px;
      margin-top: 5px; } }

.replacementItem {
  position: relative;
  display: flex;
  flex-direction: row;
  width: 100%;
  height: 85px;
  background-color: transparent; }
  @media (max-width: 750px) {
    .replacementItem {
      height: 85px; } }

.itemImage {
  position: relative;
  width: 100px;
  height: 100%;
  background-color: transparent; }

.itemDescription {
  position: relative;
  display: flex;
  flex-direction: column;
  justify-content: center;
  padding-left: 5px;
  width: 100%;
  height: 100%;
  background-color: transparent; }

.outOfStock,
.replacedWith {
  margin: 0;
  color: #E7003E;
  font-size: 12px;
  line-height: 16px; }

.replacedWith {
  color: #F7A700; }

.itemName {
  margin: 0;
  color: #393939;
  font-size: 14px;
  line-height: 20px;
  font-weight: 600; }

.itemPriceAndSize {
  color: #b0b0b0;
  margin: 0; }

.thumbsUp {
  width: 57px;
  height: 57px;
  margin: 0 6px;
  background-image: url(icon-like@2x-df67fd964ca7b76a0dfe2fcc53e5d468.png);
  background-size: cover;
  background-repeat: no-repeat;
  cursor: pointer; }
  .thumbsUp.selected {
    background-image: url(icon-like-active@2x-20c514a17d40d59b925b5dc590a8b9e6.png); }
  .thumbsUp.thumbs-up-color {
    background-image: url(icon-like-color@2x-d624553a58e3d2bd9187b89112781f02.png); }

.thumbsDown {
  width: 57px;
  height: 57px;
  margin: 0 6px;
  background-image: url(icon-dislike@2x-19715c3a0163f4bfcf892989bf91024e.png);
  background-size: cover;
  background-repeat: no-repeat;
  cursor: pointer; }
  .thumbsDown.selected {
    background-image: url(icon-dislike-active@2x-ca420752b6597469b92180aa266cdece.png); }
  .thumbsDown.thumbs-down-color {
    background-image: url(icon-dislike-color@2x-c3c477d2eae387a69d659188fa84b350.png); }

.btnWrap {
  position: relative;
  width: 100%;
  text-align: center;
  margin: 0 auto;
  padding: 20px; }

.ic-btn.ic-btn-success.replacements-next {
  width: 85%;
  height: 44px;
  margin: auto; }

.btnWrap > button > span {
  font-size: 16px;
  font-weight: 600; }

.mobileThumbWrap {
  display: none; }
  @media (max-width: 750px) {
    .mobileThumbWrap {
      position: relative;
      display: flex !important;
      flex-direction: row;
      justify-content: center;
      width: 100%;
      height: 85px;
      top: 8px;
      background-color: transparent; } }

.sectionLine {
  width: 100%;
  height: 1px;
  border-bottom: 1px solid #e0e0e0; }

html {
  -webkit-box-sizing: border-box;
  box-sizing: border-box; }

*, ::after, ::before {
  -webkit-box-sizing: inherit;
  box-sizing: inherit; }

html, body {
  height: 100%;
  -moz-osx-font-smoothing: grayscale;
  -webkit-font-smoothing: antialiased; }

/* prevent scrolling while during modal */
body.modal-open {
  overflow: hidden; }

body {
  background: #f7f7f7;
  font-family: "Open Sans", "Helvetica Neue", Helvetica, sans-serif;
  color: #393939;
  padding: 0px;
  font-size: 14px; }
  body.storefront-alcohol {
    background: white; }
  body.secondary {
    padding-top: 80px; }
  body.has-nav-banner {
    padding-top: 179px; }

h1, h2, h3, h4, h5, h6 {
  margin: 10px 0;
  line-height: inherit; }

select {
  border: 1px solid #cccccc;
  background-color: #ffffff;
  height: 30px;
  line-height: 30px;
  vertical-align: middle; }

img {
  max-width: 100%;
  width: auto\9;
  height: auto;
  vertical-align: middle;
  border: 0;
  -ms-interpolation-mode: bicubic; }

ul, ol {
  padding: 0;
  margin: 0 0 10px 25px; }

ul.unstyled,
ol.unstyled {
  margin-left: 0;
  list-style: none; }

li {
  line-height: 20px; }

label {
  font-weight: normal; }

input,
textarea {
  outline: 0; }

input,
textarea,
.uneditable-input {
  width: 206px; }

input[type="file"],
input[type="image"],
input[type="submit"],
input[type="reset"],
input[type="button"],
input[type="radio"],
input[type="checkbox"] {
  width: auto; }

select,
textarea,
input[type="text"],
input[type="password"],
input[type="datetime"],
input[type="datetime-local"],
input[type="date"],
input[type="month"],
input[type="time"],
input[type="week"],
input[type="number"],
input[type="email"],
input[type="url"],
input[type="search"],
input[type="tel"],
input[type="color"],
.uneditable-input {
  margin-bottom: 10px; }

label,
input,
button,
select,
textarea {
  font-size: 14px;
  font-weight: normal;
  line-height: 20px; }

.hide {
  display: none; }

.form-horizontal .control-label {
  float: left;
  width: 160px;
  padding-top: 5px;
  text-align: right; }

.form-horizontal .controls {
  margin-left: 180px; }

.form-horizontal .control-group {
  margin-bottom: 20px; }

/* old bootstrap modal styles */
@media (max-width: 767px) {
  .modal-cell {
    padding: 0; } }

@media (max-width: 767px) {
  .modal-container.active .modal-table .modal-cell .modal {
    width: 100vw;
    position: fixed;
    top: 15px;
    left: 0; }
    .modal-container.active .modal-table .modal-cell .modal .modal-header h3 {
      margin: 0;
      line-height: 30px; } }
  @media (max-width: 767px) and (max-width: 767px) {
    .modal-container.active .modal-table .modal-cell .modal .modal-header {
      text-align: center; }
      .modal-container.active .modal-table .modal-cell .modal .modal-header h3 {
        font-size: 20px; } }

@media (max-width: 767px) {
    .modal-container.active .modal-table .modal-cell .modal .form-horizontal .control-label {
      width: 35%; }
    .modal-container.active .modal-table .modal-cell .modal .form-horizontal .controls {
      margin-left: 40%; } }

.modal {
  width: 560px;
  outline: 0;
  top: 50%;
  left: 50%;
  bottom: inherit;
  right: inherit;
  margin: -250px 0 0 -280px; }

/* end old bootstrap modal styles */
.tooltip {
  font-size: 11px;
  padding: 5px; }
  .tooltip .tooltip-inner {
    line-height: 20px; }
  .tooltip.right .tooltip-arrow {
    top: 50%;
    left: 0;
    margin-top: -5px;
    border-width: 5px 5px 5px 0; }

.nav-pills > li {
  float: left; }

.nav > li > a:hover,
.nav > li > a:focus {
  text-decoration: none;
  background-color: #e6e6e6; }

.dropdown-toggle::after {
  border: 0;
  display: none; }

.container {
  padding-bottom: 40px; }

.placeholder {
  color: #555; }

.strike {
  text-decoration: line-through; }

.inline {
  display: inline-block; }

.no-aliasing-image {
  image-rendering: optimizeSpeed;
  /* FUCK SMOOTHING, GIVE ME SPEED  */
  image-rendering: -moz-crisp-edges;
  /* Firefox                        */
  image-rendering: -o-crisp-edges;
  /* Opera                          */
  image-rendering: -webkit-optimize-contrast;
  /* Chrome (and eventually Safari) */
  image-rendering: optimize-contrast;
  /* CSS3 Proposed                  */
  -ms-interpolation-mode: nearest-neighbor;
  /* IE8+                           */ }

.btn-large {
  vertical-align: top;
  padding: 11px 19px;
  line-height: 20px; }

.alert {
  background-color: #fcf8e3;
  border-color: #faf2cc;
  color: #8a6d3b;
  border: 1px solid transparent; }
  .alert h4 {
    margin: 0; }

.hide-on-checkout, .hide-on-order-status {
  display: inherit; }

.checking-out .hide-on-checkout {
  display: none !important; }

.landing-page-no-nav .hide-on-checkout {
  display: none !important; }

.landing-page .hide-on-landing {
  display: none !important; }

.placeholder {
  color: #aaa; }

.control-label img {
  width: 100px;
  height: 100px; }
  .control-label img:hover {
    width: 200px;
    height: 200px; }

input[type='search']:focus::-webkit-input-placeholder {
  color: transparent; }

input[type='search']:focus:-moz-placeholder {
  color: transparent; }

input[type='search']:focus::-moz-placeholder {
  color: transparent; }

.banner {
  width: 500px;
  margin: 0 auto;
  background: #eee;
  margin-top: 0;
  background: #A6E69A;
  box-shadow: 0 1px 3px #555; }
  .banner h4 {
    margin-top: 0;
    margin-bottom: 5px; }
  .banner p {
    margin-bottom: 0;
    line-height: 30px; }

body:not(.checking-out) .outside-container .container-fluid {
  margin-right: 0; }

body:not(.checking-out) .outside-container .store-wrapper {
  -webkit-transition: margin-right 450ms cubic-bezier(0.23, 1, 0.32, 1) 0ms;
  -moz-transition: margin-right 450ms cubic-bezier(0.23, 1, 0.32, 1) 0ms;
  transition: margin-right 450ms cubic-bezier(0.23, 1, 0.32, 1) 0ms; }

body:not(.checking-out) .outside-container .store-wrapper:focus {
  outline: none; }

body:not(.checking-out) .outside-container .container-fluid.no-overlay {
  margin-right: 370px; }
  body:not(.checking-out) .outside-container .container-fluid.no-overlay.cart-minimized {
    margin-right: 0px; }

.item .btn-group, .item-detail .btn-group {
  top: 5px;
  right: 5px; }
  .item .btn-group .btn, .item-detail .btn-group .btn {
    text-shadow: none;
    border: 0; }
  .item .btn-group .btn-qty, .item-detail .btn-group .btn-qty {
    padding-left: 6px;
    padding-right: 6px; }
  .item .btn-group .btn.disabled, .item-detail .btn-group .btn.disabled {
    color: #000; }
  .item .btn-group.left, .item-detail .btn-group.left {
    top: 5px;
    left: 5px;
    right: auto;
    text-align: left;
    z-index: 2; }
    .item .btn-group.left .btn, .item-detail .btn-group.left .btn {
      border: inherit; }

/*
 * Backbone layout
 */
.panel-manager .content-panel {
  display: none; }
  .panel-manager .content-panel.active {
    display: inherit; }
  .panel-manager .content-panel .lead {
    max-width: 600px;
    margin: 0 auto;
    padding: 0 30px; }

.modal fieldset {
  margin-bottom: 10px;
  border-bottom: none;
  padding-top: 10px; }
  .modal fieldset:last-child {
    border-bottom: none;
    margin-bottom: 0; }

.dropdown-submenu .dropdown-menu {
  min-width: 180px; }

.or {
  text-align: center;
  padding: 10px 20px 20px; }
  .or em {
    display: block;
    margin: -32px auto 0;
    background: white;
    width: 42px;
    padding: 0;
    font-size: 18px;
    font-weight: 500;
    color: #444; }
  .or hr {
    width: 460px; }

/* BOOTSTRAP OVERRIDES */
.modal {
  background: #fff;
  border: none;
  -moz-border-radius-topleft: 4px !important;
  -moz-border-radius-topright: 4px !important;
  -moz-border-radius-bottomright: 4px !important;
  -moz-border-radius-bottomleft: 4px !important;
  -webkit-border-top-left-radius: 4px !important;
  -webkit-border-top-right-radius: 4px !important;
  -webkit-border-bottom-right-radius: 4px !important;
  -webkit-border-bottom-left-radius: 4px !important;
  border-top-left-radius: 4px !important;
  border-top-right-radius: 4px !important;
  border-bottom-right-radius: 4px !important;
  border-bottom-left-radius: 4px !important;
  box-shadow: 0 22px 70px 4px rgba(0, 0, 0, 0.56); }
  .modal > .close {
    position: absolute;
    z-index: 9999;
    right: 5px;
    top: 10px;
    opacity: 1;
    background: url(icon-close-thin-dd6da2ef8b311de1fba4c95b8228b2a6.png) no-repeat 0px 0px;
    background-size: cover;
    width: 44px;
    height: 43px;
    text-indent: -9999px; }
    .modal > .close:hover {
      opacity: 0.65; }
  .modal .alert .close {
    line-height: 30px;
    font-size: 30px; }

.popover {
  -moz-border-radius-topleft: 0 !important;
  -moz-border-radius-topright: 0 !important;
  -moz-border-radius-bottomright: 0 !important;
  -moz-border-radius-bottomleft: 0 !important;
  -webkit-border-top-left-radius: 0 !important;
  -webkit-border-top-right-radius: 0 !important;
  -webkit-border-bottom-right-radius: 0 !important;
  -webkit-border-bottom-left-radius: 0 !important;
  border-top-left-radius: 0 !important;
  border-top-right-radius: 0 !important;
  border-bottom-right-radius: 0 !important;
  border-bottom-left-radius: 0 !important; }

.front-and-center {
  position: fixed;
  top: 0;
  left: 50%;
  width: 400px;
  margin-left: -200px;
  z-index: 2000;
  text-align: center; }

body.chrome input[type=checkbox], body.chrome input[type=radio], body.webkit input[type=checkbox], body.webkit input[type=radio] {
  line-height: 1.3em;
  width: 1.3em;
  height: 1.3em;
  margin: 0 0 0 -25px;
  padding: 10px;
  -webkit-appearance: none;
  background-image: url(check-unfill_2x-6675c05adf356c1f19e3e3d88afd07a3.png);
  background-size: cover;
  outline: none; }
  body.chrome input[type=checkbox]:checked, body.chrome input[type=radio]:checked, body.webkit input[type=checkbox]:checked, body.webkit input[type=radio]:checked {
    background-image: url(check-circle_2x-614c7b4c6f35cc72407e9a4bd615ec85.png); }

body.chrome input[type=checkbox], body.webkit input[type=checkbox] {
  margin-right: 5px;
  background-image: url(checkbox-inactive-ea0f5105f41865983a2782373eeb0d3c.png); }
  body.chrome input[type=checkbox]:hover, body.webkit input[type=checkbox]:hover {
    background-image: url(checkbox-inactive-hover-31fad5d08bb6f4790a68a32857d4b440.png); }
  body.chrome input[type=checkbox]:checked, body.webkit input[type=checkbox]:checked {
    background-image: url(checkbox-active-cb1c2e86b7c021772f3de2cc692999ec.png); }

#terms {
  max-height: 400px;
  overflow-y: scroll;
  border: 1px solid #e6e6e6;
  padding: 20px; }

.popover {
  z-index: 1099; }

.disclaimer {
  font-size: 12px;
  color: #999; }

body.welcome-page {
  background: #fff;
  overflow: inherit !important; }
  body.welcome-page .container-fluid {
    margin-right: 10px; }
  @media (max-width: 991px) {
    body.welcome-page .retailer-chooser {
      margin: 0; } }

.input-append input[type="text"],
.input-append input[type="search"],
.input-append input[type="password"],
.input-append input[type="email"],
.input-append input[type="number"],
.input-append input[type="tel"],
.input-append input[type="date"] {
  -moz-border-radius-topleft: 8px !important;
  -moz-border-radius-topright: 0 !important;
  -moz-border-radius-bottomright: 0 !important;
  -moz-border-radius-bottomleft: 8px !important;
  -webkit-border-top-left-radius: 8px !important;
  -webkit-border-top-right-radius: 0 !important;
  -webkit-border-bottom-right-radius: 0 !important;
  -webkit-border-bottom-left-radius: 8px !important;
  border-top-left-radius: 8px !important;
  border-top-right-radius: 0 !important;
  border-bottom-right-radius: 0 !important;
  border-bottom-left-radius: 8px !important; }

.input-append .btn:last-child {
  -moz-border-radius-topleft: 0 !important;
  -moz-border-radius-topright: 8px !important;
  -moz-border-radius-bottomright: 8px !important;
  -moz-border-radius-bottomleft: 0 !important;
  -webkit-border-top-left-radius: 0 !important;
  -webkit-border-top-right-radius: 8px !important;
  -webkit-border-bottom-right-radius: 8px !important;
  -webkit-border-bottom-left-radius: 0 !important;
  border-top-left-radius: 0 !important;
  border-top-right-radius: 8px !important;
  border-bottom-right-radius: 8px !important;
  border-bottom-left-radius: 0 !important; }

.price .tag {
  position: relative;
  margin-left: 17px;
  display: inline-block;
  background: #d0dfe0;
  height: 21px;
  line-height: 21px;
  padding: 0 10px 0 9px;
  font-size: 13px;
  font-weight: bold; }
  .price .tag:before {
    content: url(pricetag-ae876d96ca4510df1eaa7b580eabe192.png);
    position: absolute;
    left: -17px;
    top: 0; }

.edit-list {
  margin-top: 30px; }
  .edit-list .product-search {
    width: 365px; }

.ic-truncate {
  text-overflow: ellipsis;
  white-space: nowrap;
  overflow-x: hidden;
  width: 100%; }

button .spinkit-spinner {
  position: relative;
  left: 7px;
  margin: 0;
  display: inline-block; }

.spinkit-spinner > div {
  width: 10px;
  height: 10px;
  background-color: white;
  border-radius: 100%;
  display: inline-block;
  -webkit-animation: bouncedelay 1.4s infinite ease-in-out;
  animation: bouncedelay 1.4s infinite ease-in-out;
  /* Prevent first frame from flickering when animation starts */
  -webkit-animation-fill-mode: both;
  animation-fill-mode: both; }

.spinkit-spinner .bounce1 {
  -webkit-animation-delay: -0.32s;
  animation-delay: -0.32s; }

.spinkit-spinner .bounce2 {
  -webkit-animation-delay: -0.16s;
  animation-delay: -0.16s; }

.pac-container {
  z-index: 9999; }

.content-panel.content-panel-centered {
  max-width: 1080px;
  margin: 0 auto; }
  .content-panel.content-panel-centered #referral-callout-account {
    margin-bottom: -35px; }

#account-tabs {
  max-width: 1080px;
  margin: 0 auto;
  position: relative;
  top: 35px; }
  #account-tabs .ic-vertical-tabs {
    margin-bottom: 15px; }
    #account-tabs .ic-vertical-tabs a.vertical-tabs-cell {
      display: block;
      position: relative;
      padding: 10px;
      text-decoration: none;
      background-color: #fff;
      border: 1px solid #F0EFEC; }
      #account-tabs .ic-vertical-tabs a.vertical-tabs-cell:first-child {
        -moz-border-radius-topleft: 5px !important;
        -moz-border-radius-topright: 5px !important;
        -moz-border-radius-bottomright: 0 !important;
        -moz-border-radius-bottomleft: 0 !important;
        -webkit-border-top-left-radius: 5px !important;
        -webkit-border-top-right-radius: 5px !important;
        -webkit-border-bottom-right-radius: 0 !important;
        -webkit-border-bottom-left-radius: 0 !important;
        border-top-left-radius: 5px !important;
        border-top-right-radius: 5px !important;
        border-bottom-right-radius: 0 !important;
        border-bottom-left-radius: 0 !important; }
      #account-tabs .ic-vertical-tabs a.vertical-tabs-cell:not(:first-child) {
        margin-top: -1px; }
      #account-tabs .ic-vertical-tabs a.vertical-tabs-cell:last-child {
        -moz-border-radius-topleft: 0 !important;
        -moz-border-radius-topright: 0 !important;
        -moz-border-radius-bottomright: 5px !important;
        -moz-border-radius-bottomleft: 5px !important;
        -webkit-border-top-left-radius: 0 !important;
        -webkit-border-top-right-radius: 0 !important;
        -webkit-border-bottom-right-radius: 5px !important;
        -webkit-border-bottom-left-radius: 5px !important;
        border-top-left-radius: 0 !important;
        border-top-right-radius: 0 !important;
        border-bottom-right-radius: 5px !important;
        border-bottom-left-radius: 5px !important; }
      #account-tabs .ic-vertical-tabs a.vertical-tabs-cell > div {
        vertical-align: middle; }
      #account-tabs .ic-vertical-tabs a.vertical-tabs-cell .ic-icon {
        display: inline-block;
        font-size: 16px;
        margin-top: 2px; }
      #account-tabs .ic-vertical-tabs a.vertical-tabs-cell .nav-cell-label {
        display: inline-block;
        margin: 0 0 0 5px; }
      #account-tabs .ic-vertical-tabs a.vertical-tabs-cell .ic-icon.ic-icon-arrow-right-small {
        position: absolute;
        right: 2px;
        top: 25%; }
      #account-tabs .ic-vertical-tabs a.vertical-tabs-cell.mobile-account-tab {
        display: none; }
        @media (max-width: 991px) {
          #account-tabs .ic-vertical-tabs a.vertical-tabs-cell.mobile-account-tab {
            display: block; } }
  #account-tabs .small-list {
    display: none;
    margin: 0 0 20px 0px;
    padding-top: 10px;
    font-size: 16px;
    text-align: center;
    border-top: 1px solid #ededed; }
    #account-tabs .small-list li {
      display: inline-block; }
      #account-tabs .small-list li:before {
        content: '\B7';
        margin: 0px 5px; }
      #account-tabs .small-list li:first-child:before {
        content: ' ';
        margin: 0px; }
    @media (max-width: 991px) {
      #account-tabs .small-list {
        display: block; } }
  #account-tabs .ic-tab:not(.active) {
    display: none; }
  #account-tabs .empty-state {
    font-size: 30px;
    font-weight: 100;
    padding: 50px; }
  #account-tabs .btn {
    text-transform: uppercase;
    letter-spacing: 1px;
    font-size: 13px;
    font-family: 'Open Sans', 'Noto Sans', sans-serif; }
  #account-tabs > .ic-tabs-content {
    padding-top: 20px; }
  #account-tabs .ic-tab.profile > .profile-panel {
    max-width: 100%;
    margin-bottom: 20px;
    padding: 10px 30px 20px;
    background-color: #fff;
    border: 1px solid #F0EFEC;
    -moz-border-radius-topleft: 5px !important;
    -moz-border-radius-topright: 5px !important;
    -moz-border-radius-bottomright: 5px !important;
    -moz-border-radius-bottomleft: 5px !important;
    -webkit-border-top-left-radius: 5px !important;
    -webkit-border-top-right-radius: 5px !important;
    -webkit-border-bottom-right-radius: 5px !important;
    -webkit-border-bottom-left-radius: 5px !important;
    border-top-left-radius: 5px !important;
    border-top-right-radius: 5px !important;
    border-bottom-right-radius: 5px !important;
    border-bottom-left-radius: 5px !important; }
    #account-tabs .ic-tab.profile > .profile-panel > h4 {
      margin: 20px 0; }
      #account-tabs .ic-tab.profile > .profile-panel > h4:not(:first-child) {
        margin-top: 50px; }
    #account-tabs .ic-tab.profile > .profile-panel:last-child {
      margin-bottom: 50px; }
    @media (max-width: 768px) {
      #account-tabs .ic-tab.profile > .profile-panel {
        width: 100%; } }
  #account-tabs .account-info {
    background-color: #fff; }
    #account-tabs .account-info .content {
      position: relative; }
      #account-tabs .account-info .content .input-line {
        margin-bottom: 10px; }
  #account-tabs .personal-info.has_avatar {
    padding-left: 170px; }
    #account-tabs .personal-info.has_avatar .profile-pic {
      display: block;
      width: 150px;
      height: 150px;
      background-color: #eee;
      border: 1px solid #ccc;
      background-size: cover;
      background-position: center;
      position: absolute;
      left: 0;
      top: 10px; }
      #account-tabs .personal-info.has_avatar .profile-pic .btn {
        opacity: 0;
        position: absolute;
        bottom: 0;
        left: 0;
        width: 100%; }
      #account-tabs .personal-info.has_avatar .profile-pic:hover .btn {
        opacity: 1; }
  #account-tabs .credit-card-info {
    width: 100%;
    margin: 0 30px 20px 0;
    padding: 10px 30px 20px;
    float: left;
    background-color: #fff;
    border: 1px solid #F0EFEC;
    -moz-border-radius-topleft: 5px !important;
    -moz-border-radius-topright: 5px !important;
    -moz-border-radius-bottomright: 5px !important;
    -moz-border-radius-bottomleft: 5px !important;
    -webkit-border-top-left-radius: 5px !important;
    -webkit-border-top-right-radius: 5px !important;
    -webkit-border-bottom-right-radius: 5px !important;
    -webkit-border-bottom-left-radius: 5px !important;
    border-top-left-radius: 5px !important;
    border-top-right-radius: 5px !important;
    border-bottom-right-radius: 5px !important;
    border-bottom-left-radius: 5px !important; }
    #account-tabs .credit-card-info > h4 {
      margin: 20px 0; }
      #account-tabs .credit-card-info > h4:not(:first-child) {
        margin-top: 50px; }
    #account-tabs .credit-card-info .ic-btn {
      width: 100%;
      margin-bottom: 10px; }
  #account-tabs .credit-card-info .line > *,
  #account-tabs .personal-info .line > *,
  #account-tabs .password .line > * {
    display: block;
    margin-bottom: 15px; }
  #account-tabs .notifications .toggles {
    margin: 20px 0; }
    #account-tabs .notifications .toggles label.checkbox {
      padding-left: 50px;
      font-size: 16px;
      line-height: 18px; }
      #account-tabs .notifications .toggles label.checkbox input {
        margin-right: 15px; }
      #account-tabs .notifications .toggles label.checkbox input[type='checkbox'] {
        position: inherit;
        float: left; }

#addresses .ic-tab-header, #cards .ic-tab-header, #orders-history .ic-tab-header {
  background-color: #fff;
  border: 1px solid #F0EFEC; }
  #addresses .ic-tab-header.call-to-action, #cards .ic-tab-header.call-to-action, #orders-history .ic-tab-header.call-to-action {
    border: 1px dashed #d4e2e0; }

#addresses .ic-tabs-content, #cards .ic-tabs-content, #orders-history .ic-tabs-content {
  margin-bottom: 100px; }

#addresses .ic-tab-header, #cards .ic-tab-header {
  padding: 10px 15px; }

.button-group button, .button-group a {
  width: 100%;
  margin-bottom: 0.75em;
  display: block; }

.top-right {
  top: 85px;
  right: 20px;
  position: absolute; }

#addresses .map-view {
  margin-bottom: 15px; }

#addresses .ic-tab-header .zipcode {
  float: right; }

#addresses .ic-tab-header.call-to-action {
  border-color: #d4e2e0; }

#addresses .ic-tab .btn.right {
  margin-left: 10px; }

#addresses .ic-tab .input-line .inputs.type-of-location {
  margin-top: 10px; }

#cards .ic-tab .btn.right {
  margin-left: 10px; }

#cards .ic-tab-header img {
  width: 40px;
  margin-right: 5px; }

#cards .ic-tab-header.btn-create-cc {
  height: 48px; }

.update-card-label-modal {
  width: 500px; }
  @media (max-width: 767px) {
    .update-card-label-modal .icModalBody {
      padding: 30px 0; }
    .update-card-label-modal .form-horizontal .control-label {
      width: 100px; }
    .update-card-label-modal .form-horizontal .controls {
      margin-left: 120px; } }

.coupons {
  width: auto !important;
  padding-left: 120px !important; }

.green-title {
  font-weight: 800;
  color: #43B02A;
  font-size: 40px;
  line-height: 40px;
  margin-bottom: 30px; }
  .green-title p.subtitle {
    font-weight: 100;
    font-size: 30px; }

#orders-history .stars {
  float: right;
  width: 105px;
  margin-left: 5px;
  margin-top: -2px; }

#orders-history .star {
  height: 20px; }

.ic-tab.loyalty_cards .retailer-cards-list {
  margin-top: 0; }

#orders-history.new .ic-tabs-headers {
  float: none;
  width: 100%;
  margin-bottom: 50px;
  padding: 0;
  border: 0; }
  #orders-history.new .ic-tabs-headers .ic-tab-header {
    min-height: 130px;
    display: block;
    margin-bottom: 15px;
    margin-right: 0;
    padding: 15px 20px;
    border-left-width: 2px; }
    #orders-history.new .ic-tabs-headers .ic-tab-header > div {
      font-weight: 400; }
    #orders-history.new .ic-tabs-headers .ic-tab-header.order-live {
      border-left-color: #43B02A; }
    #orders-history.new .ic-tabs-headers .ic-tab-header.order-canceled {
      border-left-color: #E8104A; }
    #orders-history.new .ic-tabs-headers .ic-tab-header.active span.name {
      color: #43B02A; }
    #orders-history.new .ic-tabs-headers .ic-tab-header .stars {
      position: relative;
      display: inline-block;
      top: -2px;
      float: none; }
    #orders-history.new .ic-tabs-headers .ic-tab-header span.warehouse-name {
      font-weight: 500;
      font-size: 14px;
      color: black; }
    #orders-history.new .ic-tabs-headers .ic-tab-header span.rate_msg {
      font-weight: normal; }
    #orders-history.new .ic-tabs-headers .ic-tab-header .instacart-list-product {
      height: 50px;
      margin: 10px 0;
      overflow: hidden; }

#orders-history.new .ic-tabs-content {
  max-width: 620px; }

#orders-history.new .order-links {
  border-bottom: 1px solid #9b9b9b;
  padding: 0 10px 5px; }

#orders-history.new .btns {
  padding: 0 10px 10px; }

#orders-history.new .warehouse-name {
  font-weight: 500; }

#orders-history.new br.clear {
  clear: right; }

#orders-history.new .bottom-right {
  bottom: 15px;
  right: 20px;
  position: absolute; }

#orders-history.new .btn-load-more-orders {
  width: 100%; }

ul.loyalty-cards-list {
  margin-top: 0; }
  ul.loyalty-cards-list .retailer-card {
    margin-top: 0;
    margin-bottom: 0; }
    ul.loyalty-cards-list .retailer-card .card-header {
      cursor: inherit; }
  ul.loyalty-cards-list .card-body {
    background-color: white;
    border: 1px solid #eee;
    border-top: 0px;
    padding: 5px 20px 15px 20px;
    height: 80px;
    margin-bottom: 30px;
    border-bottom-left-radius: 4px;
    border-bottom-right-radius: 4px;
    width: 297px; }
    ul.loyalty-cards-list .card-body .ic-btn {
      width: 100%;
      margin-top: 16px; }
    ul.loyalty-cards-list .card-body h4 {
      font-weight: 400;
      height: 18px;
      color: inherit;
      letter-spacing: inherit; }
  ul.loyalty-cards-list [class*="col-"] .card-body {
    width: auto; }

.order-header {
  display: flex;
  justify-content: space-between; }
  .order-header .order-info-container {
    display: flex;
    justify-content: space-between;
    flex: 6;
    max-width: 360px; }
  .order-header .view-detail-link {
    flex: 4;
    text-align: right; }
    @media (max-width: 767px) {
      .order-header .view-detail-link {
        flex: 1; } }
    .order-header .view-detail-link .order-detail-header:before {
      content: 'View order detail'; }
      @media (max-width: 767px) {
        .order-header .view-detail-link .order-detail-header:before {
          content: '>'; } }

.order-info .info-name {
  font-weight: 400;
  font-size: 12px;
  color: #939291; }

.order-info .info-value {
  font-weight: 600;
  font-size: 14px;
  color: black; }
  @media (max-width: 767px) {
    .order-info .info-value {
      font-size: 12px; } }

.header-line-separator {
  margin: 1em -20px;
  height: 1px;
  background: #D4D4D4; }

.view-detail-link {
  font-weight: 600;
  font-size: 14px;
  color: #01939A; }
  .view-detail-link:hover {
    color: #3C5555; }

.orders-product-images {
  margin: 10px 0;
  display: flex;
  flex-flow: row wrap;
  overflow: hidden;
  height: 50px;
  width: 80%; }
  @media (max-width: 767px) {
    .orders-product-images {
      height: 30px;
      width: 100%; } }

.orders-product-image {
  margin-right: 20px;
  width: 50px;
  height: 50px; }
  @media (max-width: 767px) {
    .orders-product-image {
      margin-right: 4px;
      width: 30px;
      height: 30px; } }
  .orders-product-image img {
    width: 100%;
    height: 100%; }

@media (min-width: 768px) {
  .order-actions {
    width: auto;
    top: 85px;
    right: 20px;
    position: absolute; } }

@media (max-width: 767px) {
  .btn-add-all-to-cart {
    display: none !important; } }

.addressPickerModal {
  width: 592px; }
  .addressPickerModal .icModalHeader {
    border-top: none;
    padding-bottom: 0; }
    .addressPickerModal .icModalHeader h1 {
      text-align: center;
      margin: 0;
      color: #393939; }
  .addressPickerModal .icModalBody {
    padding: 30px 60px;
    border-top: 0; }
    .addressPickerModal .icModalBody textarea.form-control {
      max-width: 480px; }
    @media (max-width: 991px) {
      .addressPickerModal .icModalBody {
        padding: 15px; } }
  .addressPickerModal .icModalFooter {
    border-bottom-radius: 4px;
    padding-top: 0px;
    background-color: #fcfcfc; }
  .addressPickerModal .action-input {
    box-sizing: border-box;
    position: relative;
    float: left;
    width: 66.66667%;
    min-height: 1px;
    padding-left: 15px;
    padding-right: 15px;
    margin: 0; }
    .addressPickerModal .action-input input {
      width: 100%;
      height: 36px;
      color: #555555;
      letter-spacing: 1px; }
  .addressPickerModal .action-button {
    box-sizing: border-box;
    position: relative;
    float: left;
    width: 33.33333%;
    min-height: 1px;
    padding-left: 15px;
    padding-right: 15px; }

.UserAddress-container {
  box-sizing: border-box;
  padding: 15px;
  text-align: left; }
  .UserAddress-container *, .UserAddress-container *:before, .UserAddress-container *:after {
    box-sizing: border-box; }
  .UserAddress-container .address-icon {
    display: inline-block;
    padding-right: 4px;
    vertical-align: top; }
  .UserAddress-container .address-label {
    width: 300px;
    padding-right: 5px;
    display: inline-block; }
    .UserAddress-container .address-label div {
      white-space: initial; }

.UserAddresses-newAddress .address-icon {
  padding: 0 2px;
  position: relative;
  top: 1px; }

@media (max-width: 544px) {
  .addressPickerModal .icModalContent {
    width: auto;
    margin: 0 15px; }
    .addressPickerModal .icModalContent .icModalRow {
      padding: 10px; }
      .addressPickerModal .icModalContent .icModalRow h1 {
        font-size: 30px; }
    .addressPickerModal .icModalContent .icModalBody {
      padding: 20px; }
    .addressPickerModal .icModalContent .address-form .inner-button-wrapper {
      width: 100%; }
      .addressPickerModal .icModalContent .address-form .inner-button-wrapper .ic-btn {
        display: block;
        width: 100%;
        margin: 0;
        margin-bottom: 10px; }
    .addressPickerModal .icModalContent .address-form .delete-btn-wrapper {
      width: 100%; }
      .addressPickerModal .icModalContent .address-form .delete-btn-wrapper .ic-btn {
        width: 100%; } }

#alcohol-disclaimer {
  display: none;
  text-align: center;
  padding-top: 20px; }
  #alcohol-disclaimer[data-route="express"] {
    color: white; }

.cart-popover .sub-header, .cart-popover .warehouse-cart .warehouse-cart-header .sub-warehouse-header, .cart-popover #cart-sidebar .warehouse-cart .warehouse-cart-header .sub-warehouse-header, #cart-sidebar .warehouse-cart .warehouse-cart-header .cart-popover .sub-warehouse-header, .cart-popover .warehouse-cart .warehouse-cart-header .sub-warehouse-cell, .cart-popover #cart-sidebar .warehouse-cart .warehouse-cart-header .sub-warehouse-cell, #cart-sidebar .warehouse-cart .warehouse-cart-header .cart-popover .sub-warehouse-cell, .cart-popover #cart-sidebar header .cart-description, #cart-sidebar header .cart-popover .cart-description, #cart-sidebar .sub-header, .cart-popover .warehouse-cart .warehouse-cart-header #cart-sidebar .sub-warehouse-header, #cart-sidebar .warehouse-cart .warehouse-cart-header .sub-warehouse-header, .cart-popover .warehouse-cart .warehouse-cart-header #cart-sidebar .sub-warehouse-cell, #cart-sidebar .warehouse-cart .warehouse-cart-header .sub-warehouse-cell, #cart-sidebar header .cart-description {
  background-color: #fbfaf9;
  padding: 6px 12px;
  margin: 0 0 2px 0;
  font-size: 13px;
  color: #777777;
  letter-spacing: initial;
  font-weight: 600; }

.cart-popover .visible-minimized, #cart-sidebar .visible-minimized {
  display: none; }

.cart-popover .visible-expanded, #cart-sidebar .visible-expanded {
  display: inherit; }

.cart-popover.minimized .visible-expanded, #cart-sidebar.minimized .visible-expanded {
  display: none; }

.cart-popover.minimized .visible-minimized, #cart-sidebar.minimized .visible-minimized {
  display: inherit; }

.cart-popover table, #cart-sidebar table {
  font-size: 13px;
  font-weight: normal;
  margin-bottom: 0; }
  .cart-popover table tfoot th, .cart-popover table .subtotals th, #cart-sidebar table tfoot th, #cart-sidebar table .subtotals th {
    text-align: right;
    color: #43B02A;
    font-weight: 500; }
  .cart-popover table tbody td, #cart-sidebar table tbody td {
    padding: 8px; }
    .cart-popover table tbody td.name, #cart-sidebar table tbody td.name {
      padding: 15px 8px; }
      .cart-popover table tbody td.name .item-clickable, #cart-sidebar table tbody td.name .item-clickable {
        width: 210px; }
        @media (max-width: 991px) {
          .cart-popover table tbody td.name .item-clickable, #cart-sidebar table tbody td.name .item-clickable {
            max-width: calc(100vw - 165px); } }
    .cart-popover table tbody td.price, #cart-sidebar table tbody td.price {
      padding: 15px 0; }

.cart-popover .qty, #cart-sidebar .qty {
  width: 50px;
  min-height: 50px;
  font-size: 16px;
  line-height: 16px;
  text-align: center;
  color: #929292; }
  .cart-popover .qty .change-qty, #cart-sidebar .qty .change-qty {
    display: inline-block;
    visibility: hidden;
    font-size: 20px;
    color: #929292;
    text-decoration: none; }
    .cart-popover .qty .change-qty:hover, #cart-sidebar .qty .change-qty:hover {
      color: #6e6e6e;
      text-decoration: none; }
    .cart-popover .qty .change-qty.qty-disabled, #cart-sidebar .qty .change-qty.qty-disabled {
      color: #dadada; }
      .cart-popover .qty .change-qty.qty-disabled:hover, #cart-sidebar .qty .change-qty.qty-disabled:hover {
        cursor: default; }

.cart-popover .image, #cart-sidebar .image {
  padding: 15px 0;
  width: 50px; }
  .cart-popover .image img, #cart-sidebar .image img {
    max-width: 42px;
    max-height: 42px;
    width: 42px;
    height: 42px; }

.cart-popover .remove-item, #cart-sidebar .remove-item {
  color: #929292; }
  .cart-popover .remove-item:hover, #cart-sidebar .remove-item:hover {
    color: #c58990;
    text-decoration: none; }

.cart-popover .item-clickable:hover, #cart-sidebar .item-clickable:hover {
  cursor: pointer; }

.cart-popover .special-instructions-box, #cart-sidebar .special-instructions-box {
  width: 150px;
  font-size: 11px;
  line-height: 11px;
  resize: none; }

.cart-popover .cart-bottom, #cart-sidebar .cart-bottom {
  width: 100%;
  background-color: #fff;
  color: #929292;
  font-weight: 400;
  display: block;
  font-size: 12px;
  text-align: center;
  text-decoration: none;
  letter-spacing: 1px;
  border-top: 1px solid #e5edec;
  line-height: 25px; }
  .cart-popover .cart-bottom.empty, #cart-sidebar .cart-bottom.empty {
    border: none; }
  .cart-popover .cart-bottom a, #cart-sidebar .cart-bottom a {
    color: #6e6e6e; }
    .cart-popover .cart-bottom a:hover, .cart-popover .cart-bottom a:active, #cart-sidebar .cart-bottom a:hover, #cart-sidebar .cart-bottom a:active {
      color: #777777; }
  .cart-popover .cart-bottom .cart-bottom-left, .cart-popover .cart-bottom .cart-bottom-right, #cart-sidebar .cart-bottom .cart-bottom-left, #cart-sidebar .cart-bottom .cart-bottom-right {
    float: left;
    width: 49%;
    padding: 10px 0;
    border-top: none;
    height: 25px; }
  .cart-popover .cart-bottom .cart-bottom-centered, #cart-sidebar .cart-bottom .cart-bottom-centered {
    padding: 10px 0;
    border-top: none;
    height: 25px; }
  .cart-popover .cart-bottom .new-badge, #cart-sidebar .cart-bottom .new-badge {
    color: #e74c3c;
    position: relative;
    top: -10px;
    font-size: 10px;
    font-weight: 600; }
  .cart-popover .cart-bottom .cart-bottom-left, #cart-sidebar .cart-bottom .cart-bottom-left {
    border-right: 1px solid #e5edec; }
  .cart-popover .cart-bottom .cart-bottom-right .fa,
  .cart-popover .cart-bottom .cart-bottom-centered .fa, #cart-sidebar .cart-bottom .cart-bottom-right .fa,
  #cart-sidebar .cart-bottom .cart-bottom-centered .fa {
    font-size: 20px;
    line-height: 20px;
    vertical-align: middle; }
  .cart-popover .cart-bottom a:hover, #cart-sidebar .cart-bottom a:hover {
    text-decoration: none; }

.cart-popover .delivery-fee-message, #cart-sidebar .delivery-fee-message {
  background-color: #e5edec;
  text-align: center;
  line-height: 1em;
  color: #798989;
  margin-left: -1px; }
  .cart-popover .delivery-fee-message .delivery-fee-message-content, #cart-sidebar .delivery-fee-message .delivery-fee-message-content {
    padding: 11px 0; }
  .cart-popover .delivery-fee-message .visible-expanded, #cart-sidebar .delivery-fee-message .visible-expanded {
    color: #A1AFAF;
    padding-top: 3px; }

.cart-popover .warehouse-cart .cart-items, #cart-sidebar .warehouse-cart .cart-items {
  font-size: 11px;
  padding: 0; }
  .cart-popover .warehouse-cart .cart-items .add-note, #cart-sidebar .warehouse-cart .cart-items .add-note {
    color: #438ead;
    display: inline;
    right: 10000px;
    position: absolute; }
    .cart-popover .warehouse-cart .cart-items .add-note:hover, #cart-sidebar .warehouse-cart .cart-items .add-note:hover {
      text-decoration: none; }
  .cart-popover .warehouse-cart .cart-items .remove-item, #cart-sidebar .warehouse-cart .cart-items .remove-item {
    font-size: 30px;
    font-weight: 100;
    line-height: 30px;
    text-shadow: none;
    margin-left: 10px; }
  .cart-popover .warehouse-cart .cart-items .discount-note, #cart-sidebar .warehouse-cart .cart-items .discount-note {
    padding-top: 5px; }
  .cart-popover .warehouse-cart .cart-items .friend-name, #cart-sidebar .warehouse-cart .cart-items .friend-name {
    font-size: 10px;
    margin: 0 0 0 10px;
    padding: 4px 9px;
    font-size: 12px;
    line-height: 12px;
    vertical-align: middle;
    color: #929292;
    background-color: #dadada;
    -moz-border-radius-topleft: 4px !important;
    -moz-border-radius-topright: 4px !important;
    -moz-border-radius-bottomright: 4px !important;
    -moz-border-radius-bottomleft: 4px !important;
    -webkit-border-top-left-radius: 4px !important;
    -webkit-border-top-right-radius: 4px !important;
    -webkit-border-bottom-right-radius: 4px !important;
    -webkit-border-bottom-left-radius: 4px !important;
    border-top-left-radius: 4px !important;
    border-top-right-radius: 4px !important;
    border-bottom-right-radius: 4px !important;
    border-bottom-left-radius: 4px !important; }
    .cart-popover .warehouse-cart .cart-items .friend-name:hover, #cart-sidebar .warehouse-cart .cart-items .friend-name:hover {
      cursor: pointer;
      color: #777777; }
  .cart-popover .warehouse-cart .cart-items .remove-cell, #cart-sidebar .warehouse-cart .cart-items .remove-cell {
    width: 40px;
    position: absolute;
    border: none;
    right: 10000px;
    margin-top: 15px;
    background-color: white;
    display: block;
    opacity: 0.8; }
    @media (max-width: 991px) {
      .cart-popover .warehouse-cart .cart-items .remove-cell, #cart-sidebar .warehouse-cart .cart-items .remove-cell {
        display: block;
        margin: 30px -8px 0 0;
        background-color: transparent;
        text-align: center; } }
  .cart-popover .warehouse-cart .cart-items tr, #cart-sidebar .warehouse-cart .cart-items tr {
    position: relative;
    border-bottom: 1px solid #dadada; }
    .cart-popover .warehouse-cart .cart-items tr:last-child, #cart-sidebar .warehouse-cart .cart-items tr:last-child {
      border-bottom: 0; }
  .cart-popover .warehouse-cart .cart-items td, #cart-sidebar .warehouse-cart .cart-items td {
    box-sizing: content-box; }
  .cart-popover .warehouse-cart .cart-items .name, #cart-sidebar .warehouse-cart .cart-items .name {
    width: 225px;
    color: #6e6e6e; }
  .cart-popover .warehouse-cart .cart-items .item-size, #cart-sidebar .warehouse-cart .cart-items .item-size {
    color: #929292; }
  .cart-popover .warehouse-cart .cart-items .price, #cart-sidebar .warehouse-cart .cart-items .price {
    width: 60px;
    color: #929292; }
    .cart-popover .warehouse-cart .cart-items .price .ic-loading .ic-spinner, #cart-sidebar .warehouse-cart .cart-items .price .ic-loading .ic-spinner {
      height: 12px;
      width: 12px; }
  .cart-popover .warehouse-cart .cart-items tr:hover .add-note, .cart-popover .warehouse-cart .cart-items tr:focus .add-note, .cart-popover .warehouse-cart .cart-items tr:active .add-note, #cart-sidebar .warehouse-cart .cart-items tr:hover .add-note, #cart-sidebar .warehouse-cart .cart-items tr:focus .add-note, #cart-sidebar .warehouse-cart .cart-items tr:active .add-note {
    right: 70px; }
  .cart-popover .warehouse-cart .cart-items tr:hover td.qty .change-qty, .cart-popover .warehouse-cart .cart-items tr:focus td.qty .change-qty, .cart-popover .warehouse-cart .cart-items tr:active td.qty .change-qty, #cart-sidebar .warehouse-cart .cart-items tr:hover td.qty .change-qty, #cart-sidebar .warehouse-cart .cart-items tr:focus td.qty .change-qty, #cart-sidebar .warehouse-cart .cart-items tr:active td.qty .change-qty {
    visibility: visible; }
  .cart-popover .warehouse-cart .cart-items tr:hover .remove-cell, .cart-popover .warehouse-cart .cart-items tr:focus .remove-cell, .cart-popover .warehouse-cart .cart-items tr:active .remove-cell, #cart-sidebar .warehouse-cart .cart-items tr:hover .remove-cell, #cart-sidebar .warehouse-cart .cart-items tr:focus .remove-cell, #cart-sidebar .warehouse-cart .cart-items tr:active .remove-cell {
    right: 0px; }

.cart-popover .warehouse-cart .warehouse-cart-header, #cart-sidebar .warehouse-cart .warehouse-cart-header {
  min-height: 20px;
  font-size: 13px;
  font-weight: normal;
  letter-spacing: 1px;
  color: #fff; }
  .cart-popover .warehouse-cart .warehouse-cart-header:hover, #cart-sidebar .warehouse-cart .warehouse-cart-header:hover {
    cursor: pointer; }
  .cart-popover .warehouse-cart .warehouse-cart-header .warehouse-name, #cart-sidebar .warehouse-cart .warehouse-cart-header .warehouse-name {
    font-size: 16px;
    line-height: 32px;
    margin-left: 5px;
    width: 175px; }
  .cart-popover .warehouse-cart .warehouse-cart-header .delivery-fee, #cart-sidebar .warehouse-cart .warehouse-cart-header .delivery-fee {
    display: inline-block;
    position: relative; }
  .cart-popover .warehouse-cart .warehouse-cart-header .main-warehouse-header, #cart-sidebar .warehouse-cart .warehouse-cart-header .main-warehouse-header {
    background-color: #438ead;
    padding: 12px;
    margin: 0; }
    .cart-popover .warehouse-cart .warehouse-cart-header .main-warehouse-header:hover, #cart-sidebar .warehouse-cart .warehouse-cart-header .main-warehouse-header:hover {
      cursor: pointer; }
    .cart-popover .warehouse-cart .warehouse-cart-header .main-warehouse-header.error, #cart-sidebar .warehouse-cart .warehouse-cart-header .main-warehouse-header.error {
      background-color: #d16c76;
      color: #fff; }
    .cart-popover .warehouse-cart .warehouse-cart-header .main-warehouse-header .ic-loading, #cart-sidebar .warehouse-cart .warehouse-cart-header .main-warehouse-header .ic-loading {
      position: absolute;
      bottom: -13px;
      right: 30px; }
      .cart-popover .warehouse-cart .warehouse-cart-header .main-warehouse-header .ic-loading .ic-spinner, #cart-sidebar .warehouse-cart .warehouse-cart-header .main-warehouse-header .ic-loading .ic-spinner {
        display: inline-block; }
    .cart-popover .warehouse-cart .warehouse-cart-header .main-warehouse-header .price-well.loading .ic-loading, #cart-sidebar .warehouse-cart .warehouse-cart-header .main-warehouse-header .price-well.loading .ic-loading {
      position: relative;
      bottom: inherit;
      right: inherit;
      height: 20px; }
      .cart-popover .warehouse-cart .warehouse-cart-header .main-warehouse-header .price-well.loading .ic-loading .ic-spinner, #cart-sidebar .warehouse-cart .warehouse-cart-header .main-warehouse-header .price-well.loading .ic-loading .ic-spinner {
        display: inline-block;
        width: 14px;
        height: 14px; }
  .cart-popover .warehouse-cart .warehouse-cart-header .sub-warehouse-header, #cart-sidebar .warehouse-cart .warehouse-cart-header .sub-warehouse-header {
    border-bottom: 1px solid #dadada;
    position: relative; }
    .cart-popover .warehouse-cart .warehouse-cart-header .sub-warehouse-header.sub-warehouse-header-dark, #cart-sidebar .warehouse-cart .warehouse-cart-header .sub-warehouse-header.sub-warehouse-header-dark {
      background-color: #36778d;
      color: #fff;
      margin: -2px auto;
      font-weight: 400;
      letter-spacing: 0.05em; }
    .cart-popover .warehouse-cart .warehouse-cart-header .sub-warehouse-header.error, #cart-sidebar .warehouse-cart .warehouse-cart-header .sub-warehouse-header.error {
      background-color: #d16c76;
      color: #fff; }
    .cart-popover .warehouse-cart .warehouse-cart-header .sub-warehouse-header .ic-icon-info, #cart-sidebar .warehouse-cart .warehouse-cart-header .sub-warehouse-header .ic-icon-info {
      font-size: 14px;
      display: inline-block;
      margin-left: 5px;
      margin-top: 2px;
      float: right; }
  .cart-popover .warehouse-cart .warehouse-cart-header .sub-warehouse-cell, #cart-sidebar .warehouse-cart .warehouse-cart-header .sub-warehouse-cell {
    border-bottom: 1px solid #dadada;
    position: relative;
    font-weight: 400;
    background-color: #fcfcfc;
    min-height: 37px; }
    .cart-popover .warehouse-cart .warehouse-cart-header .sub-warehouse-cell:hover .remove-sub-warehouse-cell, #cart-sidebar .warehouse-cart .warehouse-cart-header .sub-warehouse-cell:hover .remove-sub-warehouse-cell {
      visibility: visible; }
    .cart-popover .warehouse-cart .warehouse-cart-header .sub-warehouse-cell .remove-sub-warehouse-cell, #cart-sidebar .warehouse-cart .warehouse-cart-header .sub-warehouse-cell .remove-sub-warehouse-cell {
      float: right;
      font-size: 30px;
      font-weight: 100;
      line-height: 30px;
      text-shadow: none;
      visibility: hidden;
      color: #777777; }
      .cart-popover .warehouse-cart .warehouse-cart-header .sub-warehouse-cell .remove-sub-warehouse-cell:hover, #cart-sidebar .warehouse-cart .warehouse-cart-header .sub-warehouse-cell .remove-sub-warehouse-cell:hover {
        text-decoration: none;
        color: #c58990; }
    .cart-popover .warehouse-cart .warehouse-cart-header .sub-warehouse-cell .image, #cart-sidebar .warehouse-cart .warehouse-cart-header .sub-warehouse-cell .image {
      min-width: 75px;
      margin-left: 15px;
      float: left;
      text-align: center; }
      .cart-popover .warehouse-cart .warehouse-cart-header .sub-warehouse-cell .image img, #cart-sidebar .warehouse-cart .warehouse-cart-header .sub-warehouse-cell .image img {
        width: 40px;
        height: auto;
        min-height: 30px; }

.cart-popover .warehouse-cart .price-well, #cart-sidebar .warehouse-cart .price-well {
  -webkit-border-radius: 3px;
  -moz-border-radius: 3px;
  border-radius: 3px;
  padding: 6px 14px;
  display: inline-block;
  background-color: #36778d;
  color: #fff;
  margin: 0 3px; }
  .cart-popover .warehouse-cart .price-well.error, #cart-sidebar .warehouse-cart .price-well.error {
    background-color: #d16c76;
    color: #fff; }

.cart-popover .warehouse-cart.collapsed .main-warehouse-header, #cart-sidebar .warehouse-cart.collapsed .main-warehouse-header {
  background-color: #9ec3cd; }

.cart-popover .warehouse-cart.collapsed .price-well, #cart-sidebar .warehouse-cart.collapsed .price-well {
  background-color: #6c9dac; }
  .cart-popover .warehouse-cart.collapsed .price-well.error, #cart-sidebar .warehouse-cart.collapsed .price-well.error {
    background-color: #c58990; }

.cart-popover .warehouse-cart.collapsed .sub-warehouse-header, #cart-sidebar .warehouse-cart.collapsed .sub-warehouse-header {
  display: none; }

#cart-sidebar {
  height: 100%;
  position: fixed;
  width: 380px;
  background-color: #ffffff;
  z-index: 1020;
  right: 0px;
  top: 56px;
  -webkit-transition: all 450ms cubic-bezier(0.23, 1, 0.32, 1) 0ms;
  -moz-transition: all 450ms cubic-bezier(0.23, 1, 0.32, 1) 0ms;
  transition: all 450ms cubic-bezier(0.23, 1, 0.32, 1) 0ms; }
  #cart-sidebar.has-nav-banner {
    top: 156px; }
  #cart-sidebar header {
    background: #3c5555;
    -webkit-user-select: none;
    -moz-user-select: none;
    -ms-user-select: none;
    user-select: none;
    -moz-box-shadow: none;
    -webkit-box-shadow: none;
    box-shadow: none; }
    #cart-sidebar header .header-controls {
      margin-right: 5px;
      padding: 8px; }
      #cart-sidebar header .header-controls strong {
        padding: 0 5px; }
      #cart-sidebar header .header-controls .btn-group {
        margin-right: 5px; }
    #cart-sidebar header strong small {
      font-weight: normal;
      margin-left: 5px; }
    #cart-sidebar header .cart-description {
      line-height: 30px;
      height: 30px;
      text-overflow: ellipsis;
      overflow: hidden;
      white-space: nowrap; }
      #cart-sidebar header .cart-description:empty {
        display: none; }
    #cart-sidebar header .shop-with-friends-banner {
      border-top: 0;
      border-left: 0;
      border-right: 0;
      margin-bottom: 0;
      padding: 15px 0 15px 65px;
      background-color: #fff;
      color: #43B02A;
      font-weight: 600;
      background-image: url(Fruit-517d1f1b7b97fb8a5976331cc2b40c03.png);
      background-repeat: no-repeat;
      background-size: 50px;
      background-position: 10px 20px;
      overflow: hidden; }
      @media only screen and (-webkit-min-device-pixel-ratio: 1.3), only screen and (min--moz-device-pixel-ratio: 1.3), only screen and (-o-min-device-pixel-ratio: 1.3 / 1), only screen and (min-resolution: 125dpi), only screen and (min-resolution: 1.3dppx) {
        #cart-sidebar header .shop-with-friends-banner {
          background-image: url(Fruit@2x-0bbff0e43e7f6109ecbfadfb18255028.png);
          background-size: 50px; } }
      #cart-sidebar header .shop-with-friends-banner:hover {
        cursor: pointer; }
      #cart-sidebar header .shop-with-friends-banner .fa {
        font-size: 18px;
        line-height: 18px; }
      #cart-sidebar header .shop-with-friends-banner p {
        font-size: 16px;
        margin: 0;
        display: inline-block;
        max-width: 95px;
        float: left;
        line-height: 33px;
        margin-right: 5px; }
      #cart-sidebar header .shop-with-friends-banner .friend-count {
        font-size: 10px;
        font-weight: 400;
        display: inline-block;
        line-height: 34px;
        vertical-align: middle; }
      #cart-sidebar header .shop-with-friends-banner .back-to-original-cart,
      #cart-sidebar header .shop-with-friends-banner .back-to-cart-items {
        border-color: #43B02A;
        color: #43B02A;
        margin-right: 20px;
        padding: 6px;
        font-size: 12px;
        margin-top: 2px; }
      #cart-sidebar header .shop-with-friends-banner .back-to-cart-items {
        display: none; }
      #cart-sidebar header .shop-with-friends-banner.overlay-visible .back-to-cart-items {
        display: inline-block; }
      #cart-sidebar header .shop-with-friends-banner.overlay-visible .back-to-original-cart {
        display: none; }
  #cart-sidebar.minimized {
    -webkit-transform: translateX(416px);
    -moz-transform: translateX(416px);
    -ms-transform: translateX(416px);
    -o-transform: translateX(416px);
    transform: translateX(416px);
    display: none; }
    #cart-sidebar.minimized .visible-minimized {
      margin-top: 2px; }
    #cart-sidebar.minimized .visible-expanded {
      display: none; }
    #cart-sidebar.minimized header {
      display: none; }
    #cart-sidebar.minimized section {
      display: none; }
    @media (max-width: 991px) {
      #cart-sidebar.minimized {
        -webkit-transform: translateX(100vw);
        -moz-transform: translateX(100vw);
        -ms-transform: translateX(100vw);
        -o-transform: translateX(100vw);
        transform: translateX(100vw); } }
  #cart-sidebar .alert-info {
    margin: 0 -1px -1px -1px;
    padding: 12px 10px 12px 10px;
    text-align: center;
    color: #43B02A;
    text-shadow: none;
    background-color: #fff;
    border-bottom: 0;
    border-left: 1px solid #e5edec;
    border-top: 0; }
  #cart-sidebar #order-alerts {
    position: relative; }
  #cart-sidebar section {
    position: relative; }
  #cart-sidebar .cart-sidebar-overlay {
    position: absolute;
    top: 0;
    bottom: 0;
    left: 0;
    right: 0;
    background-color: #000;
    opacity: 0.50;
    z-index: 1;
    display: none; }
  #cart-sidebar .cart-overlay {
    position: absolute;
    background: #fff;
    background: rgba(255, 255, 255, 0.95);
    z-index: 10;
    width: 100%;
    overflow: hidden; }
    #cart-sidebar .cart-overlay .share-cart-link-banner {
      background-color: #CBF1C4;
      padding: 15px;
      width: 100%; }
      #cart-sidebar .cart-overlay .share-cart-link-banner .cart-share-link {
        width: 180px;
        margin-left: 8px; }
      #cart-sidebar .cart-overlay .share-cart-link-banner a {
        color: #43B02A; }
      #cart-sidebar .cart-overlay .share-cart-link-banner p {
        margin: 0;
        margin-bottom: 5px; }
        #cart-sidebar .cart-overlay .share-cart-link-banner p.sit-tight {
          text-align: justify;
          color: #6e6e6e;
          font-size: 14px;
          line-height: 20px;
          width: 300px;
          margin: 10px auto; }
    #cart-sidebar .cart-overlay .checking-out-banner {
      margin: 50px 0; }
      #cart-sidebar .cart-overlay .checking-out-banner .fa {
        font-size: 90px;
        line-height: 90px;
        color: #9b9b9b; }
      #cart-sidebar .cart-overlay .checking-out-banner .ic-strikethrough-header {
        margin-bottom: 30px; }
      #cart-sidebar .cart-overlay .checking-out-banner p {
        font-size: 20px;
        line-height: 20px;
        margin: 20px 0; }
    #cart-sidebar .cart-overlay .cart-users {
      padding: 10px 0; }
      #cart-sidebar .cart-overlay .cart-users .cart-user {
        position: relative;
        padding: 12px 20px;
        font-size: 20px;
        line-height: 25px;
        vertical-align: middle;
        border-bottom: 1px solid #e5e5e5; }
        #cart-sidebar .cart-overlay .cart-users .cart-user:hover {
          cursor: default; }
        #cart-sidebar .cart-overlay .cart-users .cart-user .online, #cart-sidebar .cart-overlay .cart-users .cart-user .offline, #cart-sidebar .cart-overlay .cart-users .cart-user .checking-out {
          padding: 4px 15px;
          font-size: 20px;
          line-height: 36px;
          vertical-align: middle;
          float: right;
          font-weight: 300; }
        #cart-sidebar .cart-overlay .cart-users .cart-user .user-name {
          max-width: 230px;
          display: inline-block;
          overflow: hidden;
          text-overflow: ellipsis;
          white-space: nowrap;
          padding: 4px 16px;
          border-radius: 20px;
          background-color: #e6e6e6;
          color: #9b9b9b; }
        #cart-sidebar .cart-overlay .cart-users .cart-user.online .user-name {
          background-color: #CBF1C4;
          color: #43B02A; }
        #cart-sidebar .cart-overlay .cart-users .cart-user .online {
          color: #43B02A; }
        #cart-sidebar .cart-overlay .cart-users .cart-user .offline {
          color: #929292; }
        #cart-sidebar .cart-overlay .cart-users .cart-user .checking-out {
          color: #36778d;
          margin-right: 8px; }
        #cart-sidebar .cart-overlay .cart-users .cart-user .removeSharedUser, #cart-sidebar .cart-overlay .cart-users .cart-user .paddingRemoveUser {
          color: #E8104A;
          margin-right: 8px;
          float: right;
          padding: 0;
          font-size: 36px;
          line-height: 36px;
          vertical-align: middle; }
        #cart-sidebar .cart-overlay .cart-users .cart-user .removeSharedUser {
          padding-top: 5px;
          position: absolute;
          right: 0px; }
          #cart-sidebar .cart-overlay .cart-users .cart-user .removeSharedUser:hover {
            cursor: pointer; }
  #cart-sidebar .cart-wrapper {
    background-color: #fff;
    box-shadow: 0px 1px 5px 0px rgba(0, 0, 0, 0.16), 0px 1px 2px 0px rgba(0, 0, 0, 0.26);
    overflow-y: auto;
    overflow-x: hidden;
    position: relative;
    padding-top: 0;
    width: 100%; }
    #cart-sidebar .cart-wrapper .btn-hollow {
      display: inline-block;
      margin: 0 auto 10px auto;
      width: 295px; }
    #cart-sidebar .cart-wrapper tr:hover .remove-cell,
    #cart-sidebar .cart-wrapper tr:focus .remove-cell,
    #cart-sidebar .cart-wrapper tr:active .remove-cell {
      display: block; }
    #cart-sidebar .cart-wrapper .empty-cart-notice {
      color: #929292;
      margin-top: 100px; }
      #cart-sidebar .cart-wrapper .empty-cart-notice h3, #cart-sidebar .cart-wrapper .empty-cart-notice h4, #cart-sidebar .cart-wrapper .empty-cart-notice h5 {
        font-weight: 300; }
      #cart-sidebar .cart-wrapper .empty-cart-notice h3 {
        margin: 15px 0 25px 0; }
  #cart-sidebar .cart-options {
    box-shadow: 0px 3px 5px 0px rgba(0, 0, 0, 0.16), 0px 1px 2px 0px rgba(0, 0, 0, 0.26);
    background-color: #fff;
    position: relative;
    top: 0; }
    @media (max-width: 991px) {
      #cart-sidebar .cart-options {
        position: fixed;
        bottom: 0;
        top: inherit;
        width: 100vw; } }
  #cart-sidebar .cart-reserved-time.enabled {
    background-color: #dff0d8; }
    #cart-sidebar .cart-reserved-time.enabled .reserved-time-checkbox {
      background-image: url(check-mark-e867212fbc8a98e8871770bb5208abd6.png); }
  #cart-sidebar .cart-reserved-time {
    background-color: #F0EFEC;
    width: 100%;
    display: table; }
    #cart-sidebar .cart-reserved-time .reserved-time-checkbox {
      display: table-cell;
      background-repeat: no-repeat;
      background-position: center;
      min-width: 54px;
      min-height: 66px;
      background-image: url(check-mark-off-1b379adbc5f865604ef2b0b56a1ecad7.png); }
    #cart-sidebar .cart-reserved-time .cart-reserved-time-row {
      display: table-row; }
    #cart-sidebar .cart-reserved-time h4 {
      margin: 0;
      color: #393939;
      font-weight: 600;
      font-size: 14px; }
    #cart-sidebar .cart-reserved-time .reserved-time-detail {
      display: table-cell;
      padding: 20px 0;
      font-size: 12px; }
    #cart-sidebar .cart-reserved-time .reserved-time-clock {
      display: table-cell;
      background-image: url(clock-green-large-8ee927bbc1074f3b2e1f67146067808d.png);
      background-repeat: no-repeat;
      background-position: center;
      background-size: 65px 46px;
      min-width: 85px;
      min-height: 66px; }
    #cart-sidebar .cart-reserved-time .reserved-time {
      margin-top: 6px;
      color: #5b5b5b; }
  #cart-sidebar .cart-checkout {
    background-color: #fff;
    border-top: 1px solid #e5edec;
    padding: 18px;
    display: block;
    height: inherit; }
    #cart-sidebar .cart-checkout .checkout-divider {
      height: 0;
      border-top: 1px solid #6e6e6e;
      margin: 20px auto;
      width: 85%; }
      #cart-sidebar .cart-checkout .checkout-divider span {
        color: #929292;
        line-height: 12px;
        font-size: 12px;
        font-weight: 600px;
        letter-spacing: 1px;
        background-color: #FFF;
        position: absolute;
        left: 180px;
        padding: 0 5px;
        background: #FFF;
        margin-top: -6px; }
  #cart-sidebar .how-to-add-items {
    font-size: 13px; }
    #cart-sidebar .how-to-add-items li {
      text-align: left; }
  #cart-sidebar .btn-checkout, #cart-sidebar .btn-merge {
    margin: auto;
    width: 100%; }
  #cart-sidebar .btn-hollow.btn-merge {
    text-transform: none; }
  #cart-sidebar .ic-btn.btn-merge.hide {
    display: none; }
  #cart-sidebar .btn-checkout {
    position: relative;
    background-color: #FF5600;
    color: #fff;
    border-color: #FF5600; }
    #cart-sidebar .btn-checkout .price-well {
      -moz-border-radius-topleft: 4px !important;
      -moz-border-radius-topright: 4px !important;
      -moz-border-radius-bottomright: 4px !important;
      -moz-border-radius-bottomleft: 4px !important;
      -webkit-border-top-left-radius: 4px !important;
      -webkit-border-top-right-radius: 4px !important;
      -webkit-border-bottom-right-radius: 4px !important;
      -webkit-border-bottom-left-radius: 4px !important;
      border-top-left-radius: 4px !important;
      border-top-right-radius: 4px !important;
      border-bottom-right-radius: 4px !important;
      border-bottom-left-radius: 4px !important;
      background-color: #E44C00;
      border: 1px solid transparent;
      right: 10px;
      top: 10px;
      padding: 4px 8px;
      position: absolute;
      font-size: 14px; }
    #cart-sidebar .btn-checkout .price-well.loading .ic-loading .ic-spinner {
      height: 12px;
      width: 12px; }
  #cart-sidebar .cart-close-header {
    display: none; }
  #cart-sidebar.silver-surfer-nav {
    width: 415px;
    height: 100vh;
    top: 0; }
    #cart-sidebar.silver-surfer-nav .cart-close-header {
      display: block;
      height: 56px;
      padding: 12px;
      border-bottom: 1px solid #e5edec;
      border-left: 1px solid #e5edec; }
      #cart-sidebar.silver-surfer-nav .cart-close-header .close-cart {
        border-color: #43B02A;
        color: #43B02A;
        font-size: 16px; }
        #cart-sidebar.silver-surfer-nav .cart-close-header .close-cart .ic-icon {
          margin-right: 5px; }
      #cart-sidebar.silver-surfer-nav .cart-close-header p {
        font-size: 20px;
        font-weight: normal;
        color: #757575;
        margin: 0;
        display: inline-block;
        padding-left: 5px;
        vertical-align: -webkit-baseline-middle; }
    #cart-sidebar.silver-surfer-nav .warehouse-cart .cart-items .remove-cell {
      width: 50px; }

@media (max-width: 991px) {
  #cart-sidebar,
  #cart-sidebar.silver-surfer-nav {
    width: 100vw; } }

.cart-popover {
  position: relative; }
  .cart-popover .delivery-fee-message {
    display: none;
    position: absolute;
    top: 59px;
    left: 0;
    right: 0; }
  .cart-popover.minimized .delivery-fee-message {
    display: inherit; }
  .cart-popover .nav-content {
    margin: 0;
    width: 380px;
    height: 42px;
    color: #909b9c;
    font-size: 13px;
    font-weight: normal;
    letter-spacing: 1px;
    color: #929292;
    padding: 16px 12px 0 14px; }
    .cart-popover .nav-content:hover {
      cursor: pointer;
      background-color: #487943; }
      .cart-popover .nav-content:hover .toggle-cart {
        color: #fff; }
      .cart-popover .nav-content:hover .btn-checkout-mini {
        background-color: #DB9420 !important; }
      .cart-popover .nav-content:hover .icon-shopping-cart {
        color: #fff; }
      .cart-popover .nav-content:hover .items-total, .cart-popover .nav-content:hover .delivery-total, .cart-popover .nav-content:hover .items-count {
        color: #fff; }
      .cart-popover .nav-content:hover .truck-icon {
        display: none; }
        .cart-popover .nav-content:hover .truck-icon.light {
          display: inline-block; }
      .cart-popover .nav-content:hover .pickup-icon {
        display: none; }
        .cart-popover .nav-content:hover .pickup-icon.light {
          display: inline-block; }
    .cart-popover .nav-content .icon-shopping-cart, .cart-popover .nav-content .toggle-cart {
      float: left;
      vertical-align: middle;
      font-size: 26px;
      color: #43B02A;
      padding: 0 6px 0 8px;
      line-height: 30px; }
    .cart-popover .nav-content .truck-icon.light {
      display: none; }
    .cart-popover .nav-content .pickup-icon.light {
      display: none; }
    .cart-popover .nav-content .btn-group {
      margin: 0; }
      .cart-popover .nav-content .btn-group .btn-checkout-mini {
        padding: 9px 12px;
        margin-top: 1px;
        color: #fff !important;
        text-transform: uppercase;
        font-size: 12px;
        line-height: 12px; }
      .cart-popover .nav-content .btn-group .btn-item-total {
        background-color: #DB9420 !important; }
        .cart-popover .nav-content .btn-group .btn-item-total:hover {
          background-color: #DB9420 !important;
          margin: inherit !important; }
        .cart-popover .nav-content .btn-group .btn-item-total:active {
          background-color: #DB9420 !important;
          margin: inherit !important;
          -moz-box-shadow: none;
          -webkit-box-shadow: none;
          box-shadow: none; }
      .cart-popover .nav-content .btn-group .btn-checkout-label {
        background-color: #F5A623 !important; }
        .cart-popover .nav-content .btn-group .btn-checkout-label:hover {
          background-color: #F5A623 !important; }
        .cart-popover .nav-content .btn-group .btn-checkout-label:active {
          background-color: #F5A623 !important; }
    .cart-popover .nav-content .toggle-cart {
      width: 14px;
      font-size: 18px;
      color: #929292; }
      .cart-popover .nav-content .toggle-cart.hide {
        display: none; }
    .cart-popover .nav-content .delivery-total {
      margin: 5px 5px 0 0; }
  .cart-popover .items-count, .cart-popover .delivery-total {
    display: inline-block;
    margin-top: 5px; }
  .cart-popover .popover {
    font-family: "Open Sans", "Helvetica Neue", Helvetica, sans-serif;
    top: 0;
    left: inherit;
    right: 10px;
    opacity: 0;
    width: 385px;
    max-width: 385px;
    border: none;
    box-shadow: 0 22px 70px 4px rgba(0, 0, 0, 0.56);
    padding: 0;
    border: 1px solid #ccc;
    overflow: inherit !important;
    transition: opacity .2s ease-out;
    -moz-transition: opacity .2s ease-out;
    -webkit-transition: opacity .2s ease-out;
    -o-transition: opacity .2s ease-out; }
    .cart-popover .popover:hover {
      cursor: default;
      box-shadow: 0px 2px 25px rgba(0, 0, 0, 0.25); }
    .cart-popover .popover.in {
      opacity: 1; }
    .cart-popover .popover .delivery-alert {
      text-align: center;
      width: 100%;
      height: 42px; }
      .cart-popover .popover .delivery-alert .inner-alert-content {
        margin-top: 20px; }
    .cart-popover .popover .popover-content {
      padding: 0;
      padding-top: 9px; }
    .cart-popover .popover .warehouse-cart .warehouse-cart-header {
      font-size: 12px; }
    .cart-popover .popover .warehouse-cart .cart-items table {
      margin-top: -10px; }
      .cart-popover .popover .warehouse-cart .cart-items table td {
        border: none;
        vertical-align: middle; }
    .cart-popover .popover .warehouse-cart .pull-right {
      margin-top: -6px; }
    .cart-popover .popover .warehouse-cart .sub-warehouse-header {
      border-bottom: none; }

.cart-popover .cart-items .popover-row {
  border-bottom: 1px solid #CCCCCC; }
  .cart-popover .cart-items .popover-row:last-child {
    border-bottom: none; }
  .cart-popover .cart-items .popover-row .popover-item {
    display: table; }
  .cart-popover .cart-items .popover-row .popover-cell {
    display: table-cell;
    vertical-align: middle; }

.cart-popover .popover {
  margin-top: 10px; }
  .cart-popover .popover .arrow {
    left: 335px;
    top: -10px;
    margin-left: -10px;
    border-width: 0 10px 10px;
    position: absolute;
    display: inline-block;
    width: 0;
    height: 0;
    border-color: transparent;
    border-style: solid;
    border-bottom-color: #ffffff; }
    .cart-popover .popover .arrow:after {
      border-width: 0 11px 11px;
      top: -1px;
      left: -11px;
      content: "";
      z-index: -1;
      position: absolute;
      display: inline-block;
      width: 0;
      height: 0;
      border-color: transparent;
      border-style: solid;
      border-bottom-color: rgba(0, 0, 0, 0.25); }

ul.credit-cards a, ul.loyalty-cards a {
  text-decoration: none;
  display: block; }

ul.credit-cards li, ul.loyalty-cards li {
  margin: 8px 3px 20px 3px;
  height: 50px;
  width: 83px;
  box-sizing: content-box;
  display: inline-block;
  float: left; }
  ul.credit-cards li:hover, ul.loyalty-cards li:hover {
    cursor: pointer; }
  ul.credit-cards li.add-credit-card, ul.credit-cards li.add-loyalty-card, ul.loyalty-cards li.add-credit-card, ul.loyalty-cards li.add-loyalty-card {
    border: 1px solid #757575;
    border-radius: 10px;
    color: #757575;
    background: transparent; }
    ul.credit-cards li.add-credit-card:hover, ul.credit-cards li.add-loyalty-card:hover, ul.loyalty-cards li.add-credit-card:hover, ul.loyalty-cards li.add-loyalty-card:hover {
      border-color: #438ead;
      background-color: #438ead; }
      ul.credit-cards li.add-credit-card:hover .credit-card-label, ul.credit-cards li.add-credit-card:hover .loyalty-card-label, ul.credit-cards li.add-loyalty-card:hover .credit-card-label, ul.credit-cards li.add-loyalty-card:hover .loyalty-card-label, ul.loyalty-cards li.add-credit-card:hover .credit-card-label, ul.loyalty-cards li.add-credit-card:hover .loyalty-card-label, ul.loyalty-cards li.add-loyalty-card:hover .credit-card-label, ul.loyalty-cards li.add-loyalty-card:hover .loyalty-card-label {
        color: #438ead; }
    ul.credit-cards li.add-credit-card i, ul.credit-cards li.add-loyalty-card i, ul.loyalty-cards li.add-credit-card i, ul.loyalty-cards li.add-loyalty-card i {
      font-size: 30px;
      position: relative;
      top: 12px;
      left: 30px; }
    ul.credit-cards li.add-credit-card .credit-card-label, ul.credit-cards li.add-credit-card .loyalty-card-label, ul.credit-cards li.add-loyalty-card .credit-card-label, ul.credit-cards li.add-loyalty-card .loyalty-card-label, ul.loyalty-cards li.add-credit-card .credit-card-label, ul.loyalty-cards li.add-credit-card .loyalty-card-label, ul.loyalty-cards li.add-loyalty-card .credit-card-label, ul.loyalty-cards li.add-loyalty-card .loyalty-card-label {
      padding-top: 22px; }
  ul.credit-cards li .credit-card-label, ul.credit-cards li .loyalty-card-label, ul.loyalty-cards li .credit-card-label, ul.loyalty-cards li .loyalty-card-label {
    font-weight: bold;
    font-size: 11px;
    color: #757575;
    padding-top: 32px;
    line-height: 12px; }
  ul.credit-cards li.credit-card, ul.loyalty-cards li.credit-card {
    background-color: #2e4443;
    border: 3px solid #fff;
    background: url(creditcards-3e439d861457b3b3b740394bdaa801d3.png) -510px 0 no-repeat;
    position: relative; }
    ul.credit-cards li.credit-card.selected, ul.loyalty-cards li.credit-card.selected {
      border: 3px solid #438ead;
      border-radius: 10px; }
      ul.credit-cards li.credit-card.selected i.icon-check, ul.loyalty-cards li.credit-card.selected i.icon-check {
        color: #f0efec;
        background-color: #438ead;
        border: 3px solid #438ead;
        position: relative;
        top: 32px;
        left: -29px;
        border-radius: 0 6px 0 6px; }
      ul.credit-cards li.credit-card.selected .credit-card-label, ul.loyalty-cards li.credit-card.selected .credit-card-label {
        color: #438ead;
        padding-top: 32px; }
    ul.credit-cards li.credit-card.default:after, ul.loyalty-cards li.credit-card.default:after {
      content: "\E026";
      font-family: 'ic-icons' !important;
      font-style: normal !important;
      font-weight: normal !important;
      font-variant: normal !important;
      text-transform: none !important;
      speak: none;
      line-height: 1;
      -webkit-font-smoothing: antialiased;
      -moz-osx-font-smoothing: grayscale;
      position: absolute;
      top: -6px;
      right: -5px;
      color: #F7A700;
      font-size: 16px; }
    ul.credit-cards li.credit-card .last-four, ul.loyalty-cards li.credit-card .last-four {
      font-size: 11px;
      color: #c0d3d1;
      position: relative;
      left: 44px;
      top: 2px; }
    ul.credit-cards li.credit-card:hover, ul.loyalty-cards li.credit-card:hover {
      background-position: -510px -52px;
      color: #bfbebb; }
      ul.credit-cards li.credit-card:hover i.icon-check, ul.loyalty-cards li.credit-card:hover i.icon-check {
        background-color: #438ead;
        color: #f0efec; }
      ul.credit-cards li.credit-card:hover .credit-card-label, ul.loyalty-cards li.credit-card:hover .credit-card-label {
        color: #438ead; }
    ul.credit-cards li.credit-card.Visa, ul.loyalty-cards li.credit-card.Visa {
      background-position: 0px 0; }
      ul.credit-cards li.credit-card.Visa:hover, ul.loyalty-cards li.credit-card.Visa:hover {
        background-position: 0px -52px; }
    ul.credit-cards li.credit-card.MasterCard, ul.loyalty-cards li.credit-card.MasterCard {
      background-position: -85px 0; }
      ul.credit-cards li.credit-card.MasterCard:hover, ul.loyalty-cards li.credit-card.MasterCard:hover {
        background-position: -85px -52px; }
    ul.credit-cards li.credit-card.AmericanExpress, ul.loyalty-cards li.credit-card.AmericanExpress {
      background-position: -170px 0; }
      ul.credit-cards li.credit-card.AmericanExpress:hover, ul.loyalty-cards li.credit-card.AmericanExpress:hover {
        background-position: -170px -52px; }
    ul.credit-cards li.credit-card.Discover, ul.loyalty-cards li.credit-card.Discover {
      background-position: -255px 0; }
      ul.credit-cards li.credit-card.Discover:hover, ul.loyalty-cards li.credit-card.Discover:hover {
        background-position: -255px -52px; }
    ul.credit-cards li.credit-card.JCB, ul.loyalty-cards li.credit-card.JCB {
      background-position: -340px 0; }
      ul.credit-cards li.credit-card.JCB:hover, ul.loyalty-cards li.credit-card.JCB:hover {
        background-position: -340px -52px; }
    ul.credit-cards li.credit-card.DinersClub, ul.loyalty-cards li.credit-card.DinersClub {
      background-position: -425px 0; }
      ul.credit-cards li.credit-card.DinersClub:hover, ul.loyalty-cards li.credit-card.DinersClub:hover {
        background-position: -425px -52px; }

.checkout-card {
  background-color: #fff;
  border: 1px solid #e5edec;
  margin: 0 auto; }

.checkout-container {
  max-width: 1000px;
  margin: 0 auto; }

#order-status.delivery .inline-address .btn.btn-inline-address {
  background-color: #438ead !important; }

#order-status.delivery .addresses .tooltip .tooltip-inner {
  background-color: #438ead; }

#order-status.delivery .addresses .tooltip.bottom .tooltip-arrow {
  border-bottom-color: #438ead; }

#order-status.delivery .addresses .address {
  border: none;
  padding: 0; }
  #order-status.delivery .addresses .address:hover {
    background-color: initial; }

#order-status.delivery .addresses li.selected .address-label {
  color: #438ead; }

#order-status.delivery .addresses li.selected .address-type {
  border-color: #438ead;
  background-color: #438ead; }

#order-status.delivery .addresses li:hover .address-label {
  color: #438ead; }

#order-status.delivery .addresses li:hover .address-type {
  border-color: #438ead;
  background-color: #438ead; }

#order-status.payment .btn-tip, #order-status.payment .btn-tip-other {
  color: #438ead; }
  #order-status.payment .btn-tip small, #order-status.payment .btn-tip-other small {
    font-size: 11px;
    color: #61828f; }
  #order-status.payment .btn-tip.btn-success, #order-status.payment .btn-tip-other.btn-success {
    background-color: #438ead !important;
    padding: 13px 25px; }
    #order-status.payment .btn-tip.btn-success small, #order-status.payment .btn-tip-other.btn-success small {
      font-size: 11px;
      color: #ecf2f5; }
    #order-status.payment .btn-tip.btn-success:hover:not(.disabled):not([disabled]), #order-status.payment .btn-tip-other.btn-success:hover:not(.disabled):not([disabled]) {
      background-color: #438ead !important; }

#order-status .delivery-date:hover .down-arrow, #order-status .delivery-time:hover .down-arrow, #order-status .delivery-day-chooser:hover .down-arrow, #order-status .pickup-location-chooser:hover .down-arrow {
  background-color: #438ead;
  border-color: #438ead; }

#order-status .delivery-date .needs-selection, #order-status .delivery-time .needs-selection, #order-status .delivery-day-chooser .needs-selection, #order-status .pickup-location-chooser .needs-selection {
  color: #9b9b9b; }

#order-status ol.delivery-options li.selected, #order-status .delivery-day-options li.selected, #order-status .pickup-location-options li.selected {
  background-color: #438ead;
  border-color: #438ead; }

#order-status ol.delivery-options li:hover, #order-status .delivery-day-options li:hover, #order-status .pickup-location-options li:hover {
  background-color: #438ead;
  border-color: #438ead; }

/* high-contrast-mode */
.high-contrast-mode ul.credit-cards li.credit-card,
.high-contrast-mode ul.loyalty-cards li.credit-card {
  background: #fff;
  border: 1px solid #000; }
  .high-contrast-mode ul.credit-cards li.credit-card .credit-card-label,
  .high-contrast-mode ul.credit-cards li.credit-card .last-four,
  .high-contrast-mode ul.loyalty-cards li.credit-card .credit-card-label,
  .high-contrast-mode ul.loyalty-cards li.credit-card .last-four {
    color: #000; }

.high-contrast-mode ul.credit-cards li .credit-card-label,
.high-contrast-mode ul.loyalty-cards li .credit-card-label {
  color: #000; }

.date-chooser {
  display: inline;
  background: #FFF;
  color: #666;
  border: 1px solid #e5edec;
  -moz-box-shadow: none;
  -webkit-box-shadow: none;
  box-shadow: none;
  -moz-border-radius-topleft: 8px !important;
  -moz-border-radius-topright: 8px !important;
  -moz-border-radius-bottomright: 8px !important;
  -moz-border-radius-bottomleft: 8px !important;
  -webkit-border-top-left-radius: 8px !important;
  -webkit-border-top-right-radius: 8px !important;
  -webkit-border-bottom-right-radius: 8px !important;
  -webkit-border-bottom-left-radius: 8px !important;
  border-top-left-radius: 8px !important;
  border-top-right-radius: 8px !important;
  border-bottom-right-radius: 8px !important;
  border-bottom-left-radius: 8px !important;
  padding: 15px; }
  .date-chooser * {
    display: inline-block; }
  .date-chooser input {
    width: 50px;
    padding: 10px;
    border: none;
    font-size: 100%;
    text-align: center; }
    .date-chooser input:focus {
      outline: none; }
    .date-chooser input.year {
      width: 70px; }

.checkout-promotion {
  padding: 10px;
  border: 1px solid #e7e6e5;
  border-radius: 3px; }

.checkout-promotion:hover {
  background-color: #F0EFEC; }

.dp-checkout-widget {
  background-color: #fbfaf9; }
  .dp-checkout-widget:hover {
    background-color: #fbfaf9; }
  .dp-checkout-widget .dp-checkout-container {
    position: relative; }
    .dp-checkout-widget .dp-checkout-container > div {
      position: relative;
      display: inline-block;
      vertical-align: middle; }
    .dp-checkout-widget .dp-checkout-container .logo {
      width: 90px;
      height: 70px;
      margin-right: 8px; }
      .dp-checkout-widget .dp-checkout-container .logo img {
        max-width: 85px;
        max-height: 60px;
        position: absolute;
        margin: auto;
        top: 0;
        bottom: 0;
        left: 0;
        right: 0; }
      @media (max-width: 767px) {
        .dp-checkout-widget .dp-checkout-container .logo {
          width: 70px; }
          .dp-checkout-widget .dp-checkout-container .logo img {
            max-width: 65px; } }
    .dp-checkout-widget .dp-checkout-container .content {
      width: 60%;
      margin-top: -3px;
      padding: 0 15px;
      border-left: 1px solid #E7E6E5; }
      .dp-checkout-widget .dp-checkout-container .content .sub-header, .dp-checkout-widget .dp-checkout-container .content .cart-popover .warehouse-cart .warehouse-cart-header .sub-warehouse-header, .cart-popover .warehouse-cart .warehouse-cart-header .dp-checkout-widget .dp-checkout-container .content .sub-warehouse-header, .dp-checkout-widget .dp-checkout-container .content #cart-sidebar .warehouse-cart .warehouse-cart-header .sub-warehouse-header, #cart-sidebar .warehouse-cart .warehouse-cart-header .dp-checkout-widget .dp-checkout-container .content .sub-warehouse-header, .dp-checkout-widget .dp-checkout-container .content .cart-popover .warehouse-cart .warehouse-cart-header .sub-warehouse-cell, .cart-popover .warehouse-cart .warehouse-cart-header .dp-checkout-widget .dp-checkout-container .content .sub-warehouse-cell, .dp-checkout-widget .dp-checkout-container .content #cart-sidebar .warehouse-cart .warehouse-cart-header .sub-warehouse-cell, #cart-sidebar .warehouse-cart .warehouse-cart-header .dp-checkout-widget .dp-checkout-container .content .sub-warehouse-cell, .dp-checkout-widget .dp-checkout-container .content #cart-sidebar header .cart-description, #cart-sidebar header .dp-checkout-widget .dp-checkout-container .content .cart-description {
        margin: 2px 0 8px;
        line-height: 18px;
        color: #8e8e8e; }
      @media (max-width: 767px) {
        .dp-checkout-widget .dp-checkout-container .content {
          width: calc(100% - 80px); } }
    .dp-checkout-widget .dp-checkout-container .link {
      height: 33px;
      position: absolute;
      margin: auto;
      top: 0;
      bottom: 0;
      right: 10px; }
      .dp-checkout-widget .dp-checkout-container .link .ic-btn.ic-btn-default {
        background-color: #FFFFFF; }
        .dp-checkout-widget .dp-checkout-container .link .ic-btn.ic-btn-default:hover {
          border-color: #43B02A;
          background-color: #F6FFF4; }
      @media (max-width: 767px) {
        .dp-checkout-widget .dp-checkout-container .link {
          display: none; } }
      @media (min-width: 768px) and (max-width: 991px) {
        .dp-checkout-widget .dp-checkout-container .link {
          height: 31px; } }

.delivery-times .retailer-card .card-body {
  color: #393939;
  min-height: 222px;
  max-height: 222px; }

.outside-container .container-fluid .delivery-times .container-fluid {
  max-width: 1800px;
  margin: 0 auto; }

.delivery-times .retailer-cards-list {
  margin-left: inherit;
  margin-right: inherit; }
  .delivery-times .retailer-cards-list > li {
    margin-left: inherit;
    margin-right: inherit; }
  .delivery-times .retailer-cards-list .retailer-card {
    width: auto; }

.fulfillment-options-list > li {
  display: block; }

.fulfillment-options-list .fulfillment-option {
  width: 100%;
  padding: 14px 0px; }

.fulfillment-options-list .empty {
  color: #868686;
  padding: 91px 0px; }

.fulfillment-option .left-cell {
  float: left;
  text-align: left;
  width: 66%; }

.fulfillment-option .right-cell {
  float: right; }

.fulfillment-option .window {
  font-size: 18px;
  font-weight: 600;
  line-height: 24px; }

.fulfillment-option .date {
  color: #868686; }

.fulfillment-option .price {
  border: 1px solid #F0EFEC;
  -moz-border-radius-topleft: 4px !important;
  -moz-border-radius-topright: 4px !important;
  -moz-border-radius-bottomright: 4px !important;
  -moz-border-radius-bottomleft: 4px !important;
  -webkit-border-top-left-radius: 4px !important;
  -webkit-border-top-right-radius: 4px !important;
  -webkit-border-bottom-right-radius: 4px !important;
  -webkit-border-bottom-left-radius: 4px !important;
  border-top-left-radius: 4px !important;
  border-top-right-radius: 4px !important;
  border-bottom-right-radius: 4px !important;
  border-bottom-left-radius: 4px !important;
  color: #8e8e8e;
  font-size: 18px;
  height: 44px;
  line-height: 44px;
  position: relative;
  width: 76px; }

.price .price-overlay {
  -webkit-animation: fadeOut 0.1s ease-in-out;
  -moz-animation: fadeOut 0.1s ease-in-out;
  animation: fadeOut 0.1s ease-in-out;
  color: #868686;
  display: none;
  font-size: 16px;
  position: absolute;
  z-index: 900;
  top: -1px;
  background-color: #fff;
  width: 200px;
  right: -1px;
  border: 1px solid #F0EFEC;
  border-radius: 4px;
  box-shadow: 0px 3px 10px 0px rgba(0, 0, 0, 0.23), 0px 3px 10px 0px rgba(0, 0, 0, 0.16);
  padding: 16px;
  line-height: 18px; }

.retailer-cards-list li:last-child .price-overlay {
  bottom: -1px;
  top: initial; }

.price .price-overlay.is-visible {
  -webkit-animation: fadeIn 0.1s ease-in-out;
  -moz-animation: fadeIn 0.1s ease-in-out;
  animation: fadeIn 0.1s ease-in-out;
  display: block; }

.price-overlay .title {
  text-align: left;
  display: block;
  font-weight: bold;
  margin-bottom: 14px; }

.price-overlay .title.busy {
  color: #F7A700; }

.price-overlay .title.sale {
  color: #43B02A; }

.price-overlay .price-details .under {
  margin-top: 15px; }

.price-overlay .price-details .amount {
  color: #8e8e8e; }

.price-overlay .price-details .amount.busy {
  color: #F7A700; }

.price-overlay .price-details .amount.sale {
  color: #43B02A; }

.card-body .ic-loading {
  padding: 98px 0px; }

.price.busy {
  color: #F7A700; }

.price.sale {
  color: #43B02A; }

.ic-delivery-warehouse {
  margin-bottom: 50px; }

.ic-delivery-option {
  border-radius: 5px;
  margin-bottom: 15px;
  background-color: #e5edec; }

.ic-delivery-option > div {
  float: left;
  padding: 10px 0px;
  font-size: 14px; }

.ic-delivery-option > div:last-child {
  border-top-left-radius: 0px;
  border-top-right-radius: 5px;
  border-bottom-right-radius: 5px;
  border-bottom-left-radius: 0px; }

.ic-delivery-window {
  width: 80%;
  text-align: left; }

.ic-delivery-price {
  width: 20%;
  text-align: center;
  background: #43B02A;
  color: #fff; }
  .ic-delivery-price.unavailable {
    display: none; }
  .ic-delivery-price.tomorrow {
    background: #F7A700; }
  .ic-delivery-price.busy {
    background: #F7A700; }

.ic-delivery-window span.delivery-window {
  margin-left: 15px; }

.ic-modal.modal.fade {
  -webkit-transition: opacity, 0.15s, linear;
  -moz-transition: opacity, 0.15s, linear;
  transition: opacity, 0.15s, linear; }

.ic-modal.modal {
  -moz-border-radius-topleft: 5px !important;
  -moz-border-radius-topright: 5px !important;
  -moz-border-radius-bottomright: 5px !important;
  -moz-border-radius-bottomleft: 5px !important;
  -webkit-border-top-left-radius: 5px !important;
  -webkit-border-top-right-radius: 5px !important;
  -webkit-border-bottom-right-radius: 5px !important;
  -webkit-border-bottom-left-radius: 5px !important;
  border-top-left-radius: 5px !important;
  border-top-right-radius: 5px !important;
  border-bottom-right-radius: 5px !important;
  border-bottom-left-radius: 5px !important; }

.ic-modal .modal-header,
.ic-modal .modal-body,
.ic-modal .modal-footer {
  -moz-border-radius-topleft: 5px !important;
  -moz-border-radius-topright: 5px !important;
  -moz-border-radius-bottomright: 5px !important;
  -moz-border-radius-bottomleft: 5px !important;
  -webkit-border-top-left-radius: 5px !important;
  -webkit-border-top-right-radius: 5px !important;
  -webkit-border-bottom-right-radius: 5px !important;
  -webkit-border-bottom-left-radius: 5px !important;
  border-top-left-radius: 5px !important;
  border-top-right-radius: 5px !important;
  border-bottom-right-radius: 5px !important;
  border-bottom-left-radius: 5px !important;
  background: #fff; }

.ic-modal .modal-body {
  padding: 0px 70px 20px;
  max-height: 420px;
  overflow-y: auto; }

.delivery-times .modal-body .ic-loading {
  padding: 150px 0px; }

.department > h4 {
  text-indent: 18px; }

.department h4 {
  font-size: 18px;
  color: #6e6e6e;
  font-weight: 600;
  line-height: 18px;
  vertical-align: center;
  margin-bottom: 20px; }
  .department h4 span {
    line-height: 18px;
    display: inline-block;
    color: #DB9420;
    font-size: 14px;
    font-weight: normal;
    text-transform: normal; }
    .department h4 span b {
      padding-right: 10px;
      padding-left: 10px; }

.dropdown-menu li > a {
  display: block;
  padding: 3px 20px;
  clear: both;
  font-size: 16px;
  font-weight: normal;
  line-height: 20px;
  color: #333333;
  white-space: nowrap; }

.dropdown-menu li > a:hover,
.dropdown-menu li > a:focus,
.dropdown-submenu:hover > a {
  text-decoration: none;
  color: #ffffff;
  background-color: #0081c2;
  background-image: -moz-linear-gradient(top, #08c, #0077b3);
  background-image: -webkit-gradient(linear, 0 0, 0 100%, from(#08c), to(#0077b3));
  background-image: -webkit-linear-gradient(top, #08c, #0077b3);
  background-image: -o-linear-gradient(top, #08c, #0077b3);
  background-image: linear-gradient(to bottom, #08c, #0077b3);
  background-repeat: repeat-x;
  filter: progid:DXImageTransform.Microsoft.gradient(startColorstr='#ff0088cc', endColorstr='#ff0077b3', GradientType=0); }

.nav-dropdown {
  cursor: pointer; }
  .nav-dropdown .section {
    border-bottom: 1px solid #E3E2DF; }
    .nav-dropdown .section:last-child {
      border-bottom: none; }
  .nav-dropdown.account-dropdown .dropdown-menu li > a {
    font-size: 14px; }
    .nav-dropdown.account-dropdown .dropdown-menu li > a.account-dropdown-name {
      margin: 0;
      padding: 0 20px;
      max-width: 220px;
      width: 100%;
      display: block;
      overflow: hidden;
      overflow-wrap: normal;
      white-space: nowrap;
      text-overflow: ellipsis;
      font-size: 24.5px;
      font-weight: 300; }
  .nav-dropdown.account-dropdown .dropdown-menu ul.small-list a {
    font-size: 12px; }
  .nav-dropdown .dropdown-title {
    padding: 0px 20px;
    font-size: 20px;
    height: 56px;
    line-height: 56px;
    color: #6c6c6c;
    overflow: hidden;
    text-overflow: ellipsis;
    white-space: nowrap; }
    .nav-dropdown .dropdown-title .close {
      color: #6c6c6c;
      position: absolute;
      right: 10px;
      top: 10px;
      font-size: 35px;
      font-weight: 300; }
    .nav-dropdown .dropdown-title.has-link:hover {
      background-color: #43B02A;
      color: #fff; }
      .nav-dropdown .dropdown-title.has-link:hover > a {
        background-color: #43B02A;
        color: #fff;
        text-decoration: none; }
  .nav-dropdown .dropdown-menu {
    border-radius: 4px !important;
    border: none;
    z-index: 1100;
    min-width: 220px;
    padding: 10px 0px;
    color: #6c6c6c;
    pointer-events: all;
    -webkit-box-shadow: 0 5px 10px rgba(0, 0, 0, 0.2);
    -moz-box-shadow: 0 5px 10px rgba(0, 0, 0, 0.2);
    box-shadow: 0 5px 10px rgba(0, 0, 0, 0.2); }
    .nav-dropdown .dropdown-menu > li:last-child {
      border-top: 1px solid #E3E2DF;
      padding: 10px 0px 0px;
      margin-top: 5px; }
    .nav-dropdown .dropdown-menu > li.no-border {
      border: none;
      margin: 0;
      padding: 0; }
    .nav-dropdown .dropdown-menu > li.divider {
      height: 2px;
      border-bottom: 1px solid #ffffff;
      margin: 9px 1px;
      overflow: hidden;
      background-color: #e5e5e5; }
    .nav-dropdown .dropdown-menu > li > a {
      color: #6c6c6c;
      height: 36px;
      line-height: 36px;
      padding: 0px 20px; }
    .nav-dropdown .dropdown-menu a:hover, .nav-dropdown .dropdown-menu a:focus {
      color: #fff;
      background-color: #43B02A;
      background-image: none; }
    .nav-dropdown .dropdown-menu a .ic-icon {
      margin-right: 5px; }
  .nav-dropdown .dropdown-submenu {
    position: static; }
    .nav-dropdown .dropdown-submenu:hover > a, .nav-dropdown .dropdown-submenu.locked > a {
      color: #fff;
      background-color: #43B02A;
      background-image: none; }
    .nav-dropdown .dropdown-submenu:hover .dropdown-menu {
      display: block; }
    .nav-dropdown .dropdown-submenu.locked .dropdown-menu {
      display: block; }
    .nav-dropdown .dropdown-submenu.no-point-events {
      pointer-events: none; }
    .nav-dropdown .dropdown-submenu > a:after {
      font: normal normal 14px ic-icons;
      content: "\E010";
      background-repeat: no-repeat;
      border-left-color: transparent;
      position: relative;
      margin-top: -1px;
      right: 10px;
      display: block;
      float: right;
      width: 0;
      height: 0;
      border-color: transparent;
      border-style: solid;
      border-width: 5px 0 5px 5px;
      /* Hide v from screenreaders */ }
      @media reader, speech, aural {
        .nav-dropdown .dropdown-submenu > a:after {
          display: none;
          visibility: hidden; } }
    .nav-dropdown .dropdown-submenu > .dropdown-menu {
      padding: 0px;
      border-radius: 0px !important;
      min-width: 100%;
      box-shadow: 0px 3px 10px 0px rgba(0, 0, 0, 0.23), 0px 3px 10px 0px rgba(0, 0, 0, 0.16); }
      .nav-dropdown .dropdown-submenu > .dropdown-menu > li a {
        display: inline-block; }
      .nav-dropdown .dropdown-submenu > .dropdown-menu > li:last-child {
        border-top: none;
        padding: 0px 0px;
        margin-bottom: 10px; }
      .nav-dropdown .dropdown-submenu > .dropdown-menu .aisle-list > li {
        -webkit-column-break-inside: avoid; }
  .nav-dropdown ul {
    overflow-x: hidden;
    overflow-y: auto; }
  .nav-dropdown .two-cols {
    -webkit-columns: 2;
    -moz-columns: 2;
    columns: 2; }
  .nav-dropdown .department-menu {
    position: fixed;
    left: 0;
    top: 112px;
    border-radius: 0px !important;
    min-width: 250px;
    width: 326px;
    padding: 0;
    color: #6c6c6c;
    margin-top: 0; }
    .nav-dropdown .department-menu a:hover {
      color: #fff;
      background-color: #43B02A;
      background-image: none; }
    .nav-dropdown .department-menu li > a {
      padding: 10px 20px;
      color: #6c6c6c; }
      .nav-dropdown .department-menu li > a.department {
        position: relative; }
    .nav-dropdown .department-menu .featured-department-list {
      color: #43B02A;
      padding: 10px 0px; }
      .nav-dropdown .department-menu .featured-department-list li > a {
        color: #43B02A; }
        .nav-dropdown .department-menu .featured-department-list li > a:hover, .nav-dropdown .department-menu .featured-department-list li > a:focus {
          color: #fff; }
    .nav-dropdown .department-menu .label-new {
      height: 20px;
      font-size: 12px;
      line-height: 20px;
      border-radius: 4px;
      padding: 0 6px;
      text-shadow: none;
      background-color: #61B450;
      margin-left: 6px;
      position: absolute;
      font-weight: 500; }

.dropdown-menu .active > a,
.dropdown-menu .active > a:hover {
  background-image: none;
  background-color: #f0f0f0; }

.dropdown-open .ic-nav-secondary {
  transition: none; }

.dropdown-backdrop {
  display: none;
  position: fixed;
  top: 0;
  left: 0;
  bottom: 0;
  right: 0;
  background-color: #000;
  opacity: 0.50;
  z-index: 999; }

body.dropdown-open .dropdown-backdrop {
  display: block; }

body.dropdown-open .nav-overlay {
  height: 44px;
  position: fixed;
  width: 100%;
  background-color: #000;
  opacity: 0.5;
  z-index: 1; }

body.dropdown-open #cart-sidebar .cart-sidebar-overlay {
  display: block; }

body.dropdown-open .btn-cart-toggle {
  display: none !important; }

body.dropdown-open .ic-nav-inner {
  pointer-events: none; }

body.dropdown-open .ic-nav-secondary .nav.pull-right {
  opacity: 0.2; }

.Topbar--checkout {
  height: 56px;
  background-color: white;
  width: 100%;
  min-width: 768px;
  position: fixed;
  top: 0;
  z-index: 1020; }
  .Topbar--checkout .Topbar-inner {
    max-width: 1000px;
    margin: 0 auto;
    padding: 0px 15px; }
  .Topbar--checkout .service-type-toggle {
    width: 320px;
    display: block;
    margin: 0 auto; }
    .Topbar--checkout .service-type-toggle input,
    .Topbar--checkout .service-type-toggle input[type=radio],
    .Topbar--checkout .service-type-toggle input[type=radio]:checked {
      background-image: none;
      visibility: hidden; }
    .Topbar--checkout .service-type-toggle input[type=radio] {
      display: none; }
    .Topbar--checkout .service-type-toggle input[type="radio"]:focus + .ic-icon {
      color: #01939A; }
    .Topbar--checkout .service-type-toggle label:hover {
      cursor: pointer; }
    .Topbar--checkout .service-type-toggle label.radio,
    .Topbar--checkout .service-type-toggle label.radio.inline + label.radio.inline {
      width: 50%;
      box-sizing: border-box;
      float: left;
      margin: 0;
      padding: 7px 15px;
      text-align: center;
      font-size: 16px;
      font-weight: 600;
      color: #999;
      line-height: 20px;
      border: 1px solid #dadada;
      border-radius: 4px;
      transition: background .2s; }
      .Topbar--checkout .service-type-toggle label.radio.active,
      .Topbar--checkout .service-type-toggle label.radio.inline + label.radio.inline.active {
        color: #01939A;
        background: #f1f8f8;
        border: 1px solid #01939A; }
        .Topbar--checkout .service-type-toggle label.radio.active input,
        .Topbar--checkout .service-type-toggle label.radio.inline + label.radio.inline.active input {
          color: #01939A; }
    .Topbar--checkout .service-type-toggle label.radio.inline:first-child {
      border-top-right-radius: 0;
      border-bottom-right-radius: 0;
      border-right-width: 0; }
      .Topbar--checkout .service-type-toggle label.radio.inline:first-child.active {
        border-right-width: 1px; }
    .Topbar--checkout .service-type-toggle label.radio.inline + label.radio.inline {
      border-left-width: 0;
      border-radius: 0;
      border-top-right-radius: 4px;
      border-bottom-right-radius: 4px; }
      .Topbar--checkout .service-type-toggle label.radio.inline + label.radio.inline.active {
        border-left-width: 1px; }
    .Topbar--checkout .service-type-toggle .ic-icon:before {
      font-size: 16px;
      left: -5px; }

.Topbar--inverted .Topbar-logo, .Topbar--checkout .Topbar-logo {
  background-image: url(instacart-logo-color-ec528759d281bfc17858b166ae8e88e1.png);
  display: inline-block;
  background-color: white;
  background-position: 0 12px;
  background-size: 149px 30px;
  height: 56px;
  width: 150px;
  background-repeat: no-repeat; }
  @media only screen and (-webkit-min-device-pixel-ratio: 1.3), only screen and (min--moz-device-pixel-ratio: 1.3), only screen and (-o-min-device-pixel-ratio: 1.3 / 1), only screen and (min-resolution: 125dpi), only screen and (min-resolution: 1.3dppx) {
    .Topbar--inverted .Topbar-logo, .Topbar--checkout .Topbar-logo {
      background-image: url(instacart-logo-color@2x-bc8a513eedacc7362ed66cedbff7c890.png);
      background-size: 149px 30px; } }

.Topbar--inverted .Topbar-powered-by-logo, .Topbar--checkout .Topbar-powered-by-logo {
  display: none;
  position: absolute;
  right: 0;
  background-image: url(powered-by-lockup-abbdef708114bf63e283beb74b612bd5.png);
  background-repeat: no-repeat;
  background-position: center center;
  background-size: 80%;
  height: 82px;
  width: 203px;
  font-size: 18px; }
  .Topbar--inverted .Topbar-powered-by-logo:hover, .Topbar--checkout .Topbar-powered-by-logo:hover {
    text-decoration: none; }

#store header#nav-checkout {
  display: none; }

#store.landing-page-no-nav header#nav-checkout, #store.checking-out header#nav-checkout, #store.order-changes header#nav-checkout {
  display: block; }

#store.landing-page-no-nav header.ic-nav-new, #store.landing-page-no-nav #primaryNavView, #store.landing-page-no-nav .ic-nav-secondary, #store.checking-out header.ic-nav-new, #store.checking-out #primaryNavView, #store.checking-out .ic-nav-secondary, #store.order-changes header.ic-nav-new, #store.order-changes #primaryNavView, #store.order-changes .ic-nav-secondary {
  display: none; }

.rainbow_road_Docked_bg {
  background-image: url(docked-bg@2x-f603cae4fe2bee8c3e8e9cd9ddfe39fe.jpg); }

.lettuce_chat_pineapple {
  background-image: url(pineapple-0cdc09b1a8d668d7d8acb12a91b7c825.svg); }

.lettuce_chat_launcher {
  background-image: url(launcher-3f69647c1b375e2db77bf92372d85c7d.svg); }

.item-price {
  display: inline-block;
  margin-bottom: 3px;
  color: black;
  font-size: 16px;
  font-weight: 600; }

.item-full-price {
  margin-left: 5px;
  text-decoration: line-through;
  font-weight: 400; }

.item-size {
  margin-top: 2px; }

.badge.badge--sale,
.badge.badge--product-coupon,
.badge.badge--product-coupon-borderless {
  display: block;
  margin-top: 2px;
  margin-bottom: 5px;
  border-radius: 12px;
  font-size: 12px;
  font-weight: 600;
  letter-spacing: 0.01em;
  text-shadow: none; }
  @media (max-width: 576px) {
    .badge.badge--sale,
    .badge.badge--product-coupon,
    .badge.badge--product-coupon-borderless {
      margin-bottom: 0; } }

.badge.badge--sale {
  height: 20px;
  text-align: center;
  max-width: 80px;
  font-weight: 600;
  font-size: 14px;
  margin-left: 4px;
  background-color: #E8104A;
  color: #fff; }

.badge--product-coupon,
.badge--product-coupon-borderless {
  line-height: 16px;
  background-color: #fff;
  color: #E8104A;
  text-align: left; }
  .badge--product-coupon .ic-icon,
  .badge--product-coupon-borderless .ic-icon {
    top: 1px; }

.badge--product-coupon-borderless {
  border: none;
  font-weight: bold; }

.badge--product-coupon {
  border: 1px dashed #E8104A;
  font-weight: 600;
  max-width: 95px;
  padding-left: 5px; }

.badge.badge--deal-multi-line .badge-label, .badge.badge--deal-multi-line .badge-sublabel {
  margin-top: -4px;
  font-size: 12px; }

@media (max-width: 767px) {
  .badge.badge--deal-multi-line .badge-sublabel {
    display: none; } }

.badge.badge--redemption-rules {
  height: 20px;
  line-height: 20px;
  padding: 0;
  border-radius: 0;
  background-color: #fff;
  text-shadow: none;
  font-weight: 600;
  font-size: 12px; }

.badge.badge--soldout {
  padding: 0px 9px;
  border-radius: 12px;
  margin-bottom: 5px;
  margin-top: -5px;
  background-color: #BDBDBD;
  display: inline-block;
  font-size: 12px;
  font-weight: 600;
  text-align: center;
  letter-spacing: 0.01em;
  text-shadow: none;
  color: white;
  height: 21px;
  line-height: 21px; }
  .badge.badge--soldout.badge-low-stock {
    background-color: #9E9E9E;
    display: block;
    width: 75px;
    border-radius: 5px;
    padding: 0;
    vertical-align: top;
    margin-top: 0px; }
  .badge.badge--soldout.on-item-modal {
    display: inline-block;
    margin-left: 10px;
    margin-top: 5px; }

/* on item modal */
.low-stock-warning-text {
  display: none !important;
  margin-bottom: 25px;
  font-size: 14px; }
  .low-stock-warning-text p {
    font-weight: 600;
    color: #757575;
    margin-bottom: 0; }
    .low-stock-warning-text p a:hover {
      cursor: pointer; }
  .low-stock-warning-text .replacement-instruction-link a {
    margin-left: 18px; }

.see-other-options {
  margin: 4px 0;
  font-weight: 600; }

.see-other-options a:hover {
  text-decoration: none; }

.aisle-selector {
  position: absolute;
  top: 180px;
  left: 18px;
  font-size: 13px;
  width: 100%; }
  .aisle-selector .aisle-button .aisle-name {
    font-weight: 600; }

.top-picks-term-link {
  border: 1px #e0e0e0 solid;
  border-radius: 4px;
  font-size: 13px;
  margin: 0 13px 12px 13px;
  padding: 4px 0;
  font-weight: 600;
  position: absolute;
  bottom: 0px;
  left: 0;
  text-align: center;
  width: 177px; }

.top-picks-term-link:hover {
  background-color: #f7f7f7; }

.top-picks-term-link a {
  color: #757575; }

.top-picks-term-link a:hover {
  color: #757575;
  text-decoration: none; }

.item-card-badge, .featured-badge, .popular-badge, .buy-it-again-badge {
  position: absolute;
  top: 8px;
  left: 8px;
  height: 20px;
  z-index: 1;
  border: 0;
  outline: none;
  background-repeat: no-repeat; }
  .item-card-badge span, .featured-badge span, .popular-badge span, .buy-it-again-badge span {
    display: none; }

.featured-badge {
  width: 78px;
  background-image: url(featured-badge-b8cebd0ed5792d96cf1d084a324f3095.png); }
  @media only screen and (-webkit-min-device-pixel-ratio: 1.3), only screen and (min--moz-device-pixel-ratio: 1.3), only screen and (-o-min-device-pixel-ratio: 1.3 / 1), only screen and (min-resolution: 125dpi), only screen and (min-resolution: 1.3dppx) {
    .featured-badge {
      background-image: url(featured-badge@2x-7ddc66e8f96145f76e0c26285a5b2c93.png);
      background-size: 68px 20px; } }

.popular-badge {
  width: 68px;
  background-image: url(popular-96490bfdd23bd53688ea2901bbbd8787.png); }
  @media only screen and (-webkit-min-device-pixel-ratio: 1.3), only screen and (min--moz-device-pixel-ratio: 1.3), only screen and (-o-min-device-pixel-ratio: 1.3 / 1), only screen and (min-resolution: 125dpi), only screen and (min-resolution: 1.3dppx) {
    .popular-badge {
      background-image: url(popular@2x-6550f6b0fa95d6723f763546af125fac.png);
      background-size: 68px 20px; } }

.buy-it-again-badge {
  width: 92px;
  background-image: url(buy-it-again-badge-8eb97baa9c4f399a741fdf20cdfbd6b2.png); }
  @media only screen and (-webkit-min-device-pixel-ratio: 1.3), only screen and (min--moz-device-pixel-ratio: 1.3), only screen and (-o-min-device-pixel-ratio: 1.3 / 1), only screen and (min-resolution: 125dpi), only screen and (min-resolution: 1.3dppx) {
    .buy-it-again-badge {
      background-image: url(buy-it-again-badge@2x-289d6feb8c016b4b1623859c476bfc34.png);
      background-size: 85px 20px; } }

.item-detail a.ic-pill.ic-pill--prices {
  border: 1px solid #F0EFEC;
  margin: 0; }

.item .sampling-promotion-badge {
  box-sizing: border-box;
  position: absolute;
  width: 100%;
  bottom: 0;
  left: 0;
  background-color: #EEF5F4;
  color: #5A8082;
  border-top: 1px solid #E5EDEC;
  text-align: center;
  font-size: 12px;
  padding: 3px; }

.item.not-interested {
  width: 205px;
  -webkit-animation-name: slidehide;
  /* Chrome, Safari, Opera */
  -webkit-animation-duration: 4s;
  /* Chrome, Safari, Opera */
  -webkit-animation-iteration-count: 1;
  -webkit-animation-delay: 4s;
  -webkit-animation-fill-mode: forwards;
  animation-fill-mode: forwards;
  animation-name: slidehide;
  animation-duration: 1s;
  animation-iteration-count: 1;
  animation-delay: 4s; }
  .item.not-interested.has-details {
    overflow: hidden; }

.item .not-interested-overlay {
  position: absolute;
  top: 0;
  left: 0;
  height: 100%;
  background: #f1f2f6;
  width: 205px;
  text-align: center;
  -webkit-animation-name: slideup;
  /* Chrome, Safari, Opera */
  -webkit-animation-duration: 4s;
  /* Chrome, Safari, Opera */
  -webkit-animation-iteration-count: 1;
  animation-name: slideup;
  animation-duration: 1s;
  animation-iteration-count: 1;
  -webkit-animation-fill-mode: forwards;
  animation-fill-mode: forwards; }
  .item .not-interested-overlay .icon {
    background-image: url(star-icon-0928beb1be59a8d31d2e1688f8d130e8.png);
    background-repeat: none;
    background-position: center center;
    display: inline-block;
    margin: 60px 0 50px;
    height: 65px;
    width: 65px; }
    @media only screen and (-webkit-min-device-pixel-ratio: 1.3), only screen and (min--moz-device-pixel-ratio: 1.3), only screen and (-o-min-device-pixel-ratio: 1.3 / 1), only screen and (min-resolution: 125dpi), only screen and (min-resolution: 1.3dppx) {
      .item .not-interested-overlay .icon {
        background-image: url(star-icon@2x-a8247356d8b7b8c218f67c02629b3faa.png);
        background-size: 65px 65px; } }
  .item .not-interested-overlay p {
    margin-bottom: 0.3rem;
    font-size: 14px; }
    .item .not-interested-overlay p strong {
      font-size: 16px;
      font-weight: 600; }
  .item .not-interested-overlay .not-interested-show-less {
    color: #6e6e6e; }

@-webkit-keyframes slidehide {
  from {
    width: 205px;
    border-width: 1px; }
  to {
    border-width: 0px;
    width: 1px; } }

@-webkit-keyframes slideup {
  from {
    top: -340px; }
  to {
    top: 0px; } }

#store.landing-page-no-nav .outside-container,
#store.landing-page-no-nav .outside-container.silver-surfer-nav {
  margin-top: 56px; }

#store .outside-container {
  margin-top: 112px; }
  #store .outside-container.silver-surfer-nav {
    margin-top: 0px; }

#pulse-animation {
  right: -15px;
  position: relative; }
  #pulse-animation .pulse {
    width: 10px;
    height: 10px;
    right: 6px;
    top: 10px;
    border: 5px solid #43B02A;
    -webkit-border-radius: 30px;
    -moz-border-radius: 30px;
    border-radius: 30px;
    background-color: #43B02A;
    z-index: 10;
    position: absolute; }
  #pulse-animation .dot {
    border: 10px solid #43B02A;
    background: transparent;
    -webkit-border-radius: 30px;
    -moz-border-radius: 30px;
    border-radius: 30px;
    height: 30px;
    width: 30px;
    -webkit-animation: pulse 3s ease-out;
    -moz-animation: pulse 3s ease-out;
    animation: pulse 3s ease-out;
    -webkit-animation-iteration-count: infinite;
    -moz-animation-iteration-count: infinite;
    animation-iteration-count: infinite;
    position: absolute;
    top: -10px;
    left: 5px;
    z-index: 1;
    opacity: 0; }

@-moz-keyframes pulse {
  0% {
    -moz-transform: scale(0);
    opacity: 0.0; }
  25% {
    -moz-transform: scale(0);
    opacity: 0.1; }
  50% {
    -moz-transform: scale(0.1);
    opacity: 0.3; }
  75% {
    -moz-transform: scale(0.5);
    opacity: 0.5; }
  100% {
    -moz-transform: scale(1);
    opacity: 0.0; } }

@-webkit-keyframes "pulse" {
  0% {
    -webkit-transform: scale(0);
    opacity: 0.0; }
  25% {
    -webkit-transform: scale(0);
    opacity: 0.1; }
  50% {
    -webkit-transform: scale(0.1);
    opacity: 0.3; }
  75% {
    -webkit-transform: scale(0.5);
    opacity: 0.5; }
  100% {
    -webkit-transform: scale(1);
    opacity: 0.0; } }

#referrals-section {
  margin-bottom: 30px; }
  #referrals-section .hero {
    padding: 16px; }
  #referrals-section h2 {
    margin: 0px 0px 4px 0px; }
  #referrals-section .dark-gray {
    color: #424242; }
  #referrals-section .gray, #referrals-section .left-padding {
    color: #757575;
    font-weight: 400; }
  #referrals-section .left-padding {
    padding-left: 5px; }
  #referrals-section .sub-heading {
    color: #424242;
    font-size: 16px;
    margin-top: 16px;
    margin-bottom: 8px; }
  @media (min-width: 768px) {
    #referrals-section #sticky {
      position: fixed;
      max-width: 300px;
      border: 1px solid #EEE;
      border-radius: 5px; } }
  #referrals-section input[readonly] {
    cursor: auto;
    color: black;
    background-color: #F5F5F5 !important; }
  #referrals-section .main-block, #referrals-section .main-block-v1 {
    max-width: 800px;
    margin: 30px auto 0 auto;
    background-color: #FFF;
    border-radius: 5px; }
    #referrals-section .main-block .invite-heading, #referrals-section .main-block-v1 .invite-heading {
      color: #424242;
      margin: 0 0 25px 0;
      font-weight: 600;
      font-size: 18px;
      text-align: center; }
    #referrals-section .main-block .heading, #referrals-section .main-block-v1 .heading {
      margin: 15px 0 30px 0;
      font-weight: 600;
      font-size: 18px;
      text-align: center; }
    #referrals-section .main-block .inner, #referrals-section .main-block-v1 .inner {
      padding: 24px;
      border: 1px solid #EEE;
      border-radius: 5px; }
  #referrals-section .main-block-v1 {
    margin: 16px auto 0 auto; }
  #referrals-section .form-group-custom input, #referrals-section .form-group-custom a, #referrals-section .form-group-custom button {
    display: inline-block;
    box-sizing: border-box;
    height: 50px;
    font-size: 18px;
    vertical-align: top; }
  #referrals-section .form-group-custom input {
    width: 75%;
    font-size: 14px;
    background-color: #FAFAFA;
    box-shadow: none;
    border-right: 0;
    border-top-right-radius: 0 !important;
    border-bottom-right-radius: 0 !important; }
  #referrals-section .form-group-custom input-contacts {
    width: 75%;
    background-color: #FAFAFA;
    box-shadow: none;
    border-right: 0;
    border-top-right-radius: 0 !important;
    border-bottom-right-radius: 0 !important;
    margin-bottom: 0px; }
  #referrals-section .form-group-custom a, #referrals-section .form-group-custom button {
    height: 50px;
    width: 25%;
    padding: 0 20px;
    border: 1px solid #EEE;
    background-color: #FF5600;
    border-radius: 0 5px 5px 0;
    color: #FFF;
    position: relative; }
  #referrals-section .form-search .select-button {
    display: inline-block;
    font-size: 16px;
    padding: 10px 5px; }
    #referrals-section .form-search .select-button:hover {
      color: #43B02A; }
  #referrals-section .form-search .fa-search {
    margin-top: 11px;
    margin-left: 10px;
    position: absolute;
    font-size: 15px; }
  #referrals-section .form-search input, #referrals-section .form-search a, #referrals-section .form-search button {
    display: inline-block;
    box-sizing: border-box;
    height: 50px;
    font-size: 18px;
    vertical-align: top; }
  #referrals-section .form-search input {
    font-size: 14px;
    width: 360px;
    height: 36px;
    background-color: #FAFAFA;
    box-shadow: none;
    text-indent: 20px; }
  #referrals-section .form-search a, #referrals-section .form-search button {
    height: 50px;
    width: 25%;
    padding: 0 20px;
    border: 1px solid #EEE;
    background-color: #FF5600;
    border-radius: 0 5px 5px 0;
    color: #FFF;
    position: relative; }
  #referrals-section .rcp-referral-code {
    margin-top: 10px; }
  #referrals-section .rcp-referral-channels {
    margin-top: 10px; }
  #referrals-section .rcp-banner .sub-heading {
    color: #424242;
    font-size: 16px;
    margin-top: 0px; }
  #referrals-section .rcp-banner .share-code {
    margin: 15px 0 0 0;
    font-size: 16px;
    text-align: center; }
  #referrals-section .rcp-converted-users .sub-heading {
    color: #424242;
    margin-top: 0px;
    font-size: 16px; }
  #referrals-section .rcp-converted-users .solid-border {
    border: 1px solid #EEE; }
  #referrals-section .rcp-converted-users .dashed-border {
    border: 2px dashed #43B02A !important; }
  #referrals-section .rcp-converted-users .inner .share-code {
    font-weight: 700;
    font-size: inherit;
    padding: 0 0 3px 6px;
    border: 0; }
    #referrals-section .rcp-converted-users .inner .share-code[readonly] {
      color: #43B02A !important;
      background-color: #FFF !important;
      cursor: pointer !important; }
  #referrals-section .rcp-converted-users .inner .heading {
    margin: 8px 0 8px 0; }
  #referrals-section .rcp-converted-users .inner .progress-wrap {
    margin-bottom: 30px;
    margin-top: 10px; }
  #referrals-section .rcp-converted-users .inner .avatar-wrap {
    float: left;
    width: 20%;
    position: relative;
    color: #FFF; }
    #referrals-section .rcp-converted-users .inner .avatar-wrap .avatar {
      height: 110px;
      width: 110px;
      margin: auto;
      border-radius: 110px;
      background-color: #E0E0E0;
      font-size: 38px;
      line-height: 110px;
      text-align: center;
      background-repeat: no-repeat;
      background-position: center center;
      background-size: cover; }
    #referrals-section .rcp-converted-users .inner .avatar-wrap.converted .avatar {
      background-color: #43B02A; }
    @media (max-width: 768px) {
      #referrals-section .rcp-converted-users .inner .avatar-wrap {
        float: none;
        width: auto; }
        #referrals-section .rcp-converted-users .inner .avatar-wrap .avatar {
          margin-bottom: 15px; } }
  #referrals-section .rcp-converted-users .inner .avatar-wrap-v1 {
    margin: 10px 0px;
    float: left;
    width: 15%;
    position: relative;
    color: #FFF; }
    #referrals-section .rcp-converted-users .inner .avatar-wrap-v1 .avatar {
      height: 60px;
      width: 60px;
      margin: auto;
      border-radius: 60px;
      background-color: #E0E0E0;
      font-size: 25px;
      line-height: 60px;
      text-align: center;
      background-repeat: no-repeat;
      background-position: center center;
      background-size: cover; }
    #referrals-section .rcp-converted-users .inner .avatar-wrap-v1.converted .avatar {
      background-color: #43B02A; }
    @media (max-width: 768px) {
      #referrals-section .rcp-converted-users .inner .avatar-wrap-v1 {
        float: none;
        width: auto; }
        #referrals-section .rcp-converted-users .inner .avatar-wrap-v1 .avatar {
          margin-bottom: 15px; } }
  #referrals-section .rcp-converted-users .inner .email {
    margin-top: 15px;
    font-size: 14px; }
  #referrals-section .rcp-converted-users .inner .name {
    text-align: left;
    margin-top: 15px;
    font-size: 16px;
    font-weight: 600; }
  #referrals-section .rcp-converted-users .inner .ordered {
    color: #43B02A;
    font-size: 14px;
    font-weight: 600;
    margin-top: 5px; }
  #referrals-section .rcp-converted-users .inner .amount {
    margin-top: 20px;
    margin-right: 10px; }
  #referrals-section .gmail-import {
    background-color: #f7f7f7; }
    #referrals-section .gmail-import .sidebar {
      background-color: #f7f7f7f; }
    #referrals-section .gmail-import .main-content {
      max-width: 1400px;
      width: 80%;
      margin: 30px auto 0 auto; }
      #referrals-section .gmail-import .main-content .invite-heading {
        margin: 8px 0 16px 0px;
        font-weight: 600;
        font-size: 18px;
        text-align: center; }
      #referrals-section .gmail-import .main-content .heading {
        margin: 15px 0 5px 0;
        font-weight: 600;
        font-size: 18px;
        text-align: center; }
      #referrals-section .gmail-import .main-content .inner {
        padding: 30px;
        border: 1px solid #EEE;
        border-radius: 5px;
        background-color: #FFF; }
  #referrals-section .rcp-email-invites button, #referrals-section .rcp-email-invites-v1 button {
    border: 0;
    padding: 0px 0px;
    background-color: #43B02A;
    color: #FFF; }
    #referrals-section .rcp-email-invites button:hover, #referrals-section .rcp-email-invites-v1 button:hover {
      background-color: #4c8b46; }
    #referrals-section .rcp-email-invites button.state-loading, #referrals-section .rcp-email-invites-v1 button.state-loading {
      background-color: #F7A700; }
    #referrals-section .rcp-email-invites button.state-success, #referrals-section .rcp-email-invites-v1 button.state-success {
      -webkit-animation: Pulse .7s ease-out;
      -moz-animation: Pulse .7s ease-out;
      animation: Pulse .7s ease-out;
      -webkit-animation-fill-mode: both;
      -moz-animation-fill-mode: both;
      animation-fill-mode: both; }
    #referrals-section .rcp-email-invites button.state-error, #referrals-section .rcp-email-invites-v1 button.state-error {
      background-color: #E8104A; }
  #referrals-section .rcp-email-invites-v1 button {
    width: 86px; }
  #referrals-section .rcp-email-select .col-rcp-select-link {
    padding-top: 10px; }
  #referrals-section .rcp-email-select .rcp-select-link {
    color: #43B02A;
    cursor: pointer; }
  #referrals-section .rcp-email-select button {
    border: 1px;
    margin-left: 3%;
    width: 150px;
    border-radius: 5px;
    height: 40px;
    margin-top: 24px;
    color: #FFF; }
    #referrals-section .rcp-email-select button:hover {
      background-color: #43B02A; }
    #referrals-section .rcp-email-select button.state-loading {
      background-color: #F7A700; }
    #referrals-section .rcp-email-select button.state-success {
      -webkit-animation: Pulse .7s ease-out;
      -moz-animation: Pulse .7s ease-out;
      animation: Pulse .7s ease-out;
      -webkit-animation-fill-mode: both;
      -moz-animation-fill-mode: both;
      animation-fill-mode: both; }
    #referrals-section .rcp-email-select button.active {
      background-color: #43B02A; }
    #referrals-section .rcp-email-select button.state-error {
      background-color: #E8104A; }
  #referrals-section .rcp-email-select .loadmore {
    padding: 10px;
    width: 160px;
    background-color: #43B02A; }
  #referrals-section .rcp-email-select input[type=text]:focus {
    border: 1px solid #43B02A; }
  #referrals-section .rcp-email-list-preview {
    text-align: left; }
    #referrals-section .rcp-email-list-preview .email-container {
      margin: 5px 0px; }
      #referrals-section .rcp-email-list-preview .email-container input[type=checkbox] {
        width: 18px;
        height: 18px;
        padding: 0;
        margin: 0;
        vertical-align: bottom;
        position: relative;
        top: 10px;
        *overflow: hidden;
        margin-right: 7px; }
      #referrals-section .rcp-email-list-preview .email-container label {
        display: block;
        padding-left: 25px;
        text-indent: -15px;
        font-weight: 600; }
      #referrals-section .rcp-email-list-preview .email-container .email {
        margin-top: -8px;
        padding-left: 10px;
        font-weight: 400; }
    #referrals-section .rcp-email-list-preview ul {
      max-height: 300px;
      margin-left: 5px;
      overflow: auto;
      opacity: 1;
      list-style: none;
      transition: opacity 1.5s ease-in-out;
      -moz-transition: opacity 1.5s ease-in-out;
      -webkit-transition: opacity 1.5s ease-in-out; }
      #referrals-section .rcp-email-list-preview ul li {
        margin-bottom: 3px;
        list-style: none;
        color: #6c6c6c; }
        #referrals-section .rcp-email-list-preview ul li span, #referrals-section .rcp-email-list-preview ul li i {
          color: #43B02A;
          padding-left: 1px; }
        #referrals-section .rcp-email-list-preview ul li.invalid span, #referrals-section .rcp-email-list-preview ul li.invalid i {
          color: #E8104A;
          opacity: 0.7; }
  #referrals-section .rcp-share-link .form-group-custom.flash-disabled input {
    width: 100%;
    border-right: 1px solid #EEE;
    border-top-right-radius: 5px !important;
    border-bottom-right-radius: 5px !important; }
  #referrals-section .rcp-share-link .form-group-custom.flash-disabled a, #referrals-section .rcp-share-link .form-group-custom.flash-disabled button {
    display: none; }
  #referrals-section button .spinkit-spinner {
    position: relative;
    left: 7px;
    margin: 0;
    display: inline-block; }
  #referrals-section .spinkit-spinner > div {
    width: 10px;
    height: 10px;
    background-color: white;
    border-radius: 100%;
    display: inline-block;
    -webkit-animation: bouncedelay 1.4s infinite ease-in-out;
    animation: bouncedelay 1.4s infinite ease-in-out;
    /* Prevent first frame from flickering when animation starts */
    -webkit-animation-fill-mode: both;
    animation-fill-mode: both; }
  #referrals-section .spinkit-spinner .bounce1 {
    -webkit-animation-delay: -0.32s;
    animation-delay: -0.32s; }
  #referrals-section .spinkit-spinner .bounce2 {
    -webkit-animation-delay: -0.16s;
    animation-delay: -0.16s; }

@-webkit-keyframes bouncedelay {
  0%, 80%, 100% {
    -webkit-transform: scale(0); }
  40% {
    -webkit-transform: scale(1); } }

@keyframes bouncedelay {
  0%, 80%, 100% {
    transform: scale(0);
    -webkit-transform: scale(0); }
  40% {
    transform: scale(1);
    -webkit-transform: scale(1); } }

.share-link-wrap {
  position: relative;
  min-height: 55px;
  margin-top: 15px;
  padding-top: 15px;
  border-top: 1px solid #EEE; }
  .share-link-wrap button {
    position: relative;
    display: inline-block;
    width: 45%;
    padding: 0 20px;
    line-height: 3em;
    border: 0;
    border-radius: 5px;
    font-size: 18px;
    text-decoration: none; }
    @media (max-width: 590px) {
      .share-link-wrap button {
        display: block;
        position: relative !important;
        width: 100%;
        padding: 0;
        margin-bottom: 15px; } }
    .share-link-wrap button i {
      position: absolute;
      left: 20px;
      top: 12px;
      font-size: 32px; }
      @media (min-width: 590px) and (max-width: 690px) {
        .share-link-wrap button i {
          position: relative;
          left: auto;
          top: auto;
          font-size: inherit; } }
    .share-link-wrap button:first-child {
      position: absolute;
      left: 0; }
    .share-link-wrap button:last-child {
      position: absolute;
      right: 0; }
  .share-link-wrap .twitter-bg-color {
    background-color: #55ACEE;
    color: #FFF; }
    .share-link-wrap .twitter-bg-color:hover {
      background-color: #3ca0ec; }
  .share-link-wrap .facebook-bg-color {
    background-color: #3B5998;
    color: #FFF; }
    .share-link-wrap .facebook-bg-color:hover {
      background-color: #334d84; }

@media (max-width: 590px) {
  #referrals-section .form-group-custom input {
    width: 70%; }
  #referrals-section .form-group-custom a, #referrals-section .form-group-custom button {
    width: 30%;
    font-size: 1em; } }

@-webkit-keyframes Pulse {
  0%, 80%, 100% {
    -webkit-transform: scale(1); }
  40% {
    -webkit-transform: scale(1.07); } }

@-moz-keyframes Pulse {
  0%, 80%, 100% {
    -moz-transform: scale(1); }
  40% {
    -moz-transform: scale(1.07); } }

@keyframes Pulse {
  0%, 80%, 100% {
    transform: scale(1); }
  40% {
    transform: scale(1.07); } }

ul.retailer-cards-list {
  margin-top: 20px;
  margin-left: -15px;
  margin-right: -15px; }
  ul.retailer-cards-list:after {
    content: "";
    display: table;
    clear: both; }

.retailer-card {
  -moz-border-radius-topleft: 4px !important;
  -moz-border-radius-topright: 4px !important;
  -moz-border-radius-bottomright: 4px !important;
  -moz-border-radius-bottomleft: 4px !important;
  -webkit-border-top-left-radius: 4px !important;
  -webkit-border-top-right-radius: 4px !important;
  -webkit-border-bottom-right-radius: 4px !important;
  -webkit-border-bottom-left-radius: 4px !important;
  border-top-left-radius: 4px !important;
  border-top-right-radius: 4px !important;
  border-bottom-right-radius: 4px !important;
  border-bottom-left-radius: 4px !important;
  background: #fff;
  border: 1px solid #F0EFEC;
  box-sizing: border-box;
  margin: 10px 0px;
  text-align: center; }

.retailer-cards-list.retailer-cards-list-fluid > li {
  width: 47%; }

.retailer-cards-list.retailer-cards-list-fluid .retailer-card {
  width: 100%; }

.retailer-card .card-header {
  border-top-left-radius: 4px;
  border-top-right-radius: 4px;
  height: 150px;
  padding-top: 10px;
  line-height: 120px;
  cursor: pointer; }

.retailer-card .logo {
  height: 100px;
  background-position: center center;
  background-size: contain;
  background-repeat: no-repeat;
  position: relative;
  margin: 15px auto; }

.retailer-card .name {
  color: #fff;
  display: inline-block;
  font-size: 32px;
  font-weight: 600;
  line-height: 36px;
  margin-bottom: auto;
  margin-top: auto;
  vertical-align: middle;
  width: 100%; }

.retailer-card .card-body {
  color: #393939;
  padding: 0px 14px; }

.retailer-card .card-footer {
  border-top: 1px solid #F0EFEC;
  height: 58px;
  line-height: 58px;
  padding: 0;
  background-color: #fff; }

/* general */
.left {
  float: left; }

.right {
  float: right; }

.capitalize {
  text-transform: capitalize; }

.underline {
  padding-bottom: 10px;
  border-bottom: 1px solid #CCC; }

.uppercase {
  text-transform: uppercase; }

.bold {
  font-weight: bold; }

.text-center {
  text-align: center; }

.text-left {
  text-align: left; }

.text-right {
  text-align: right; }

input,
button,
select,
textarea {
  font-family: "Open Sans", "Helvetica Neue", Helvetica, sans-serif; }

h1, h2, h3, h4, h5, h6 {
  font-weight: 400; }
  h1.normal, h1 .normal, h2.normal, h2 .normal, h3.normal, h3 .normal, h4.normal, h4 .normal, h5.normal, h5 .normal, h6.normal, h6 .normal {
    font-weight: normal; }

a.primary, strong.primary {
  color: #E8104A;
  font-weight: bold; }
  a.primary.max-green, strong.primary.max-green {
    color: #00A870; }

a {
  color: #43B02A; }
  a:hover, a:active, a.active {
    color: #2b721b; }

.high-contrast-mode a,
.high-contrast-mode a.active {
  color: #177d05; }

.high-contrast-mode .ic-btn-success,
.high-contrast-mode .ic-btn-ng,
.high-contrast-mode .ic-btn-primary {
  background-color: #000;
  border-color: #fff;
  color: #fff !important; }
  .high-contrast-mode .ic-btn-success:hover,
  .high-contrast-mode .ic-btn-ng:hover,
  .high-contrast-mode .ic-btn-primary:hover {
    background-color: #757575;
    border-color: #fff;
    color: #fff; }

.high-contrast-mode .ic-btn-secondary,
.high-contrast-mode .ic-btn-success-secondary {
  border-color: #000 !important;
  color: #000 !important; }

.high-contrast-mode .green-title {
  color: #757575; }

footer {
  padding: 20px;
  min-height: 240px;
  color: #9d9d9d;
  box-sizing: border-box;
  -moz-box-sizing: border-box;
  max-width: 1040px;
  margin: 0px auto; }
  footer a {
    color: #9d9d9d; }
  footer .center {
    text-align: center;
    color: #666;
    margin-bottom: 30px;
    clear: both;
    font-size: 12px; }
  footer .copyright {
    margin: 40px 0 10px 0; }
  footer ul {
    list-style: none;
    float: left;
    columns: 2;
    width: 300px;
    height: 85px;
    -webkit-columns: 2;
    -moz-columns: 2; }
    footer ul a {
      color: #888; }

/* headers */
h4 {
  font-weight: 800;
  color: #757575;
  font-size: 16px;
  line-height: 17px; }

/* forms */
input[type="text"], input[type="search"], input[type="password"], input[type="email"], input[type="number"], input[type="tel"], input[type="date"], textarea {
  border: 1px solid #e5edec;
  -moz-border-radius-topleft: 5px !important;
  -moz-border-radius-topright: 5px !important;
  -moz-border-radius-bottomright: 5px !important;
  -moz-border-radius-bottomleft: 5px !important;
  -webkit-border-top-left-radius: 5px !important;
  -webkit-border-top-right-radius: 5px !important;
  -webkit-border-bottom-right-radius: 5px !important;
  -webkit-border-bottom-left-radius: 5px !important;
  border-top-left-radius: 5px !important;
  border-top-right-radius: 5px !important;
  border-bottom-right-radius: 5px !important;
  border-bottom-left-radius: 5px !important;
  padding: 0 15px;
  height: 40px;
  font-size: 14px; }
  input[type="text"] ::-webkit-input-placeholder,
  input[type="search"] ::-webkit-input-placeholder,
  input[type="password"] ::-webkit-input-placeholder,
  input[type="email"] ::-webkit-input-placeholder,
  input[type="number"] ::-webkit-input-placeholder,
  input[type="tel"] ::-webkit-input-placeholder,
  input[type="date"] ::-webkit-input-placeholder,
  textarea ::-webkit-input-placeholder {
    color: #f0f0f0;
    padding: 10px; }
  input[type="text"] :-moz-placeholder,
  input[type="search"] :-moz-placeholder,
  input[type="password"] :-moz-placeholder,
  input[type="email"] :-moz-placeholder,
  input[type="number"] :-moz-placeholder,
  input[type="tel"] :-moz-placeholder,
  input[type="date"] :-moz-placeholder,
  textarea :-moz-placeholder {
    padding: 10px;
    color: #f0f0f0; }
  input[type="text"] ::-moz-placeholder,
  input[type="search"] ::-moz-placeholder,
  input[type="password"] ::-moz-placeholder,
  input[type="email"] ::-moz-placeholder,
  input[type="number"] ::-moz-placeholder,
  input[type="tel"] ::-moz-placeholder,
  input[type="date"] ::-moz-placeholder,
  textarea ::-moz-placeholder {
    padding: 10px;
    color: #f0f0f0; }
  input[type="text"] :-ms-input-placeholder,
  input[type="search"] :-ms-input-placeholder,
  input[type="password"] :-ms-input-placeholder,
  input[type="email"] :-ms-input-placeholder,
  input[type="number"] :-ms-input-placeholder,
  input[type="tel"] :-ms-input-placeholder,
  input[type="date"] :-ms-input-placeholder,
  textarea :-ms-input-placeholder {
    padding: 10px;
    color: #f0f0f0; }

textarea {
  height: inherit;
  padding: 10px 15px; }

.input-line {
  margin-bottom: 14px; }
  .input-line * {
    box-sizing: border-box; }
  .input-line > label, .input-line > span {
    float: left;
    width: 30%;
    margin: 0;
    line-height: 50px; }
  .input-line > input,
  .input-line > textarea,
  .input-line > .inputs {
    float: left;
    width: 70%;
    margin: 0; }
  .input-line > input[type=text],
  .input-line > input[type=password],
  .input-line > input[type=email],
  .input-line > input[type=tel] {
    height: 50px;
    border: none;
    border-bottom: 1px solid #ccc;
    font-weight: 200;
    background-color: transparent;
    -moz-box-shadow: none;
    -webkit-box-shadow: none;
    box-shadow: none;
    -moz-border-radius: 0 !important;
    -webkit-border-radius: 0 !important;
    border-radius: 0 !important; }
  .input-line > input:not([type="checkbox"]):hover {
    background-color: rgba(0, 0, 0, 0.1); }
  .input-line > input:not([type="checkbox"]):active,
  .input-line > input:not([type="checkbox"]):focus {
    border-bottom: 1px solid #43B02A; }
  .input-line.checkbox-line > label {
    width: 70%; }
  .input-line.checkbox-line > input {
    width: 30%; }
  .input-line > input[type=checkbox] {
    position: relative;
    top: 10px;
    float: right; }

.ic-tabs * {
  box-sizing: border-box; }

.ic-tabs .ic-tabs-headers .ic-tab-header {
  display: inline-block;
  padding: 10px 25px;
  color: #9b9b9b;
  margin: 0 20px 20px 0;
  font-weight: 700;
  border-bottom: 5px solid transparent;
  position: relative;
  cursor: pointer;
  -webkit-user-select: none;
  -moz-user-select: none;
  -ms-user-select: none;
  user-select: none;
  text-decoration: none; }
  .ic-tabs .ic-tabs-headers .ic-tab-header:after {
    content: " ";
    width: 0;
    height: 5px;
    background: transparent;
    position: absolute;
    bottom: 0;
    left: 0;
    -webkit-transition: opacity, 0.2s, ease-in-out;
    -moz-transition: opacity, 0.2s, ease-in-out;
    transition: opacity, 0.2s, ease-in-out; }
  .ic-tabs .ic-tabs-headers .ic-tab-header.active {
    color: #549250; }
  .ic-tabs .ic-tabs-headers .ic-tab-header.active:after {
    background: #fd9e28;
    width: 100%; }

.ic-tabs .ic-tabs-content .ic-tab,
.ic-tabs .ic-vertical-tabs-content .ic-tab {
  max-height: 0;
  overflow: hidden;
  opacity: 0; }

.ic-tabs .ic-tabs-content .ic-tab,
.ic-tabs .ic-vertical-tabs-content .ic-tab {
  -webkit-transition: opacity, 0.2s, ease-in-out;
  -moz-transition: opacity, 0.2s, ease-in-out;
  transition: opacity, 0.2s, ease-in-out; }
  .ic-tabs .ic-tabs-content .ic-tab.active,
  .ic-tabs .ic-vertical-tabs-content .ic-tab.active {
    height: auto;
    opacity: 1;
    max-height: none; }

.ic-tabs.vertical .ic-tabs-headers {
  float: left;
  width: 40%;
  padding-right: 30px;
  border-right: 1px solid #ccc; }
  .ic-tabs.vertical .ic-tabs-headers .ic-tab-header {
    display: block;
    margin-bottom: 10px;
    background-color: #f8f8f8;
    color: #9b9b9b;
    border-radius: 5px;
    border: 1px solid #eee;
    padding: 25px 25px; }
  .ic-tabs.vertical .ic-tabs-headers .ic-tab-header:after {
    display: none; }
  .ic-tabs.vertical .ic-tabs-headers .ic-tab-header.active {
    color: #4a4a4a; }

.ic-tabs.vertical .ic-tabs-content,
.ic-tabs.vertical .ic-vertical-tabs-content {
  float: left;
  width: 60%;
  padding-left: 30px; }

@-webkit-keyframes fadeIn {
  from {
    opacity: 0; }
  to {
    opacity: 1; } }

@keyframes fadeIn {
  from {
    opacity: 0; }
  to {
    opacity: 1; } }

.modal-container {
  position: fixed;
  z-index: 2000;
  top: 0;
  right: 0;
  bottom: 0;
  left: 0;
  overflow-y: auto;
  -webkit-transform: translate3d(0, 0, 0);
  display: none;
  opacity: 0;
  filter: alpha(opacity=0); }
  .modal-container.active {
    display: block;
    opacity: 1;
    filter: alpha(opacity=1); }
  .modal-container .modal-table {
    display: table;
    table-layout: fixed;
    height: 100%;
    width: 100%; }
    .modal-container .modal-table .modal-cell {
      display: table-cell;
      height: 100%;
      width: 100%;
      vertical-align: middle;
      padding: 50px; }
      .modal-container .modal-table .modal-cell .modal {
        position: relative;
        margin: auto !important;
        overflow: visible;
        top: auto;
        left: auto; }

.label {
  font-weight: 600;
  font-size: 11px; }

.special-request-form {
  margin: 0 auto; }
  .special-request-form .item.landscape {
    cursor: pointer;
    padding: 7px;
    position: relative; }
    .special-request-form .item.landscape .badge.badge--sale {
      display: none; }
    .special-request-form .item.landscape .badge.badge--soldout {
      float: right;
      margin-top: 0px; }
    .special-request-form .item.landscape .full-item-name {
      font-weight: 600;
      margin-top: 15px; }
    .special-request-form .item.landscape .full-item-name,
    .special-request-form .item.landscape .item-size.muted {
      display: block;
      text-align: left;
      margin-left: 83px;
      margin-right: 90px; }
    .special-request-form .item.landscape .item-price {
      position: absolute;
      right: 0;
      top: 35px;
      font-weight: normal; }
    .special-request-form .item.landscape:hover .item-price, .special-request-form .item.landscape:focus .item-price {
      display: none; }
    .special-request-form .item.landscape:hover .qty-buttons, .special-request-form .item.landscape:focus .qty-buttons {
      display: block; }
      .special-request-form .item.landscape:hover .qty-buttons .dec, .special-request-form .item.landscape:focus .qty-buttons .dec {
        display: none; }
    .special-request-form .item.landscape:hover.in-cart .qty-buttons .dec, .special-request-form .item.landscape:focus.in-cart .qty-buttons .dec {
      display: inline-block; }
    .special-request-form .item.landscape .item-quantity-small {
      -moz-border-radius-topleft: 20px !important;
      -moz-border-radius-topright: 20px !important;
      -moz-border-radius-bottomright: 20px !important;
      -moz-border-radius-bottomleft: 20px !important;
      -webkit-border-top-left-radius: 20px !important;
      -webkit-border-top-right-radius: 20px !important;
      -webkit-border-bottom-right-radius: 20px !important;
      -webkit-border-bottom-left-radius: 20px !important;
      border-top-left-radius: 20px !important;
      border-top-right-radius: 20px !important;
      border-bottom-right-radius: 20px !important;
      border-bottom-left-radius: 20px !important;
      padding: 4px 9px;
      min-width: 10px;
      position: absolute;
      display: none;
      left: 0;
      top: 0;
      background-color: #43B02A;
      color: #fff;
      font-size: 16px;
      text-align: center;
      font-weight: normal;
      text-rendering: optimizeLegibility; }
    .special-request-form .item.landscape .qty-buttons {
      display: none;
      position: absolute;
      right: 0;
      top: 35px; }
    .special-request-form .item.landscape.in-cart .media {
      float: left; }
      .special-request-form .item.landscape.in-cart .media .item-quantity-small {
        display: block; }
      .special-request-form .item.landscape.in-cart .media .info-group .qty-buttons .dec {
        display: inline-block; }
    .special-request-form .item.landscape.in-cart:hover .item-quantity, .special-request-form .item.landscape.in-cart:focus .item-quantity {
      display: block; }
    .special-request-form .item.landscape.in-cart:hover .on-sale-banner, .special-request-form .item.landscape.in-cart:focus .on-sale-banner {
      display: none; }
    .special-request-form .item.landscape.in-cart:hover .item-coupon, .special-request-form .item.landscape.in-cart:focus .item-coupon {
      display: none; }
  .special-request-form .special-request-details {
    width: 100%;
    display: inline-block; }
    .special-request-form .special-request-details .special-request-row {
      position: relative; }
      .special-request-form .special-request-details .special-request-row.special-request-row-extend {
        height: 116px;
        margin-bottom: 16px; }
        @media (max-width: 991px) {
          .special-request-form .special-request-details .special-request-row.special-request-row-extend {
            height: 248px; } }
    .special-request-form .special-request-details .special-request-text {
      padding-top: 7px;
      padding-left: 7px;
      display: inline-block;
      float: left;
      font-size: 16px; }
    .special-request-form .special-request-details input,
    .special-request-form .special-request-details textarea,
    .special-request-form .special-request-details select,
    .special-request-form .special-request-details .department-select {
      -webkit-box-shadow: none;
      box-shadow: none;
      width: 100%;
      font-size: 16px; }
    .special-request-form .special-request-details input {
      text-transform: capitalize; }
    .special-request-form .special-request-details select {
      padding-left: 7px; }
    .special-request-form .special-request-details select.department-select {
      height: 56px;
      margin-bottom: 0px; }
    .special-request-form .special-request-details .quantity-select {
      width: calc(50% - 8px);
      float: right;
      height: 56px;
      margin-bottom: 0px; }
    .special-request-form .special-request-details .special-request-text {
      width: calc(60% - 8px);
      height: 116px;
      border: 1px solid #bdbdbd; }
      @media (max-width: 991px) {
        .special-request-form .special-request-details .special-request-text {
          width: 100%;
          margin-bottom: 16px; } }
    .special-request-form .special-request-details .image-select-button {
      width: calc(40% - 8px);
      height: 116px;
      display: inline-block;
      float: right;
      border-radius: 4px;
      text-align: center;
      border: 1px dashed #bdbdbd; }
      @media (max-width: 991px) {
        .special-request-form .special-request-details .image-select-button {
          float: none;
          width: 100%;
          height: 116px; } }
      .special-request-form .special-request-details .image-select-button.image-missing img {
        width: 34.2px;
        height: 34.2px;
        margin-top: 25px; }
      .special-request-form .special-request-details .image-select-button .image-label {
        color: #43B02A;
        font-size: 18px;
        font-weight: 700; }
      .special-request-form .special-request-details .image-select-button.image-uploaded img {
        max-width: 100%;
        height: 114px; }
  .special-request-form .special-request-suggestion .special-request-suggestion-note {
    color: #757575;
    font-size: 16px;
    font-weight: 700; }

.after-order-interstitial {
  padding-bottom: 15px; }
  .after-order-interstitial .wfm-icon {
    background: url(bag-icon-c9a38589921cdf867bf83b3a8fef4ff0.png) no-repeat center center;
    background-size: contain;
    margin: auto; }
  .after-order-interstitial .ic-panel {
    margin-top: 15px;
    max-width: 800px; }
  .after-order-interstitial h1 {
    color: #424242;
    margin: 0 0 5px 0;
    font-weight: 800;
    font-size: 28px;
    text-align: center; }
  .after-order-interstitial .btn-order-details {
    letter-spacing: 0;
    padding: 8px; }
    .after-order-interstitial .btn-order-details span {
      font-weight: 600;
      padding-right: 5px;
      font-size: 16px;
      font-size: 14px; }
  .after-order-interstitial .heading-icon {
    margin-top: 24px;
    margin-bottom: 15px; }
  .after-order-interstitial .section-order-times {
    font-size: 20px;
    color: gray; }
    .after-order-interstitial .section-order-times i {
      vertical-align: middle;
      padding-right: 10px; }
  .after-order-interstitial .section-interstitial .invite-heading {
    margin: 10px;
    font-size: 20px;
    font-weight: 600;
    margin-top: 24px; }
  .after-order-interstitial .section-interstitial button {
    border: 0;
    padding: 10px;
    background-color: #43B02A;
    color: #FFF;
    font-weight: 600; }
    .after-order-interstitial .section-interstitial button:hover {
      background-color: #4c8b46; }
    .after-order-interstitial .section-interstitial button.state-loading {
      background-color: #F7A700; }
    .after-order-interstitial .section-interstitial button.state-success {
      -webkit-animation: Pulse .7s ease-out;
      -moz-animation: Pulse .7s ease-out;
      animation: Pulse .7s ease-out;
      -webkit-animation-fill-mode: both;
      -moz-animation-fill-mode: both;
      animation-fill-mode: both; }
    .after-order-interstitial .section-interstitial button.state-error {
      background-color: #E8104A; }
  .after-order-interstitial .section-interstitial .sub-heading {
    font-size: 14px;
    color: gray; }
  .after-order-interstitial .section-interstitial .form-group-custom {
    margin-top: 10px; }
    .after-order-interstitial .section-interstitial .form-group-custom input {
      border-top-right-radius: 0 !important;
      border-bottom-right-radius: 0 !important;
      width: 550px;
      border: 1px solid #E0E0E0;
      background-color: #F7F7F7;
      height: 50px;
      font-size: 16px; }
    .after-order-interstitial .section-interstitial .form-group-custom button {
      font-size: 16px;
      height: 50px; }
  .after-order-interstitial .section-interstitial .img-container div {
    float: left;
    font-size: 13px; }
    .after-order-interstitial .section-interstitial .img-container div img {
      max-height: 24px; }
  .after-order-interstitial .section-interstitial .img-container span {
    display: block;
    font-size: 16px;
    font-weight: 400;
    padding: 0px 0 0 6px; }
  .after-order-interstitial .rcp-email-list-preview ul {
    list-style-type: none;
    margin-left: 0; }
  .after-order-interstitial .section-product-strip {
    margin: 32px 0 32px 0; }
    .after-order-interstitial .section-product-strip img {
      width: 44px;
      height: 44px;
      margin-right: 16px;
      float: left; }
    .after-order-interstitial .section-product-strip .more-products {
      width: 32px;
      height: 32px;
      display: inline-block;
      text-align: center;
      background: #bdbdbd;
      font-weight: bold;
      color: #fff;
      border-radius: 22px;
      float: left;
      margin-top: 5px; }
      .after-order-interstitial .section-product-strip .more-products span {
        display: block;
        margin-top: 5px; }
    .after-order-interstitial .section-product-strip .strip-container {
      overflow: hidden;
      margin: auto;
      display: inline-block; }
  .after-order-interstitial .btn-order-details-container {
    margin: 15px; }
  .after-order-interstitial .icDropdownItems {
    min-width: 225px; }